nr |
titel |
auteur |
tijdschrift |
jaar |
jaarg. |
afl. |
pagina('s) |
type |
1 |
Acetato(1,10-phenanthroline-5,6-dione)silver(I) trihydrate
|
Onuegbu, Jonathan |
|
2008 |
64 |
2 |
p. m403-m404 |
artikel |
2 |
(Acetylacetonato-κ2O,O′)aqua[salicylaldehyde nicotinoylhydrazonato(2−)-κ3O,N,O′]manganese(III)
|
Wang, Zeng-You |
|
2008 |
64 |
2 |
p. m371-m372 |
artikel |
3 |
Acrylato[tris(1-methylbenzimidazol-2-ylmethyl)amine]zinc(II) perchlorate–dimethylformamide–methanol (1/1/1.5) at 153 (2) K
|
Tian, Yongqiang |
|
2008 |
64 |
2 |
p. m316 |
artikel |
4 |
1,4a-Dimethyl-6-methylene-5-(5,5,6,6-tetracyano-2-methylcyclohex-2-enylmethyl)decahydronaphthalene-1-carboxylic acid: a trans-communic acid derivative
|
Rejouani, Nezha |
|
2008 |
64 |
2 |
p. o475 |
artikel |
5 |
(2-Amino-5-chlorobenzenesulfonato)bis(triphenylphosphine)silver(I)
|
Wu, Hua |
|
2008 |
64 |
2 |
p. m395 |
artikel |
6 |
2′-Amino-3,6-dihydroxyxanthene-9-spiro-1′-isoindolin-3′-one monohydrate
|
Wang, Dong-Xiang |
|
2008 |
64 |
2 |
p. o397 |
artikel |
7 |
2-Amino-4,6-dimethylpyrimidinium 3,5-dinitrobenzoate dihydrate
|
Subashini, Annamalai |
|
2008 |
64 |
2 |
p. o426 |
artikel |
8 |
4′-Amino-2,2′′-dioxo-2,2′′,3,3′′-tetrahydro-1H-indole-3-spiro-1′-cyclopent-3′-ene-2′-spiro-3′′-1H-indole-3′,5′,5′-tricarbonitrile dihydrate
|
Gayathri, D. |
|
2008 |
64 |
2 |
p. o501-o502 |
artikel |
9 |
4-Aminophenylsulfur pentafluoride
|
Nava, Eva Lina |
|
2008 |
64 |
2 |
p. o416 |
artikel |
10 |
2-(4-Amino-5-thioxo-4,5-dihydro-1H-1,2,4-triazol-3-ylmethyl)isoindoline-1,3-dione
|
Yunus, Uzma |
|
2008 |
64 |
2 |
p. o476-o477 |
artikel |
11 |
2-Anilino-3-benzoyl-4-(2,5-dichlorophenyl)-7,7-dimethyl-5-oxo-5,6,7,8-tetrahydro-4H-benzo[b]pyran
|
Wen, Li-Rong |
|
2008 |
64 |
2 |
p. o407 |
artikel |
12 |
1-{2-[(Anthracen-10-yl)methyleneamino]phenyl}-3-phenylthiourea
|
Gayathri, D. |
|
2008 |
64 |
2 |
p. o408 |
artikel |
13 |
4-(9-Anthryl)-2-methylbutyn-2-ol
|
Bylińska, Irena |
|
2008 |
64 |
2 |
p. o484-o485 |
artikel |
14 |
A one-dimensional zigzag coordination polymer: catena-poly[[[triaquacadmium(II)]-[μ-2,2′-(5-methyl-1,3-phenylenedioxy)diacetato-κ4O,O′:O′′,O′′′]] monohydrate]
|
Lin, Ying |
|
2008 |
64 |
2 |
p. m280-m281 |
artikel |
15 |
Aquabis(2-chloroacetato-κO)(1,10-phenanthroline-κ2N,N′)copper(II)
|
Yang, Rongdong |
|
2008 |
64 |
2 |
p. m348 |
artikel |
16 |
Aquabis[1-ethyl-6-fluoro-7-(4-methylpiperazin-1-yl)-4-oxo-1,4-dihydroquinoline-3-carboxylato]zinc(II) dihydrate
|
Qi, Wei |
|
2008 |
64 |
2 |
p. m302 |
artikel |
17 |
Aquabis(nicotinamide-κN)(thiocyanato-κN)copper(II)
|
Li, Chunyuan |
|
2008 |
64 |
2 |
p. m314 |
artikel |
18 |
Aquabis(o-vanillinato-κ2O,O′)nickel(II)
|
Wang, Qiang |
|
2008 |
64 |
2 |
p. m298 |
artikel |
19 |
Aquachloridobis(1,10-phenanthroline-κ2N,N′)zinc(II) chloride N,N-dimethylformamide solvate
|
Kong, Li-Li |
|
2008 |
64 |
2 |
p. m423 |
artikel |
20 |
Aqua(4,5-dihydroxybenzene-1,3-disulfonato-κO)bis(1,10-phenanthroline-κ2N,N')cadmium(II) monohydrate
|
Zhang, Xiangdong |
|
2008 |
64 |
2 |
p. m396-m397 |
artikel |
21 |
Aqua(3-formyl-2-oxidobenzoato-κ2O1,O2)(1,10-phenanthroline-κ2N,N′)copper(II) methanol solvate
|
Zhang, Wu |
|
2008 |
64 |
2 |
p. m294 |
artikel |
22 |
Aqua(3-hydroxybenzoato-κO)bis(1,10-phenanthroline-κ2N,N′)cobalt(II) 3-hydroxybenzoate pentahydrate
|
Li, Jun-Hua |
|
2008 |
64 |
2 |
p. m382-m383 |
artikel |
23 |
Aqua(4-hydroxybenzoato-κO)(4-hydroxybenzoato-κ2O,O′)(1,10-phenanthroline-κ2N,N′)zinc(II) monohydrate
|
Kong, Li-Li |
|
2008 |
64 |
2 |
p. m422 |
artikel |
24 |
Aqua(4-methylquinoline-κN)[N-(2-oxidobenzylidene)glycinato-κ3O,N,O′]copper(II) hemihydrate
|
Trávníček, Zdeněk |
|
2008 |
64 |
2 |
p. m282-m283 |
artikel |
25 |
Aquatris[6-(3,5-dimethyl-1H-pyrazol-1-yl)picolinato]-κ6N,N′,O;κO-dysprosium(III) trihydrate
|
Kai, Zhao |
|
2008 |
64 |
2 |
p. m408-m409 |
artikel |
26 |
(4aR,8aR)-2,3-Diphenyl-4a,5,6,7,8,8a-hexahydroquinoxaline
|
Wang, Guo-Xi |
|
2008 |
64 |
2 |
p. o359 |
artikel |
27 |
A redetermination of bis(5,5′-diethylbarbiturato)bis(imidazole)cobalt(II)
|
Fan, Run-Zhen |
|
2008 |
64 |
2 |
p. m289 |
artikel |
28 |
Aromaticine, a sesquiterpene lactone from Amblyopappus pusillus
|
Brito, Iván |
|
2008 |
64 |
2 |
p. o529 |
artikel |
29 |
1-Benzhydryl-4-(4-chlorophenylsulfonyl)piperazine
|
Girisha, H. R. |
|
2008 |
64 |
2 |
p. o358 |
artikel |
30 |
Benzoylmethyl 4-chlorobenzoate
|
Jin, Yi |
|
2008 |
64 |
2 |
p. o507 |
artikel |
31 |
1-Benzyl-2,3-dihydroquinolin-4(1H)-one
|
Wang, Ming-Liang |
|
2008 |
64 |
2 |
p. o447 |
artikel |
32 |
1-Benzyl-2-(1H-indol-3-yl)-5-oxopyrrolidine-2-carbonitrile
|
Tamazyan, Rafael |
|
2008 |
64 |
2 |
p. o368 |
artikel |
33 |
1-Benzylimidazolium hexafluorophosphate–1-benzylimidazole (1/1)
|
Zang, Yan |
|
2008 |
64 |
2 |
p. o478 |
artikel |
34 |
1-Benzyl-6-phenylimino-5-(pyrrol-2-ylidene)hexahydropyrimidine-2,4-dione
|
Tamazyan, Rafael |
|
2008 |
64 |
2 |
p. o483 |
artikel |
35 |
1-[Bicyclo[4.2.0]octa-1(6),2,4-trien-3-yl]-3-[bicyclo[4.2.0]octa-1(6),2,4-trien-3-ylmethyl]imidazolium hexafluorophosphate
|
Zhu, Fang-Hua |
|
2008 |
64 |
2 |
p. o434 |
artikel |
36 |
1-[Bicyclo[4.2.0]octa-1(6),2,4-trien-3-yl]-3-(but-3-enyl)imidazolium bromide
|
Zhu, Fang-Hua |
|
2008 |
64 |
2 |
p. o433 |
artikel |
37 |
μ-4,4′-Bipyridine-κ2N:N′-bis[aqua(4,4′-bipyridine-κN)(l-valinato-κ2N,O)copper(II)] dinitrate dihydrate
|
Lou, Ben-Yong |
|
2008 |
64 |
2 |
p. m405 |
artikel |
38 |
Bis(acetato-κO)[N,N,N′,N′-tetramethylethane-1,2-diamine-κ2N,N′]copper(II)
|
Slootweg, J. Chris |
|
2008 |
64 |
2 |
p. m430-m431 |
artikel |
39 |
