nr |
titel |
auteur |
tijdschrift |
jaar |
jaarg. |
afl. |
pagina('s) |
type |
1 |
3a,8c-Dichloro-8b-phenyl-3a,3b,8b,8c-tetrahydro-2-methyl-1H-[1]benzothieno[2′,3′:3,4]cyclobuta[1,2-c]pyrrole-1,3(2H)-dione
|
An, Hui-Ying |
|
2005 |
61 |
12 |
p. o4331-o4332 |
artikel |
2 |
1-Acetonitrile-3-chloro-1,2-(μ-3,5-dinitrobenzoato-κ2O,O′)-1-(triphenylphosphine-κP)-closo-1-ruthenaundecaborane
|
Guo, Qing-Liang |
|
2005 |
61 |
12 |
p. m2613-m2615 |
artikel |
3 |
Acetonyl methyl 1,4-dihydro-2,6-dimethyl-4-(2-nitrophenyl)pyridine-3,5-dicarboxylate
|
Wang, Xue-Yuan |
|
2005 |
61 |
12 |
p. o4287-o4288 |
artikel |
4 |
4-Acetylphenyl phenyl sulfone
|
Guo, Sheng-Rong |
|
2005 |
61 |
12 |
p. o4032-o4033 |
artikel |
5 |
A 1:1 complex of 2,4,5,6-tetrachloro-1,3-dicyanobenzene with pyrene
|
Britton, Doyle |
|
2005 |
61 |
12 |
p. o4188-o4189 |
artikel |
6 |
(2-Acryloylaminophenyl)arsonic acid
|
Herrera, Ana M. |
|
2005 |
61 |
12 |
p. m2752-m2754 |
artikel |
7 |
(Adeninato-N9)[N-(2-aminoethyl)salicylideneiminato]palladium(II) 3.5-hydrate
|
Odoko, Mamiko |
|
2005 |
61 |
12 |
p. m2670-m2673 |
artikel |
8 |
A heterobimetallic zinc(II)/uranium(IV) complex with the Schiff base 2-amino-N,N′-bis(3-hydroxysalicylidene)benzylamine
|
Salmon, Lionel |
|
2005 |
61 |
12 |
p. m2607-m2609 |
artikel |
9 |
5-Amino-1-benzyl-4-cyano-3-methylimidazolium toluene-p-sulfonate
|
Dey, Raja |
|
2005 |
61 |
12 |
p. o4039-o4041 |
artikel |
10 |
1-(Aminocarbonyl)ethylammonium hydrogensquarate monohydrate
|
Kolev, Tsonko |
|
2005 |
61 |
12 |
p. o4292-o4294 |
artikel |
11 |
10-Amino-9-(4-chlorophenyl)-3,3,6,6-tetramethyl-3,4,5,6,9,10-hexahydroacridine-1,8(2H,7H)-dione
|
Tu, Shujiang |
|
2005 |
61 |
12 |
p. o4082-o4084 |
artikel |
12 |
5-Amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethylsulfanyl)-1H-pyrazole-3-carbonitrile
|
Tang, Ri-Yuan |
|
2005 |
61 |
12 |
p. o4374-o4375 |
artikel |
13 |
3-(2-Aminophenyl)-2-methylsulfanyl-5,6,7,8-tetrahydrobenzothieno[2,3-d]pyrimidin-4(3H)-one
|
Zeng, Xiao-Hua |
|
2005 |
61 |
12 |
p. o4160-o4161 |
artikel |
14 |
A new nickel(II) complex, [NiL]·CH3OH, where H2L is 2-phenyl-3,10,18,21-tetraazatetracyclo[20.4.0.04,9.012,17]hexacosa-2,10,12,14,16,22,24,26-octaene-19,20-dionate(2−)
|
Jia, Xue-Qiao |
|
2005 |
61 |
12 |
p. m2655-m2657 |
artikel |
15 |
A new ternary aluminide, CePt3Al5
|
Tursina, Anna I. |
|
2005 |
61 |
12 |
p. i285-i286 |
artikel |
16 |
A novel triple-stranded cadmium(II) polymer chain: catena-poly[cadmium(II)-μ-1,2-bis(imidazol-1-yl)ethane-κ2N3:N3′-di-μ-1,5-dicyanamido-κ4N1:N5]
|
Zhang, Yong |
|
2005 |
61 |
12 |
p. m2722-m2725 |
artikel |
17 |
Aqua[4-bromo-2-(pyridinylmethyliminomethyl)phenolato]zinc(II) nitrate monohydrate
|
Chen, Yue |
|
2005 |
61 |
12 |
p. m2716-m2717 |
artikel |
18 |
Aquadichlorobis(2-chloropyridine-κN)copper(II)
|
Jin, Zhi-Min |
|
2005 |
61 |
12 |
p. m2566-m2567 |
artikel |
19 |
Aqua[N,N′-ethylenebis(5-nitrosalicylideneiminato)]methanolmanganese(III) perchlorate
|
Butcher, Ray J. |
|
2005 |
61 |
12 |
p. m2618-m2620 |
artikel |
20 |
