| nr |
titel |
auteur |
tijdschrift |
jaar |
jaarg. |
afl. |
pagina('s) |
type |
| 1 |
Ablation behavior and high temperature ceramization mechanism of TiB2-B4C-ZrC modified carbon fiber/boron phenolic resin composites
|
Weng, Shaoxiong
|
|
|
50 |
22PB |
p. 46173-46186
|
artikel
|
| 2 |
A closer look at the fabrication of some doped metal ions in borophosphate glass system and their structural, elastic, optical, and gamma-ray shielding characteristics
|
Abd-Allah, W.M.
|
|
|
50 |
22PB |
p. 46429-46439
|
artikel
|
| 3 |
A new potential Ti6AlV alloy smelting material with reliable chemical stability and thermal shock resistance: Lightweight Ba0.8Ca0.2ZrO3 ceramic
|
Han, Suzhen
|
|
|
50 |
22PB |
p. 46774-46783
|
artikel
|
| 4 |
Artificial shock wave impact studies on Olivine single crystal - A Raman spectroscopic approach
|
Aswathappa, Sivakumar
|
|
|
50 |
22PB |
p. 46252-46258
|
artikel
|
| 5 |
Atomic insight on the electronic structure and interfacial bonding characterization of the Cu/TiC interface
|
Ding, Haimin
|
|
|
50 |
22PB |
p. 46791-46801
|
artikel
|
| 6 |
BN fiber aerogels with high solar reflectivity and thermal insulation for green buildings
|
Liu, Ziyu
|
|
|
50 |
22PB |
p. 46589-46599
|
artikel
|
| 7 |
Broad spectral response of Y-NaBi(MoO4)2@NaYF4:Yb, Tm photocatalysts for efficient degradation of ciprofloxacin: Upconversion mechanism and theoretical calculations
|
Yang, Weijin
|
|
|
50 |
22PB |
p. 46904-46915
|
artikel
|
| 8 |
Characterization of structural and spectroscopic properties of ZnO/Fe₂O₃ nanocomposites
|
Patwa, Rahul
|
|
|
50 |
22PB |
p. 47268-47277
|
artikel
|
| 9 |
Charge storage mechanism and pseudocapacitance performance of NiO and Ce-doped NiO synthesized via modified combustion technique
|
Alex, Javeesh
|
|
|
50 |
22PB |
p. 47317-47332
|
artikel
|
| 10 |
Combustion synthesis of the (Ti,Zr)B2-(Zr,Ti)C eutectic composites: Structure formation and properties
|
Potanin, A.Yu.
|
|
|
50 |
22PB |
p. 47433-47444
|
artikel
|
| 11 |
Component design for stabilizing P phase in NaNbO3-based ceramics and the energy storage performance
|
Ye, Fen
|
|
|
50 |
22PB |
p. 46327-46333
|
artikel
|
| 12 |
Compositing thermal conductivity behavior to enhance thermoelectric properties of honeycomb-like porous Ca3Co4O9 ceramics
|
Xing, Fei
|
|
|
50 |
22PB |
p. 46273-46278
|
artikel
|
| 13 |
Compositional diversity of vitrified silicate ceramics: Delimiting the chemical perimeter of industrial bodies
|
Conte, Sonia
|
|
|
50 |
22PB |
p. 46157-46165
|
artikel
|
| 14 |
Coral-inspired fabrication of Ag-Cu2O-zwitterionic polymers-phosphor films with day and night antifouling properties
|
Tang, Junxiao
|
|
|
50 |
22PB |
p. 46471-46483
|
artikel
|
| 15 |
Corrigendum to ‘Tribological behaviour of bilayer alumina and mullite plasma-sprayed coatings deposited on a refractory substrate at high temperatures’ [Ceram. Int. 49 (2023) 1250–1260]
|
Franco, D.
