nr |
titel |
auteur |
tijdschrift |
jaar |
jaarg. |
afl. |
pagina('s) |
type |
1 |
4-Acetamidobenzenesulfonyl azide
|
Norris, Peter |
|
2006 |
62 |
5 |
p. o1751-o1753 |
artikel |
2 |
3-Acetyl-7-(diethylamino)coumarin
|
Hamaker, Christopher G. |
|
2006 |
62 |
5 |
p. o2072-o2074 |
artikel |
3 |
1-Acetyl-3-ethyl-r-2,c-6-di-2-furylpiperidin-4-one
|
Balamurugan, S. |
|
2006 |
62 |
5 |
p. o2005-o2006 |
artikel |
4 |
3-Acetyl-4-furyl-1-methylspiro[pyrrolidine-2,2′-indol]-2′(3′H)-one
|
Subbiahpandi, A. |
|
2006 |
62 |
5 |
p. o1964-o1965 |
artikel |
5 |
A 2:1 cocrystal of 2,3-bis(4-bromophenyl)quinoxaline and 1,2-bis(4-bromophenyl)ethane-1,2-diol
|
Rong, Liang-Ce |
|
2006 |
62 |
5 |
p. o1959-o1960 |
artikel |
6 |
A Cu–Mn complex of a Schiff base containing alanylglycine: hexaaquamanganese(II) bis{[N-(2-oxidobenzylidene)alanylglycinato]cuprate(II)} dodecahydrate
|
Liu, Wen-Long |
|
2006 |
62 |
5 |
p. m1109-m1111 |
artikel |
7 |
A dianionic 5-sulfonatosalicylate species in the proton-transfer compound bis(benzylaminium) 3-carboxylato-4-hydroxybenzenesulfonate
|
Smith, Graham |
|
2006 |
62 |
5 |
p. o1863-o1865 |
artikel |
8 |
9,9a-Diphenyl-1,3,4,6,7,9a-hexahydro-2H-pyrazino[1,2-a]pyrimidine at 130 K
|
White, Jonathan |
|
2006 |
62 |
5 |
p. o1846-o1848 |
artikel |
9 |
Ag(MoO2)(AsO4)
|
Zid, Mohamed Faouzi |
|
2006 |
62 |
5 |
p. i114-i116 |
artikel |
10 |
A hydrogen-bonded C(6) chain in glyoxal 3-nitrophenylhydrazone
|
Low, John N. |
|
2006 |
62 |
5 |
p. o1816-o1818 |
artikel |
11 |
(η3-Allyl)bromo(η5-cyclopentadienyl)(phenylaminodiphenylphosphine-κP)ruthenium(IV) hexafluorophosphate
|
Pavlik, Sonja |
|
2006 |
62 |
5 |
p. m1051-m1053 |
artikel |
12 |
4-Allyl-2-methoxy-5-nitrophenyl acetate
|
Carrasco-Altamirano, Hector |
|
2006 |
62 |
5 |
p. o1782-o1784 |
artikel |
13 |
(2-Amidoethyl-κ2C,O)trichloro(3-chloropropionamide-κO)stannane
|
Wardell, James L. |
|
2006 |
62 |
5 |
p. m971-m973 |
artikel |
14 |
2-Amino-1-(4-chlorobenzyl)pyridinium bis(1,2-dicyanoethene-1,2-dithiolato)nickelate(III)
|
Liu, Ming-Guo |
|
2006 |
62 |
5 |
p. m1114-m1116 |
artikel |
15 |
4-Amino-5-(4-chlorophenoxymethyl)-2-(2-cyanoethyl)-2H-1,2,4-triazole-3(4H)-thione monohydrate
|
He, Ting |
|
2006 |
62 |
5 |
p. o1928-o1929 |
artikel |
16 |
7-Amino-1,2,3,4-tetrahydroquinazoline-2,4-dithione
|
Yang, Kai-Bin |
|
2006 |
62 |
5 |
p. o1938-o1940 |
artikel |
17 |
A 1:1 molecular complex of dicyclohexylamine and cyclohexanone oxime
|
Chetina, Olga V. |
|
2006 |
62 |
5 |
p. o2053-o2055 |
artikel |
18 |
An ent-kaurane diterpenoid from Isodon japonica
|
He, Zhi-An |
|
2006 |
62 |
5 |
p. o2021-o2023 |
artikel |
19 |
A new polymorph of poly[tetraaquadi-μ3-malonato-dicadmium(II)]
|
Fu, Xu-Cheng |
|
2006 |
62 |
5 |
p. m959-m961 |
artikel |
20 |
An orthorhombic modification of 4,4′-diaminobenzophenone
|
Wen, Yi-Hang |
|
2006 |
62 |
5 |
p. o1787-o1788 |
artikel |
21 |
A photodimer of a 4-phenyl-4H-pyran
|
Yan, Hong |
|
2006 |
62 |
5 |
p. o1951-o1953 |
artikel |
22 |
Aquabis(2-formyl-6-methoxyphenolato)copper(II)
|
Zeng, Wen |
|
2006 |
62 |
5 |
p. m1074-m1076 |
artikel |
23 |
Aquabis(2-nitrobenzoato-κO)bis(pyridine-κN)copper(II)
|
Chi, Wei-Ping |
|
2006 |
62 |
5 |
p. m1134-m1135 |
artikel |
24 |
Aquadichloro(2,9-dimethyl-1,10-phenanthroline-κ2N,N′)nickel(II)
|
Ding, Cai-Feng |
|
2006 |
62 |
5 |
p. m1062-m1063 |
artikel |
25 |
Aqua(8-hydroxy-7-iodoquinoline-5-sulfonato-κ2N,O8)silver(I) dihydrate
|
Liu, Hai-Yan |
|
2006 |
62 |
5 |
p. m1036-m1037 |
artikel |
26 |
Aqua(l-aspartato-κ2N,O)(2,2′-bipyridine-κ2N,N)copper(II) pentahydrate
|
Shao, Min |
|
2006 |
62 |
5 |
p. m965-m967 |
artikel |
27 |
Azido{1-[2-(dimethylamino)ethyliminomethyl]naphthalenolato}copper(II)
|
Zhu, Qi-Yong |
|
2006 |
62 |
5 |
p. m983-m985 |
artikel |
28 |
Benzimidazolium 3,5-dihydroxybenzoate benzimidazole
|
Huang, Xuan |
|
2006 |
62 |
5 |
p. o1833-o1835 |
artikel |
29 |
1-[2-(1,3-Benzothiazol-2-ylimino)imidazolidin-1-yl]ethanone
|
Yıldırım, Sema Öztürk |
|
2006 |
62 |
5 |
p. o1870-o1871 |
artikel |
30 |
3-(1,3-Benzothiazol-2-yl)-2-naphthol
|
Huang, Zhi-Qiang |
|
2006 |
62 |
5 |
p. o2010-o2011 |
artikel |
31 |
4-Benzoylhydrazono-1,4-dihydroquinazoline monohydrate
|
Li, Xiu-Wen |
|
2006 |
62 |
5 |
p. o1789-o1790 |
artikel |
32 |
3-Benzoyl-4-hydroxy-2,4,6-triphenylcyclohexane-1,1-dicarbonitrile
|
Rong, Liang-Ce |
|
2006 |
62 |
5 |
p. o1766-o1767 |
artikel |
33 |
Benzyldiethylammonium chloride
|
Lorono-Gonzalez, Daniel |
|
2006 |
62 |
5 |
p. o1735-o1737 |
artikel |
34 |
Benzylideneacetophenone 2,4-dinitrophenylhydrazone
|
Qian, Heng-Yu |
|
2006 |
62 |
5 |
p. o2017-o2018 |
artikel |
35 |
4-Benzylidene-2-diethylamino-1-phenyl-1H-imidazol-5(4H)-one
|
Li, Gui-Hua |
|
2006 |
62 |
5 |
p. o1691-o1693 |
artikel |
36 |