μ-Aqua-κ2O:O-di-μ-phenylacetato-κ4O:O′-bis[(1,10-phenanthroline-κ2N,N′)(phenylacetato-κO)cobalt(II)]
|
Kong, Li-Li |
|
2005 |
61 |
12 |
p. m2485-m2487 |
artikel |
21 |
Aqua(1,10-phenanthroline)[1,1,1-trifluoro-3-(2-thenoyl)acetonato]copper(II) (1,10-phenanthroline)(5-sulfonatosalicylato)[1,1,1-trifluoro-3-(2-thenoyl)acetonato]cuprate(II)
|
Fan, Sai-Rong |
|
2005 |
61 |
12 |
p. m2480-m2482 |
artikel |
22 |
Aquatris(nitrato-κ2O,O′)(2,2′:6,2′′-terpyridine)praseodymium(III) acetone solvate
|
Charushnikova, Iraida A. |
|
2005 |
61 |
12 |
p. m2514-m2516 |
artikel |
23 |
A second polymorph of 1,2-bis[4-(4-chlorophenyl)-1,3-thiazol-2-yl]disulfane
|
Hartung, Jens |
|
2005 |
61 |
12 |
p. o3974-o3976 |
artikel |
24 |
A trinuclear Cu2Mn complex, [Mn(CuL)2(DMF)2](SCN)2, where H2L is 3,10,18,21-tetraazatetracyclo[20.4.0.04,9.012,17]hexacosa-2,10,12,14,16,22,24,26-octaene-19,20-dionate(2−) and DMF is dimethylformamide
|
Jia, Xue-Qiao |
|
2005 |
61 |
12 |
p. m2653-m2654 |
artikel |
25 |
A two-dimensional brick-wall layer barium(II) coordination polymer: poly[[tetraaquabarium(II)-di-μ-1H-imidazole-4,5-dicarboxylato] dihydrate]
|
Zhang, Xian-Fa |
|
2005 |
61 |
12 |
p. m2488-m2490 |
artikel |
26 |
Benzimidazolium 4-carboxyphenoxyacetate
|
Zhang, Xian-Fa |
|
2005 |
61 |
12 |
p. o3958-o3960 |
artikel |
27 |
Benzimidazolium hydrogen nitroterephthalate
|
Pan, Tian-Tian |
|
2005 |
61 |
12 |
p. o3996-o3997 |
artikel |
28 |
2-Benzyl-1,3-diphenylpropane-1,3-dione
|
Judaš, Nenad |
|
2005 |
61 |
12 |
p. o4008-o4010 |
artikel |
29 |
2-[1-(Benzylphenylphosphinothioyl)-2-phenylethyl]-2′-[(E)-2-chlorovinyl]-1,1′-binaphthyl
|
Kasák, Peter |
|
2005 |
61 |
12 |
p. o4093-o4095 |
artikel |
30 |
(4-Benzylpiperazine-1-carbodithioato)triphenyltin(IV)
|
Li, Feng |
|
2005 |
61 |
12 |
p. m2464-m2465 |
artikel |
31 |
2,6-Bis(4-aminophenyl)benzo[1,2-d:5,4-d′]dioxazole 1-methylpyrrolidin-2-one trisolvate
|
Zhao, Hui |
|
2005 |
61 |
12 |
p. o4158-o4159 |
artikel |
32 |
Bis(biguanido-κ2N,N′)nickel(II) dihydrate
|
Su, Ying-Lan |
|
2005 |
61 |
12 |
p. m2531-m2533 |
artikel |
33 |
Bis(2,2′-bipyridine-κ2N,N′)chlorocopper(II) 3-carboxybenzenesulfonate trihydrate
|
Cai, Lei |
|
2005 |
61 |
12 |
p. m2546-m2547 |
artikel |
34 |
Bis[bis(4-aminopyridine-κN1)silver(I)] terephthalate decahydrate
|
Li, Yu-Guang |
|
2005 |
61 |
12 |
p. m2564-m2565 |
artikel |
35 |
Bis[4-bromo-2-(cyclohexyliminomethyl)phenolato]zinc(II)
|
You, Zhong-Lu |
|
2005 |
61 |
12 |
p. m2493-m2494 |
artikel |
36 |
Bis[4-bromo-2-(cyclopropyliminomethyl)phenolato]zinc(II)
|
You, Zhong-Lu |
|
2005 |
61 |
12 |
p. m2501-m2502 |
artikel |
37 |
Bis(μ-3-carboxylatophenoxyacetato)bis[aquabis(1H-benzimidazole)cadmium(II)] dihydrate
|
Zhao, Hui |
|
2005 |
61 |
12 |
p. m2686-m2688 |
artikel |
38 |
1,2-Bis[4-(4-chlorophenyl)-1,3-thiazol-2-yl]disulfane
|
Hartung, Jens |
|
2005 |
61 |
12 |
p. o3971-o3973 |
artikel |
39 |
Bis[2-(cyclohexyliminomethyl)-4-nitrophenolato]zinc(II)
|
You, Zhong-Lu |
|
2005 |
61 |
12 |
p. m2495-m2496 |
artikel |
40 |
Bis[2-(cyclopropyliminomethyl)-4-nitrophenolato]zinc(II)
|
You, Zhong-Lu |
|
2005 |
61 |
12 |