|
|
|
50 |
22PB |
p. 47527
|
artikel
|
| 16 |
Co-sintering of a ceramic-metal bilayer: Coupled experimental, analytical and numerical approaches
|
Antou, Guy
|
|
|
50 |
22PB |
p. 46196-46210
|
artikel
|
| 17 |
Crystal structure, chemical bonds and microwave dielectric properties of ultra-low loss Li2Mg2GaTi2O8F ceramics
|
Hou, Zegui
|
|
|
50 |
22PB |
p. 46542-46547
|
artikel
|
| 18 |
Crystal structure evolution and solid solution mechanism of Al2O3-Cr2O3 system under different reaction conditions
|
Wang, Ye
|
|
|
50 |
22PB |
p. 46460-46470
|
artikel
|
| 19 |
Defect design and vacancy engineering of NiCo2Se4 spinel composite for excellent electromagnetic wave absorption
|
Liu, Yue
|
|
|
50 |
22PB |
p. 46643-46652
|
artikel
|
| 20 |
Defect tuning and its effect on conductivity, dielectric properties of combustion derived nano CeO2: A fuel dependent approach
|
Reddy, M.V. Hemantha
|
|
|
50 |
22PB |
p. 47333-47344
|
artikel
|
| 21 |
Densification and network structural changes in binary aluminosilicate glass via cold sintering process
|
Seo, Yeongjun
|
|
|
50 |
22PB |
p. 47030-47041
|
artikel
|
| 22 |
Densification, phase composition, microstructure and properties of spark plasma sintered La0.6Ce0.3Pr0.1B6 bulks
|
Wang, Yan
|
|
|
50 |
22PB |
p. 47299-47307
|
artikel
|
| 23 |
Design and electromagnetic shielding of Bi0.5Na0.5TiO3 ceramics as meta-surface absorber for high-frequency microwave application
|
Das, Dibyaranjan
|
|
|
50 |
22PB |
p. 46621-46631
|
artikel
|
| 24 |
Design a well-dispersed Ag-based/CoFe2O4–CNT catalyst for hydrogen production via NaBH4 hydrolysis
|
Abdel-Salam, M.O.
|
|
|
50 |
22PB |
p. 46419-46428
|
artikel
|
| 25 |
Dielectric properties of sodium potassium tantalate (Na0.5 K0.5 TaO3)
|
Uniyal, Manish
|
|
|
50 |
22PB |
p. 47428-47432
|
artikel
|
| 26 |
Dislocation extension in coarse–grained Al reinforced by SiC nanowires under complex stress condition
|
Wu, Yiming
|
|
|
50 |
22PB |
p. 46259-46272
|
artikel
|
| 27 |
Eco-friendly activation of cotton textiles with LiNbO3 nanoparticles for enhanced self-cleaning and antibacterial performance
|
Alves, Annelise Kopp
|
|
|
50 |
22PB |
p. 46187-46195
|
artikel
|
| 28 |
Effect of BaO/CaO on structure and properties of BaO-CaO-SiO2-TiO2-CaF2-Li2O-Na2O slag system
|
Li, Fangfang
|
|
|
50 |
22PB |
p. 46916-46924
|
artikel
|
| 29 |
Effect of Ga/Al ratio on the luminescent properties of inorganic scintillating GGAG:(4 mol%)Ce ceramic powder
|
Oad, Nisha
|
|
|
50 |
22PB |
p. 47507-47512
|
artikel
|
| 30 |
Effect of in-situ nano-alumina on the properties of alumina ceramics from secondary aluminum dross
|
Feng, Haigang
|
|
|
50 |
22PB |
p. 46227-46238
|
artikel
|
| 31 |
Effect of interface structure on microwave absorbing performance and oxidation behavior of SiCf/mullite composites
|
Pan, Haijun
|
|
|
50 |
22PB |
p. 46530-46541
|
artikel
|
| 32 |
Effect of nano-multilayered ZrN/TiAlN hard coating as the interlayer on the microstructure, mechanical properties, and wear resistance
|
Li, Xiangrong
|
|
|
50 |
22PB |
p. 46831-46843
|
artikel
|
| 33 |
Effect of sintering temperature on magnetic, catalytic and photocatalytic properties of Cu-Co-Mn ferrite catalyst