Bis(1-adamantylammonium) tetrachloridocobaltate(II)
|
Guo, Hang-Ming |
|
2008 |
64 |
2 |
p. m415 |
artikel |
40 |
Bis(benzoato-κ2O,O′)(2,9-dimethyl-1,10-phenanthroline-κ2N,N′)cobalt(II)
|
Zhao, Pei-Zheng |
|
2008 |
64 |
2 |
p. m327 |
artikel |
41 |
1,4-Bis[2-(1,3-benzothiazol-2-yl)phenoxy]butane
|
Büyükgüngör, Orhan |
|
2008 |
64 |
2 |
p. o528 |
artikel |
42 |
Bis[benzyl N′-(3-phenylprop-2-enylidene)hydrazinecarbodithioato-κ2N′,S]copper(II)
|
Tarafder, M. T. H. |
|
2008 |
64 |
2 |
p. m416-m417 |
artikel |
43 |
Bis(4,4′-bipyridinium) di-μ-hydroxido-bis[dihydroxido(pyridine-2,6-dicarboxylato)antimonate(III,V)] octahydrate
|
Soleimannejad, Janet |
|
2008 |
64 |
2 |
p. m387-m388 |
artikel |
44 |
Bis[μ-1,4-bis(4,5-dihydro-1H-imidazol-2-yl)benzene-κ2N3:N3′]silver(I) dinitrate dihydrate
|
Sun, Hua |
|
2008 |
64 |
2 |
p. m427-m428 |
artikel |
45 |
Bis[μ-1,2-bis(diphenylphosphino)methane-κ2P:P′]bis[(η2-ethene)nickel(0)] toluene disolvate
|
Langer, Jens |
|
2008 |
64 |
2 |
p. m412 |
artikel |
46 |
Bis[μ-bis(diphenylphosphino)methane-κ2P:P′]bis[(4-toluenesulfonato-κO)silver(I)] monohydrate
|
Ma, Zhen |
|
2008 |
64 |
2 |
p. m269 |
artikel |
47 |
1,2-Bis{bis[4-(trifluoromethyl)phenyl]phosphino}ethane
|
Bork, Matthew A. |
|
2008 |
64 |
2 |
p. o421 |
artikel |
48 |
Bis[3-chloro-6-(3,5-dimethyl-1H-pyrazol-1-yl)picolinato-κ3O,N,N′]copper(II) tetrahydrate
|
Zhao, Kai |
|
2008 |
64 |
2 |
p. m284-m285 |
artikel |
49 |
Bis{4-chloro-2-[2-(1H-indol-3-yl)ethyliminomethyl]phenolato-κ2N,O}zinc(II)
|
Ali, Hapipah M. |
|
2008 |
64 |
2 |
p. m421 |
artikel |
50 |
Bis(4-chloropyridinium) tetrachloridonickelate(II)
|
Cao, Lili |
|
2008 |
64 |
2 |
p. m377 |
artikel |
51 |
[2,6-Bis(5-chloropyrimidin-2-yl-κN)pyridine-κN](2,2′:6′,2′′-terpyridine-κ3N,N′,N′′)ruthenium(II) bis(hexafluoridophosphate) acetonitrile disolvate
|
Medlycott, Elaine A. |
|
2008 |
64 |
2 |
p. m326 |
artikel |
52 |
1,2-Bis[5-(2,2′-dicyanovinyl)-2-n-pentyl-3-thienyl]-3,3,4,4,5,5-hexafluorocyclopent-1-ene: a new photochromic diarylethene compound
|
Li, Min |
|
2008 |
64 |
2 |
p. o517 |
artikel |
53 |
μ-1,2-Bis(diethylphosphino)ethane-κ2P:P′-bis{[1,2-bis(diethylphosphino)ethane-κ2P,P′]trichloridonitrosyltungsten(II)}
|
Avramović, Nataša |
|
2008 |
64 |
2 |
p. m367-m368 |
artikel |
54 |
Bis(dihydrogen norfloxacinium) tri-μ2-chlorido-bis[trichloridobismuthate(III)] chloride dihydrate
|
Gerasimenko, A. V. |
|
2008 |
64 |
2 |
p. m378 |
artikel |
55 |
Bis[6-(3,5-dimethyl-1H-pyrazol-1-yl)picolinato-κ2N1,O2]cadmium(II) 1.75-hydrate
|
Kai, Zhao |
|
2008 |
64 |
2 |
p. m434 |
artikel |
56 |
[1,2-Bis(dimethylphosphino)ethane]carbonyl(η5-cyclopentadienyl)iron(II) diphenylphosphinoylborate
|
Lee, Kajin |
|
2008 |
64 |
2 |
p. m338-m339 |
artikel |
57 |
Bis{μ-2,2′-[1,1′-(ethane-1,2-diyldinitrilo)diethylidyne]diphenolato-κ5O,N,N′,O′:O}bis[chloridomanganese(III)]
|
Thampidas, V. S. |
|
2008 |
64 |
2 |
p. m307 |
artikel |
58 |
[(2-{[3′,6′-Bis(ethylamino)-2′,7′-dimethyl-3-oxospiro[1H-isoindole-1,9′-9H-xanthen]-2-yl}ethyl)aminomethyl]phenol
|
Zhang, Li-Zhu |
|
2008 |
64 |
2 |
p. o403 |
artikel |
59 |
Bis(μ-3-hydroxybenzoato)-κ2O1:O3;κ2O3:O1-bis[bis(1H-benzimidazole-κN3)(3-hydroxybenzoato-κO)nickel(II)] bis(1H-benzimidazole-κN3)bis(3-hydroxybenzoato-κO1)nickel(II) hexahydrate
|
Shen, Hong |
|
2008 |
64 |
2 |
p. m401-m402 |
artikel |
60 |
Bis[4-(2-hydroxybenzylamino)phenyl] ether
|
Guo, Ya-Nan |
|
2008 |
64 |
2 |
p. o505 |
artikel |
61 |
Bis[1-hydroxyethylidenediphosphonato(1−)](1,10-phenanthroline)nickel(II) monohydrate
|
Zhang, Xiangdong |
|
2008 |
64 |
2 |
p. m398 |
artikel |
62 |
Bis(3-methoxy-6-methyl-2-pyridyl) ether
|
Jiang, Yuan-Yuan |
|
2008 |
64 |
2 |
p. o369 |
artikel |
63 |
Bis(methylammonium) tetrasulfidotungstate(VI)
|
Srinivasan, Bikshandarkoil R. |
|
2008 |
64 |
2 |
p. m296-m297 |
artikel |
64 |
4,4-Bis(4-methylphenylsulfanyl)-1,1-diphenyl-2-azabuta-1,3-diene
|
Kinghat, Rodolphe |
|
2008 |
64 |
2 |
p. o370 |
artikel |
65 |
Bis[methyl 2-(2-pyridylmethylidene)hydrazinecarbodithioato]zinc(II)
|
Zhou, Xiu-Xia |
|
2008 |
64 |
2 |
p. m328-m329 |
artikel |
66 |
Bis{μ-N′-[1-(5-bromo-2-oxidophenyl)ethylidene]benzenesulfonohydrazidato}-κ3O2,N′:N;κ3N:O2,N′-bis[(dimethyl sulfoxide-κO)copper(II)]
|
Ali, Hapipah M. |
|
2008 |
64 |
2 |
p. m414 |
artikel |
67 |
3,4-Bis(4-nitrophenyl)-1,2,5-oxadiazole 2-oxide
|
Alhouari, Ghali |
|
2008 |
64 |
2 |
p. o511 |
artikel |
68 |
Bis[N,N′-bis[(1H-pyrrol-2-yl)methylene]cyclohexane-1,2-diamine]titanium(IV) tetrahydrofuran solvate
|
Zhang, Xue-Qin |
|
2008 |
64 |
2 |
p. m437 |
artikel |
69 |
Bis[N-(8-quinolyl)pyridine-2-carboxamidato-κ3N,N′,N′′]manganese(III) perchlorate monohydrate
|
Meng, Qingguo |
|
2008 |
64 |
2 |
p. m332 |
artikel |
70 |
Bis{μ-2-[(2-oxidobenzylidene)aminomethyl]phenolato-κ3O,N,O′}bis[(pyridine-κN)zinc(II)]
|
Yang, Chun |
|
2008 |
64 |
2 |
p. m362 |
artikel |
71 |
Bis(pyridine-κN)bis[4,4,4-trifluoro-1-(4-fluorophenyl)butane-1,3-dionato-κ2O,O′]cobalt(II)
|
Fan, Ling |
|
2008 |
64 |
2 |
p. m347 |
artikel |
72 |
[Bis(2-pyridylmethyl)amine]dichloridomercury(II)
|
Kim, Young-Inn |
|
2008 |
64 |
2 |
p. m358 |
artikel |
73 |
Bis[(2-quinolyl)methanediol-κ2N,O](sulfato-κO)copper(II) dihydrate
|
Martins, Nuno D. |
|
2008 |
64 |
2 |
p. m394 |
artikel |
74 |
5,5′-Bis[(trimethylsilyl)methyl]-2,2′-bipyridine
|
Davies, Murray S. |
|
2008 |
64 |
2 |
p. o364 |
artikel |
75 |
Bis{4-[(Z)-N′-(4-hydroxybenzylidene)hydrazino]-8-(trifluoromethyl)quinolinium} sulfate dihydrate
|
Jasinski, Jerry P. |
|
2008 |
64 |
2 |
p. o481-o482 |
artikel |
76 |
4-(5-Bromo-2-hydroxybenzylideneamino)-3-methyl-1H-1,2,4-triazole-5(4H)-thione