p. m2497-m2498 |
artikel |
41 |
Bis(dibenzylamine)silver(I) nitrate
|
Brito, Iván |
|
2005 |
61 |
12 |
p. m2626-m2628 |
artikel |
42 |
Bis[2,4-dichloro-6-(cyclopropyliminomethyl)phenolato]zinc(II)
|
You, Zhong-Lu |
|
2005 |
61 |
12 |
p. m2499-m2500 |
artikel |
43 |
1,2-Bis[5-(2,2-dicyanovinyl)-2-ethyl-3-thienyl]-3,3,4,4,5,5-hexafluorocyclopent-1-ene, a new photochromic diarylethene compound
|
Pu, Shou-Zhi |
|
2005 |
61 |
12 |
p. o4077-o4079 |
artikel |
44 |
Bis{μ-dimethyl 1-[1-methoxycarbonyl-3-(methoxyoxalyl)-2-methylpropenyl]-3,3-dimethylcyclopropane-1,2-dicarboxylato(2–)}bis[(triphenylphosphine)palladium(II)] acetone solvate
|
Bolte, Michael |
|
2005 |
61 |
12 |
p. m2677-m2679 |
artikel |
45 |
11,12-Bis(2,2-dimethylpropyl)-9,10-dihydro-9,10-ethenoanthracene
|
Herres, Joseph P. |
|
2005 |
61 |
12 |
p. o3961-o3963 |
artikel |
46 |
Bis(3,5-dimethylpyrazolium) bis(hydroxonium) β-octamolybdate(VI) ethanol disolvate
|
Deng, Zhao-Peng |
|
2005 |
61 |
12 |
p. m2553-m2555 |
artikel |
47 |
2,5-Bis(2,2-diphenylethenyl)thiophene
|
Zeller, Matthias |
|
2005 |
61 |
12 |
p. o4183-o4184 |
artikel |
48 |
[Bis(diphenylphosphino)methane-κ2P,P′][bis(diphenylthiophosphinyl)methane-κ2S,S′]platinum(II) bis(perchlorate) acetone solvate
|
Alkan, Leman |
|
2005 |
61 |
12 |
p. m2706-m2708 |
artikel |
49 |
2,6-Bis(1H-imidazol-1-ylmethyl)pyridine sesquihydrate
|
Meng, Xiang-Tai |
|
2005 |
61 |
12 |
p. o4338-o4339 |
artikel |
50 |
3,5-Bis(2-hydroxyethyl)-4-oxahexacyclo[5.4.1.02,6.03,10.05,9.08,11]dodecane
|
Kruger, Hendrik G. |
|
2005 |
61 |
12 |
p. o3968-o3970 |
artikel |
51 |
Bis{[2-hydroxy-κO-1,1-bis(hydroxymethyl)ethylamino-κN]acetato-κO}copper(II)
|
Gao, En-Jun |
|
2005 |
61 |
12 |
p. m2720-m2721 |
artikel |
52 |
Bis{4-methyl-N-[(Z)-(3-methyl-5-oxo-1-phenyl-4,5-dihydro-1H-pyrazol-4-ylidene)(phenyl)methyl]anilinato-κ2N,O}cobalt(II)
|
Ma, Rong-Ming |
|
2005 |
61 |
12 |
p. m2741-m2742 |
artikel |
53 |
Bis{μ-N-[bis(hydroxymethyl)(oxidomethyl)methyl]glycinato}bis[dimethyltin(IV)] dioxane hemisolvate
|
Fang, Xiao-Niu |
|
2005 |
61 |
12 |
p. m2604-m2606 |
artikel |
54 |
Bis[N-(2-hydroxyethyl)ethylenediamine-κ3N,N′,O]nickel(II) squarate monohydrate
|
Uçar, Ibrahim |
|
2005 |
61 |
12 |
p. m2730-m2732 |
artikel |
55 |
1,1′-Bis(2-nitrophenyl)-5,5′-dipropyl-3,3′-bipyrazole
|
Bouabdallah, Ibrahim |
|
2005 |
61 |
12 |
p. o4243-o4245 |
artikel |
56 |
Bis(N,N-diethyldithiocarbamato-κ2S,S′)iodo(1,10-phenanthroline)bismuth(III)
|
Li, Feng |
|
2005 |
61 |
12 |
p. m2541-m2543 |
artikel |
57 |
Bis(1,10-phenanthroline-κ2N,N)bis(thiosalicylato-1κ2O,O′:2κ2O′,S)dizinc(II)
|
Dai, Yu-Mei |
|
2005 |
61 |
12 |
p. m2491-m2492 |
artikel |
58 |
2,8-Bis(3-phenylquinoxalin-2-yl)-5λ6-dibenzo[b,d]thiophene-5,5-dione
|
Huang, Tai-Hsiang |
|
2005 |
61 |
12 |
p. o4126-o4127 |
artikel |
59 |
Bis(μ-4-sulfamoylbenzoato)bis[chloro(di-2-pyridylamine)copper(II)] dihydrate
|
Li, Xin-Hua |
|
2005 |
61 |
12 |
p. m2623-m2625 |
artikel |
60 |
Bis(thiosemicarbazide)zinc(II) bis(maleate) dihydrate
|
Li, Sheng-Li |
|
2005 |
61 |
12 |
p. m2701-m2703 |
artikel |
61 |