|
Manhas, Ujwal
|
|
|
50 |
22PB |
p. 46760-46773
|
artikel
|
| 34 |
Effect of YSZ composite ceramics with different LaF3 doping content on microstructure evolution and infrared emissivity
|
Xiang, Yang
|
|
|
50 |
22PB |
p. 46973-46981
|
artikel
|
| 35 |
Effects of alkali/alkaline-earth ions on the preparation, crystallization behavior and photocatalytic activity of R2O/MO-ZnO-Al2O3-TiO2-P2O5 (R=Li, Na, K; M=Mg, Ca, Sr) glass and glass-ceramics
|
Liu, Xinzhu
|
|
|
50 |
22PB |
p. 47118-47127
|
artikel
|
| 36 |
Effects of Cu ion implantation on the microstructure, dielectric and impedance properties of SrTiO3 ceramics prepared by reduction-reoxidation method
|
Bai, Wei
|
|
|
50 |
22PB |
p. 46279-46287
|
artikel
|
| 37 |
Effects of MOF-MoO3-x derivatives synthesis and oxygen defect engineering on photocatalytic CO2 reduction
|
Hong, Dongfeng
|
|
|
50 |
22PB |
p. 47042-47050
|
artikel
|
| 38 |
Electrospinning of Sm0.5Sr0.5CoO3-δ nanofiber cathode for solid oxide fuel cells
|
Wang, Wenjuan
|
|
|
50 |
22PB |
p. 47519-47526
|
artikel
|
| 39 |
Enabling stable operation of Ba0.5Sr0.5Co0.8Fe0.2O3‒δ based multiphase nanocomposite cathode for efficient intermedium temperature solid oxide fuel cells
|
Chen, Kongfa
|
|
|
50 |
22PB |
p. 46822-46830
|
artikel
|
| 40 |
Enhanced energy storage performance of Bi(Mg0.5Hf0.5)O3 modified K0.5Na0.5NbO3 relaxor ferroelectric ceramics via synergistic strategy
|
Tian, Jingjing
|
|
|
50 |
22PB |
p. 46750-46759
|
artikel
|
| 41 |
Enhanced properties of hard metal WC-Ni processed from nanostructured powders
|
Lima, Maria J.S.
|
|
|
50 |
22PB |
p. 47445-47455
|
artikel
|
| 42 |
Enhancement of sintering and mechanical properties of alumina-rich Al2O3-MgO-CaO refractory composite by doping La2O3
|
Yin, Xue-liang
|
|
|
50 |
22PB |
p. 47494-47500
|
artikel
|
| 43 |
Enhancement of thermoelectric performance by Ag/Bi/Fe co-doping into Cu3SbSe4 ceramics for green thermoelectric applications
|
Wang, Honglei
|
|
|
50 |
22PB |
p. 46239-46245
|
artikel
|
| 44 |
Enhancing security authentication and mapping of fingermarks using dual-mode emission of phosphor-immobilized glass nanofiber-reinforced carboxymethyl cellulose nanocomposite
|
Al-Qahtani, Salhah D.
|
|
|
50 |
22PB |
p. 46653-46662
|
artikel
|
| 45 |
Enhancing the mechanical performance of 3D-printed self-hardening calcium phosphate bone scaffolds: PLGA-based strategies
|
Johansson, Linh
|
|
|
50 |
22PB |
p. 46300-46317
|
artikel
|
| 46 |
Excitation energy transfer in gadolinium tantalum niobates activated with Eu3+ and Tb3+
|
Gusev, G.A.
|
|
|
50 |
22PB |
p. 47259-47267
|
artikel
|
| 47 |
Explorations of physicochemical, photodegradation, phototoxicity, and kinetics of Bi2-2xCoxCdxO3/rGO nanocomposites for wastewater treatment applications
|
Fahim, Farah
|
|
|
50 |
22PB |
p. 46993-47007
|
artikel
|
| 48 |
Fabrication and characterization of high-temperature AlN thick-film piezoelectric accelerometer
|
Lv, Ting
|
|
|
50 |
22PB |
p. 47008-47016
|
artikel
|
| 49 |
Fabrication and thermoelectric properties of multilayer textured Sr-doped Ca3Co4O9/Ag laminar composites
|
Amirkhizi, P.