3-Benzyl-6-isopropyl-5-methoxy-3H-1,2,3-triazolo[4,5-d]pyrimidin-7(6H)-one
|
Zeng, Xiao-Hua |
|
2006 |
62 |
5 |
p. o1888-o1890 |
artikel |
37 |
2-(Benzylsulfanyl)benzaldehyde azine
|
Oberts, Benjamin P. |
|
2006 |
62 |
5 |
p. o1780-o1781 |
artikel |
38 |
Bis(2-aminopyridine)dibenzoatocobalt(II)
|
Ju, Wen-Zheng |
|
2006 |
62 |
5 |
p. m1012-m1013 |
artikel |
39 |
Bis(2,2′-bipyridine){3,8-bis[2-(4-tolyl)ethynyl]-1,10-phenanthroline}ruthenium(II) bis(hexafluorophosphate)
|
Ito, Mitsuhiro |
|
2006 |
62 |
5 |
p. m980-m982 |
artikel |
40 |
Bis[bis(1-oxo-2-pyridyl)aminato]nickel(II) methanol solvate
|
Kuang, Han-Mao |
|
2006 |
62 |
5 |
p. m1132-m1133 |
artikel |
41 |
Bis(1-butyl-4-methylpyridinium) tetrachloropalladate(II)
|
Zawartka, Wojciech |
|
2006 |
62 |
5 |
p. m1100-m1102 |
artikel |
42 |
4,5-Bis(carboxymethylsulfanyl)-1,3-dithiole-2-thione monohydrate
|
Hu, Pu-Zhou |
|
2006 |
62 |
5 |
p. o2059-o2061 |
artikel |
43 |
Bis[2-(4-chlorophenyliminomethyl)phenolato]nickel(II)
|
Zhou, Congshan |
|
2006 |
62 |
5 |
p. m1066-m1068 |
artikel |
44 |
1,5-Bis(4-chlorophenyl)penta-1,4-dien-3-one
|
Butcher, Ray J. |
|
2006 |
62 |
5 |
p. o1973-o1975 |
artikel |
45 |
1,5-Bis(4-chlorophenyl)-3-(4-pyridyl)pentane-1,5-dione
|
Qiu, Xiao-Yang |
|
2006 |
62 |
5 |
p. o1826-o1827 |
artikel |
46 |
Bis[(18-crown-6)isothiocyanatolead(II)] tetrathiocyanatopalladate(II)
|
Kong, Ling-Qian |
|
2006 |
62 |
5 |
p. m1030-m1032 |
artikel |
47 |
Bis{1-[3-(cyclohexylamino)propyliminomethyl]naphth-2-olato}cobalt(II) tetrahydrate
|
You, Zhong-Lu |
|
2006 |
62 |
5 |
p. m1162-m1163 |
artikel |
48 |
Bis(cyclopentenylacetato)tetraethyldistannoxane dimer
|
Ahmad, Aftab |
|
2006 |
62 |
5 |
p. m1088-m1090 |
artikel |
49 |
Bis(cyclopentenylacetato)tetramethyldistannoxane dimer
|
Khan, Azim |
|
2006 |
62 |
5 |
p. m1167-m1169 |
artikel |
50 |
Bis[diamminesilver(I)] dioxalatoplatinate(II)
|
Wu, Guo-Qiang |
|
2006 |
62 |
5 |
p. m1144-m1146 |
artikel |
51 |
4,4′-Bis(2,6-dichlorobenzylideneamino)biphenyl
|
Hou, Zhen-Yu |
|
2006 |
62 |
5 |
p. o1901-o1902 |
artikel |
52 |
1,4-Bis(3,4-dicyanophenoxy)-2-butyne
|
Köysal, Yavuz |
|
2006 |
62 |
5 |
p. o1989-o1990 |
artikel |
53 |
Bis{2-[2-(diethylamino)ethyliminomethyl]-4-nitrophenolato}dimethanolzinc(II) dinitrate
|
Qiu, Xiao-Yang |
|
2006 |
62 |
5 |
p. m1091-m1093 |
artikel |
54 |
Bis{1-[3-(dimethylamino)propyliminomethyl]naphtholato}nickel(II) bis(perchlorate)
|
You, Zhong-Lu |
|
2006 |
62 |
5 |
p. m1097-m1099 |
artikel |
55 |
Bis[4-(dimethylamino)pyridinium] bis(1,2-dicyanoethene-1,2-dithiolato-κ2S,S′)cuprate(II)
|
Zhou, H. |
|
2006 |
62 |
5 |
p. m1119-m1121 |
artikel |
56 |
[1,3-Bis(diphenylphosphino)propane]tetracarbonylchromium(0)
|
Shawkataly, Omar bin |
|
2006 |
62 |
5 |
p. m1086-m1087 |
artikel |
57 |
Bis(2-formylphenolato-κ2O,O′)nickel(II)
|
Li, Yan-Guo |
|
2006 |
62 |
5 |
p. m1038-m1039 |
artikel |
58 |
1,4-Bis(1H-benzimidazol-2-ylmethyl)-1,4,7-triazacyclononane 4.5-hydrate
|
Li, Qing-Xiang |
|
2006 |
62 |
5 |
p. o1682-o1684 |
artikel |
59 |
4,5-Bis(hydroxymethyl)-1,3-dithiole-2-thione
|
Pløger, Jane M. |
|
2006 |
62 |
5 |
p. o2066-o2068 |
artikel |
60 |
Bis{4-[2-(2-hydroxyphenyl)ethyleneamino]phenyl} ether
|
Pınar, Şerife |
|
2006 |
62 |
5 |
p. o2056-o2058 |
artikel |
61 |
Bis(imidazol-1-yl)methane
|
Li, Jian |
|
2006 |
62 |
5 |
p. o1798-o1799 |
artikel |
62 |
2,6-Bis(4-methoxybenzylidene)cyclohexanone
|
Butcher, Ray J. |
|
2006 |
62 |
5 |
p. o1910-o1912 |
artikel |
63 |
Bis(2-methyl-1H-imidazole)silver(I) nitrate methanol solvate
|
Liu, Jin |
|
2006 |
62 |
5 |
p. m1173-m1174 |
artikel |
64 |
Bis(N-benzoylglycinato)diimidazolecobalt(II)
|
Lis, Tadeusz |
|
2006 |
62 |
5 |
p. m1006-m1008 |
artikel |
65 |
2-[4,5-Bis(n-pentylsulfanyl)-1,3-dithiol-2-ylidene]-1,3-dithiolo[4,5-c]pyrrole
|
Nielsen, Kent A. |
|
2006 |
62 |
5 |
p. o1702-o1703 |
artikel |
66 |
Bis[4-n-propyl-N-(8-quinolyl)benzenesulfonamidato-κ2N,N′]zinc(II) dimethylformamide solvate
|
Foro, Sabine |
|
2006 |
62 |
5 |
p. m999-m1001 |
artikel |
67 |
Bis(piperidinium) chloranilate
|
Refat, Moamen S. |
|
2006 |
62 |
5 |
p. o1886-o1887 |
artikel |
68 |
5,15-Bis(p-methylphenyl)-2,8,12,18-tetrabutyl-3,7,13,17-tetramethylporphyrin
|
Boyd, Peter D.W. |
|
2006 |
62 |
5 |
p. o2081-o2083 |
artikel |
69 |
Bis(propane-1,2-diammonium) hexaiodoplumbate(II) trihydrate
|
Billing, David G. |
|
2006 |
62 |
5 |
p. m1103-m1105 |
artikel |
70 |
Bis(tetrabutylammonium) isophthalate 1-phenyl-3-[2,4,5-tris(3-phenylureido)phenyl]urea: a synchrotron study
|
Light, Mark E |
|
2006 |
62 |
5 |
p. o1905-o1907 |
artikel |
71 |
[Bis(trimethylsilyl)methyl]chloro(phenyl)phosphine
|
Xi, Fang |
|
2006 |
62 |
5 |
p. o1944-o1945 |
artikel |
72 |
5-Bromo-2-(hydroxymethyl)pyridine
|
Wu, Ya-Ming |
|
2006 |
62 |
5 |
p. o2102-o2103 |