Bis(triaquasodium) 2,5-dibenzoylterephthalate tetrahydrate
|
Wang, Dan-Dan |
|
2005 |
61 |
12 |
p. m2610-m2612 |
artikel |
62 |
Bis(triethanolamine-κ3N,O,O′)nickel(II) benzene-1,4-dicarboxylate
|
Haukka, Matti |
|
2005 |
61 |
12 |
p. m2746-m2748 |
artikel |
63 |
1,3-Bis(3,4,5-trimethoxyphenyl)-2,3-epoxypropanone: an anticancer chalcone epoxide
|
Cuthbertson, Timothy |
|
2005 |
61 |
12 |
p. o4300-o4302 |
artikel |
64 |
4′-(4-Bromobenzoyl)-1′-methyldispiro[indole-3(2H),2′-pyrrolidine-3′,3′′(2′′H)-indole]-2,2′′-dione
|
Palani, K. |
|
2005 |
61 |
12 |
p. o4254-o4256 |
artikel |
65 |
6-Bromo-1′-ethyl-4-(1-ethyl-3,3-dimethyl-1H-indolin-2-ylidenemethyl)-3′,3′-dimethylspiro[3,4-dihydro-2H-1-benzopyran-2,2′(3′H)-1′H-indoline], a dicondensed spiropyran
|
Zhang, Feng |
|
2005 |
61 |
12 |
p. o4085-o4087 |
artikel |
66 |
1-(4-Bromo-2-fluorophenyl)-3-trifluoromethyl-1H-pyrazol-5-yl benzenesulfonate
|
Duan, Xue-Min |
|
2005 |
61 |
12 |
p. o4266-o4267 |
artikel |
67 |
6-Bromo-3-(2-methylpropenyl)imidazo[1,2-a]pyridine
|
Zhang, Rui |
|
2005 |
61 |
12 |
p. o4037-o4038 |
artikel |
68 |
5-[(2-Bromophenylamino)methylene]-2,2-dimethyl-1,3-dioxane-4,6-dione
|
Silva, Luiz Everson da |
|
2005 |
61 |
12 |
p. o4252-o4253 |
artikel |
69 |
Caesium dimethyldiselenidoarsenate(V)
|
Van Almsick, Tobias |
|
2005 |
61 |
12 |
p. m2661-m2663 |
artikel |
70 |
Carbonyl(8-hydroxyquinolinato)[tris(2-methylphenyl) phosphite]rhodium(I)
|
Janse van Rensburg, J. Marthinus |
|
2005 |
61 |
12 |
p. m2743-m2745 |
artikel |
71 |
2-Carboxypyridinium hydrogen chloranilate
|
Tabuchi, Youhei |
|
2005 |
61 |
12 |
p. o4215-o4217 |
artikel |
72 |
catena-Poly[[[aqua(2,2′-bipyridine)copper(II)]-μ-3-sulfonatobenzoato] monohydrate]
|
Miao, Xiao-He |
|
2005 |
61 |
12 |
p. m2561-m2563 |
artikel |
73 |
catena-Poly[[[aqua(di-2-pyridylamine-κ2N2,N2′)copper(II)]-μ-thiophene-2,5-dicarboxylato-κ2O2:O5] N,N-dimethylformamide monohydrate]
|
Xiao, Hong-Ping |
|
2005 |
61 |
12 |
p. m2592-m2594 |
artikel |
74 |
catena-Poly[[aqua(1H-imidazole-κN)cadmium(II)]-μ-thiodiacetato-κ4O,S,O′:O′′]
|
Pan, Tian-Tian |
|
2005 |
61 |
12 |
p. m2674-m2676 |
artikel |
75 |
catena-Poly[[[aquazinc(II)]-μ-6-[bis(2-pyridylmethyl)amino]caproato] perchlorate]
|
Choi, Ki-Young |
|
2005 |
61 |
12 |
p. m2474-m2476 |
artikel |
76 |
catena-Poly[4,4′-bipyridinium(+) [argentate(I)-di-μ-iodo]]
|
Niu, Yun-Yin |
|
2005 |
61 |
12 |
p. m2736-m2737 |
artikel |
77 |
catena-Poly[[bis(tetrahydrofuran)lithium(I)]-μ-N-(2-isopropylphenyl)benzamidinato]
|
Bai, Sheng-Di |
|
2005 |
61 |
12 |
p. m2726-m2727 |
artikel |
78 |
catena-Poly[[bis(thiocyanato-κN)cobalt(II)]-di-μ-2-aminobenzonitrile-κ2N,N′]
|
Moitsheki, Lesego J. |
|
2005 |
61 |
12 |
p. m2580-m2581 |
artikel |
79 |
catena-Poly[[bromomercury(II)]-di-μ-bromo-κ4Br:Br-[bromomercury(II)]-μ-1,4-bis(benzylsulfanyl)butane-κ2S:S′]
|
Che, Guang-Bo |
|
2005 |
61 |
12 |
p. m2704-m2705 |
artikel |
80 |
catena-Poly[[diiodocadmium(II)]-μ-1,4-bis(1,2,4-triazol-1-ylmethyl)benzene-κ2N4:N4′]
|
Niu, Yun-Yin |
|
2005 |
61 |
12 |
p. m2536-m2537 |
artikel |
81 |