|
|
|
50 |
22PB |
p. 46784-46790
|
artikel
|
| 50 |
Facile process for cost-effective layer-by-layer rGO/SiO2 structure for high microwave absorption
|
Nguyen, Van Quang
|
|
|
50 |
22PB |
p. 47136-47144
|
artikel
|
| 51 |
Femtosecond laser controllable annealing for color centers based on ion-implanted silicon carbide substrate
|
Wang, Jianshi
|
|
|
50 |
22PB |
p. 46566-46578
|
artikel
|
| 52 |
Flexible sheets of lead free KNN-PVDF composite: A sustainable pyroelectric energy harvester
|
Sharma, Babita
|
|
|
50 |
22PB |
p. 46982-46992
|
artikel
|
| 53 |
Formation of YOF on Y2O3 through surface modification with NH4F and its plasma-resistance behavior
|
Jang, Hwan-Yoon
|
|
|
50 |
22PB |
p. 47513-47518
|
artikel
|
| 54 |
Graphene oxide/silicon dioxide (GO/SiO2) hybrid coating on zirconia ceramic for sustainable water desalination
|
Darmawan, Adi
|
|
|
50 |
22PB |
p. 47232-47243
|
artikel
|
| 55 |
Green engineered Mo-CeO2@C nanocomposites for visible light-assisted dye decomposition and microbial apoptosis
|
Zhan, Qingying
|
|
|
50 |
22PB |
p. 47359-47372
|
artikel
|
| 56 |
Green mullite whiskers prepared from zeolite waste at low-temperature
|
Chen, Peiquan
|
|
|
50 |
22PB |
p. 47051-47066
|
artikel
|
| 57 |
High efficiency femtosecond laser ablation of alumina ceramics under the filament induced plasma shock wave
|
Li, Zhou
|
|
|
50 |
22PB |
p. 47472-47484
|
artikel
|
| 58 |
High transparency Ce3+-doped oxyfluoride glass scintillator for X-ray imaging and γ-ray detection
|
Yang, Dong
|
|
|
50 |
22PB |
p. 47253-47258
|
artikel
|
| 59 |
Improved electrochemical performance of Fe3O4/TiO2 composite thin film electrode for energy storage applications
|
Krishnakanth, E.
|
|
|
50 |
22PB |
p. 46548-46556
|
artikel
|
| 60 |
Improved oxidation and ablation resistance of SiCf/SiC-HfB2 composites: Role of oxygen-blocking scale and protection mechanism
|
Guo, Ruru
|
|
|
50 |
22PB |
p. 46377-46390
|
artikel
|
| 61 |
Improved SOFC performance by enhancing cathode/electrolyte bonding and grain refinement of cathode with thermal expansion offset
|
Lu, Fei
|
|
|
50 |
22PB |
p. 46318-46326
|
artikel
|
| 62 |
Influence of bonding systems on the properties of Al2O3-MgO refractory castables: Aluminate cement and alumina silica gel
|
Hou, Xiangshuai
|
|
|
50 |
22PB |
p. 46695-46704
|
artikel
|
| 63 |
Influence of stabilized zirconium dioxide and high hydrostatic pressure on the kinetics of sintering nanopowders of metastable aluminum oxide
|
Maletskii, A.V.
|
|
|
50 |
22PB |
p. 46506-46515
|
artikel
|
| 64 |
Investigation on the microstructure and high-temperature properties of AlN coating through oxygen addition
|
Du, Jian W.
|
|
|
50 |
22PB |
p. 47373-47383
|
artikel
|
| 65 |
Liquid metal bridging boron nitride/bacterial cellulose composite films with excellent thermal and mechanical performance
|
Sun, Na
|
|
|
50 |
22PB |
p. 47128-47135
|
artikel
|
| 66 |
Mechanical behavior and biological activity performance of Li+/Ca2+@Li+/K+ ion-exchanged lithium disilicate glass-ceramics
|
Li, X.C.