artikel |
73 |
16β-Bromo-17-hydroxypregn-4-ene-3,11,20-trione chloroform solvate
|
Wang, Jing-Kang |
|
2006 |
62 |
5 |
p. o1777-o1779 |
artikel |
74 |
4-Bromo-N-(3,4,5-trimethoxyphenyl)benzamide
|
Xue, Na |
|
2006 |
62 |
5 |
p. o2030-o2031 |
artikel |
75 |
1-(4-Bromophenyl)-3-(2,4-dichlorophenyl)prop-2-en-1-one
|
Patil, P. S. |
|
2006 |
62 |
5 |
p. o1710-o1712 |
artikel |
76 |
12-(4-Bromophenyl)-9,9-dimethyl-1,2,3,4,9,10-hexahydrobenz[a]acridin-11-one
|
Jia, Run-Hong |
|
2006 |
62 |
5 |
p. o2032-o2033 |
artikel |
77 |
9-[4-(6-Bromo-4-phenylnaphthalen-2-yl)phenyl]-9H-carbazole
|
Liu, Bo |
|
2006 |
62 |
5 |
p. o1814-o1815 |
artikel |
78 |
5-{[4-(4-Bromophenyl)thiazol-2-yl]aminomethylene}-2,2-dimethyl-1,3-dioxane-4,6-dione
|
Foro, Sabine |
|
2006 |
62 |
5 |
p. o1722-o1723 |
artikel |
79 |
6-Bromopyridine-2-carbaldehyde
|
Gu, Shao-Jin |
|
2006 |
62 |
5 |
p. o1715-o1716 |
artikel |
80 |
Butane-1,4-diammonium diiodide
|
Lemmerer, Andreas |
|
2006 |
62 |
5 |
p. o1954-o1956 |
artikel |
81 |
Caesium zirconium uranium pentatelluride, CsZrUTe5
|
Kim, Jong-Young |
|
2006 |
62 |
5 |
p. i124-i125 |
artikel |
82 |
Carbonyl(cyclohexyldiphenylphosphine)(8-hydroxyquinolinato)rhodium(I)
|
Janse van Rensburg, J. Marthinus |
|
2006 |
62 |
5 |
p. m1040-m1042 |
artikel |
83 |
catena-Poly[[aquachlorodimethylformamidecopper(II)]-μ-chloro]
|
Feng, Yun-Long |
|
2006 |
62 |
5 |
p. m962-m964 |
artikel |
84 |
catena-Poly[[(di-2-pyridylamine-κ2N,N′)copper(II)]-μ-benzene-1,4-dicarboxylato-κ4O,O′:O′′,O′′′]
|
Zheng, Yi |
|
2006 |
62 |
5 |
p. m1079-m1080 |
artikel |
85 |
catena-Poly[[(2,2′-diquinolyl)zinc(II)]-μ-terephthalato]
|
Ao, Wen-Jiang |
|
2006 |
62 |
5 |
p. m1048-m1050 |
artikel |
86 |
3-(4-Chloroanilino)isobenzofuran-1(3H)-one
|
Büyükgüngör, Orhan |
|
2006 |
62 |
5 |
p. o2003-o2004 |
artikel |
87 |
1-(3-Chlorobenzoyl)-3-(2,6-dichlorophenyl)thiourea
|
Khawar Rauf, M. |
|
2006 |
62 |
5 |
p. o1849-o1850 |
artikel |
88 |
1-(3-Chlorobenzoyl)-3-phenylthiourea
|
Khawar Rauf, M. |
|
2006 |
62 |
5 |
p. o1859-o1860 |
artikel |
89 |
Chlorobis(η5-cyclopentadienyl)[N-(2,6-diisopropylphenyl)-N-(1-phenylvinyl)amide]zirconium(IV)
|
Arnold, John |
|
2006 |
62 |
5 |
p. m950-m951 |
artikel |
90 |
Chlorobis(1,10-phenanthroline-κ2N,N′)copper(II) dicyanamide
|
Dušek, Michal |
|
2006 |
62 |
5 |
p. m1009-m1011 |
artikel |
91 |
μ-Chloro-μ-diphenylphosphido-μ-hydrido-bis[(η6-hexamethylbenzene)ruthenium(II)] tetrafluoroborate
|
Tschan, Mathieu Jean-Luc |
|
2006 |
62 |
5 |
p. m954-m956 |
artikel |
92 |
4-(2-Chloro-4-nitrophenoxy)-N-[2-(4,6-dimethoxypyrimidin-2-yloxy)benzyl]aniline
|
Chen, Zheng-Bo |
|
2006 |
62 |
5 |
p. o1671-o1672 |
artikel |
93 |
1-Chloro-4-octyloxy-10-thiaanthracen-9-one
|
Ji, Xiao-Juan |
|
2006 |
62 |
5 |
p. o1891-o1892 |
artikel |
94 |
1-(4-Chlorophenyl)-6,7-dimethoxyisochroman
|
Saeed, Aamer |
|
2006 |
62 |
5 |
p. o1819-o1821 |
artikel |
95 |
6-(4-Chlorophenyl)imidazo[2,1-b][1,3,4]thiadiazole-2-sulfonamide
|
Anilkumar, G. N. |
|
2006 |
62 |
5 |
p. o2014-o2016 |
artikel |
96 |
2-(4-Chlorophenyl)-5-methyl-1H-pyrazol-3(2H)-one
|
Duan, Xue-Min |
|
2006 |
62 |
5 |
p. o2019-o2020 |
artikel |
97 |
2-(4-Chlorophenyl)-N-{3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl}-3-methylbutanamide ethanol solvate
|
Cheng, Jing-Li |
|
2006 |
62 |
5 |
p. o1836-o1838 |
artikel |
98 |
Chloro(triphenylphosphine)(tropolonato)palladium(II)
|
Steyl, Gideon |
|
2006 |
62 |
5 |
p. m974-m976 |
artikel |
99 |
cis-[Bis(diphenylphosphino)ethane-κ2P,P′]dichlororuthenium(II) dichloromethane disolvate
|
Russo, Luca |
|
2006 |
62 |
5 |
p. m1154-m1155 |
artikel |
100 |
5-cis-Bromo-2,2,6,6-tetramethyltetrahydropyran-3-carboxylic acid
|
Hartung, Jens |
|
2006 |
62 |
5 |
p. o1918-o1919 |
artikel |
101 |
cis-5-Bromo-2,2,6-trimethyl-trans-6-phenyltetrahydropyran-3-carboxylic acid
|
Hartung, Jens |
|
2006 |
62 |
5 |
p. o1920-o1922 |
artikel |
102 |
3,10-C-meso-2,5,5,7,9,12,12,14-Octamethyl-1,8-diaza-4,11-diazoniacyclotetradecane bis(thiocyanate)
|
Benson, Ronald E. |
|
2006 |
62 |
5 |
p. o1968-o1970 |
artikel |
103 |
5-(2-Cyanoethylsulfanyl)-4-methylsulfanyl-1,3-dithiole-2-thione
|
Madsen, Anders |
|
2006 |
62 |
5 |
p. o1669-o1670 |
artikel |
104 |
cyclo{[(6-Amino-6-deoxy-2,3:4,5-di-O-isopropylidene-d-galactonic acid)-(d-Phe)]2}
|
Bream, Richard |
|
2006 |
62 |
5 |
p. o1851-o1853 |
artikel |
105 |
2-(Cyclohexa-1,4-dienyl)acetic acid
|
Therrien, Bruno |
|
2006 |
62 |
5 |
p. o1877-o1878 |
artikel |
106 |
9,10-Dehydrodeoxyartemisinin
|
Li, Shu-Hui |
|
2006 |
62 |
5 |
p. o1898-o1900 |
artikel |
107 |
2,7-Diacetylxanthene
|
Wu, Li |
|
2006 |
62 |
5 |
p. o1770-o1771 |
artikel |
108 |
Diaquabis(1,10-phenanthroline-κ2N,N′)manganese(II) pentafluorooxoniobate(V)
|
Zhu, Gang |
|
2006 |
62 |
5 |
p. m1018-m1020 |