catena-Poly[[dipyridylcopper(II)]-di-μ-thiocyanato]
|
Chen, Guang |
|
2005 |
61 |
12 |
p. m2718-m2719 |
artikel |
82 |
catena-Poly[N-[4-(1H-benzimidazol-3-yl)butyl]benzimidazolium [[diiodobismuthate(III)]-di-μ2-iodo]]
|
Niu, Yun-Yin |
|
2005 |
61 |
12 |
p. m2534-m2535 |
artikel |
83 |
catena-Poly[[(1,10-phenanthroline-κ2N,N′)zinc(II)]-μ-3-carboxylatophenoxyacetato-κ2O,O′:κ2O′′,O′′′]
|
Deng, Zhao-Peng |
|
2005 |
61 |
12 |
p. m2520-m2522 |
artikel |
84 |
catena-Poly[sesqui(1,2-ethanediammonium) [[aqua(sulfato-κO)cerate(III)]-di-μ-sulfato-κ3O,O′:O′′;κ4O,O′:O′′,O′′′] dihydrate]
|
Fu, Yun-Long |
|
2005 |
61 |
12 |
p. m2738-m2740 |
artikel |
85 |
catena-Poly[[(trifluoroacetato-κO)silver(I)]-μ-1,2-bis(diphenylphosphino)ethane-κ2P:P′]
|
Bao, Feng |
|
2005 |
61 |
12 |
p. m2637-m2638 |
artikel |
86 |
catena-Poly[trimethyltin(IV)-μ-3,4-dichlorophenylacetato]
|
Saeed, M. Adeel |
|
2005 |
61 |
12 |
p. m2595-m2597 |
artikel |
87 |
catena-Poly[[tri-n-butyltin(IV)]-μ-2-{(E)-4-hydroxy-3-[(E)-4-methylphenyliminomethyl]phenyldiazenyl}benzoato-κ2O:O′]
|
Linden, Anthony |
|
2005 |
61 |
12 |
p. m2711-m2713 |
artikel |
88 |
catena-Poly[[[tris(pyridine-κN)copper(II)]-μ-3-carboxylatophenoxyacetato-κ2O3:O′] trihydrate]
|
Gao, Shan |
|
2005 |
61 |
12 |
p. m2696-m2698 |
artikel |
89 |
4′-(4-Chlorobenzoyl)-1′-methyldispiro[indole-3(2H),2′-pyrrolidine-3′,3′′(2′′H)-indole]-2,2′′-dione
|
Palani, K. |
|
2005 |
61 |
12 |
p. o4257-o4259 |
artikel |
90 |
1-(3-Chlorobenzyl)pyrimidine-2,4(1H,3H)-dione
|
Li, Gong-Chun |
|
2005 |
61 |
12 |
p. o4220-o4221 |
artikel |
91 |
Chlorobis(1,10-phenanthroline)copper(II) 2-carboxybenzenesulfonate monohydrate
|
Zhang, Wei-Bing |
|
2005 |
61 |
12 |
p. m2559-m2560 |
artikel |
92 |
6-[4-(2-Chloroethyloxy)naphthyl]fulvene. Corrigendum
|
Li, Jie |
|
2005 |
61 |
12 |
p. e11 |
artikel |
93 |
6-Chloro-2-(4-fluorophenyl)imidazo[1,2-b]pyridazine
|
Wang, Ling-Ling |
|
2005 |
61 |
12 |
p. o4030-o4031 |
artikel |
94 |
3-Chloro-4-hydroxy-4′-methylbenzophenone
|
Harrison, William T. A. |
|
2005 |
61 |
12 |
p. o4146-o4148 |
artikel |
95 |
1-Chloromercurio-2-{(2-chlorophenyl)[(3-chlorophenyl)imino]methyl}ferrocene
|
Wang, Hong-Xing |
|
2005 |
61 |
12 |
p. m2570-m2571 |
artikel |
96 |
3-(4-Chlorophenyl)-6-(2,4-difluorophenyl)-7H-1,2,4-triazolo[3,4-b][1,3,4]thiadiazine
|
Zhang, Li-Xue |
|
2005 |
61 |
12 |
p. o4340-o4342 |
artikel |
97 |
cis-Diaquabis(1,10-phenanthroline)manganese(II) 4-sulfonatobenzoate 6.5-hydrate
|
Zhang, Li-Ping |
|
2005 |
61 |
12 |
p. m2634-m2636 |
artikel |
98 |
Cocrystal of 2,5-di-4-pyridyl-1,3,4-oxadiazole and malonic acid (1/1)
|
Wang, Yong-Tao |
|
2005 |
61 |
12 |
p. o3979-o3980 |
artikel |
99 |
Cyclohexylammonium dichloroacetate
|
Wang, Jian-Ping |
|
2005 |
61 |
12 |
p. o4006-o4007 |
artikel |
100 |
1-Cyclopentyl-4-(4-fluorophenyl)-7,7-dimethyl-4,6,7,8-tetrahydroquinoline-2,5-dione
|
Tu, Shujiang |
|
2005 |
61 |
12 |
p. o4372-o4373 |
artikel |
101 |
Di-μ-acetato-κ4O:O′-bis[bis(2,2′-bipyridine-κ2N,N′)manganese(II)] bis(perchlorate)
|
Niu, Xue-Li |
|
2005 |
61 |
12 |
p. m2538-m2540 |
artikel |
102 |