|
|
|
50 |
22PB |
p. 47157-47171
|
artikel
|
| 67 |
Microstructure and fracture behaviour of biomimetic Al2O3-ZrO2 composite with 2-levels of structural hierarchy
|
Sikder, Soumavo
|
|
|
50 |
22PB |
p. 46844-46857
|
artikel
|
| 68 |
Microstructure and high-temperature oxidation resistance of Ti-6Al-4V alloy with in-situ SiC-SiO2 nano-composite coating by LPDS technique
|
Wang, Jiacheng
|
|
|
50 |
22PB |
p. 46288-46299
|
artikel
|
| 69 |
Microwave absorption performance of La1.5Sr0.5NiO4/SrFe12O19 composites with thin matching thickness
|
Tho, P.T.
|
|
|
50 |
22PB |
p. 46683-46694
|
artikel
|
| 70 |
Microwave-assisted sol-gel synthesis of MFe2O4@SiO2 (M = Cu, Ni, Co) ceramic nanostructures using rice husk as a sustainable precursor for electrochemical energy storage
|
Priyan, S. Ranjith
|
|
|
50 |
22PB |
p. 47456-47471
|
artikel
|
| 71 |
Mid-infrared fine-grained Er:Y2O3 laser ceramics fabricated by spark plasma sintering
|
Furuse, Hiroaki
|
|
|
50 |
22PB |
p. 46925-46931
|
artikel
|
| 72 |
Multifaceted biomedical applications of bismuth oxide-doped bioactive glass: Synthesis challenges, characterization and potential clinical implications
|
Saha, Rupam
|
|
|
50 |
22PB |
p. 46858-46868
|
artikel
|
| 73 |
Multifunctional Si3N4-skeleton-reinforced graphite flake composites with preferred orientation integrate excellent mechanical, thermophysical, and electromagnetic shielding properties
|
Zhang, Xiaoyu
|
|
|
50 |
22PB |
p. 47223-47231
|
artikel
|
| 74 |
Nanosheet-assembled porous-wall hollow hydroxyapatite microspheres prepared by a template-free hydrothermal method for pH-responsive drug release
|
Xu, Wei-li
|
|
|
50 |
22PB |
p. 47501-47506
|
artikel
|
| 75 |
NiFe2O4-based cermet inert anode in CaCl2-based molten salts
|
Jia, Yadong
|
|
|
50 |
22PB |
p. 47098-47107
|
artikel
|
| 76 |
Novel α/β SiC-(Ti, Nb)B2 toughened (Ti, Nb)C-based composites with enhanced mechanical properties fabricated by in situ reactions sintering at low temperature
|
Wang, Liwei
|
|
|
50 |
22PB |
p. 46211-46226
|
artikel
|
| 77 |
Novel synthesis of (Hf0.25Zr0.25Ti0.25Ta0.25)C-SiC biphasic ceramic micro-powders using single-source-precursor route
|
Du, Bin
|
|
|
50 |
22PB |
p. 46166-46172
|
artikel
|
| 78 |
One-step in situ doping of Sb achieves enhanced performance of [001]-oriented nano-LiFe0.6Mn0.4PO4/C cathode high-rate materials
|
Kong, Dongdong
|
|
|
50 |
22PB |
p. 47308-47316
|
artikel
|
| 79 |
Optimized electromagnetic wave absorption of Ag/Fe3O4/SiO2 via magnetic field-induced synthesis
|
Xu, Ye
|
|
|
50 |
22PB |
p. 46579-46588
|
artikel
|
| 80 |
Oxidation behavior and structural damage mechanism of LaMgAl11O19 dual-ceramic thermal barrier coating with varying thickness of Al plating layer
|
Tao, Haotian
|
|
|
50 |
22PB |
p. 47108-47117
|
artikel
|
| 81 |
Oxidized textured stainless steel surface with passivation layer as a high temperature selective solar absorber
|
Pelenovich, Vasiliy O.
