| nr |
titel |
auteur |
tijdschrift |
jaar |
jaarg. |
afl. |
pagina('s) |
type |
| 1 |
A comparative study on dark adsorption of dyes using mesoporous MCM-41 catalyst
|
Yarbay Şahin, Rahmiye Zerrin
|
|
|
48 |
2 |
p. 541-553
|
artikel
|
| 2 |
Aerobic oxidation of ethylbenzene to acetophenone over mesoporous ceria–cobalt mixed oxide catalyst
|
Palli, Sitaramulu
|
|
|
48 |
2 |
p. 471-490
|
artikel
|
| 3 |
A new Hg2+ colorimetric chemosensor: the synthesis of chromeno[d]pyrimidine-2,5-dione/thione derivatives using Fe3O4@SiO2@(BuSO3H)3
|
Jamasbi, Negar
|
|
|
48 |
2 |
p. 899-909
|
artikel
|
| 4 |
Anti-inflammation and antimalarial profile of 5-pyridin-2-yl-1H-[1,2,4]triazole-3-carboxylic acid ethyl ester as a low molecular intermediate for hybrid drug synthesis
|
Eya’ane Meva, Francois
|
|
|
48 |
2 |
p. 885-898
|
artikel
|
| 5 |
A periodic DFT study of CO adsorption over Pd–Cu alloy (111) surfaces
|
Zavelev, Denis E.
|
|
|
48 |
2 |
p. 853-867
|
artikel
|
| 6 |
Basic ionic liquid, 2-hydroxyethylammonium formate, catalyzed one-pot synthesis of novel 2-(phenylsulfonyl)-1H-benzo[a]pyrano[2,3-c]phenazin-3-amine derivatives
|
Shirzaei, Farhad
|
|
|
48 |
2 |
p. 751-770
|
artikel
|
| 7 |
Black yet green: A heterogenous carbon-based acid catalyst for the synthesis of biscyclic derivatives under eco-friendly conditions
|
Teli, Pankaj
|
|
|
48 |
2 |
p. 731-750
|
artikel
|
| 8 |
Click approach to the novel 1,2,3-triazolium phosphotungstate organic–inorganic hybrids for the highly promoted synthesis of spirooxindoles
|
Taib, Layla A.
|
|
|
48 |
2 |
p. 795-815
|
artikel
|
| 9 |
Cobalt copper ferrite: burning rate modifier for composite solid propellants and its catalytic activity on the thermal decomposition of ammonium perchlorate
|
Dave, Pragnesh
|
|
|
48 |
2 |
p. 555-574
|
artikel
|
| 10 |
Design and synthesis of some new biologically active amidoalkyl naphthols in the presence of sulfonic acid functionalized silica-coated Fe3O4 nanoparticles
|
Rahimizadeh, Razieh
|
|
|
48 |
2 |
p. 607-627
|
artikel
|
| 11 |
Efficient synthesis of novel chromenopyrido[3,2-e]isothiazolo[2,3-a]pyrimidines via a non-catalytic one-pot three-component reaction
|
Danehchin, Maryam
|
|
|
48 |
2 |
p. 629-646
|
artikel
|
| 12 |
Fabrication of La (III) supported on CoFe2O4 MNPs: a novel and efficient heterogeneous catalyst for selective oxidation of sulfides and synthesis of symmetrical disulfides
|
Molaei, Somayeh
|
|
|
48 |
2 |
p. 771-793
|
artikel
|
| 13 |
Functionalized GO@ZIF-90-supported sulfuric acid and its application in the catalytic synthesis of sulfonamides
|
Ghazviniyan, Maryam
|
|
|
48 |
2 |
p. 457-470
|
artikel
|
| 14 |
1-Methylimidazolium ionic liquid supported on Ni@zeolite-Y: fabrication and performance as a novel multi-functional nanocatalyst for one-pot synthesis of 2-aminothiazoles and 2-aryl benzimidazoles
|
Kalhor, Mehdi
|
|
|
48 |
2 |
p. 519-540
|
artikel
|
| 15 |
Nano-BFn/cellulose: a bio-based nano-catalyst for synthesis of bio-active 7-hydroxycoumarins
|
Mirjalili, Bi Bi Fatemeh
|
|
|
48 |
2 |
p. 839-851
|
artikel
|
| 16 |
One-pot synthesis of nitrogen-doped highly ordered mesoporous polymer nanospheres as a highly efficient catalyst for the water-medium Knoevenagel reactions
|
Zhu, Fengxia
|
|
|
48 |
2 |
p. 505-518
|
artikel
|
| 17 |
Post-synthesis fluoride treatment of Analcime zeolite synthesized using a novel organic template. Crystalline, textural, and acid study
|
Chouat, Nadjat
|
|
|
48 |
2 |
p. 491-503
|
artikel
|
| 18 |
Revisit to Henry reaction by non conventional heterogeneous and efficient catalyst for nitroalcohol synthesis
|
Jadhav, Swati D.
|
|
|
48 |
2 |
p. 593-606
|
artikel
|
| 19 |
Substitutional isomerism of triisopropylnaphthalenes in the isopropylation of naphthalene. Assignment by gas chromatography and confirmation by DFT calculation
|
Sugi, Yoshihiro
|
|
|
48 |
2 |
p. 869-884
|
artikel
|
| 20 |
Synthesis and characterization of Fe3O4@SiO2-(CH2)3-NH-Asn-M(II) (Cu (II)/ Ni(II)/ Co(II)) and its catalytic application in the synthesis of chromeno-pyrazolo-phthalazine derivatives
|
Mostashari, Seyedeh Zahra
|
|
|
48 |
2 |
p. 669-682
|
artikel
|
| 21 |
Synthesis, crystal structure and battery-like studies on a new acylpyrazolone-based mixed-ligand Cu(II) complex
|
Hasanzadeh Esfahani, Maryam
|
|
|
48 |
2 |
p. 575-591
|
artikel
|
| 22 |
Synthesis of Pd–Ag/Al2O3 catalyst by colloidal oxide method for acetylene selective hydrogenation: a study on the sintering of PdO nanoparticles
|
Takht Ravanchi, Maryam
|
|
|
48 |
2 |
p. 817-837
|
artikel
|
| 23 |
The phenyltetrazolethiol-based nickel complex: a versatile catalyst for the synthesis of diverse amidoalkyl naphthols and chromenes
|
Mansouri, Maryam
|
|
|
48 |
2 |
p. 683-702
|
artikel
|
| 24 |
Thermal stability of CeVO4-based catalysts depending on support composition for the selective catalytic reduction of NOx by ammonia
|
Kim, Dong Ho
|
|
|
48 |
2 |
p. 647-667
|
artikel
|
| 25 |
Transition metal complexes of triazole-based bioactive ligands: synthesis, spectral characterization, antimicrobial, anticancer and molecular docking studies
|
Deswal, Yogesh
|
|
|
48 |
2 |
p. 703-729
|
artikel
|
Tijdschrift beschrijving