| nr |
titel |
auteur |
tijdschrift |
jaar |
jaarg. |
afl. |
pagina('s) |
type |
| 1 |
Accuracy and precision of sensing fructose concentration in water using new fractal antenna biosensor
|
Mezache, Zinelabiddine
|
|
|
129 |
4 |
|
artikel
|
| 2 |
Analysis of friction and wear performance of Y2O3-doped Si3N4 ceramic using the estimation of stress
|
Wang, Qiang
|
|
|
129 |
4 |
|
artikel
|
| 3 |
An improved method for unidirectional mechanical wave propagation in a metamaterial beam
|
Kargozarfard, Mohammad Hassan
|
|
|
129 |
4 |
|
artikel
|
| 4 |
Antibacterial activity studies of ZnO nanostructures with different morphologies against E. coli and S. aureus
|
Goyal, Rahul
|
|
|
129 |
4 |
|
artikel
|
| 5 |
Antibacterial effect and photothermal sterilization of low dose two-dimensional vanadium carbide
|
Zhao, Weidan
|
|
|
129 |
4 |
|
artikel
|
| 6 |
A performance comparison between honey and water as electrolytic dielectrics for ZnO liquid-gated transistors
|
Vieira, Douglas H.
|
|
|
129 |
4 |
|
artikel
|
| 7 |
Application of locational CdCl2 treatment to CdS thin films grown on an ultra-thin MgZnO for CdTe solar cells
|
Çiriş, Ali
|
|
|
129 |
4 |
|
artikel
|
| 8 |
A study on the epitaxial large-size CsPbBr3 nanosheets grown by vapor phase epitaxy
|
Liu, Qingbo
|
|
|
129 |
4 |
|
artikel
|
| 9 |
Atomic layer deposition of hafnium oxide on porous silicon to form a template for athermal SERS-active substrates
|
Girel, K.
|
|
|
129 |
4 |
|
artikel
|
| 10 |
Atomic-scale study of the nano-cutting deformation mechanism of nickel-based single crystal superalloy containing Cr, Co, and γ/γ´
|
Zhu, Zongxiao
|
|
|
129 |
4 |
|
artikel
|
| 11 |
Atomistic modeling of pulsed laser ablation in liquid: spatially and time-resolved maps of transient nonequilibrium states and channels of nanoparticle formation
|
Chen, Chaobo
|
|
|
129 |
4 |
|
artikel
|
| 12 |
Atomistic simulation of mechanical behavior of Cu/Cu3Sn solder interface with Kirkendall void under shear and tensile deformation
|
Wu, Cheng-Da
|
|
|
129 |
4 |
|
artikel
|
| 13 |
Correction: Effect of indentation rate on deformation behavior and mechanical properties of FeO/Fe is simulated based on molecular dynamics
|
Fan, Mingyang
|
|
|
129 |
4 |
|
artikel
|
| 14 |
Critical current density of (Bi1.6Pb0.4)Sr2Ca2Cu3O10 superconductor irradiated with neutron in in-core facilities: rotary rack and dry tube at PUSPATI TRIGA Research Reactor
|
Mujaini, Madihah
|
|
|
129 |
4 |
|
artikel
|
| 15 |
Cu-poor chalcostibite CuSbS2 thin films for inverted photovoltaic applications
|
Chinnaiyah, Sripan
|
|
|
129 |
4 |
|
artikel
|
| 16 |
Design and passivation of short-/mid-wavelength dual-color infrared detector photodiodes based on InAs/GaSb type II superlattice
|
Wang, Jinchun
|
|
|
129 |
4 |
|
artikel
|
| 17 |
Design of 6 × 2 linear feed antenna array with suppressed SLL by employing CCSRR for Ka-band and 5G mm-wave applications
|
Sambathkumar, Praveena
|
|
|
129 |
4 |
|
artikel
|
| 18 |
3D extrusion printing of 304 stainless steel/polypropylene composites and sintering process optimization
|
Xu, Teng
|
|
|
129 |
4 |
|
artikel
|
| 19 |
Dielectric, ac-conductivity, magneto-impedance, magneto-dielectric and magneto-conductivity properties of novel magnetic core materials
|
Sankaranarayanan, R.