2,2′-Diamino-4,4′-bi-1,3-thiazol-3,3′-diium bis(2,2′-diamino-4,4′-bi-1,3-thiazol-3-ium) tetrakis(2-nitrobenzoate)
|
Liu, Bing-Xin |
|
2005 |
61 |
12 |
p. o4119-o4120 |
artikel |
103 |
Diaquabis(4,4′-bipyridine-κN)bis(4-carboxyphenoxyacetato-κO)cobalt(II) tetrahydrate
|
Deng, Zhao-Peng |
|
2005 |
61 |
12 |
p. m2550-m2552 |
artikel |
104 |
Diaquabis(2,3-dimethylpyrazine 1,4-dioxide-κO)bis(thiocyanato-κN)manganese(II) dihydrate
|
Wu, Chang-Ju |
|
2005 |
61 |
12 |
p. m2590-m2591 |
artikel |
105 |
Diaquabis(l-serinato)copper(II) 0.1-hydrate at 120 K
|
Versiane, Otavio |
|
2005 |
61 |
12 |
p. m2517-m2519 |
artikel |
106 |
1,1-Diaqua-2,3,4,5,6-pentaisopropoxy-1-nickeladodecaborane
|
Wu, Li-Bin |
|
2005 |
61 |
12 |
p. m2585-m2587 |
artikel |
107 |
Diaquatris(nitrato-κ2O,O′)bis(4-pyridone-κO)lanthanum(III)
|
Deng, Zhao-Peng |
|
2005 |
61 |
12 |
p. m2523-m2525 |
artikel |
108 |
Diazidobis(1,10-phenanthroline)cobalt(III) perchlorate
|
Song, Xue-Yan |
|
2005 |
61 |
12 |
p. m2649-m2650 |
artikel |
109 |
1,1-Dibenzoyl-3,3-dimethylurea
|
Blewett, Gavin |
|
2005 |
61 |
12 |
p. o4042-o4044 |
artikel |
110 |
Dibromobis[2-(N,N-dimethylaminomethyl)phenyl]tin(IV)
|
Padělková, Zdeňka |
|
2005 |
61 |
12 |
p. m2691-m2693 |
artikel |
111 |
3,6-Dibromo-9-hexyl-9H-carbazole
|
Duan, Xue-Min |
|
2005 |
61 |
12 |
p. o3977-o3978 |
artikel |
112 |
3,6-Dibromo-9-isopropyl-9H-carbazole
|
Cui, Jian-Lan |
|
2005 |
61 |
12 |
p. o4227-o4228 |
artikel |
113 |
Dibrucinium sulfate heptahydrate
|
Białońska, Agata |
|
2005 |
61 |
12 |
p. o4222-o4224 |
artikel |
114 |
Di-μ-chloro-bis[aqua(caffeine)chlorocopper(II)]
|
Jin, Zhi-Min |
|
2005 |
61 |
12 |
p. m2631-m2633 |
artikel |
115 |
Dichlorobis[phosphonic tris(dimethylamide)]manganese(II)
|
Jin, Zhi Min |
|
2005 |
61 |
12 |
p. m2510-m2511 |
artikel |
116 |
Dichloro-1κCl,3κCl-bis[μ-methylenebis(diphenylphosphine)]-1:2κ2P:P′;2:3κ2P:P′-trigold(I) perchlorate
|
Zhang, Tian-Le |
|
2005 |
61 |
12 |
p. m2588-m2589 |
artikel |
117 |
Dichlorodiphenylbis(pyridine-κN)tin(IV)
|
Yin, Handong |
|
2005 |
61 |
12 |
p. m2568-m2569 |
artikel |
118 |
4-(2,3-Dichlorophenyl)-1-[3-oxo-3-(2-thienyl)propyl]piperazin-1-ium chloride
|
Yang, Xiong-Wen |
|
2005 |
61 |
12 |
p. o4144-o4145 |
artikel |
119 |
Diethanol(2-hydroxy-2,2-diphenylacetato)pyridinecopper(II)
|
Zhu, Li-Na |
|
2005 |
61 |
12 |
p. m2646-m2648 |
artikel |
120 |
4-(Diethylamino)salicylaldehyde
|
Vančo, Ján |
|
2005 |
61 |
12 |
p. o4209-o4211 |
artikel |
121 |
Diethyl 2-(3,4-dicyanophenyl)-2-[(2-naphthyl)methyl]malonate
|
Yıldırım, Sema Öztürk |
|
2005 |
61 |
12 |
p. o4101-o4103 |
artikel |
122 |
Diethylenetriammonium oxonium naphthalene-1,6-disulfonate 3.5-hydrate
|
Jin, Zhi-Min |
|
2005 |
61 |
12 |
p. o4325-o4327 |
artikel |
123 |
6-(2,4-Difluorophenyl)-3-(4-methoxyphenyl)-7H-1,2,4-triazolo[3,4-b][1,3,4]thiadiazine
|
Zhang, Li-Xue |
|
2005 |
61 |
12 |
p. o4058-o4059 |
artikel |
124 |
1,4-Dihydro-6-methyl-5-(N-methylcarbamoyl)-4-(4-nitrophenyl)pyrimidine-2(3H)-thione monohydrate
|
Sridhar, Balasubramanian |
|
2005 |
61 |
12 |
p. o4130-o4132 |
artikel |