artikel |
109 |
Diaquabis(pyridine-2,3-dicarboxylato)copper(II)
|
Xiang, Jiang-Feng |
|
2006 |
62 |
5 |
p. m1122-m1123 |
artikel |
110 |
Diaquasulfato(2,4,6-tri-2-pyridyl-1,3,5-triazine)nickel(II) dihydrate
|
Baggio, Sergio |
|
2006 |
62 |
5 |
p. m986-m988 |
artikel |
111 |
1,9-Diazahexacyclo[17.6.1.13,7.19,16.010,15.020,25]hexacosa-3,5,7(26),10(15),11,13,16(27),17,19(28),20(25),21,23-dodecaene
|
Kumar, G. Senthil |
|
2006 |
62 |
5 |
p. o1809-o1811 |
artikel |
112 |
2-(Dibenzoylamino)pyridine
|
Weng, Yan-Bo |
|
2006 |
62 |
5 |
p. o1868-o1869 |
artikel |
113 |
4,4′-Dibenzyl-5,5′-(pyridine-2,6-diyl)bis(3,4-dihydro-2H-1,2,4-triazole-3-thione)
|
Demir, Sibel |
|
2006 |
62 |
5 |
p. o1822-o1823 |
artikel |
114 |
6,9-Dibromo-2a,10b-diphenyl-2a,5,10,10b-tetrahydro-2H,3H-2,3,4a,10a-tetraazabenzo[g]cyclopenta[cd]azulene-1,4-dione monohydrate
|
She, Neng-Fang |
|
2006 |
62 |
5 |
p. o1754-o1755 |
artikel |
115 |
{2,4-Dibromo-6-[2-(dimethylamino)ethyliminomethyl]phenolato}thiocyanatonickel(II)
|
Sun, Xin-Zhi |
|
2006 |
62 |
5 |
p. m1130-m1131 |
artikel |
116 |
3,6-Dibromo-9-(4-tolylsulfonyl)-9H-carbazole
|
Xu, Xiao-Dong |
|
2006 |
62 |
5 |
p. o1805-o1806 |
artikel |
117 |
Di-μ2-chloro-1:2κ2Cl,3:4κ2Cl-chloro-4κCl-(6-chloropyridine-3-carboxylato-1κ2O,O′)octamethyl-1κ2C,2κ2C,3κ2C,4κ2C-di-μ3-oxo-1:2:3κ3O,2:3:4κ3O-tetratin(IV) diethyl ether solvate
|
Li, Fa-Hui |
|
2006 |
62 |
5 |
p. m1117-m1118 |
artikel |
118 |
Dichloro{2-[2-(ethylamino)ethyliminomethyl]phenolato}zinc(II)
|
Yang, Tao |
|
2006 |
62 |
5 |
p. m1147-m1149 |
artikel |
119 |
1-(2,4-Dichlorophenyl)-3-(4-methoxyphenyl)prop-2-en-1-one
|
Patil, P. S. |
|
2006 |
62 |
5 |
p. o1707-o1709 |
artikel |
120 |
3-[5-(2,4-Dichlorophenyl)-1,3,4-thiadiazol-2-yl]-2-phenylthiazolidin-4-one
|
Wu, Feng |
|
2006 |
62 |
5 |
p. o1930-o1931 |
artikel |
121 |
Diethyl 3,3′-(cis-[4a]-cisoid-[4a,4b]-cis-[4b]-9,11-dimethyl-2,4,6,8-tetraoxoperhydrocyclobuta[1,2-d:3,4-d]dipyrimidine-1,5-diyl)dipropionate
|
Tang, Wen-Jian |
|
2006 |
62 |
5 |
p. o1759-o1761 |
artikel |
122 |
Diethyl naphthalene-1,8-dicarboxylate
|
Jing, Lin-Hai |
|
2006 |
62 |
5 |
p. o1934-o1935 |
artikel |
123 |
4-Difluoromethyl-1-(2,5-dimethoxyphenyl)-1H-1,2,3-triazole
|
Costa, Marilia S. |
|
2006 |
62 |
5 |
p. o2048-o2050 |
artikel |
124 |
4-Difluoromethyl-1-(4-methylphenyl)-1H-1,2,3-triazole
|
Costa, Marilia S. |
|
2006 |
62 |
5 |
p. o1925-o1927 |
artikel |
125 |
2,3-Dihydro-1,5-benzothiazepin-4(5H)-one
|
Qin, Bing-Yi |
|
2006 |
62 |
5 |
p. o1831-o1832 |
artikel |
126 |
2,6-Diisopropyl-2,3,6,7-tetrahydro-2,3a,4a,6,7a,8a-hexaaza-1H,5H-cyclopenta[def]fluorene-4,8-dione
|
Qin, Shu-Qi |
|
2006 |
62 |
5 |
p. o1812-o1813 |
artikel |
127 |
Di-μ2-methanolato-bis[tetrakis(pyrimidin-2-amine-κN1)cobalt(II)] bis(tetrafluoroborate)
|
Li, Yang |
|
2006 |
62 |
5 |
p. m1159-m1161 |
artikel |
128 |
3,5-Dimethoxybenzohydrazide
|
Liu, Hui-Yan |
|
2006 |
62 |
5 |
p. o1976-o1977 |
artikel |
129 |
{6,6′-Dimethoxy-2,2′-[ethane-1,2-diylbis(nitrilomethylidyne)]diphenolato}nickel(II) chloroform solvate
|
Yu, Yu-Ye |
|
2006 |
62 |
5 |
p. m948-m949 |
artikel |
130 |
[4-(Dimethylamino)pyridine-κN]bis(pentane-2,4-dionato-κ2O,O′)copper(II)
|
Lindoy, Leonard F. |
|
2006 |
62 |
5 |
p. m1142-m1143 |
artikel |
131 |
Dimethylbis(4-methylpiperidine-1-dithiocarboxylato-κ2S,S′)tin(IV)
|
Shahzadi, Saira |
|
2006 |
62 |
5 |
p. m1178-m1180 |
artikel |
132 |
2,2′-Dimethyl-3,3′-bis(methylsulfanyl)-5,5′-bis(1-benzofuran)
|
Choi, Hong Dae |
|
2006 |
62 |
5 |
p. o2092-o2094 |
artikel |
133 |
2,9-Dimethyl-3,8-bis(methylsulfanyl)naphtho[2,1-b:3,4-b′]difuran
|
Choi, Hong Dae |
|
2006 |
62 |
5 |
p. o1785-o1786 |
artikel |
134 |
Dimethyl 3,6-dioxatetracyclo[6.1.0.02,4.05,7]nonane-2,9-dicarboxylate
|
Hökelek, Tuncer |
|
2006 |
62 |
5 |
p. o1991-o1993 |
artikel |
135 |
1,1′-(2,5-Dimethyl-1,4-phenylenemethylene)di-1H-imidazole dihydrate
|
Wang, Wen-Hua |
|
2006 |
62 |
5 |
p. o1733-o1734 |
artikel |
136 |
4-(1,1-Dimethylprop-2-enyl)-1,3,5,6-tetrahydroxy-2-(3-methylbut-2-enyl)-9H-xanthen-9-one monohydrate
|
Boonnak, Nawong |
|
2006 |
62 |
5 |
p. o2034-o2036 |
artikel |
137 |
3,3-Dimethylpyrrolidine-2,4-dione
|
Hamzah, A. Sazali |
|
2006 |
62 |
5 |
p. o1795-o1797 |
artikel |
138 |
2-{4-[2-(2,5-Dimethyl-3-thienyl)-3,3,4,4,5,5-hexafluorocyclopent-1-enyl]-5-methyl-2-thienylmethylene}propanedinitrile: a new photochromic diarylethene compound
|
Pu, Shou-Zhi |
|
2006 |
62 |
5 |
p. o2007-o2009 |
artikel |
139 |
Dimethyl 3t,4t-dicarboxytetrahydrofuran-2r,5c-dicarboxylate
|
Villiers, Claude |
|
2006 |
62 |
5 |
p. o1724-o1726 |
artikel |
140 |
1,5-Dimethy-4-[(2-nitrobenzylidene)amino]-2-phenyl-1H-pyrazol-3(4H)-one
|
Li, Zong-Xiao |
|
2006 |
62 |
5 |
p. o1738-o1739 |
artikel |
141 |