|
|
|
129 |
4 |
|
artikel
|
| 20 |
Direct writing of three-dimensional spiral structure by electrospinning with double tips
|
Liu, Yifang
|
|
|
129 |
4 |
|
artikel
|
| 21 |
Effect of (Bi, Li) co-doping on dielectric and ferroelectric properties in BaZr0.15Ti0.85O3 ceramics
|
Wang, X. W.
|
|
|
129 |
4 |
|
artikel
|
| 22 |
Effect of external electric field on the electronic and magnetic properties of doped silicon carbide nanotubes: DFT
|
Al-Khaza’leh, Khaled
|
|
|
129 |
4 |
|
artikel
|
| 23 |
Effect of ground state charge transfer and photoinduced charge separation on the energy level alignment at metal halide perovskite/organic charge transport layer interfaces
|
Frohloff, Lennart
|
|
|
129 |
4 |
|
artikel
|
| 24 |
Efficient electrochemical performance of the RGO/SrO nanorods prepared by the hydrothermal method
|
Godlaveeti, Sreenivasa Kumar
|
|
|
129 |
4 |
|
artikel
|
| 25 |
Enhanced critical current density and pinning properties in KNbO3 nanoparticles added YBCO superconductor
|
Kumar, Gaurav
|
|
|
129 |
4 |
|
artikel
|
| 26 |
Enhanced toluene sensing performance of nanostructured aluminium-doped nickel oxide gas sensor
|
Shailja,
|
|
|
129 |
4 |
|
artikel
|
| 27 |
Enhancement of the electrical properties of Au/MgSe/Au microwave resonators via pulsed laser welding of MgSe and Au nanosheets
|
Almotiri, R. A.
|
|
|
129 |
4 |
|
artikel
|
| 28 |
Evaluation of magnetocaloric behavior and refrigeration performance of Gd3Co10Al87 nanostructured thin film alloy with multiple Curie temperatures
|
Bayer, Özgür
|
|
|
129 |
4 |
|
artikel
|
| 29 |
Evidence of cluster glass phase, exchange bias, reversible magnetocaloric effect and study of electrical properties in Ni1−xCdxCr2O4 (x = 0–0.30) spinel
|
Borah, Ritupan
|
|
|
129 |
4 |
|
artikel
|
| 30 |
Experimental and DFT studies of copper nanoparticles as SERS substrates
|
Amador-Martínez, J. D.
|
|
|
129 |
4 |
|
artikel
|
| 31 |
Fabrication and electrical surface characterization of pellets of V2O5 nanostructures for robust and portable gas sensor applications
|
Rahman, Habeebur
|
|
|
129 |
4 |
|
artikel
|
| 32 |
Fabrication and tribological properties of the laser textured SiC cylinders with diamond coating
|
Hu, Enli
|
|
|
129 |
4 |
|
artikel
|
| 33 |
Giant cross-Kerr nonlinearity in the metal nanoparticles-graphene nanodisks-quantum dots hybrid system with low light intensity for photovoltaic devices
|
Tohari, Mariam M.
|
|
|
129 |
4 |
|
artikel
|
| 34 |
Growth kinetics and photothermal conversion of Cu2O–Ag nanocomposites
|
Zhao, Jinling
|
|
|
129 |
4 |
|
artikel
|
| 35 |
Highly sensitive pure molybdenum trioxide thin films at a higher annealing temperature for liquefied petroleum gas and humidity sensing at room temperature
|
Singh, Peramjeet
|
|
|
129 |
4 |
|
artikel
|
| 36 |
Improved piezoelectric and electric field-induced strain properties in Eu3+ modified 0.42PMN–0.26PIN–0.32PT ceramics
|
Gowthami, S.
