nr |
titel |
auteur |
tijdschrift |
jaar |
jaarg. |
afl. |
pagina('s) |
type |
1 |
Ammonium diselenite
|
Chomnilpan, S. |
|
1980 |
36 |
3 |
p. 675-677 |
artikel |
2 |
Atomic vibrations in the magnesium difluoride crystal
|
Pauling, L. |
|
1980 |
36 |
3 |
p. 761-762 |
artikel |
3 |
Bis(ethylmethyldithiophosphinato)nickel(II)
|
Wunderlich, H. |
|
1980 |
36 |
3 |
p. 717-718 |
artikel |
4 |
Bis(oxamide oximato)platinum(II)–hydrogen chloride (1:2), form (II)
|
Endres, H. |
|
1980 |
36 |
3 |
p. 715-716 |
artikel |
5 |
Bonding in [S2O6]2−: refinement and pictorial representation from an X-ray diffraction study of Na2S2O6.2H2O and Na2S2O6.2D2O
|
Kirfel, A. |
|
1980 |
36 |
3 |
p. 512-523 |
artikel |
6 |
Caesium lithium tungstate: a stuffed H-cristobalite structure
|
Okada, K. |
|
1980 |
36 |
3 |
p. 657-659 |
artikel |
7 |
Change of publisher of Structure Reports, Molecular Structures and Dimensions and other publications
|
|
|
1980 |
36 |
3 |
p. 762 |
artikel |
8 |
5-Chloro-6-dichloromethylene-4-methoxy-1-methyl-4-trichloromethylhexahydro-2-pyrimidinone
|
Stam, C. H. |
|
1980 |
36 |
3 |
p. 729-730 |
artikel |
9 |
Configuration of Diels–Alder adducts. IV. Structures of configuration-controlled monoadducts between certain propellanes and dienophiles
|
Kaftory, M. |
|
1980 |
36 |
3 |
p. 597-606 |
artikel |
10 |
Convergent-beam electron diffraction symmetry from a disordered structure (Ce,Ta)Ta6O19
|
Johnson, A. W. S. |
|
1980 |
36 |
3 |
p. 523-526 |
artikel |
11 |
Crystal structure of hydrated barium cytidine 5'-phosphate, Ba2(C9N12N3O8P)2(8.5H2O)2. Crystal packing and conformational homologies in alkali-metal– and alkaline-earth–metal–ribonucleotide complexes
|
Hogle, J. |
|
1980 |
36 |
3 |
p. 564-570 |
artikel |
12 |
(+–)-Decahydro-4-hydroxy-4a,8-dimethylazuleno[6,5-b]furan-2,5(3H)-dione (3aα,4α,4aβ,7aα,8α,9aβ)
|
Declercq, J. P. |
|
1980 |
36 |
3 |
p. 739-741 |
artikel |
13 |
4,5-Dihydro-5-hydroxy-4-oxo-5-(2-oxopropyl)-1H-pyrrolo[2,3-f]quinoline-2,7,9-tricarboxylic acid dihydrate
|
Cruse, W. B. T. |
|
1980 |
36 |
3 |
p. 751-754 |
artikel |
14 |
2,3-Dihydro-5-methyl-1,4-dithiin 1,1,4,4-tetroxide
|
Bates, R. B. |
|
1980 |
36 |
3 |
p. 736-738 |
artikel |
15 |
{2,12-Dimethyl-3,7,11,17-tetraazabicyclo[11.3.1]heptadeca-1(17),13,15-triene}nickel(II) monohydrate diperchlorate (β form)
|
Drew, M. G. B. |
|
1980 |
36 |
3 |
p. 718-720 |
artikel |
16 |
(−)-5-Ethyl-2'-hydroxy-2-isobutyl-9,9-dimethyl-6,7-benzomorphan hydrobromide
|
Gelders, Y. G. |
|
1980 |
36 |
3 |
p. 744-746 |
artikel |
17 |
Etude par la diffraction des neutrons de la structure à 80 K du complexe mixte de la triméthylamine avec le tétracyano-7,7,8,8 p-quinodiméthane et l'iode: TMA+.TCNQ2/3−.(I3−)1/3