|
Wang, Min |
|
2008 |
64 |
2 |
p. o374 |
artikel |
77 |
3-Bromo-N′-(2-hydroxybenzylidene)benzohydrazide
|
Li, He-Bing |
|
2008 |
64 |
2 |
p. o465 |
artikel |
78 |
4-(4-Bromophenylhydrazono)-1-(5-bromopyrimidin-2-yl)-3-methyl-2-pyrazolin-5-one
|
Subramanyam, M. |
|
2008 |
64 |
2 |
p. o362 |
artikel |
79 |
1,1′-(Butane-1,4-diyl)dipyridinium dibromide dihydrate
|
Wu, Ming-Qiang |
|
2008 |
64 |
2 |
p. o467 |
artikel |
80 |
(2-Butoxyphenyl)boronic acid
|
Dąbrowski, Marek |
|
2008 |
64 |
2 |
p. o437 |
artikel |
81 |
4-Butyl-3-(3,5-dimethoxyphenyl)-4-methoxy-2-(triisopropylsilyl)cyclopent-2-enone
|
Zhao, Zhenyu |
|
2008 |
64 |
2 |
p. o516 |
artikel |
82 |
(μ-5-Carboxybenzene-1,3-dicarboxylato-κ2O1:O3)bis[bis(2,2′-bipyridine-κ2N,N′)copper(II)] 5-carboxybenzene-1,3-dicarboxylate 2,2′-bipyridine solvate tridecahydrate
|
Marek, Jaromír |
|
2008 |
64 |
2 |
p. m384-m385 |
artikel |
83 |
catena-Poly[[[aqua(propane-1,3-diamine-κ2N,N′)copper(II)]-μ-fumarato-κ2O:O′] monohydrate]
|
Padmanabhan, M. |
|
2008 |
64 |
2 |
p. m303-m304 |
artikel |
84 |
catena-Poly[[copper(I)-bis[μ-bis(diphenylphosphino)methane-κ2P:P′]-copper(I)-μ-2,2′-bipyridine-κ2N:N′] bis(tetrafluoridoborate) dichloromethane 2.5-solvate]
|
Mo, Juan |
|
2008 |
64 |
2 |
p. m391 |
artikel |
85 |
catena-Poly[[[diaquairon(II)]-μ-pyridine-2,5-dicarboxylato-[tetraaquairon(II)]-μ-pyridine-2,5-dicarboxylato] tetrahydrate]
|
Xu, Hai-Yun |
|
2008 |
64 |
2 |
p. m413 |
artikel |
86 |
catena-Poly[[dichloridozinc(II)]-μ-2,5-di-4-pyridyl-1,3,4-thiadiazole-κ2N2:N5]
|
Chen, Li-Juan |
|
2008 |
64 |
2 |
p. m393 |
artikel |
87 |
catena-Poly[[(dipyrido[3,2-a:2′,3′-c]phenazine)cobalt(II)]-μ-biphenyl-2,2′-dicarboxylato]
|
Wei, Fang |
|
2008 |
64 |
2 |
p. m379 |
artikel |
88 |
catena-Poly[[(1,10-phenanthroline-κ2N,N′)praseodymium(III)]-di-μ-phenoxyacetato-κ4O:O′-[(1,10-phenanthroline-κ2N,N′)praseodymium(III)]-di-μ-phenoxyacetato-κ4O:O′-di-μ-phenoxyacetato-κ3O,O′:O;κ3O:O,O′]
|
Zhong, H. |
|
2008 |
64 |
2 |
p. m317-m318 |
artikel |
89 |
catena-Poly[silver(I)-μ-pyrazolato-κ2N:N′]
|
Zhang, Chao-Yan |
|
2008 |
64 |
2 |
p. m352 |
artikel |
90 |
catena-Poly[[tetraaquacobalt(II)]-μ-2,2′-dihydroxy-5,5′-diazenediyldibenzoato]
|
Tan, Yu-Hui |
|
2008 |
64 |
2 |
p. m274 |
artikel |
91 |
catena-Poly[[tetraaquazinc(II)]-μ-2,2′-dihydroxy-5,5′-diazenediyldibenzoato]
|
Tan, Yu-Hui |
|
2008 |
64 |
2 |
p. m276-m277 |
artikel |
92 |
catena-Poly[[tetrakis(hexamethylphosphoramide-κO)bis(nitrato-κ2O,O′)lanthanum(III)] [silver(I)-di-μ2-sulfido-tungstate(VI)-di-μ2-sulfido]]
|
Tang, Guodong |
|
2008 |
64 |
2 |
p. m399-m400 |
artikel |
93 |
catena-Poly[[[trans-diaquabis(pyridine-κN)cobalt(II)]-μ-(4-{N′-[1-(3-acetyl-4-methyl-1H-pyrazol-5-yl)ethylidene]hydrazino}benzoato-κ3O:N,N′)-[bis(pyridine-κN)cobalt(III)]-μ-(4-{N′-[1-(3-acetyl-4-methyl-1H-pyrazol-5-yl)ethylidene]hydrazino}benzoato-κ3N,N′:O)]perchlorate 3.66-hydrate]
|
Penkova, Larysa |
|
2008 |
64 |
2 |
p. m432-m433 |
artikel |
94 |
catena-Poly[[triaquacadmium(II)]-μ-pyridine-2,3-dicarboxylato-κ3N,O2:O3]
|
Aghabozorg, Hossein |
|
2008 |
64 |
2 |
p. m320-m321 |
artikel |
95 |
Chlorido{5-chloro-2-[2-(methylsulfanyl)phenyldiazenyl]phenyl}platinum(II)
|
Bagchi, Vivek |
|
2008 |
64 |
2 |
p. m359 |
artikel |
96 |
3-Chloro-2-methylanilinium dihydrogenphosphate
|
Khemiri, Hamed |
|
2008 |
64 |
2 |
p. o526 |
artikel |
97 |
2-[1-Chloro-3-(2-methyl-5-nitro-1H-imidazol-1-yl)propan-2-yloxycarbonyl]benzoic acid
|
Tao, Xiao |
|
2008 |
64 |
2 |
p. o472 |
artikel |
98 |
2-Chloro-N-(2,3-dichlorophenyl)acetamide
|
Gowda, B. Thimme |
|
2008 |
64 |
2 |
p. o419 |
artikel |
99 |
2-Chloro-N-(3,5-dichlorophenyl)acetamide
|
Gowda, B. Thimme |
|
2008 |
64 |
2 |
p. o420 |
artikel |
100 |
4-(4-Chlorophenyl)-5-[1-(4-chlorophenyl)-2-methyl-2-nitropropyl]-1,2,3-selenadiazole
|
Marx, A. |
|
2008 |
64 |
2 |
p. o349 |
artikel |
101 |
3-(4-Chlorophenyl)-7-methyl-4-(4-methylphenyl)-1-oxa-2,7-diazaspiro[4.5]dec-2-en-10-one
|
Gayathri, D. |
|
2008 |
64 |
2 |
p. o398 |
artikel |
102 |
3-Chloro-5-(trifluoromethyl)pyridin-2-amine
|
Tan, Sheng |
|
2008 |
64 |
2 |
p. o430 |
artikel |
103 |
cis-Bis(azido-κN)bis(pyridine-2-carboxamide-κ2N1,O)nickel(II)
|
Đaković, Marijana |
|
2008 |
64 |
2 |
p. m311-m312 |
artikel |
104 |
cis-Bis(2-sulfidopyridine N-oxide)platinum(II)
|
Ravindran Durai Nayagam, B. |
|
2008 |
64 |
2 |
p. m425 |
artikel |
105 |
cis-Difluoridobis(1,10-phenanthroline)chromium(III) perchlorate monohydrate
|
Birk, Torben |
|
2008 |
64 |
2 |
p. m369-m370 |
artikel |
106 |
cis-(9S,10S)-Methyl 1-propyl-1,2,3,4-tetrahydro-β-carboline-3-carboxylate
|
Alam, Samina |
|
2008 |
64 |
2 |
p. o361 |
artikel |
107 |
2-{3-Cyano-5,5-dimethyl-4-[4-(piperidin-1-yl)buta-1,3-dienyl]-2,5-dihydrofuran-2-ylidene}malononitrile
|
Gainsford, Graeme J. |
|
2008 |
64 |
2 |
p. o503 |
artikel |
108 |
Cyclo(l-tyrosyl-l-tryptophanyl) dimethylformamide solvate
|
Görbitz, Carl Henrik |
|
2008 |
64 |
2 |
p. o436 |
artikel |
109 |
(η5-Cyclopentadienyl){[3-(2,2-dicyanoethenyl)bicyclo[2.2.1]hepta-2,5-dien-2-yl]ethynyl}(triphenylphosphine)nickel(II)
|
Gallagher, John F. |
|
2008 |
64 |
2 |
p. m411 |
artikel |
110 |
Diacetatobis[1,3-bis(benzimidazol-2-yl)benzene]zinc(II) dihydrate
|
Meng, Fa-Yan |
|
2008 |
64 |
2 |
p. m319 |
artikel |
111 |
Di-μ-acetato-κ4O:O′-bis{[2-(2-pyridyl)phenyl-κ2C,N]palladium(II)}
|
Dinçer, Muharrem |
|
2008 |
64 |
2 |
p. m381 |
artikel |
112 |
Di-μ2-acetato-1:2κ2O:O′;2:3κ2O:O′-bis(N,N′-dimethylformamide)-1κO,3κO-bis{μ2-2,2′-[propane-1,3-diylbis(iminomethylene)]diphenolato-1κ4O,N,N′,O′:2κ2O,O′;2κ2O,O′:3κ4O,N,N′,O′-1,3-dinickel(II)-2-cadmium(II)