|
|
|
50 |
22PB |
p. 47215-47222
|
artikel
|
| 82 |
Oxygen plasma treatment to enhance the gas-sensing performance of ZnO to N-methyl pyrrolidone: Experimental and computational study
|
Gui, Yanghai
|
|
|
50 |
22PB |
p. 47418-47427
|
artikel
|
| 83 |
Oxygen vacancies, hydroxyl groups and fluorine ions in the local environment of Yb3+ ions doped in CeO2 nanoparticles
|
Rakhmatullin, R.M.
|
|
|
50 |
22PB |
p. 46516-46521
|
artikel
|
| 84 |
Phase evolution at interface between magnesia refractories and low-density steel/slag by Mg/Ca mass transfer
|
Wang, Jinlong
|
|
|
50 |
22PB |
p. 47288-47298
|
artikel
|
| 85 |
Photocatalytic and magnetic properties of nanocrystalline Er/Eu-doped ZnO samples
|
Wang, Ting
|
|
|
50 |
22PB |
p. 47485-47493
|
artikel
|
| 86 |
Photocatalytic degradation of rhodamine B using Yb3+-Doped Zn-Mg ferrites synthesized via conventional sol-gel auto-combustion method
|
Dhasharatha, U.
|
|
|
50 |
22PB |
p. 46940-46961
|
artikel
|
| 87 |
Potential improvement in thermoelectric properties of SnTe polycrystals via anionic and cationic substitution
|
Shankar, Manasa R.
|
|
|
50 |
22PB |
p. 46869-46881
|
artikel
|
| 88 |
Preparation and arc erosion mechanism of Ni skeleton reinforced Ag-based contact materials with CuO-coated SnO2
|
Wang, Jun
|
|
|
50 |
22PB |
p. 47202-47214
|
artikel
|
| 89 |
Preparation and phase structure optimization of plasma-sprayed Yb2SiO5 environmental barrier coating
|
Xue, Zhaolu
|
|
|
50 |
22PB |
p. 47089-47097
|
artikel
|
| 90 |
Preparation of magnesium oxysulfate cement with significantly improved setting rate and compressive strength using highly active magnesium oxide powders
|
Sun, Yining
|
|
|
50 |
22PB |
p. 46440-46451
|
artikel
|
| 91 |
Preparation of spherical NiO-8YSZ composite powder through spray drying
|
Liu, Yang
|
|
|
50 |
22PB |
p. 46347-46355
|
artikel
|
| 92 |
Preparation, upconversion/downshifting emissions, temperature sensing, and thermochromic properties of one-dimensional Y2Zr2O7:Er3+/Yb3+ tube-in-tube nanostructures via single-nozzle electrospinning
|
Cong, Shanshan
|
|
|
50 |
22PB |
p. 46391-46400
|
artikel
|
| 93 |
Probing the thermophysical property mechanism of Mg2+-doped high-entropy oxide ceramics
|
Meng, Ziqian
|
|
|
50 |
22PB |
p. 46364-46376
|
artikel
|
| 94 |
Realizing high energy storage performances and ultrafast charge-discharge rate of NaNbO3-based ceramics for application in pulse power capacitors
|
Guo, Yunfeng
|
|
|
50 |
22PB |
p. 46729-46737
|
artikel
|
| 95 |
Research on sintering performance and corrosion mechanism of whisker enhanced MgAl2O4 saggar
|
Zhang, Hao
|
|
|
50 |
22PB |
p. 47017-47023
|
artikel
|
| 96 |
Response of variation of electrical control parameters to coatings prepared in organo-silicon electrolyte by plasma electrolytic oxidation
|
Chen, Qiong
|
|
|
50 |
22PB |
p. 47402-47417
|
artikel
|
| 97 |
RGO@β-CaSiO3:Sm3+ nanocomposites for super capacitors, biosensor and w-LEDs applications
|
Nadar, Nandini Robin
|
|
|
50 |
22PB |
p. 47067-47088
|
artikel
|
| 98 |
Role of CsBr in structure and properties of new cesium bromo-borate glasses
|
Aqeel, N.