10,10′-Dinitro-10,10′-(propane-1,3-diyl)di-10H-anthracen-9-one
|
Arslan, Mustafa |
|
2006 |
62 |
5 |
p. o2037-o2039 |
artikel |
142 |
Diphenylcarbonohydrazide–phenylsemicarbazide (1/1)
|
Wei, Chun-Xia |
|
2006 |
62 |
5 |
p. o1719-o1721 |
artikel |
143 |
Diphenyl (hydroxyphenylmethyl)phosphonate
|
Fang, Mei-Juan |
|
2006 |
62 |
5 |
p. o1998-o1999 |
artikel |
144 |
Diphenyl naphthalene-1,4-dicarboxylate
|
Gu, Shao-Jin |
|
2006 |
62 |
5 |
p. o1717-o1718 |
artikel |
145 |
Dipropiodurene
|
Pinkus, A. G. |
|
2006 |
62 |
5 |
p. o1854-o1855 |
artikel |
146 |
2,3-Di-p-toluoyl-(2R,3R)-tartaric acid ethyl acetate solvate
|
Tang, Li-Da |
|
2006 |
62 |
5 |
p. o1685-o1686 |
artikel |
147 |
Di-μ-pyridyl-1:2κ2N:C2;2:1κ2N:C2-μ-tetrahydrofuran-κ2O:O-bis[bromo(tetrahydrofuran)magnesium(II)] tetrahydrofuran hemisolvate
|
Churakov, Andrei V. |
|
2006 |
62 |
5 |
p. m1094-m1096 |
artikel |
148 |
3,8-Di-tert-butyl-2,2,9,9-tetramethyldeca-3,7-diene
|
Hänel, Ralf |
|
2006 |
62 |
5 |
p. o2095-o2096 |
artikel |
149 |
1d-1,2,5,6-Tetra-O-methyl-3,4-di-O-phosphinoyl-chiro-inositol 2.5-hydrate
|
Lensink, Cornelis |
|
2006 |
62 |
5 |
p. o2099-o2101 |
artikel |
150 |
(E)-2-Bromo-4,5-dimethoxybenzaldehyde oxime
|
Li, Xiang |
|
2006 |
62 |
5 |
p. o1946-o1947 |
artikel |
151 |
(E)-5-[(3-Chlorophenyl)diazenyl]-2-hydroxy-3-methoxybenzaldehyde
|
Karadayı, Nevzat |
|
2006 |
62 |
5 |
p. o1699-o1701 |
artikel |
152 |
3-[(E)-2-Chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethyl-N-(3-pyridyl)cyclopropanecarboxamide acetone hemisolvate
|
Liu, Dong-Qing |
|
2006 |
62 |
5 |
p. o1747-o1748 |
artikel |
153 |
(E,E)-N,N′-Bis(1-phenylethylidene)ethylenediamine
|
Benson, Ronald E. |
|
2006 |
62 |
5 |
p. o1971-o1972 |
artikel |
154 |
(E)-4,4′-Ethylenedipyridinium bis{[(5-fluoro-2,4-dioxo-1,2,3,4-tetrahydropyrimidin-4-yl)acetamido]acetate} dihydrate
|
Hu, Mao-Lin |
|
2006 |
62 |
5 |
p. o1696-o1698 |
artikel |
155 |
(E)-3-Ferrocenyl-1-(4-tolylphenyl)prop-2-en-1-one
|
Mao, Xin-Biao |
|
2006 |
62 |
5 |
p. m968-m970 |
artikel |
156 |
(E)-2-Hydroxy-3-methoxy-5-[(3-methoxyphenyl)diazenyl]benzaldehyde
|
Albayrak, Çiğdem |
|
2006 |
62 |
5 |
p. o1727-o1729 |
artikel |
157 |
2-[(E)-2-(3-Hydroxy-4-methoxyphenyl)ethenyl]-1-methylquinolinium 4-chlorobenzenesulfonate
|
Jindawong, Boonwasana |
|
2006 |
62 |
5 |
p. o1802-o1804 |
artikel |
158 |
(E)-3-(3-Phenylpropoxy)but-2-enoic acid
|
Li, Jing |
|
2006 |
62 |
5 |
p. o1994-o1995 |
artikel |
159 |
Ethyl 5-amino-1-(5-amino-3-methyl-1-phenyl-1H-pyrazol-4-ylcarbonyl)-3-methyl-1H-pyrazole-4-carboxylate
|
Li, Jun-Fei |
|
2006 |
62 |
5 |
p. o1756-o1758 |
artikel |
160 |
Ethyl 1-[5-amino-1-tert-butyl-3-(methylsulfanyl)-1H-pyrazole-4-carbonyl]-5-methyl-3-(methylsulfanyl)-1H-pyrazole-4-carboxylate
|
Li, Jun-Fei |
|
2006 |
62 |
5 |
p. o1679-o1681 |
artikel |
161 |
Ethylammonium saccharinate
|
Wei, Lin-Heng |
|
2006 |
62 |
5 |
p. o1800-o1801 |
artikel |
162 |
Ethyl 2-{1,3-bis[(6-chloro-3-pyridyl)methyl]imidazolidin-2-ylidene}-2-cyanoacetate ethanol solvate
|
Tian, Man-Man |
|
2006 |
62 |
5 |
p. o1866-o1867 |
artikel |
163 |
Ethylenediammonium tetraaquabis(pyridine-3,5-dicarboxylato-κN)cuprate(II) dihydrate
|
Toscano, Ruben A. |
|
2006 |
62 |
5 |
p. m1027-m1029 |
artikel |
164 |
2,2′-[(Ethylenedioxy)bis(ethyleneoxy)]bis[N-(2-pyridyl)benzamide]
|
Wang, Wen-Hua |
|
2006 |
62 |
5 |
p. o1768-o1769 |
artikel |
165 |
1-Ethyl-3-(4-hydroxy-3-methoxyphenyl)-6-methoxy-2-methylindan-5-ol
|
Alvarez-Thon, Luis |
|
2006 |
62 |
5 |
p. o2000-o2002 |
artikel |
166 |
4-Ethyl-4-hydroxy-2-phenyl-5,6-dihydro-4H-1,3-thiazine
|
Ebihara, Masahiro |
|
2006 |
62 |
5 |
p. o1666-o1668 |
artikel |
167 |
3-Ethylpentan-3-ol
|
Bond, Andrew D. |
|
2006 |
62 |
5 |
p. o2064-o2065 |
artikel |
168 |
Eudesma-5,12-dien-13-oic acid from Laggera pterodonta
|
Xu, Ying-Qian |
|
2006 |
62 |
5 |
p. o1844-o1845 |
artikel |
169 |
5-(4-Fluorobenzylamino)-3,6-diphenyl-2-thioxo-2,3-dihydro-1,3-thiazolo[4,5-d]pyrimidin-7(6H)-one
|
Zhang, Qian |
|
2006 |
62 |
5 |
p. o2062-o2063 |
artikel |
170 |
2′-[2-(4-Fluorophenyl)chroman-4-ylidene]isonicotinohydrazide
|
Nie, Aihua |
|
2006 |
62 |
5 |
p. o1824-o1825 |
artikel |
171 |
11-(4-Fluorophenyl)-7,11-dihydrobenzo[f]furo[3,4-b]quinolin-10(8H)-one
|
Tu, Shu-Jiang |
|
2006 |
62 |
5 |
p. o1872-o1873 |
artikel |
172 |
1-(1H-Benzimidazol-2-yl)ethanone
|
Yang, Xiao-Yan |
|
2006 |
62 |
5 |
p. o1936-o1937 |
artikel |
173 |
{2-[2-(1H-1,3-Benzimidazol-2-yl)ethyliminomethyl]-4-chlorophenolato}thiocyanatocopper(II) monohydrate
|
Zhao, Jun |
|
2006 |
62 |
5 |
p. m977-m979 |
artikel |
174 |
Hemi{tris(picolinic acid-κ2N,O)iron(II)/tris(picolinato-κ2N,O)iron(II)} hemi(tetrafluoroborate)
|
Onggo, Djulia |
|
2006 |
62 |
5 |
p. m1112-m1113 |
artikel |
175 |
Hexaaquamanganese(II) bis[2-(carboxylatomethylsulfanyl)pyridine N-oxide]