|
Tatar Yıldırım, Leyla |
|
2008 |
64 |
2 |
p. m291-m292 |
artikel |
113 |
Diacetonitriletetrakis{μ2-3-anilinocarbonyl-1-[(5-chloro-2-oxidophenyl)diazenyl]-2-naphtholato}tetraaquadiiron(III)disodium(I) dihydrate. Corrigendum
|
Sato, Yohei |
|
2008 |
64 |
2 |
p. e14 |
artikel |
114 |
2,4-Diamino-6-methyl-1,3,5-triazine ethanol solvate
|
Xiao, Zun-Hong |
|
2008 |
64 |
2 |
p. o411 |
artikel |
115 |
Diammonium bis[(2-aminoacetato-κ2N,O)(2,2′-bipyridine-κ2N,N′)(N,N-dimethylformamide-κO)copper(II)] hexacosaoxidooctamolybdate(VI)
|
Liu, Haiyan |
|
2008 |
64 |
2 |
p. m305-m306 |
artikel |
116 |
Diaquabis(2,2′-biimidazole)cobalt(II) dichloride
|
Zhang, Lan-Cui |
|
2008 |
64 |
2 |
p. m308 |
artikel |
117 |
Diaquabis[6-(3,5-dimethyl-1H-pyrazol-1-yl)picolinato-κ3N,N′,O](nitrato-κ2O,O′)lanthanum(III) monohydrate
|
Kai, Zhao |
|
2008 |
64 |
2 |
p. m410 |
artikel |
118 |
Diaquabis(9-oxo-4,5-diazafluoren-3-olato-κ2N4,O3)cadmium(II)
|
Zhao, Ya-Hui |
|
2008 |
64 |
2 |
p. m266 |
artikel |
119 |
Diaquabis(5-phenyl-1H-pyrazole-3-carboxylato)copper(II)
|
Wu, Yuan-Hui |
|
2008 |
64 |
2 |
p. m355 |
artikel |
120 |
2,6-Diazidotoluene
|
Klapötke, Thomas M. |
|
2008 |
64 |
2 |
p. o348 |
artikel |
121 |
(5,6:19,20-Dibenzo-1,4,11,14-tetraoxa-8,17-diazacycloeicosane-κ4N8,O11,O14,N17)dinitrato-κ4O,O′-cadmium(II)
|
Han, Ting-Ting |
|
2008 |
64 |
2 |
p. m322 |
artikel |
122 |
2,5-Dibenzoylbenzene-1,4-diaminium dichloride
|
Deng, Shui-Ping |
|
2008 |
64 |
2 |
p. o387 |
artikel |
123 |
Di-μ-bromido-bis({bis[2-(2-pyridyl)ethyl]amine}copper(II)) bis(perchlorate)
|
Butcher, Ray J. |
|
2008 |
64 |
2 |
p. m323 |
artikel |
124 |
Dibromido(di-2-pyridyl sulfide-κ2N,N′)zinc(II)
|
Wriedt, Mario |
|
2008 |
64 |
2 |
p. m315 |
artikel |
125 |
3,3′-Dibromo-5,5′-di-tert-butyl-2,2′-dimethoxybiphenyl
|
Polson, Matthew I. J. |
|
2008 |
64 |
2 |
p. o532 |
artikel |
126 |
[μ-11,23-Dibromo-3,7,15,19-tetraazatricyclo[19.3.1.19,13]hexacosa-1(25),2,7,9,11,13(26),14,19,21,23-decaene-25,26-diolato-κ4N3,N7,O,O′:κ4O,O′,N15,N19]bis[perchloratocopper(II)]
|
Zhang, Han-Ping |
|
2008 |
64 |
2 |
p. m340 |
artikel |
127 |
2-(Dibutylamino)-3-(4-fluorophenyl)-5,6,7,8-tetrahydro-7-methyl-6,8-diphenylpyridine[3′,4′:2,3]thieno[5,4-d]pyrimidin-4(3H)-one
|
Zeng, Guo-ping |
|
2008 |
64 |
2 |
p. o535 |
artikel |
128 |
Di-μ-chlorido-bis{[2-(2-pyridylmethylamino)ethanesulfonato-κ3N,N′,O]copper(II)}
|
Du, Zhong-Xiang |
|
2008 |
64 |
2 |
p. m341 |
artikel |
129 |
Dichloridobis{2-[(triphenylmethyl)amino]pyridine-κN}cadmium(II)
|
Zhang, Guang-Ning |
|
2008 |
64 |
2 |
p. m357 |
artikel |
130 |
Dichlorido-1κCl,3κCl-hexakis[1,1,2,2,3,3(η5)-methylcyclopentadienyl]di-μ2-oxido-1:2κ2O:O;2:3κ2O:O-trihafnium(IV)
|
Wisniewska, Aleksandra |
|
2008 |
64 |
2 |
p. m361 |
artikel |
131 |
Dichlorido(dimethylglyoximato-κ2N,N′)(dimethylglyoxime-κ2N,N′)cobalt(III)
|
Ramesh, P. |
|
2008 |
64 |
2 |
p. m300-m301 |
artikel |
132 |
Dichlorido{2-hydroxyimino-N′-[1-(2-pyridyl)ethylidene]propanohydrazide-κ3N,N′,O}zinc(II) hemihydrate
|
Moroz, Yurii S. |
|
2008 |
64 |
2 |
p. m353-m354 |
artikel |
133 |
Dichlorido(η6-toluene)[tris(4-methoxyphenyl)phosphine]ruthenium(II)
|
Wang, Lei |
|
2008 |
64 |
2 |
p. m429 |
artikel |
134 |
Dichloridotris(trimethylphosphine)nickel(II)
|
Cao, Ruixia |
|
2008 |
64 |
2 |
p. m335 |
artikel |
135 |
Dichlorodiphenoxymethane
|
Betz, Richard |
|
2008 |
64 |
2 |
p. o354 |
artikel |
136 |
2,4-Dichloro-6-nitrobenzoic acid
|
Liu, Hai-Lian |
|
2008 |
64 |
2 |
p. o536 |
artikel |
137 |
2,2-Dichloro-N-(3-nitrophenyl)acetamide
|
Gowda, B. Thimme |
|
2008 |
64 |
2 |
p. o382 |
artikel |
138 |
9-(2,3-Dichlorophenyl)-4a-hydroxy-3,3,6,6-tetramethyl-4,4a,5,6,9,9a-hexahydro-3H-xanthene-1,8(2H,7H)-dione
|
Mohammadi Ziarani, Ghodsi |
|
2008 |
64 |
2 |
p. o519 |
artikel |
139 |
Dicyclohexylammonium thiocyanate
|
Khawar Rauf, M. |
|
2008 |
64 |
2 |
p. o366 |
artikel |
140 |
1-[(Diethylaminocarbonyl)methyl]-2-[hydroxy(6-methoxyquinolin-4-yl)methyl]-5-vinyl-1-azoniabicyclo[2.2.2]octane chloride monohydrate
|
Zhang, Li-Ping |
|
2008 |
64 |
2 |
p. o518 |
artikel |
141 |
Diethyl 2,3-dihydrothieno[3,4-b]-1,4-dioxine-5,7-dicarboxylate
|
Ono, Katsuhiko |
|
2008 |
64 |
2 |
p. o468 |
artikel |
142 |
2,3-Difluorobenzoic acid
|
Knapik, Aleksandra A. |
|
2008 |
64 |
2 |
p. o466 |
artikel |
143 |
Di-μ-hydroxido-κ4O:O-μ-trifluoromethanesulfonato-κ2O:O′-bis[(5,5′-dimethyl-2,2-bipyridine-κ2N,N′)(η5-pentamethylcyclopentadienyl)ytterbium(III)] tetraphenylborate 5,5′-dimethyl-2,2-bipyridine
|
Kazhdan, Daniel |
|
2008 |
64 |
2 |
p. m435 |
artikel |
144 |
3,6-Dihydroxy-2′-[(2-hydroxy-1-naphthyl)methyleneamino]xanthene-9-spiro-1′-isoindolin-3′-one acetonitrile solvate
|
Wang, Pei-San |
|
2008 |
64 |
2 |
p. o442 |
artikel |
145 |
2,4-Dihydroxy-N′-(4-methoxybenzylidene)benzohydrazide
|
Diao, Yun-Peng |
|
2008 |
64 |
2 |
p. o470 |
artikel |
146 |
1,16-Diiodohexadecane
|
Nakamura, Naotake |
|
2008 |
64 |
2 |
p. o418 |
artikel |
147 |
Diisopropylammonium 3,5,6-trichloropyridin-2-olate
|
Hu, Zhi Yan |
|
2008 |
64 |
2 |
p. o537 |
artikel |
148 |
9-(Dimethoxymethyl)anthracene
|
Wang, Li |
|
2008 |
64 |
2 |
p. o487 |
artikel |
149 |
{μ-6,6′-Dimethoxy-2,2′-[propane-1,3-diylbis(nitrilomethylidyne)]diphenolato}trinitratocopper(II)samarium(III) acetone solvate
|
Wang, Jing-Hua |
|
2008 |
64 |
2 |
p. m344 |
artikel |
150 |
Dimethyl [1-(1-allyl-5-iodo-1H-indol-3-yl)-3-hydroxypropyl]phosphonate
|
Guo, Ying-Cen |
|
2008 |
64 |
2 |
p. o384 |
artikel |
151 |
1,1′-Dimethyl-1,1′-(butane-1,4-diyl)dipyrrolidinium dibromide methanol disolvate