|
|
|
50 |
22PB |
p. 46413-46418
|
artikel
|
| 99 |
Sapphire optical fiber with (BN/SiBCN)n coating prepared by chemical vapor deposition for high-temperature sensing applications
|
Lv, Shandi
|
|
|
50 |
22PB |
p. 46557-46565
|
artikel
|
| 100 |
Self-cleaning transparent Cu2Y2O5/Tb:Bi2Sn2O7 quantum dots/Bi2O3 pn junction for photovoltaic enhancement via synergism of up-conversion fluorescence and surface hydrophobicity
|
Wang, Rui
|
|
|
50 |
22PB |
p. 46496-46505
|
artikel
|
| 101 |
SHS of copper Chevrel phase compounds
|
Gilmore, Tessa
|
|
|
50 |
22PB |
p. 47244-47252
|
artikel
|
| 102 |
Smart composite based on fly ash cenospheres and transformer oil with switchable electrical conductivity
|
Komarov, Andrey G.
|
|
|
50 |
22PB |
p. 47278-47287
|
artikel
|
| 103 |
Sol-gel synthesis of Tb-doped lithium-nickel ferrite anchored onto g-C3N4 sheets for efficient photocatalytic degradation of organic dyes
|
AlMasoud, Najla
|
|
|
50 |
22PB |
p. 46892-46903
|
artikel
|
| 104 |
Step-by-step strategy to improve the performance of the (La,Sr)(Ga,Mg)O3-δ electrolyte for symmetrical solid oxide fuel cells
|
Gordeev, E.V.
|
|
|
50 |
22PB |
p. 47395-47401
|
artikel
|
| 105 |
Straightforward fabrication of luminescent-magnetic GdF3:Yb3 +, Ho3 +@void@SiO2 wire-in-tube structured nanofibers
|
Li, Shuo
|
|
|
50 |
22PB |
p. 47192-47201
|
artikel
|
| 106 |
Strontium titanate and its flexible polymer composite film: Enhanced biological, mechanical, and photocatalytic performance
|
Nayak, Tusharkanta
|
|
|
50 |
22PB |
p. 47345-47358
|
artikel
|
| 107 |
Structural, electrical, and dynamic scaling behavior of Ba0.85Ca0.15Zr0.10Ti0.90O3 nanoceramics synthesized at low temperature by sonochemical method
|
Thakur, Neha
|
|
|
50 |
22PB |
p. 46718-46728
|
artikel
|
| 108 |
Structural, thermal, and radiation shielding properties of B2O3-TeO2-Bi2O3-CdO-Tm2O3 glasses: The role of Tm2O3
|
Dogru, Kaan
|
|
|
50 |
22PB |
p. 47384-47394
|
artikel
|
| 109 |
Structure and properties of Er3+- modified (Bi0.5Na0.5)0.945Ba0.055TiO3-based lead-free ferroelectric ceramics
|
Kong, Kaidi
|
|
|
50 |
22PB |
p. 47024-47029
|
artikel
|
| 110 |
Structure, electronic transitions, and ligand field parameters of CoO-Na2O-borate glass via different La2O3 concentrations
|
Alqarni, Areej S.
|
|
|
50 |
22PB |
p. 47145-47156
|
artikel
|
| 111 |
Synergistic effect of physics and chemistry on material removal of fused quartz in nanoparticle jet polishing
|
Li, Jiahui
|
|
|
50 |
22PB |
p. 46600-46610
|
artikel
|
| 112 |
Synergizing empirical and AI methods to examine nano-silica's microscale contribution to epoxy coating corrosion resistance
|
Hussain, Zahoor
|
|
|
50 |
22PB |
p. 47172-47191
|
artikel
|
| 113 |
Synthesis of CS/Fe3O4/TiO2@MXene nanocomposite photocatalyst with excellent degradation and bacteriostatic properties by one-step hydrothermal method
|
Ding, Huiling
|
|
|
50 |
22PB |
p. 46334-46346
|
artikel
|
| 114 |
The ancient glass decoloration technology based on the Fe-Mn redox pairs revived to improve the chemical stability of Fe2O3-containing borosilicate glass for medical application
|
Fu, Jie
|
|
|
50 |
22PB |
p. 46673-46682
|
artikel
|
| 115 |
The effect of conduction loss on microwave absorption performance of Fe-doped NiCo2O4 spinel oxide
|
Xu, Jie
|
|
|
50 |
22PB |
p. 46882-46891
|
artikel
|
| 116 |
The impact of cobalt oxide additions and heat treatment on wollastonite for magnetic applications
|
Sherif, H.H.A.