|
Jebas, Samuel Robinson |
|
2006 |
62 |
5 |
p. m1069-m1070 |
artikel |
176 |
Hexakis(N,N-dimethylformamide-κO)magnesium tetrachloromagnesate
|
Barker, Bobby L. |
|
2006 |
62 |
5 |
p. m942-m944 |
artikel |
177 |
3-(4-Hexyloxyphenyl)isobenzofuran-1(3H)-one
|
Vijayan, M. |
|
2006 |
62 |
5 |
p. o1941-o1943 |
artikel |
178 |
Hydrochlorothiazide N,N-dimethylformamide solvate
|
Johnston, Andrea |
|
2006 |
62 |
5 |
p. o1730-o1732 |
artikel |
179 |
3-(4-Hydroxyanilino)isobenzofuran-1(3H)-one
|
Odabaşoğlu, Mustafa |
|
2006 |
62 |
5 |
p. o1879-o1881 |
artikel |
180 |
14-Hydroxy-14-hydroxymethyl-5,5,9-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane hemihydrate
|
Chantrapromma, Suchada |
|
2006 |
62 |
5 |
p. o1742-o1744 |
artikel |
181 |
2-Hydroxy-3-methoxybenzaldehyde (pyridinium-4-ylcarbonyl)hydrazone chloride hemihydrate
|
Chen, Shao-Wen |
|
2006 |
62 |
5 |
p. o2043-o2044 |
artikel |
182 |
(2-Hydroxy-5-methylphenyl)(4-methylphenyl)methanone
|
Naveen, S. |
|
2006 |
62 |
5 |
p. o1664-o1665 |
artikel |
183 |
2-Hydroxy-N-(2-pyridyl)benzamide
|
Wang, Wen-Hua |
|
2006 |
62 |
5 |
p. o1772-o1773 |
artikel |
184 |
1-(2-Hydroxyphenyl)octan-1-one
|
Bin, Xu |
|
2006 |
62 |
5 |
p. o1793-o1794 |
artikel |
185 |
2-Hydroxy-2′,4,4′-trimethoxybenzophenone
|
Qiu, Lin |
|
2006 |
62 |
5 |
p. o1980-o1981 |
artikel |
186 |
Inversion parameter of the CoGa2O4 spinel determined from single-crystal X-ray data
|
Ikeda, Yuya |
|
2006 |
62 |
5 |
p. i109-i111 |
artikel |
187 |
Isoguanine dihydrochloride dihydrate
|
Bats, Jan W. |
|
2006 |
62 |
5 |
p. o2040-o2042 |
artikel |
188 |
l-Histidinium trichloroacetate
|
Kumar, G. Ramesh |
|
2006 |
62 |
5 |
p. o1704-o1706 |
artikel |
189 |
3-(2-Methoxyanilino)isobenzofuran-1(3H)-one
|
Odabaşoğlu, Mustafa |
|
2006 |
62 |
5 |
p. o1884-o1885 |
artikel |
190 |
3-(4-Methoxyanilino)isobenzofuran-1(3H)-one
|
Odabaşoğlu, Mustafa |
|
2006 |
62 |
5 |
p. o1882-o1883 |
artikel |
191 |
2-[3-(4-Methoxybenzoyl)thioureido]-3-methylbutyric acid
|
Ngah, Nurziana |
|
2006 |
62 |
5 |
p. o1903-o1904 |
artikel |
192 |
4-Methoxy-3-methylbenzophenone
|
Vijay, T. |
|
2006 |
62 |
5 |
p. o1749-o1750 |
artikel |
193 |
[3-Methoxy-2-oxidobenzaldehyde (2-thienylcarbonyl)hydrazonato]dimethyltin(IV)
|
Chen, Shao-Wen |
|
2006 |
62 |
5 |
p. m1024-m1026 |
artikel |
194 |
4-Methoxy-7-phenyl-6,7-dihydrofuro[3,2-g]chromen-5-one
|
Chantrapromma, Suchada |
|
2006 |
62 |
5 |
p. o1984-o1986 |
artikel |
195 |
Methyl 12-benzoyldehydroabietate
|
Li, Fang-Yao |
|
2006 |
62 |
5 |
p. o1895-o1897 |
artikel |
196 |
Methyl 3-[4,6-bis(diphenylphosphino)phenoxazin-10-yl]propionate
|
Ricken, Stefan |
|
2006 |
62 |
5 |
p. o1807-o1808 |
artikel |
197 |
Methyl (E,E)-{2-[({[1,3-dimethyl-5-(2-fluorophenoxy)-1H-pyrazol-4-ylmethylene]amino}oxy)methyl]phenyl}-2-(methoxyimino)acetate
|
Li, Yan |
|
2006 |
62 |
5 |
p. o2027-o2029 |
artikel |
198 |
3,4-Methylenedioxybenzoic acid
|
Li, Jiang-Tao |
|
2006 |
62 |
5 |
p. o1893-o1894 |
artikel |
199 |
Methyl 2-{[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methoxy}phenylacetate
|
Wang, Hai-Bo |
|
2006 |
62 |
5 |
p. o1839-o1840 |
artikel |
200 |
Methyl 3-(4-methylbenzylidene)dithiocarbazate
|
Shan, Shang |
|
2006 |
62 |
5 |
p. o2051-o2052 |
artikel |
201 |
Methyl (2S)-2-[2-(5-fluoro-2,4-dioxo-1,2,3,4-tetrahydropyrimidin-1-yl)acetamido]propionate monohydrate
|
Yin, Ping |
|
2006 |
62 |
5 |
p. o1745-o1746 |
artikel |
202 |
(Morpholine-1-dithiocarboxylato-κ2S,S′)bis(piperidine-1-dithiocarboxylato-κ2S,S′)bismuth(III)
|
Li, Feng |
|
2006 |
62 |
5 |
p. m1083-m1085 |
artikel |
203 |
Morpholinium hydrogensulfate
|
Yin, Cai-Xia |
|
2006 |
62 |
5 |
p. o2084-o2085 |
artikel |
204 |
N-(2-Acetylphenyl)acetamide
|
Slater, Heather L. |
|
2006 |
62 |
5 |
p. o1957-o1958 |
artikel |
205 |
2-(1-Naphthyliminomethyl)phenol
|
Cheng, Kui |
|
2006 |
62 |
5 |
p. o1932-o1933 |
artikel |
206 |
N-(3-Benzyloxy-5-methylpyrazin-2-yl)-2-chlorobenzenesulfonamide
|
Yang, Xing |
|
2006 |
62 |
5 |
p. o1713-o1714 |
artikel |
207 |
N-(4-Bromobenzyl)-4-cyanopyridinium bis(2-thioxo-1,3-dithiole-4,5-dithiolato)nickelate(III) acetone solvate
|
Su, Yang |
|
2006 |
62 |
5 |
p. m1004-m1005 |
artikel |
208 |
N-(4-Chloro-3-nitrophenyl)-N′-(3-nitrobenzoyl)thiourea
|
Yusof, M. Sukeri M. |
|
2006 |
62 |
5 |
p. o1740-o1741 |
artikel |
209 |
N,6-Dimethyl-4-(methylsulfanyl)-3-nitro-4H-chromen-2-amine
|
Gayathri, D. |
|
2006 |
62 |
5 |
p. o1961-o1963 |
artikel |
210 |
N-{[3′-Formyl-2,2′-bis(methoxymethoxy)biphenyl-3-yl]methyl}formamide
|
Gao, Yu-Xing |
|
2006 |
62 |
5 |
p. o1687-o1688 |
artikel |
211 |
N′-(2-Hydroxybenzoyl)-2-oxo-2H-chromene-3-carbohydrazide
|
Lin, Shu-Kun |
|
2006 |
62 |
5 |
p. o2097-o2098 |
artikel |
212 |