|
Yang, Yu-Lin |
|
2008 |
64 |
2 |
p. o417 |
artikel |
152 |
5,11-Dimethyldibenzo[b,f][1,5]diazocine-6,12(5H,11H)-dione
|
Mahon, Andrew B. |
|
2008 |
64 |
2 |
p. o469 |
artikel |
153 |
Dimethyl 6H,12H-5,11-methanodibenzo[b,f][1,5]diazocine-2,8-diacetate
|
Faroughi, Masoud |
|
2008 |
64 |
2 |
p. o500 |
artikel |
154 |
3,3-Dimethyl-1-[5-(1H-1,2,4-triazol-1-ylmethyl)-1,3,4-thiadiazol-2-ylsulfanyl]butan-2-one
|
Wei, Qing-Li |
|
2008 |
64 |
2 |
p. o412 |
artikel |
155 |
1-(2,4-Dinitrophenyl)-5-ferrocenyl-3-methyl-1H-pyrazole
|
Stalin Elanchezhian, V. |
|
2008 |
64 |
2 |
p. m265 |
artikel |
156 |
5,7-Di-2-pyridyl-2,3-dihydrothieno[3,4-b][1,4]dioxine
|
Djukic, Brandon |
|
2008 |
64 |
2 |
p. o463 |
artikel |
157 |
Disodium tetraaquabis(sulfato)iron(II)
|
Hudák, Martin |
|
2008 |
64 |
2 |
p. i10 |
artikel |
158 |
2,6-Di-tert-butyl-4-(morpholinomethyl)phenol monohydrate
|
Zeng, Tao |
|
2008 |
64 |
2 |
p. o406 |
artikel |
159 |
2,6-Di-tert-butyl-4-[(N-methylanilino)methyl]phenol
|
Zeng, Tao |
|
2008 |
64 |
2 |
p. o410 |
artikel |
160 |
2-(1,3-Dithian-2-ylidene)-1-phenylbutane-1,3-dione
|
Zhang, Lan-Cui |
|
2008 |
64 |
2 |
p. o534 |
artikel |
161 |
Di-μ-thiocyanato-κ4N:N-bis({2,4-dibromo-6-[2-(methylamino)ethyliminomethyl]phenolato-κ3N,N′,O}nickel(II))
|
Lin, Hong-Wei |
|
2008 |
64 |
2 |
p. m295 |
artikel |
162 |
(E)-1,2-Bis(3-bromo-4-methylphenyl)ethene
|
Boeré, René T. |
|
2008 |
64 |
2 |
p. o363 |
artikel |
163 |
(E)-1-(4-Bromophenyl)-2-(4-tert-butylphenyl)-1-phenylethene
|
Kim, Chul-Bae |
|
2008 |
64 |
2 |
p. o457 |
artikel |
164 |
(E)-2-[(2-Chlorophenyl)iminomethyl]-4-methylphenol
|
Deveci, Özlem |
|
2008 |
64 |
2 |
p. o539 |
artikel |
165 |
(E)-3-(2-Chloro-3,3,3-trifluoroprop-1-enyl)-2,2-dimethyl-N-p-tolylcyclopropanecarboxamide
|
Yan, Fan-Yong |
|
2008 |
64 |
2 |
p. o451 |
artikel |
166 |
3-[(E)-2,4-Dichlorobenzylidene]-1-methylpiperidin-4-one
|
Gayathri, D. |
|
2008 |
64 |
2 |
p. o520 |
artikel |
167 |
(E)-Ethyl 3-(2-fluoroanilino)-2-(4-methoxyphenyl)acrylate
|
Zheng, Yi |
|
2008 |
64 |
2 |
p. o489 |
artikel |
168 |
(E)-2-Methoxy-6-[(5-methylisoxazol-3-yl)iminomethyl]phenol
|
Zhao, Ren-Gao |
|
2008 |
64 |
2 |
p. o499 |
artikel |
169 |
(E)-N-[2-(9-Fluorenylidene)-3a,5,7-trimethyl-3,3a-dihydro-2H-indol-3-ylidene]-2,4,6-trimethylaniline
|
Mizuhata, Yoshiyuki |
|
2008 |
64 |
2 |
p. o493 |
artikel |
170 |
Ethane-1,2-diylbis(methylphosphinic acid)
|
Reiss, Guido J. |
|
2008 |
64 |
2 |
p. o400 |
artikel |
171 |
3,3′-(Ethane-1,2-diyl)bis(2-thioxo-1,3-oxazolidin-4-one)
|
Ge, Chunhua |
|
2008 |
64 |
2 |
p. o506 |
artikel |
172 |
2-(Ethoxycarbonyl)quinolinium butyltrichlorido(quinoline-2-carboxylato-κ2N,O)stannate(IV)
|
Wang, Hongyun |
|
2008 |
64 |
2 |
p. m272 |
artikel |
173 |
Ethyl 7-amino-1-cyclopropyl-6-fluoro-8-methoxy-4-oxo-1,4-dihydroquinoline-3-carboxylate monohydrate
|
Pan, Jia |
|
2008 |
64 |
2 |
p. o527 |
artikel |
174 |
Ethyl 4-chloro-3-nitrobenzoate
|
Li, Hao-Yuan |
|
2008 |
64 |
2 |
p. o523 |
artikel |
175 |
Ethyl 6-(2-chlorophenyl)-4-methyl-1-(3-oxobutyl)-2-thioxo-1,2,3,6-tetrahydropyrimidine-5-carboxylate
|
He, Qing-Peng |
|
2008 |
64 |
2 |
p. o352 |
artikel |
176 |
Ethyl 3′-cyano-1′-methyl-2-oxo-4′-phenylspiro[acenaphthene-1,2′-pyrrolidine]-3′-carboxylate
|
Yang, Wen-Long |
|
2008 |
64 |
2 |
p. o440 |
artikel |
177 |
1-Ethyl-6-fluoro-7-(4-methylpiperazin-4-ium-1-yl)-4-oxo-1,4-dihydroquinoline-3-carboxylate hexahydrate
|
An, Zhe |
|
2008 |
64 |
2 |
p. o441 |
artikel |
178 |
Ethyl 4-nitrophenylacetate
|
Li, Ji |
|
2008 |
64 |
2 |
p. o443 |
artikel |
179 |
Ethyl 2-[(phenylsulfanyl)methyl]-1-(phenylsulfonyl)-1H-indole-3-carboxylate
|
Chakkaravarthi, G. |
|
2008 |
64 |
2 |
p. o392 |
artikel |
180 |
3-Ethyl-9-phenyl-2-tosyl-2,3,3a,4,9,9a-hexahydro-1H-pyrrolo[3,4-b]quinoline
|
Sudha, D. |
|
2008 |
64 |
2 |
p. o425 |
artikel |
181 |
5-(4-Fluorophenyl)-2-furylmethyl N-(2,6-difluorobenzoyl)carbamate
|
Li, Ying |
|
2008 |
64 |
2 |
p. o474 |
artikel |
182 |
5-(4-Fluorophenyl)-5-methylimidazolidine-2,4-dione
|
Kashif, M. Kaleem |
|
2008 |
64 |
2 |
p. o444 |
artikel |
183 |
4-(4-Fluorophenyl)-2-methyl-3-(1-oxy-4-pyridyl)isoxazol-5(2H)-one
|
Margutti, Simona |
|
2008 |
64 |
2 |
p. o504 |
artikel |
184 |
1-Furoyl-3-methyl-3-phenylthiourea
|
Pérez, Hiram |
|
2008 |
64 |
2 |
p. o513 |
artikel |
185 |
(Glycol-κ2O,O′)nitrosyl(η5-pentamethylcyclopentadienyl)ruthenium(II) bis(trifluoromethanesulfonate)
|
Munie, Semeret |
|
2008 |
64 |
2 |
p. m293 |
artikel |
186 |
Hexaaquamanganese(II) dipicrate dihydrate
|
Liu, Changying |
|
2008 |
64 |
2 |
p. m270-m271 |
artikel |
187 |
Hexaaquazinc(II) bis[4-(2-hydroxybenzylideneamino)benzenesulfonate]
|
Tai, Xi-Shi |
|
2008 |
64 |
2 |
p. m273 |
artikel |
188 |
6H,12H-5,11-Ethanodibenzo[b,f][1,5]diazocine
|
Faroughi, Masoud |
|
2008 |
64 |
2 |
p. o458 |
artikel |
189 |
5-(1H-Inden-2-yl)-1,3-benzodioxole
|
Deng, Rui-Xue |
|
2008 |
64 |
2 |
p. o492 |
artikel |
190 |
4-[(2H-Tetrazol-2-yl)methyl]benzonitrile
|
Xing, Zheng |
|
2008 |
64 |
2 |
p. o445 |
artikel |
191 |
Hydrazinediium bis(6-carboxypyridazine-3-carboxylate) dihydrate
|
Starosta, Wojciech |
|
2008 |
64 |
2 |
p. o461 |
artikel |
192 |
7β-Hydroxyartemisinin
|
Carvalho, Paulo B. |
|
2008 |
64 |
2 |
p. o395-o396 |
artikel |
193 |
[3-Hydroxy-N′-(2-oxidobenzylidene)-2-naphthohydrazidato-κ3O,N,O′]tris(pyridine-κN)nickel(II) pyridine trisolvate
|
Sun, Shi-Zhu |
|
2008 |
64 |
2 |
p. m438 |
artikel |
194 |
2-Hydroxy-1,6,7,8-tetramethoxy-3-methylanthraquinone
|
Zhu, Li-Cai |
|
2008 |
64 |
2 |
p. o371 |
artikel |
195 |