|
|
|
50 |
22PB |
p. 46962-46972
|
artikel
|
| 117 |
The impact of LSM pretreatment on the growth behavior, electrical insulation and corrosion resistance properties of PEO coating on 6061 aluminum alloy
|
Ma, Dahang
|
|
|
50 |
22PB |
p. 46401-46412
|
artikel
|
| 118 |
The influence of the dopant concentration and sintering parameters on properties of antimony doped barium stannate ceramics
|
Mitrović, Jelena S.
|
|
|
50 |
22PB |
p. 46632-46642
|
artikel
|
| 119 |
The new rheological model for zirconia suspensions with long-term kinetic stability
|
Sokola, Patrik
|
|
|
50 |
22PB |
p. 46611-46620
|
artikel
|
| 120 |
Thermal properties and anti-corrosion behavior of multicomponent (Dy1/5Er1/5Tm1/5Yb1/5Y1/5)2SiO5 monosilicate against water vapor attack at high temperature
|
Abrar, Sehreish
|
|
|
50 |
22PB |
p. 46738-46749
|
artikel
|
| 121 |
Thermodynamic investigation of reduced barium molybdates
|
Lara-Contreras, Andrés
|
|
|
50 |
22PB |
p. 46452-46459
|
artikel
|
| 122 |
The synergistic effect of cold sintering and reaction sintering on BST tape casting sheets
|
Wang, Hongwei
|
|
|
50 |
22PB |
p. 46522-46529
|
artikel
|
| 123 |
Towards high-density and thick-walled NiFe2O4-based cermet by ceramic injection molding using spherical composite powder
|
Fu, Yang
|
|
|
50 |
22PB |
p. 46705-46717
|
artikel
|
| 124 |
Transverse size effect of relaxor ferroelectric Pb(In1/2Nb1/2)O3-Pb(Mg1/3Nb2/3)O3-PbTiO3 film for one- and two-dimensional integrated sensors by simulation
|
Liang, Cao
|
|
|
50 |
22PB |
p. 46246-46251
|
artikel
|
| 125 |
Tuning chemical composition and structural properties of bismuth ferrite based thin films by reactive bipolar HiPIMS
|
Tiron, Vasile
|
|
|
50 |
22PB |
p. 46663-46672
|
artikel
|
| 126 |
Ultra-precision grinding of polycrystalline magnesia alumina spinel (MgAl2O4) ceramics based on AE signals monitoring: Surface characteristics and damage mechanisms
|
Wang, Sheng
|
|
|
50 |
22PB |
p. 46802-46821
|
artikel
|
| 127 |
Ultra-sensitive CuAl2O4 Nanoflakes for ppb level detection of Isopropanol
|
Kulkarni, Saraswati
|
|
|
50 |
22PB |
p. 46356-46363
|
artikel
|
| 128 |
Using steel slag and fly ash solid wastes to fabricate ceramics-based phase change composites with excellent mechanical and thermal properties applied in thermal energy storage
|
Wu, Bingji
|
|
|
50 |
22PB |
p. 46932-46939
|
artikel
|
| 129 |
ZnTiO3-nanoparticles effect on the structure, FTIR, and optical properties of SiO2 – B2O3 – Al2O3 glasses
|
Mohamed, Mansour
|
|
|
50 |
22PB |
p. 46484-46495
|
artikel
|
Tijdschrift beschrijving