2-Nitrophenylacetic acid: hydrogen-bonded sheets of R22(8) and R44(18) rings
|
Wardell, James L. |
|
2006 |
62 |
5 |
p. o1915-o1917 |
artikel |
213 |
1-(3-Nitrophenyl)-5-tosylperhydropyrrolo[3,4-b]pyrrole
|
Gayathri, D. |
|
2006 |
62 |
5 |
p. o2045-o2047 |
artikel |
214 |
N-Methyl-N-cis-styrylcinnamamide monohydrate, a compound of Clausenaminade from Clausena lansium (Lour.) Skeels
|
Huang, Xue-Song |
|
2006 |
62 |
5 |
p. o1987-o1988 |
artikel |
215 |
N-[4-(Morpholinocarbonylmethoxy)phenyl]acetamide monohydrate: a potential antiamnesic agent
|
Sundar, T. V. |
|
2006 |
62 |
5 |
p. o1874-o1876 |
artikel |
216 |
N,N′-Bis(9-anthracenylidene)hydrazine
|
Zheng, Peng-Wu |
|
2006 |
62 |
5 |
p. o2077-o2078 |
artikel |
217 |
N,N′-Bis[(4-chloroanilino)thiocarbonyl]isophthalamide dimethylformamide solvate
|
Zhang, You-Ming |
|
2006 |
62 |
5 |
p. o1791-o1792 |
artikel |
218 |
N,N′-Bis(2,6-dichlorobenzylidene)hydrazine
|
Zheng, Peng-Wu |
|
2006 |
62 |
5 |
p. o1913-o1914 |
artikel |
219 |
[N,N′-Bis(diphenylphosphino)pyridine-2,6-diamine-κ3P,N1,P′]chloropalladium(II) chloride monohydrate 1,2-dichloroethane solvate
|
Wiedermann, Julia |
|
2006 |
62 |
5 |
p. m1106-m1108 |
artikel |
220 |
N,N′-Bis(4-methylphenyl)-3-oxapentanediamide
|
Wen, Yong-Hong |
|
2006 |
62 |
5 |
p. o1861-o1862 |
artikel |
221 |
N,N′-Bis(1-naphthyl)-N,N′-diphenyl-1,1′-biphenyl-4,4′-diamine
|
Huang, Li-Qun |
|
2006 |
62 |
5 |
p. o2075-o2076 |
artikel |
222 |
N-(4-Nitrobenzyl)quinolinium bis(2-thioxo-1,3-dithiole-4,5-dithiolato)palladium(III) acetone solvate
|
Su, Yang |
|
2006 |
62 |
5 |
p. m1002-m1003 |
artikel |
223 |
N,N′-Octamethylenebis(4-methylbenzamide)
|
Awaleh, Mohamed Osman |
|
2006 |
62 |
5 |
p. o1996-o1997 |
artikel |
224 |
Nonaaquayttrium(III) tris(bromate)
|
Eriksson, Lars |
|
2006 |
62 |
5 |
p. m126-m128 |
artikel |
225 |
N-{(2RS)-2-Hydroxy-3-[2-(3-phenylpropanoyl)phenoxy]propyl}propanaminium chloride
|
Bruni, Bruno |
|
2006 |
62 |
5 |
p. o1694-o1695 |
artikel |
226 |
Octaammonium diaquahexa-μ2-oxalato-dioxalatotetracopper(II) tetrahydrate
|
Kadir, Karim |
|
2006 |
62 |
5 |
p. m1139-m1141 |
artikel |
227 |
μ-Oxalato-bis[(2,2′-bipyridine)(N,N-dimethylformamide)copper(II)] bis(perchlorate)
|
Zhang, Gui-Ling |
|
2006 |
62 |
5 |
p. m1175-m1177 |
artikel |
228 |
μ-Oxalato-bis[(N,N′-dimethylformamide)(1,10-phenanthroline)copper(II)] bis(perchlorate)
|
Tu, Xiao-Hua |
|
2006 |
62 |
5 |
p. m1081-m1082 |
artikel |
229 |
μ-Oxo-bis[trans-dichloro(2,4,6-tri-2-pyridyl-1,3,5-triazine)iron(III)] dihydrate
|
Zibaseresht, Ramin |
|
2006 |
62 |
5 |
p. m1150-m1153 |
artikel |
230 |
8-Oxocanadine
|
Wang, Xiao-Ling |
|
2006 |
62 |
5 |
p. o1764-o1765 |
artikel |
231 |
Pentaaquahydroxoscandium(III) dibromide, [Sc(H2O)5(OH)]Br2
|
Kolitsch, Uwe |
|
2006 |
62 |
5 |
p. i122-i123 |
artikel |
232 |
1,10-Phenanthrolinium tetraiodo(1,10-phenanthroline-κ2N,N′)bismuthate(III) 1,10-phenanthroline
|
Li, Feng |
|
2006 |
62 |
5 |
p. m1170-m1172 |
artikel |
233 |
Phenyltris(pyrimidine-2-thiolato)tin(IV)
|
Li, Yong-Xin |
|
2006 |
62 |
5 |
p. m957-m958 |
artikel |
234 |
Poly[μ-aqua-aqua-μ-3-carboxypyrazine-2-carboxylato-sodium(I)]
|
Tombul, Mustafa |
|
2006 |
62 |
5 |
p. m945-m947 |
artikel |
235 |
Poly[aquabis(μ4-benzene-1,2-dicarboxylato)(μ3-benzene-1,2-dicarboxylato)digadolinium(III)]
|
Wu, Xiao-Yuan |
|
2006 |
62 |
5 |
p. m1033-m1035 |
artikel |
236 |
Poly[[bis(4-chlorosalicylato-κO)copper(II)]-di-μ-3-pyridylmethanol-κ2N:O;κ2O:N]
|
Maroszová, Jaroslava |
|
2006 |
62 |
5 |
p. m1164-m1166 |
artikel |
237 |
Poly[[diaqua-μ-1,2-benzene-1,2-dicarboxylato-μ-4,4′-bipyridine-copper(II)] dihydrate]: a two-dimensional copper(II) polymer
|
Xu, Han |
|
2006 |
62 |
5 |
p. m1156-m1158 |
artikel |
238 |
Poly[di-μ4-1,4-benzenedicarboxylato-μ6-succinato-dierbium(III)]
|
Zi, Jun-Feng |
|
2006 |
62 |
5 |
p. m997-m998 |
artikel |
239 |
Poly[hexabromobis[μ3-1,3,5-tris(imidazol-1-ylmethyl)-2,4,6-trimethylbenzene]trimercury(II)]
|
Wang, Xiao-Feng |
|
2006 |
62 |
5 |
p. m1124-m1126 |
artikel |
240 |
Poly[μ4-isonicotinato-μ3-nitrato-barium(II)]
|
Schuy, Andrea |
|
2006 |
62 |
5 |
p. m992-m993 |
artikel |
241 |
Poly[propane-1,2-diammonium μ-disulfido-deca-μ-sulfido-disulfidooctaantimonate(III)]
|
Puls, Angela |
|
2006 |
62 |
5 |
p. m1045-m1047 |
artikel |
242 |
Potassium 2-methyl-5-nitrobenzenesulfonate
|
Lui, Gui-Rong |
|
2006 |
62 |
5 |
p. m1016-m1017 |
artikel |
243 |
Pterodontic acid
|
Mei, Zhi-Nan |
|
2006 |
62 |
5 |
p. o1841-o1843 |
artikel |
244 |
5-(p-Tolylsulfonyl)-3-oxa-5-azatricyclo[5.2.1.04,8]decane
|
Arıcı, Cengiz |
|
2006 |
62 |
5 |
p. o1923-o1924 |
artikel |
245 |
3-(2-Pyridylamino)isobenzofuran-1(3H)-one
|
Odabaşoğlu, Mustafa |
|
2006 |
62 |
5 |
p. o2079-o2080 |
artikel |
246 |
3-(3-Pyridylamino)isobenzofuran-1(3H)-one
|
Odabaşoğlu, Mustafa |