4-Hydroxy-2,2,6,6-tetramethylpiperidinium chloride–hydroxonium chloride (3/1)
|
Zhang, Li |
|
2008 |
64 |
2 |
p. o512 |
artikel |
196 |
4-Hydroxy-2,2,6,6-tetramethylpiperidinium hydrogensulfate monohydrate
|
Xiao, Li |
|
2008 |
64 |
2 |
p. o350 |
artikel |
197 |
5-Iodo-2,7-dimethyl-3-phenylsulfinyl-1-benzofuran
|
Choi, Hong Dae |
|
2008 |
64 |
2 |
p. o486 |
artikel |
198 |
l-Glutamic acid hydrochloride at 153 K
|
Zhang, Yi Jian |
|
2008 |
64 |
2 |
p. o446 |
artikel |
199 |
l-Lysinium trifluoroacetate
|
Sun, Zhi Hua |
|
2008 |
64 |
2 |
p. o393-o394 |
artikel |
200 |
Melaminium sulfate
|
Zhu, Bao-Yong |
|
2008 |
64 |
2 |
p. o351 |
artikel |
201 |
[4-(Methoxycarbonyl)benzyl]triphenylphosphonium bromide hemihydrate
|
Nazir, Saba |
|
2008 |
64 |
2 |
p. o423 |
artikel |
202 |
(2-Methoxy-1,3-phenylene)diboronic acid
|
Dąbrowski, Marek |
|
2008 |
64 |
2 |
p. o414-o415 |
artikel |
203 |
3-(4-Methoxyphenyl)-6-(phenylsulfonyl)perhydro-1,3-thiazolo[3′,4′:1,2]pyrrolo[4,5-c]pyrrole
|
Sundaramoorthy, S. |
|
2008 |
64 |
2 |
p. o515 |
artikel |
204 |
1-Methyl-1-azonia-3,5-diaza-7-phosphatricyclo[3.3.1.1]decane 7-oxide triiodide
|
Kirillov, Alexander M. |
|
2008 |
64 |
2 |
p. o496-o497 |
artikel |
205 |
Methyl 4-chloro-3-nitrobenzoate
|
Liu, Bo-Nian |
|
2008 |
64 |
2 |
p. o456 |
artikel |
206 |
1-Methyl-2-(4-methylphenyl)-4-morpholinopyridazine-3,6(1H,2H)-dione
|
Gzella, Andrzej |
|
2008 |
64 |
2 |
p. o435 |
artikel |
207 |
Methyl 2-(N-ethylmethanesulfonamido)benzoate
|
Shafiq, Muhammad |
|
2008 |
64 |
2 |
p. o389 |
artikel |
208 |
10-Methyl-9-(2-nitrophenoxycarbonyl)acridinium trifluoromethanesulfonate
|
Sikorski, Artur |
|
2008 |
64 |
2 |
p. o372-o373 |
artikel |
209 |
4′-Methyl-3-(4-nitrophenyl)-4-phenyl-4,5,1′,2′,3′,4′-hexahydrospiro[isoxazole-5,2′-naphthalen]-1′-one
|
Alhouari, Ghali |
|
2008 |
64 |
2 |
p. o509-o510 |
artikel |
210 |
2-Methyl-N-(3-methylphenyl)benzamide
|
Gowda, B. Thimme |
|
2008 |
64 |
2 |
p. o541 |
artikel |
211 |
2-Methyl-N-phenylbenzamide
|
Gowda, B. Thimme |
|
2008 |
64 |
2 |
p. o383 |
artikel |
212 |
2-Methyl-2-phenyl-1,2-dihydroquinazolin-4(3H)-one
|
Zhang, Lijun |
|
2008 |
64 |
2 |
p. o450 |
artikel |
213 |
(2-Methyl-1-phenylsulfonyl-1H-indol-3-yl)methanol
|
Chakkaravarthi, G. |
|
2008 |
64 |
2 |
p. o542 |
artikel |
214 |
2-Methyl-3-(phenylsulfonyl)naphtho[1,2-b]furan
|
Choi, Hong Dae |
|
2008 |
64 |
2 |
p. o452 |
artikel |
215 |
2-[1-(Methylsulfanyl)naphtho[2,1-b]furan-2-yl]acetic acid
|
Choi, Hong Dae |
|
2008 |
64 |
2 |
p. o453 |
artikel |
216 |
Monoclinic form of 1,2,4,5-tetracyclohexylbenzene
|
Mague, Joel T. |
|
2008 |
64 |
2 |
p. o375 |
artikel |
217 |
Morpholinium perchlorate
|
Grigoriev, Mikhail S. |
|
2008 |
64 |
2 |
p. o390 |
artikel |
218 |
(m-Phenylenedimethylene)diammonium p-nitrophenylphosphate perchlorate
|
Tesema, Yohannes T. |
|
2008 |
64 |
2 |
p. o377-o378 |
artikel |
219 |
3-(m-Tolyloxy)phthalonitrile
|
Zhang, Xian-Fu |
|
2008 |
64 |
2 |
p. o401 |
artikel |
220 |
N-(1-Acetyl-r-7,c-9-diphenyl-4,8-dithia-1,2-diazaspiro[5.4]dec-2-en-3-yl)acetamide
|
Gayathri, D. |
|
2008 |
64 |
2 |
p. o494-o495 |
artikel |
221 |
N-(Biphenyl-4-ylcarbonyl)-N′-(2-pyridylmethyl)thiourea
|
Yamin, Bohari M. |
|
2008 |
64 |
2 |
p. o360 |
artikel |
222 |
N′-(5-Bromo-2-hydroxybenzylidene)-3-hydroxybenzohydrazide
|
Nie, Yi |
|
2008 |
64 |
2 |
p. o514 |
artikel |
223 |
9-n-Butyl-9,9′-bi[9H-fluorene]
|
Yu, Shu-Qiang |
|
2008 |
64 |
2 |
p. o490 |
artikel |
224 |
N-(2-Chloro-2-nitro-1-phenylpropyl)-4-methylbenzenesulfonamide
|
Zhi, Sanjun |
|
2008 |
64 |
2 |
p. o357 |
artikel |
225 |
N-(3-Chlorophenyl)acetamide
|
Gowda, B. Thimme |
|
2008 |
64 |
2 |
p. o381 |
artikel |
226 |
N-(3-Chlorophenyl)benzamide
|
Gowda, B. Thimme |
|
2008 |
64 |
2 |
p. o462 |
artikel |
227 |
(+)-N-[2-(4-Chlorophenyl)propanoyl]bornane-10,2-sultam
|
Lu, Wen-Chang |
|
2008 |
64 |
2 |
p. o454 |
artikel |
228 |
N-(2,6-Dichlorophenyl)benzamide
|
Gowda, B. Thimme |
|
2008 |
64 |
2 |
p. o540 |
artikel |
229 |
N′-(2,5-Dihydroxybenzylidene)benzenesulfonohydrazide
|
Ali, Hapipah M. |
|
2008 |
64 |
2 |
p. o522 |
artikel |
230 |
N′-[4-(Dimethylamino)benzylidene]-3-hydroxybenzohydrazide
|
Nie, Yi |
|
2008 |
64 |
2 |
p. o471 |
artikel |
231 |
N-(2,6-Dimethylphenyl)-2-methylacetamide
|
Gowda, B. Thimme |
|
2008 |
64 |
2 |
p. o380 |
artikel |
232 |
N′-[1-(2-Furyl)ethenyl]propanohydrazide
|
Guo, Huan-Mei |
|
2008 |
64 |
2 |
p. o508 |
artikel |
233 |
N-Hydroxy-N-o-tolylacetamide
|
Li, Yu-Hao |
|
2008 |
64 |
2 |
p. o533 |
artikel |
234 |
Nitrato(1,10-phenanthroline)(1H-1,2,4-triazole-3-carboxylato)copper(II)
|
Zhu, Jie |
|
2008 |
64 |
2 |
p. m392 |
artikel |
235 |
4-(4-Nitrobenzenesulfonamido)pyridinium trichloroacetate
|
Zhang, Peng-Wei |
|
2008 |
64 |
2 |
p. o438 |
artikel |
236 |
3-(2-Nitrophenoxy)phthalonitrile
|
Zhang, Xian-Fu |
|
2008 |
64 |
2 |
p. o356 |
artikel |
237 |
4-Nitrophenyl α-l-rhamnopyranoside hemihydrate
|
Peltier, Pauline |
|
2008 |
64 |
2 |
p. o379 |
artikel |
238 |
4-Nitrophenyl N-phenylcarbamate
|
Xu, Yun-Hua |
|
2008 |
64 |
2 |
p. o404 |
artikel |
239 |
7-Nitroquinazolin-4(3H)-one
|
Yong, Jian-Ping |
|
2008 |
64 |
2 |
p. o427 |
artikel |
240 |
N-[(3-Methyl-5-phenoxy-1-phenylpyrazol-4-yl)carbonyl]-N′-(5-propyl-1,3,4-thiadiazol-2-yl)thiourea
|
Sun, Yan-Rong |
|
2008 |
64 |
2 |
p. o413 |
artikel |
241 |
N-(2-Methylphenyl)-2-nitrobenzamide
|
Saeed, Aamer |
|
2008 |
64 |
2 |
p. o521 |
artikel |
242 |
N-(1-Naphthyl)acetoacetamide
|
Tai, Xi-Shi |
|
2008 |
64 |
2 |
p. o531 |
artikel |
243 |
N,N-Bis(diphenylphosphino)-1,2-dimethylpropylamine
|
Cloete, Nicoline |