125 |
Dihydroxonium 1,5-naphthalenedisulfonate N,N-dimethylformamide disolvate
|
Deng, Zhao-Peng |
|
2005 |
61 |
12 |
p. o4175-o4176 |
artikel |
126 |
6,6′-Dihydroxy-5,5′-dimethoxy-3,3′-methylenedibenzaldehyde
|
Jiao, Guili |
|
2005 |
61 |
12 |
p. o4298-o4299 |
artikel |
127 |
3,3′-Dihydroxy-4,4′-(propane-1,3-diyldioxy)dibenzaldehyde
|
Fan, Zhi |
|
2005 |
61 |
12 |
p. o4004-o4005 |
artikel |
128 |
Di-μ-iodo-1κI:2κI-tris(tri-m-tolylphosphine)-1κ2P,P′:2κP′′-dicopper(I): a new polymorph
|
Hossain, G. M. Golzar |
|
2005 |
61 |
12 |
p. m2629-m2630 |
artikel |
129 |
2,6-Diiodophenyl acridine-9-carboxylate
|
Sikorski, Artur |
|
2005 |
61 |
12 |
p. o4355-o4357 |
artikel |
130 |
Dimethyl dipropargylmalonate
|
Bolte, Michael |
|
2005 |
61 |
12 |
p. o4025-o4027 |
artikel |
131 |
Dimethyl 2,6-di-tert-butyl-4,8-dioxo-1,2,5,6-tetrahydro-2,3a,4a,6,7a,8a-hexaazacyclopenta[def]fluorene-8b,8c-dicarboxylate
|
Li, Yi-Tao |
|
2005 |
61 |
12 |
p. o4128-o4129 |
artikel |
132 |
[Dimethyl 5,6,7,8,15,16-hexahydro-6,7-dioxo-5,8,14,17-tetraazadibenzo[a,g]cyclotetradeca-3,9,13,17-tetraene-13,18-dicarboxylato-κ4N,N′,N′′′,N′′′']copper(II)
|
He, Jun-Hong |
|
2005 |
61 |
12 |
p. m2709-m2710 |
artikel |
133 |
Dimethyl naphthalene-1,4-dicarboxylate
|
Jing, Lin-Hai |
|
2005 |
61 |
12 |
p. o4365-o4366 |
artikel |
134 |
5,5-Dimethyl-4-(3-nitrophenyl)-2-oxo-2-(2-pyridylamino)-1,3,2-dioxaphosphorinane
|
Yu, Yan |
|
2005 |
61 |
12 |
p. o4268-o4269 |
artikel |
135 |
2-(3,7-Dimethylocta-2,6-dienyl)-1,3,5,8-tetrahydroxyxanthone
|
Choudhary, M. Iqbal |
|
2005 |
61 |
12 |
p. o4313-o4315 |
artikel |
136 |
5,5-Dimethyl-2-oxo-4-phenyl-2-(2-pyridylamino)-1,3,2-dioxaphosphorinane
|
Yu, Yan |
|
2005 |
61 |
12 |
p. o4270-o4271 |
artikel |
137 |
Dimethyl(1,10-phenanthroline)(pyridine-2,6-dicarboxylato)tin(IV)
|
Li, Ji-Kun |
|
2005 |
61 |
12 |
p. m2694-m2695 |
artikel |
138 |
2,2′-Dimethyl-3,3′-(p-phenylenedimethylene)diimidazol-1-ium dibromide
|
Dobrzańska, Liliana |
|
2005 |
61 |
12 |
p. o4113-o4115 |
artikel |
139 |
(3,5-Dimethylpyridine)bis(tri-tert-butoxysilanethiolato)zinc(II)
|
Dołęga, Anna |
|
2005 |
61 |
12 |
p. m2582-m2584 |
artikel |
140 |
Dinitratodioxo[3-(triphenylphosphonio)propionato]uranium(VI)
|
Yang, Lin |
|
2005 |
61 |
12 |
p. m2578-m2579 |
artikel |
141 |
1,4-Diphenylbutane
|
Fleck, Michel |
|
2005 |
61 |
12 |
p. o4099-o4100 |
artikel |
142 |
Di-μ-pyridine-2,5-dicarboxylato-1κ2N,O2:2κO5;1κO5:2κ2N,O2-bis[aqua(2,2′-bipyridine-κ2N,N′)cadmium(II)] dihydrate
|
Zhao, Shu-Min |
|
2005 |
61 |
12 |
p. m2505-m2506 |
artikel |
143 |
2,3-Di-4-pyridylbutane-2,3-diol
|
Niu, Yun-Yin |
|
2005 |
61 |
12 |
p. o4303-o4304 |
artikel |
144 |
3-(3,5-Di-tert-butyl-4-hydroxyphenyl)propionohydrazide
|
Xu, Wei-Ming |
|
2005 |
61 |
12 |
p. o4190-o4191 |
artikel |
145 |
2,6-Di-tert-butyl-4-(isopropylaminomethyl)phenol
|
Shu, Xue-Gui |
|
2005 |
61 |
12 |
p. o4192-o4194 |
artikel |
146 |
(Di-tert-butylphosphino)cobaltocenium hexafluorophosphate
|
Ren, Yong |
|
2005 |
61 |
12 |
p. m2714-m2715 |
artikel |
147 |
(E)-1-[3-(Benzyloxy)benzylidene]-2-(2,4-dinitrophenyl)hydrazine