|
Filhol, A. |
|
1980 |
36 |
3 |
p. 592-596 |
artikel |
18 |
Filiation structurale des complexes triéthylènediamine M (en)3Xm
|
Spinat, P. |
|
1980 |
36 |
3 |
p. 544-551 |
artikel |
19 |
Forme stable du dichloro-3,4 phénol
|
Bavoux, C. |
|
1980 |
36 |
3 |
p. 741-744 |
artikel |
20 |
Hexa-μ-acetato-di-μ3-oxo-tris[aquatungsten(IV)] trifluoromethylsulfonate
|
Bino, A. |
|
1980 |
36 |
3 |
p. 723-725 |
artikel |
21 |
1,4,7,10,13,16-Hexaoxacyclooctadecane: crystal structure at 100 K
|
Maverick, E. |
|
1980 |
36 |
3 |
p. 615-620 |
artikel |
22 |
Hydrazinium(2+) difluoride hexafluorotitanate(IV)
|
Golič, L. |
|
1980 |
36 |
3 |
p. 659-661 |
artikel |
23 |
17β-Hydroxymethyl-1,3,5(10)-estratrien-3-ol monohydrate
|
Précigoux, G. |
|
1980 |
36 |
3 |
p. 749-751 |
artikel |
24 |
Low-temperature protein crystallography. Effect on flexibility, temperature factor, mosaic spread, extinction and diffuse scattering in two examples: bovine trypsinogen and Fc fragment
|
Singh, T. P. |
|
1980 |
36 |
3 |
p. 621-627 |
artikel |
25 |
Neutron diffraction structure of Cs3CoCl5 at 4.2 K
|
Figgis, B. N. |
|
1980 |
36 |
3 |
p. 509-512 |
artikel |
26 |
Neutron profile refinement of potassium and rubidium oxalate monoperhydrates
|
Adams, J. M. |
|
1980 |
36 |
3 |
p. 570-574 |
artikel |
27 |
1,1,1,2,2,2,2,3.3-Nonacarbonyl-1,3;1,3-di-μ-nitrosyl-3-(trimethyl phosphite)-triangulo-triosmium
|
Bellard, S. |
|
1980 |
36 |
3 |
p. 705-707 |
artikel |
28 |
1,1,1,2,2,2,3,3,3-Nonacarbonyl-2-ethylene-1,3-μ-hydrido-1,3-μ-(methylthiolato)-triangulo-triosmium
|
Johnson, B. F. G. |
|
1980 |
36 |
3 |
p. 703-705 |
artikel |
29 |
Notes and News
|
|
|
1980 |
36 |
3 |
p. 762 |
artikel |
30 |
Octacarbonylbis{μ-[iodo(pentacarbonylmanganio)germanium(IV)]}dimanganese
|
Preut, H. |
|
1980 |
36 |
3 |
p. 678-680 |
artikel |
31 |
On the absolute configuration of the tris(ethylenediamine)nickel(II) cation. I. The structure and absolute configuration of (−)-[Ni(en)3](NO3)2
|
Korp, J. D. |
|
1980 |
36 |
3 |
p. 560-564 |
artikel |
32 |
Polymeric dibromo(2,4-dimethylpyridine)mercury(II)
|
Bell, N. A. |
|
1980 |
36 |
3 |
p. 710-712 |
artikel |
33 |
Potassium diaquatetrabromoindate(III)
|
Wignacourt, J. P. |
|
1980 |
36 |
3 |
p. 669-671 |
artikel |
34 |
Prostadienoic acids PGE2 and PGF2β: crystallographic studies of conformational transmission and receptor recognition
|
DeTitta, G. T. |
|
1980 |
36 |
3 |
p. 638-645 |
artikel |
35 |
Redetermination of the structure of anhydrous tetrakis(ethylamine)platinum(II) dibromotetrakis(ethylamine)platinum(IV) tetrabromide, [Pt(ea)2][PtBr2(ea)2]Br4: a red analogue of Reihlen's Green
|
Endres, H. |
|
1980 |
36 |
3 |
p. 760-761 |
artikel |
36 |