|
2008 |
64 |
2 |
p. o480 |
artikel |
244 |
[μ-N,N′-Bis(3-methoxy-2-oxidobenzylidene)propane-1,3-diamine]trinitratocopper(II)terbium(III) acetone solvate
|
Fei, Liu |
|
2008 |
64 |
2 |
p. m406 |
artikel |
245 |
N,N′-Bis(8-quinolyl)pyridine-2,6-dicarboxamide
|
Meghdadi, Soraia |
|
2008 |
64 |
2 |
p. o431 |
artikel |
246 |
N,N′-{[Bis(trifluoromethyl)methylene]di-p-phenylene}diphthalimide
|
Li, Yitao |
|
2008 |
64 |
2 |
p. o388 |
artikel |
247 |
N,N-Dimethyl-4-[5-(5-methyl-1-phenyl-1H-pyrazol-4-yl)-1,3,4-oxadiazol-2-yl]aniline
|
Wang, Shu-Wen |
|
2008 |
64 |
2 |
p. o353 |
artikel |
248 |
Norbornane-exo-cis-2,3-diyl 1′,2′-phenylene orthocarbonate
|
Betz, Richard |
|
2008 |
64 |
2 |
p. o399 |
artikel |
249 |
6,7,8,9,10,11,12,13-Octahydro-5H-1,3-dithiole[4,5-b][1,4]dithiacyclotridecine-2-thione
|
Heshmatpour, Felora |
|
2008 |
64 |
2 |
p. o402 |
artikel |
250 |
(2,3,5,10,12,13,15,20-Octaphenylporphinato)copper(II) 1,1,2,2-tetrachloroethane solvate
|
Bhyrappa, Puttaiah |
|
2008 |
64 |
2 |
p. m330-m331 |
artikel |
251 |
μ-Oxido-bis[(chloroacetato-κO)triphenylantimony(V)]
|
Quan, Li |
|
2008 |
64 |
2 |
p. m349 |
artikel |
252 |
(μ-6-Oxido-4-oxo-1,2-dihydropyrimidine-5-carboxylato-κ4O5,O6:O2,N3)bis[aquabis(4-oxido-2-oxo-1,2-dihydropyrimidin-3-ium-5-carboxylato-κ2O4,O5)(1,10-phenanthroline-κ2N,N′)neodymium(III)] hexahydrate
|
Xing, Hui-Hui |
|
2008 |
64 |
2 |
p. m419-m420 |
artikel |
253 |
(6-Oxido-2-oxo-1,2-dihydropyrimidine-5-carboxylato-κ2O5,O6)(4-oxido-2-oxo-1,2-dihydropyrimidin-3-ium-5-carboxylato-κ2O4,O5)bis(1,10-phenanthroline-κ2N,N′)erbium(III) dihydrate
|
Xing, Hui-Hui |
|
2008 |
64 |
2 |
p. m418 |
artikel |
254 |
3,3′-(2-Oxocyclopentane-1,3-diyl)dipropanenitrile
|
Deng, Yi |
|
2008 |
64 |
2 |
p. o391 |
artikel |
255 |
1′-Phenyl-6′-thiacycloheptane-1-spiro-2′-perhydropyrrolizine-3′-spiro-3′′-indoline-2,2′′-dione
|
Sundaramoorthy, S. |
|
2008 |
64 |
2 |
p. o488 |
artikel |
256 |
Poly[aqua[μ-4-(4-chlorophenyl)-2-thioxo-2,3-dihydrothiazol-3-olato]sodium(I)]
|
Hartung, Jens |
|
2008 |
64 |
2 |
p. m299 |
artikel |
257 |
Poly[[μ2-aqua-tetraaquahexakis(μ4-naphthalene-2,6-dicarboxylato)tetraholmium(III)] 1.75-hydrate]
|
Almeida Paz, Filipe A. |
|
2008 |
64 |
2 |
p. m336-m337 |
artikel |
258 |
Poly[μ2-benzene-1,3-dicarboxylato-κ2O:O′-μ2-1,3-di-4-pyridylpropane-κ2N:N′-zinc(II)]
|
Huang, Jin-Feng |
|
2008 |
64 |
2 |
p. m386 |
artikel |
259 |
Poly[bis(acetone-κO)bis{μ3-1-[(5-chloro-2-oxidophenyl)diazenyl]-2-naphtholato-κ4O:O,O′:O′}sodium(I)chromium(III)]
|
Ito, Shinpei |
|
2008 |
64 |
2 |
p. m333-m334 |
artikel |
260 |
Poly[bis(2,2′-bipyridine-κ2N,N′)deca-μ-oxido-dioxidodicopper(II)tetravanadium(V)]
|
Zhang, Xiao |
|
2008 |
64 |
2 |
p. m287-m288 |
artikel |
261 |
Poly[[{μ3-1,2-bis[(3-cyanobenzylidene)hydrazono]-1,2-diphenylethane}silver(I)] hexafluoridoantimonate]
|
Liu, Lian-Dong |
|
2008 |
64 |
2 |
p. m363 |
artikel |
262 |
Poly[[diaqua-μ2-4,4′-bipyridyl-μ2-o-phthalato-nickel(II)] dihydrate]
|
Zhang, Xiao |
|
2008 |
64 |
2 |
p. m345-m346 |
artikel |
263 |
Poly[diaqua-μ4-oxalato-di-μ6-phosphato-tetracobalt(II)]
|
Wu, Wen-Yuan |
|
2008 |
64 |
2 |
p. m436 |
artikel |
264 |
Poly[[diaqua-μ4-tartrato-μ2-tartrato-dimanganese(II)] dihydrate]
|
Ge, Chunhua |
|
2008 |
64 |
2 |
p. m360 |
artikel |
265 |
Poly[hexaaquacopper(II) [di-μ3-sulfato-disodiate(I)]]
|
Wu, Wen |
|
2008 |
64 |
2 |
p. i7 |
artikel |
266 |
Poly[[hexa-μ-cyanido-manganese(II)iron(III)] pentahydrate]
|
Matsuda, Tomoyuki |
|
2008 |
64 |
2 |
p. i11-i12 |
artikel |
267 |
Poly[octaaquadi-μ-phosphato-trinickel(II)]. Corrigendum
|
Jin, Shouwen |
|
2008 |
64 |
2 |
p. e13 |
artikel |
268 |
Poly[piperazinediium [[aquabismuthate(III)]-di-μ-pyridine-2,6-dicarboxylato-bismuthate(III)-di-μ-pyridine-2,6-dicarboxylato] monohydrate]
|
Aghabozorg, Hossein |
|
2008 |
64 |
2 |
p. m374 |
artikel |
269 |
Poly[propane-1,3-diammonium [cuprate(II)-bis(μ2-pyridine-2,3-dicarboxylato)] trihydrate]
|
Aghabozorg, Hossein |
|
2008 |
64 |
2 |
p. m267-m268 |
artikel |
270 |
Poly[[tetraaquabis(1H-imidazole-κN3)bis[2-(oxaloamino)benzoato(3–)]dicopper(II)barium(II)] dihydrate]
|
Mei, Chongzhen |
|
2008 |
64 |
2 |
p. m356 |
artikel |
271 |
Poly[tetraaqua-μ3-pyridine-3,5-dicarboxylato-strontium(II)]
|
Aghabozorg, Hossein |
|
2008 |
64 |
2 |
p. m376 |
artikel |
272 |
Poly[triaqua-μ4-pyridine-3,5-dicarboxylato-barium(II)]
|
Aghabozorg, Hossein |
|
2008 |
64 |
2 |
p. m375 |
artikel |
273 |
μ-Pyrazine-2,5-dicarboxylato-bis[chlorido(η6-p-cymene)ruthenium(II)] tert-butanol disolvate
|
Sanchez Ballester, Noelia M. |
|
2008 |
64 |
2 |
p. m309-m310 |
artikel |
274 |
3-(2-Pyridyl)-N-p-tolylindolizin-1-amine
|
Jian, Fang-Fang |
|
2008 |
64 |
2 |
p. o386 |
artikel |
275 |
Racemic 1,2,3,4,7,8,9,10-octafluoro-6H,12H-5,11-methanodibenzo[b,f][1,5]diazocine: an octafluorinated analogue of Tröger's base
|
Vande Velde, Christophe M. L. |
|
2008 |
64 |
2 |
p. o538 |
artikel |
276 |
r-2,c-6-Bis(4-fluorophenyl)-t-3,t-5-dimethylpiperidin-4-one
|
Gayathri, D. |
|
2008 |
64 |
2 |
p. o429 |
artikel |
277 |
Redetermination at 113 K of 2,2-tetramethylene-1,2-dihydroquinazolin-4(3H)-one
|
Zhang, Lijun |
|
2008 |
64 |
2 |
p. o449 |
artikel |
278 |
Redetermination of 5-iodouracil
|
Portalone, Gustavo |
|
2008 |
64 |
2 |
p. o365 |
artikel |
279 |
(5R,8R)-2-(3,8-Dimethyl-2-oxo-1,2,4,5,6,7,8,8a-octahydroazulen-5-yl)acrylic acid (rupestonic acid)
|
Aisa, Haji Akber |
|
2008 |
64 |
2 |
p. o479 |
artikel |
280 |
(1R,2R,3R,4R,5S)-2,3-Bis[(2S′)-2-acetoxy-2-phenylacetoxy]-4-azido-1-[(2,4-dinitrophenyl)hydrazonomethyl]bicyclo[3.1.0]hexane
|
Li, Jing |