|
|
|
129 |
4 |
|
artikel
|
| 37 |
Improving electrophoretic deposition of (Mg/Al)-doped Ni(OH)2 through the generation of layered double hydroxides
|
Zárate-Aguillón, Abner
|
|
|
129 |
4 |
|
artikel
|
| 38 |
Influence of composite mixtures between nematic liquid crystal and porous carbon nanoparticles towards photoluminescence and UV absorbance
|
Pathak, Govind
|
|
|
129 |
4 |
|
artikel
|
| 39 |
Influence of substrate type and magnetic anisotropy on the spin Seebeck effect in ZnFe2O4 thin films
|
Gil-Monsalve, J.
|
|
|
129 |
4 |
|
artikel
|
| 40 |
Infrared micro-emitters made by pulsed laser deposition lift-off-based processing
|
Gassenq, A.
|
|
|
129 |
4 |
|
artikel
|
| 41 |
Investigation of structural, optical, electrical, magnetic and antibacterial properties of (Mn and Sm) co-doped CdO nanostructures
|
Halabi, R.
|
|
|
129 |
4 |
|
artikel
|
| 42 |
Investigation on the superconductivity of Nb3Al by Zn doping and the effect of multi-RHQT process on the superconductivity of Nb3(Al1-xZnx)
|
Luo, Junsong
|
|
|
129 |
4 |
|
artikel
|
| 43 |
K-wave modelling of ultrasound wave propagation in aerogels and the effect of physical parameters on attenuation and loss
|
Ghimire, S.
|
|
|
129 |
4 |
|
artikel
|
| 44 |
Material characteristics of WO3/Bi2O3 substitution on the thermal, structural, and electrical properties of lithium calcium borate glasses
|
Ali, A. A.
|
|
|
129 |
4 |
|
artikel
|
| 45 |
Minkowski inspired circular fractal metamaterial microwave absorber for multiband applications
|
Goyal, Nikunj
|
|
|
129 |
4 |
|
artikel
|
| 46 |
Molecular dynamics study of the mechanical and tribological properties of graphene oxide-reinforced polyamide 66/nitrile butadiene rubber composites
|
Li, Xinhao
|
|
|
129 |
4 |
|
artikel
|
| 47 |
Nanoarchitectonics of wide-bandgap perovskite films using sputtered-PbI2 precursor and ion-exchange method
|
Hwang, Jae-Keun
|
|
|
129 |
4 |
|
artikel
|
| 48 |
Noticeable gas sensing properties of ZnO nano-crystallites using two-step preparation technique
|
Arulanantham, A. M. S.
|
|
|
129 |
4 |
|
artikel
|
| 49 |
On the importance of the SrTiO3 template and the electronic contact layer for the integration of phase-pure low hysteretic Pb(Mg0.33Nb0.67)O3-PbTiO3 layers with Si
|
Ni, Shu
|
|
|
129 |
4 |
|
artikel
|
| 50 |
On the investigation of frequency-dependent dielectric features in Schottky barrier diodes (SBDs) with polymer interfacial layer doped by graphene and ZnTiO3 nanostructures
|
Barkhordari, Ali
|
|
|
129 |
4 |
|
artikel
|
| 51 |
Parametric crystalline characterization of Anatase/Rutile polymorphic ceramic
|
Radhi, Ali
|
|
|
129 |
4 |
|
artikel
|
| 52 |
Phase stability, electronic and local structures of Li-doped (K,Na)NbO3 under hydrostatic pressure from first principles calculation
|
Metta, P.
|
|
|
129 |
4 |
|
artikel
|
| 53 |
Physical, mechanical, neutron-radiation shielding, and optical properties of ternary glasses at equimolar ratio of Na2O:P2O5 with distinct CuO contents
|
Al-Omari, S.
|
|
|
129 |
4 |
|
artikel
|
| 54 |
Precipitation behavior and mechanical properties of Al–1.0Mg–0.6Si–Cu (wt.%) alloy controlled by Cu content
|
Hou, Xingkai
|
|
|
129 |
4 |
|
artikel
|
| 55 |
Raman spectral studies on phonon softening, surface temperature, fano resonance, and phase change in MoS2 nanoflakes
|
Susmitha, B.