|
2006 |
62 |
5 |
p. o2088-o2089 |
artikel |
247 |
Redetermination of Co4Nb2O9 by single-crystal X-ray methods
|
Castellanos R., María A. |
|
2006 |
62 |
5 |
p. i117-i119 |
artikel |
248 |
(1R,2R)-(+)-1-(2-Hydroxybenzylideneamino)-2-(p-tolylsulfonylamino)cyclohexane
|
Yang, Hong-Wei |
|
2006 |
62 |
5 |
p. o1982-o1983 |
artikel |
249 |
(3R,4R)-(–)-3-Hydroxymethyl-4-phenyl-2-o-toluoyl-1,2,3,4-tetrahydroisoquinoline
|
Gzella, Andrzej |
|
2006 |
62 |
5 |
p. o1774-o1776 |
artikel |
250 |
(2R,3S)-Diethyl 2,3-dibenzoylsuccinate
|
Hu, Sheng-Li |
|
2006 |
62 |
5 |
p. o1966-o1967 |
artikel |
251 |
π-Stacked chains in 3,5-dimethyl-1,7-diphenyl-1,7-dihydrodipyrazolo[3,4-b,4′,3′-e]pyridine
|
Cobo, Justo |
|
2006 |
62 |
5 |
p. o1676-o1678 |
artikel |
252 |
μ-Terephthalato-κ2O1:O4-bis[bis(propane-1,3-diamine-κ2N,N′)iron(II)] bis(perchlorate)
|
Hu, Ren-Zhi |
|
2006 |
62 |
5 |
p. m1054-m1055 |
artikel |
253 |
Tetraamminebis(4-nitrobenzoato-κO)copper(II)
|
Peng, Jian-Jun |
|
2006 |
62 |
5 |
p. m952-m953 |
artikel |
254 |
Tetrabutylammonium bromotrichloroferrate(III)
|
Kruszynski, Rafal |
|
2006 |
62 |
5 |
p. m994-m996 |
artikel |
255 |
1,2,4,5-Tetrafluoro-3,6-bis(nitromethyl)benzene
|
Svoboda, Ingrid |
|
2006 |
62 |
5 |
p. o1689-o1690 |
artikel |
256 |
Tetrakis(benzyldiphenylphosphine-κP)tetra-μ2-sulfido-dicopper(I)molybdenum(VI) tetrahydrate
|
Niu, Yun-Yin |
|
2006 |
62 |
5 |
p. m939-m941 |
artikel |
257 |
Tetrakis(μ-4-tolylsulfanylacetato-κ2O:O′)bis[(N,N′-dimethylformamide-κO)copper(II)]
|
Su, Hong |
|
2006 |
62 |
5 |
p. m1071-m1073 |
artikel |
258 |
2,3,2′,3′-Tetramethylbiphenyl
|
Zheng, Wei |
|
2006 |
62 |
5 |
p. o2012-o2013 |
artikel |
259 |
2,3,4,6-Tetra-O-acetyl-N-(2-hydroxybenzylidene)-β-d-galactopyranosylamine
|
Akkurt, Mehmet |
|
2006 |
62 |
5 |
p. o2069-o2071 |
artikel |
260 |
Tetraphenylarsonium diisothiocyanatodibromonickelate(II)
|
Singh, S. S. |
|
2006 |
62 |
5 |
p. m1014-m1015 |
artikel |
261 |
Tetraphenylphosphonium acetonitriletribromoferrate(II)
|
Kirchner, Karl |
|
2006 |
62 |
5 |
p. m1136-m1138 |
artikel |
262 |
The 1:1 adduct of antimony trifluoride with [1.5]dibenzothia-18-crown-6
|
Ganin, Eduard V. |
|
2006 |
62 |
5 |
p. m1021-m1023 |
artikel |
263 |
The π-donor 4,5;4′,5′-bis(dioxane-1,4-diyl-2,3-dithio)tetrathiafulvalene
|
Malfant, Isabelle |
|
2006 |
62 |
5 |
p. o1948-o1950 |
artikel |
264 |
The β-form of trans-3-(2-nitrophenyl)prop-2-enoic acid at 130 K
|
Smith, Graham |
|
2006 |
62 |
5 |
p. o2024-o2026 |
artikel |
265 |
The layered monodiphosphate Li9Ga3(P2O7)3(PO4)2 refined from X-ray powder data
|
Liu, Xiao-Xuan |
|
2006 |
62 |
5 |
p. i112-i113 |
artikel |
266 |
The scheelite-type europium molybdate Eu0.96MoO4
|
Gall, P. |
|
2006 |
62 |
5 |
p. i120-i121 |
artikel |
267 |
The twinned crystal structure of diiodobis(triphenylphosphine)palladium(II) dichloromethane disolvate at 173 K
|
Theissmann, Thomas |
|
2006 |
62 |
5 |
p. m1056-m1058 |
artikel |
268 |
4-(Tosylamino)benzoic acid
|
Nan, Zhi-Hong |
|
2006 |
62 |
5 |
p. o1978-o1979 |
artikel |
269 |
trans-Bis(O-ethylxanthato)bis(triphenylphosphine)ruthenium(III) hexafluorophosphate monohydrate
|
Noda, Kyoko |
|
2006 |
62 |
5 |
p. m1077-m1078 |
artikel |
270 |
trans-Bromocarbonylbis(triphenylphosphine)rhodium
|
Steyl, Gideon |
|
2006 |
62 |
5 |
p. m1127-m1129 |
artikel |
271 |
trans-Diacetonitriledibromopalladium(II)
|
Ademi, Lumni |
|
2006 |
62 |
5 |
p. m1059-m1061 |
artikel |
272 |
trans-Tetraaquabis[3-(4-pyridyl)acrylato-κN]zinc(II)
|
Yang, E. |
|
2006 |
62 |
5 |
p. m1043-m1044 |
artikel |
273 |
Triaquatetrakis(dimethylacetamide-κO)gadolinium(III) hexacyanoferrate(III) dihydrate
|
Svendsen, Helle |
|
2006 |
62 |
5 |
p. m989-m991 |
artikel |
274 |
[3,3′,3′′-(1,4,7-Triazacyclononane-1,4,7-triyl)tripropanamide]nickel(II) bis(perchlorate)
|
Liu, Rui |
|
2006 |
62 |
5 |
p. m1064-m1065 |
artikel |
275 |
3α,7α,12α-Triformyloxy-24-nor-5β-chol-22-ene
|
Andrade, L. C. R. |
|
2006 |
62 |
5 |
p. o1856-o1858 |
artikel |
276 |
2-(1′,5′,5-Trimethyl-3,3′-bi-1H-pyrazol-1-yl)ethanol
|
Attayibat, Ahmed |
|
2006 |
62 |
5 |
p. o1908-o1909 |
artikel |
277 |
Tris(4-acetylphenyl)amine
|
Cui, Chun Mei |
|
2006 |
62 |
5 |
p. o1762-o1763 |
artikel |
278 |
Unexpected formation of a thiazolo[3,2-a]pyridinium methide: a novel subclass of mesoionic compounds
|
Bush, Alexander A. |
|
2006 |
62 |
5 |
p. o1673-o1675 |
artikel |
279 |
(Z)-4-Benzylidene-1-(4-chlorophenyl)-2-propylamino-1H-imidazol-5(4H)-one
|
Sun, Shao-Fa |
|
2006 |
62 |
5 |
p. o2090-o2091 |
artikel |
280 |
(Z)-5-Chlorofuran-2-carbaldehyde oxime
|
Wang, Xi-Zhao |
|
2006 |
62 |
5 |
p. o2086-o2087 |
artikel |
281 |
(Z)-Ethyl 4-chloro-3-oxo-2-(2-o-tolylhydrazono)butanoate
|
Alpaslan, Gökhan |
|
2006 |
62 |
5 |
p. o1828-o1830 |
artikel |
|