Rubidium tribromomanganate
|
Goodyear, J. |
|
1980 |
36 |
3 |
p. 671-672 |
artikel |
37 |
Sodium trans-bis (N-isopropyliminodiacetato)chromate(III) dihydrate
|
Mootz, D. |
|
1980 |
36 |
3 |
p. 721-722 |
artikel |
38 |
Some relationships between bond lengths and angles in –COO−, –COOH and –COOCH3 groups
|
Borthwick, P. W. |
|
1980 |
36 |
3 |
p. 628-632 |
artikel |
39 |
Stereochemistry of unsaturated amino sugars. IV. The structure of peracetylated 2,3-dideoxy-α-d-erythro-aldopyranose, C16H21NO9
|
Rużić-Toroš, Ž. |
|
1980 |
36 |
3 |
p. 607-611 |
artikel |
40 |
Structural aspects of metacyclophanes. Structures of 5,7,14,16-tetramethoxy-1,2,3,10,11,12-hexathia[3.3]metacyclophane and 6,8,10,14,16,18-hexamethyl-1,2,3,4,11,12-hexathia[4.2]metacyclophane
|
Bresciani-Pahor, N. |
|
1980 |
36 |
3 |
p. 632-638 |
artikel |
41 |
Structural studies of benzene derivatives. VII. Refinement of the crystal structure of p-dinitrobenzene
|
Di Rienzo, F. |
|
1980 |
36 |
3 |
p. 586-591 |
artikel |
42 |
Structure du dichromate de cuivre(II) dihydrate
|
Blum, D. |
|
1980 |
36 |
3 |
p. 667-669 |
artikel |
43 |
Structure du fluorure de thallium(I) et d'uranium(IV)
|
Avignant, D. |
|
1980 |
36 |
3 |
p. 664-666 |
artikel |
44 |
Structure d'un décavanadate d'hexasodium hydraté
|
Durif, A. |
|
1980 |
36 |
3 |
p. 680-682 |
artikel |
45 |
Structure of a 1:1 adduct of azulene and 1-(diethylamino)propyne
|
Lindner, H. J. |
|
1980 |
36 |
3 |
p. 754-755 |
artikel |
46 |
Structure of a 1:1 adduct of 4,6,8-trimethylazulene and 1-(diethylamino)propyne
|
Lindner, H. J. |
|
1980 |
36 |
3 |
p. 758-759 |
artikel |
47 |
Structure of a push–pull olefin: trans-N,N-dimethyl-2-nitroethenamine
|
Hazell, A. C. |
|
1980 |
36 |
3 |
p. 747-748 |
artikel |
48 |
Structure of caesium triiodostannate(II)
|
Mauersberger, P. |
|
1980 |
36 |
3 |
p. 683-684 |
artikel |
49 |
Structure of diaquatetrakis(urea)magnesium bromide
|
Lebioda, Ł. |
|
1980 |
36 |
3 |
p. 693-695 |
artikel |
50 |
Structure of 4-(diethylamino)-1,10-ethano-5-methylcyclopentacyclononene
|
Lindner, H. J. |
|
1980 |
36 |
3 |
p. 756-757 |
artikel |
51 |
Structure of manganese(II) glycolate dihydrate
|
Lis, T. |
|
1980 |
36 |
3 |
p. 701-703 |
artikel |
52 |
Structure of methylene oxalate
|
Kvick, Å. |
|
1980 |
36 |
3 |
p. 734-736 |
artikel |
53 |
Structure of peunicin
|
Chang, C. Y. |
|
1980 |
36 |
3 |
p. 731-733 |
artikel |
54 |
Structure of potassium catena-di-μ-fluoro-difluorotetraoxo-di-μ-sulphato-diuranate(VI) hydrate
|
Alcock, N. W. |
|
1980 |
36 |
3 |
p. 687-690 |
artikel |
55 |
Structure of tetrakis(4,4,4-trifluoro-1-phenyl-1,3-butanedionato)uranium
|
Navaza, A. |
|
1980 |
36 |
3 |
p. 696-697 |
artikel |
56 |