|
|
|
129 |
4 |
|
artikel
|
| 56 |
Rapid and complex dynamics of through glass via formation using a picosecond quasi-continuous wave laser as revealed by time-resolved absorptance measurements and multiphase modeling
|
Schrauben, Joel N.
|
|
|
129 |
4 |
|
artikel
|
| 57 |
Review: 2D material property characterizations by machine-learning-assisted microscopies
|
Si, Zhizhong
|
|
|
129 |
4 |
|
artikel
|
| 58 |
Role of Mn2+ ion in the optimization of the structural and dielectric properties of Co–Zn ferrite
|
Rady, K. E.
|
|
|
129 |
4 |
|
artikel
|
| 59 |
Room temperature magneto-dielectric coupling in the CaMnO3 modified NBT lead-free ceramics
|
Samantaray, Koyal Suman
|
|
|
129 |
4 |
|
artikel
|
| 60 |
Structural, electrical and mechanical properties of the (NdFeO3)x/(CuTl)-1223 superconductor phase
|
El Makdah, Marwa H.
|
|
|
129 |
4 |
|
artikel
|
| 61 |
Structural, morphological, mechanical and electrochemical properties of 532 nm Nd:YAG laser-irradiated vanadium at high fluence
|
Iftikhar, Rehman
|
|
|
129 |
4 |
|
artikel
|
| 62 |
Study on co-precursor driven solid state thermal conversion of iron(III)citrate to iron oxide nanomaterials
|
Kundu, S.
|
|
|
129 |
4 |
|
artikel
|
| 63 |
Study on structure and magnetic properties of Ni–Co co-substituted ZnFe2O4 prepared by sol–gel method
|
Huang, Xiaoyan
|
|
|
129 |
4 |
|
artikel
|
| 64 |
Superhydrophobic poly-4-methyl-1-pentene/polyvinylidene fluoride coating with excellent passive daytime radiation cooling performance
|
Xu, Feifan
|
|
|
129 |
4 |
|
artikel
|
| 65 |
Synergistic effect of Ga(NO3)3 & TiCl4 post-treatment on photovoltaic performance of dye-sensitized solar cells
|
Bilen, K.
|
|
|
129 |
4 |
|
artikel
|
| 66 |
Tandem organic solar cells with a large VOC by control of the active-layer concentration
|
Zheng, Qiao
|
|
|
129 |
4 |
|
artikel
|
| 67 |
The contribution of nonlinear behavior for large piezoelectric response in BNT-BT-based ceramics
|
Xiao, Zijing
|
|
|
129 |
4 |
|
artikel
|
| 68 |
The effect of Fe-doping on structural, elemental, magnetic, and weak anti-localization properties of Bi2Se3 topological insulator
|
Kander, Niladri Sekhar
|
|
|
129 |
4 |
|
artikel
|
| 69 |
The interfacial properties of edge-contact heterojunction of SnSSe/metal from first principles
|
Wang, Yu
|
|
|
129 |
4 |
|
artikel
|
| 70 |
Towards safe and effective femtosecond laser cleaning for the preservation of historic monuments
|
Brand, Julia
|
|
|
129 |
4 |
|
artikel
|
| 71 |
Ultra-wideband linear-polarization conversion metasurface with high-efficient asymmetric transmission
|
Huang, Xiaojun
|
|
|
129 |
4 |
|
artikel
|
| 72 |
Unconventional computing based on magnetic tunnel junction
|
Cai, Baofang
|
|
|
129 |
4 |
|
artikel
|
| 73 |
Vacancy at stacking fault-assisted nucleation of transition-metal carbides and nitrides in Fcc-Fe
|
Liu, Si
|
|
|
129 |
4 |
|
artikel
|
| 74 |
Wide temperature range magnetoresistance enhancement of La0.67Ca0.33MnO3: NiO nanocomposites
|
Lau, L. N.
|
|
|
129 |
4 |
|
artikel
|
| 75 |
ZrSe2-HfSe2 lateral heterostructures: stability, fundamental properties, and interline defects
|
Van On, Vo
|
|
|
129 |
4 |
|
artikel
|
Tijdschrift beschrijving