|
2008 |
64 |
2 |
p. o459-o460 |
artikel |
281 |
(S)-2-Amino-1-(pyrrolidinium-2-ylmethyl)pyridinium dibromide
|
Wang, Yifeng |
|
2008 |
64 |
2 |
p. o473 |
artikel |
282 |
(S)-1-Hydroxypropan-2-aminium (2R,3R)-3-carboxy-2,3-dihydroxypropanoate monohydrate
|
Tang, Xin-Yu |
|
2008 |
64 |
2 |
p. o422 |
artikel |
283 |
(S)-2-(3-Nitrophenyl)-1,2-dihydroquinazolin-4(3H)-one
|
Zhang, Lijun |
|
2008 |
64 |
2 |
p. o448 |
artikel |
284 |
(2S,4′R,5′R)-(E)-tert-Butyl 2-acetyl-2-(2-oxo-5-phenyl-1,3-dioxolan-4-ylmethyl)-5-phenylpent-4-enoate
|
Fox, David J. |
|
2008 |
64 |
2 |
p. o530 |
artikel |
285 |
{2-[(S)-({2-[(S)-1-Benzylpyrrolidine-2-carboxamido]phenyl}(phenyl)methylene)amino]-4-hydroxybutanoato-κ4N,N′,N′′,O}nickel(II)
|
Popkov, Alexander |
|
2008 |
64 |
2 |
p. m364-m365 |
artikel |
286 |
Structure Reports Online: major changes in response to a huge success
|
Clegg, William |
|
2008 |
64 |
2 |
p. e15-e17 |
artikel |
287 |
Terbium(III) hydrogendiphosphate(V) tetrahydrate
|
Fejfarová, Karla |
|
2008 |
64 |
2 |
p. i15 |
artikel |
288 |
Tetraaquabis(2-oxo-1,2-dihydroquinoline-4-carboxylato-κO4)nickel(II)
|
Yuan, Gang |
|
2008 |
64 |
2 |
p. m389-m390 |
artikel |
289 |
Tetraaquadiimidazolenickel(II) naphthalene-1,5-disulfonate
|
Liu, Ping |
|
2008 |
64 |
2 |
p. m275 |
artikel |
290 |
Tetra-μ-benzoato-bis[(quinoxaline)copper(II)]
|
Lee, Eun Yong |
|
2008 |
64 |
2 |
p. m286 |
artikel |
291 |
4,5,6,7-Tetrabromo-1,1,3-trimethyl-3-(2,3,4,5-tetrabromophenyl)indane
|
Konstantinov, Alex |
|
2008 |
64 |
2 |
p. o439 |
artikel |
292 |
1,2,3,4-Tetrahydroisoquinoline-2-sulfonamide
|
Bouasla, Radia |
|
2008 |
64 |
2 |
p. o432 |
artikel |
293 |
5,5′,7,7′-Tetramethoxy-2,2′-ethano-1,1′-spirobiindane
|
Hu, Wu-Xin |
|
2008 |
64 |
2 |
p. o455 |
artikel |
294 |
2,2′-[2,3,5,6-Tetramethyl-p-phenylenebis(methylenethio)]bis(pyridine N-oxide)
|
Ravindran Durai Nayagam, B. |
|
2008 |
64 |
2 |
p. o409 |
artikel |
295 |
6,10,16,19-Tetraoxatrispiro[4.2.2.4.2.2]nonadecane
|
Wang, Ji-Kui |
|
2008 |
64 |
2 |
p. o498 |
artikel |
296 |
(Tetraoxidoselenato-κO)tris(thiourea-κS)zinc(II)
|
Krupková, Radmila |
|
2008 |
64 |
2 |
p. m342-m343 |
artikel |
297 |
The dehydrated copper silicate Na2[Cu2Si4O11]: a three-dimensional microporous framework with a linear Si—O—Si linkage
|
Cunha-Silva, Luís |
|
2008 |
64 |
2 |
p. i13-i14 |
artikel |
298 |
The hydrochloride salt of l-ecgonine, a congener of cocaine
|
Wood, Matthew R. |
|
2008 |
64 |
2 |
p. o525 |
artikel |
299 |
Three-centre hydrogen bonds in triphenylphosphine oxide–hydroquinone (1/1)
|
Moreno-Fuquen, Rodolfo |
|
2008 |
64 |
2 |
p. o367 |
artikel |
300 |
trans-Bis(4-methoxythiophenolato-κS)bis(trimethylphosphine-κP)nickel(II)
|
Cao, Ruixia |
|
2008 |
64 |
2 |
p. m279 |
artikel |
301 |
trans-Carbonyl[dihydrobis(1,2,4-triazol-1-yl-κN2)borato]hydridobis(triphenylphosphine-κP)ruthenium(II) acetonitrile solvate
|
Huh, Seong |
|
2008 |
64 |
2 |
p. m290 |
artikel |
302 |
trans-(1,8-Dibenzyl-1,3,6,8,10,13-hexaazacyclotetradecane)diisonicotinatonickel(II)
|
Han, Jeong Hyeong |
|
2008 |
64 |
2 |
p. m366 |
artikel |
303 |
trans-4-Nitrophenyl 4-(tosyloxymethyl)cyclohexanecarboxylate
|
Qi, Qing-Rong |
|
2008 |
64 |
2 |
p. o385 |
artikel |
304 |
trans-Tetraaquabis(nicotinamide-κN)cadmium(II) biphenyl-4,4′-disulfonate
|
Li, Chunyuan |
|
2008 |
64 |
2 |
p. m424 |
artikel |
305 |
trans-Tetraaquabis[3-(3-pyridyl)acrylato-κN]cobalt(II)
|
Miklovič, Jozef |
|
2008 |
64 |
2 |
p. m426 |
artikel |
306 |
trans-4-(Tosyloxymethyl)cyclohexanecarboxylic acid
|
Qi, Qing-Rong |
|
2008 |
64 |
2 |
p. o405 |
artikel |
307 |
Triammonium hexahydroxidooctadecaoxidohexamolybdogallate(III) heptahydrate
|
Mensinger, Zachary L. |
|
2008 |
64 |
2 |
p. i8-i9 |
artikel |
308 |
Triaquabis(1H-imidazole)bis[μ2-2-(oxaloamino)benzoato(3−)]dicopper(II)calcium(II) heptahydrate
|
Mei, Chongzhen |
|
2008 |
64 |
2 |
p. m278 |
artikel |
309 |
Tricarbonylchlorido{N-[2-(diphenylphosphino)benzylidene]benzylamine-κ2N,P}rhenium(I) dichloromethane solvate
|
Monkowius, Uwe |
|
2008 |
64 |
2 |
p. m313 |
artikel |
310 |
1,3,5-Trichloro-2-methoxybenzene
|
Telu, Sanjay |
|
2008 |
64 |
2 |
p. o424 |
artikel |
311 |
2,2′-[1-(2,4,6-Trichlorophenyl)-1H-1,2,4-triazole-3,5-diyl]diphenol
|
Li, Zhong-Shu |
|
2008 |
64 |
2 |
p. o491 |
artikel |
312 |
Triclinic form of 1,2,4,5-tetracyclohexylbenzene
|
Mague, Joel T. |
|
2008 |
64 |
2 |
p. o376 |
artikel |
313 |
4-[3-(Trifluoromethyl)phenyl]-5,6,7,8-tetrahydrocinnolin-3(2H)-one
|
Wang, Xin |
|
2008 |
64 |
2 |
p. o464 |
artikel |
314 |
Tris[2-(benzyliminomethyl)phenolato-κ2N,O]iron(III)
|
Gong, Hai-Bin |
|
2008 |
64 |
2 |
p. m380 |
artikel |
315 |
Tris[6-(3,5-dimethyl-1H-pyrazol-1-yl)picolinato]gadolinium(III) methanol hemisolvate 2.5-hydrate
|
Kai, Zhao |
|
2008 |
64 |
2 |
p. m407 |
artikel |
316 |
Tris(ethane-1,2-diamine)copper(II) bis(trifluoroacetate)
|
Karpova, Elena V. |
|
2008 |
64 |
2 |
p. m373 |
artikel |
317 |
Tris(piperazinediium) bis[tris(pyridine-2,6-dicarboxylato)neodymate(III)] 15.33-hydrate
|
Derikvand, Zohreh |
|
2008 |
64 |
2 |
p. m350-m351 |
artikel |
318 |
Tris(propane-1,2-diamine-κ2N,N′)nickel(II) tetracyanidonickelate(II)
|
Kuchár, Juraj |
|
2008 |
64 |
2 |
p. m324-m325 |
artikel |
319 |
Urea–N,N-dimethylacetamide (1/1)
|
Fernandes, Philippe |
|
2008 |
64 |
2 |
p. o355 |
artikel |
320 |
(Z)-Ethyl 4-chloro-2-[(4-chlorophenyl)hydrazono]-3-oxobutanoate
|
Alpaslan, Gökhan |
|
2008 |
64 |
2 |
p. o428 |
artikel |
321 |
(Z)-5-(4-Fluorobenzylidene)-1,3-thiazolidine-2,4-dione
|
Sun, Hong-Shun |
|
2008 |
64 |
2 |
p. o524 |
artikel |
|