Structure of the potassium salt of the modified nucleotide dihydrouridine 3'-monophosphate hemihydrate: correlation between the base pucker and sugar pucker and models for metal interactions with ribonucleic acid loops
|
Emerson, J. |
|
1980 |
36 |
3 |
p. 537-543 |
artikel |
57 |
Structure of tricarbonyl[5-ethyl-2-(5'-ethyl-1',2',3',6'-tetrahydro-1'-methyl-2'-pyridyl)-1,6-dihydro-1-methylpyridine]chromium
|
Trotter, J. |
|
1980 |
36 |
3 |
p. 557-560 |
artikel |
58 |
Structure of two diastereomers of tricarbonyl[5-ethyl-2-(5'-ethyl-1',2',3',4'-tetrahydro-1'-methyl-2'-pyridyl)-1,6-dihydro-1-methylpyridine]chromium
|
Trotter, J. |
|
1980 |
36 |
3 |
p. 551-556 |
artikel |
59 |
Structure reinvestigation of the high-temperature form of K2SO4
|
Miyake, M. |
|
1980 |
36 |
3 |
p. 532-536 |
artikel |
60 |
Struktur ternärer I-tetragonaler Boride: (B12)4C2Ti1,86 und (B12)4C2V1,29
|
Amberger, E. |
|
1980 |
36 |
3 |
p. 672-675 |
artikel |
61 |
Tertiary phosphine complex of mercury(II) chloride with unusual stoichiometry: (Me2EtP)3(HgCl2)2
|
Bell, N. A. |
|
1980 |
36 |
3 |
p. 708-710 |
artikel |
62 |
Tetraammineplatinum(II) bis[trichloro(2,6-dimethylpyridine)platinate(II)]
|
Rochon, F. D. |
|
1980 |
36 |
3 |
p. 691-693 |
artikel |
63 |
The molecular adduct cyclotetra(azathiene)–arsenic pentafluoride
|
Gillespie, R. J. |
|
1980 |
36 |
3 |
p. 655-657 |
artikel |
64 |
The monoclinic structure of a fluorescent probe: ammonium 1-anilino-8-naphthalenesulfonate (ANS) monohydrate
|
Weber, L. D. |
|
1980 |
36 |
3 |
p. 611-614 |
artikel |
65 |
The structure of deuterated cytosine monohydrate at 82 K by neutron diffraction
|
Weber, H. P. |
|
1980 |
36 |
3 |
p. 645-649 |
artikel |
66 |
The structure of gentiobiose
|
Rohrer, D. C. |
|
1980 |
36 |
3 |
p. 650-654 |
artikel |
67 |
The structure of tetramethylammonium carbidohexadecacarbonylhexaruthenate
|
Ansell, G. B. |
|
1980 |
36 |
3 |
p. 726-728 |
artikel |
68 |
The structure of the hexamolybdoperiodate anion in its potassium salt
|
Kondo, H. |
|
1980 |
36 |
3 |
p. 661-664 |
artikel |
69 |
The structures of the γ-phases in the Pd–Cd and Pt–Cd systems
|
Arnberg, L. |
|
1980 |
36 |
3 |
p. 527-532 |
artikel |
70 |
trans-Dichloro(dimethyl sulphoxide) (pyridine)platinum(II)
|
Caruso, F. |
|
1980 |
36 |
3 |
p. 713-715 |
artikel |
71 |
Tribromotris(4-methylpyridine)molybdenum(III)–0.5-(4-methylpyridine)
|
Brenčič, J. V. |
|
1980 |
36 |
3 |
p. 698-700 |
artikel |
72 |
Triclinic iron trimolybdenum tetrasulphide, containing Fe pairs
|
Yvon, K. |
|
1980 |
36 |
3 |
p. 685-687 |
artikel |
73 |
X-ray and neutron studies of a displacive phase transition in N,N-dimethylnitramine (DMN)
|
Filhol, A. |
|
1980 |
36 |
3 |
p. 575-586 |
artikel |
|