|
Shi, Jun |
|
2005 |
61 |
12 |
p. o4018-o4019 |
artikel |
148 |
(E)-4-[4-(Benzyloxy)-3-ethoxybenzylideneamino]-1,5-dimethyl-2-phenyl-1H-pyrazol-3(2H)-one
|
Shi, Jun |
|
2005 |
61 |
12 |
p. o4023-o4024 |
artikel |
149 |
(E)-1-[3-(Benzyloxy)-4-methoxybenzylidene]-2-(2,4-dinitrophenyl)hydrazine acetonitrile solvate
|
Shi, Jun |
|
2005 |
61 |
12 |
p. o4020-o4022 |
artikel |
150 |
(E)-5-[(3-Bromophenyl)diazenyl]-2-hydroxy-3-methoxybenzaldehyde
|
Şahin, Onur |
|
2005 |
61 |
12 |
p. o4276-o4278 |
artikel |
151 |
(E)-5-(4-Bromophenyldiazenyl)salicylaldehyde
|
Şahin, Onur |
|
2005 |
61 |
12 |
p. o4151-o4153 |
artikel |
152 |
(E)-5-(4-Chlorophenyldiazenyl)salicylaldehyde
|
Şahin, Onur |
|
2005 |
61 |
12 |
p. o4149-o4150 |
artikel |
153 |
4-{[(1E)-(3,5-Dibromo-2-hydroxyphenyl)methylene]amino}-1,5-dimethyl-2-phenyl-1,2-dihydro-3H-pyrazol-3-one
|
Huang, Ling |
|
2005 |
61 |
12 |
p. o4169-o4170 |
artikel |
154 |
(E)-9,10-Dihydro-9-methyl-9-nitro-10-(trinitromethyl)anthracene
|
Arslan, Mustafa |
|
2005 |
61 |
12 |
p. o4133-o4135 |
artikel |
155 |
(E)-1-(2,4-Dinitrophenyl)-2-{2-[2-(2-nitrophenoxy)ethoxy]benzylidene}hydrazine
|
Diao, Chun-Hua |
|
2005 |
61 |
12 |
p. o4177-o4179 |
artikel |
156 |
(E,E)-1-[2-(4-Nitrophenyl)ethenyl]-4-[2-(2,4,6-trimethoxyphenyl)ethenyl]benzene
|
Vande Velde, Christophe M. L. |
|
2005 |
61 |
12 |
p. o4289-o4291 |
artikel |
157 |
(E)-5-(4-Ethylphenyldiazenyl)salicylaldehyde
|
Şahin, Onur |
|
2005 |
61 |
12 |
p. o4154-o4155 |
artikel |
158 |
(E)-5-[(2-Fluorophenyl)diazenyl]-2-hydroxy-3-methoxybenzaldehyde
|
Albayrak, Çiğdem |
|
2005 |
61 |
12 |
p. o4279-o4281 |
artikel |
159 |
(E)-1-(4-Methoxy-3-propoxybenzylidene)-2-(4-nitrophenyl)hydrazine
|
Shi, Jun |
|
2005 |
61 |
12 |
p. o4091-o4092 |
artikel |
160 |
(E)-2-[(2-Morpholinoethylimino)methyl]phenol
|
Petek, Hande |
|
2005 |
61 |
12 |
p. o3990-o3991 |
artikel |
161 |
(E)-N′-(4-Butoxy-3-methoxybenzylidene)benzohydrazide
|
Zhen, Xiao-Li |
|
2005 |
61 |
12 |
p. o4282-o4284 |
artikel |
162 |
5-endo,6-endo-Bis(acetoxymethyl)bicyclo[2.2.1]hept-2-ene
|
Sun, Li-Li |
|
2005 |
61 |
12 |
p. o3981-o3982 |
artikel |
163 |
(E)-N′-(3-Ethoxy-4-methoxybenzylidene)benzohydrazide
|
Zhen, Xiao-Li |
|
2005 |
61 |
12 |
p. o4360-o4361 |
artikel |
164 |
Erbium nickel trisilicide, ErNiSi3
|
Kończyk, J. |
|
2005 |
61 |
12 |
p. i259-i261 |
artikel |
165 |
3-Ethoxy-4-[2-(2-ethoxy-4-formylphenoxy)ethoxy]benzaldehyde
|
Han, Jian-Rong |
|
2005 |
61 |
12 |
p. o4073-o4074 |
artikel |
166 |
3-Ethoxy-4-[3-(2-ethoxy-4-formylphenoxy)propoxy]benzaldehyde
|
Han, Jian-Rong |
|
2005 |
61 |
12 |
p. o4069-o4070 |
artikel |
167 |
Ethyl 5,5′′-dimethyl-2,2′;6′,2′′-terpyridine-4′-carboxylate
|
Kickelbick, Guido |
|
2005 |
61 |
12 |
p. o4322-o4324 |
artikel |
168 |
5-Ethyl l-glutamate
|
Wu, Yong-Fei |
|
2005 |
61 |
12 |
p. o4028-o4029 |
artikel |
169 |
1-Ferrocenyl-N-(1-phenylethyl)ethylamine
|
Qian, Heng-Yu |
|
2005 |
61 |
12 |
p. m2641-m2642 |
artikel |
170 |
4-Fluoro-N-(quinolin-8-yl)benzenesulfonamide
|
da Silva, Luiz Everson |
|
2005 |
61 |
12 |
p. o4387-o4388 |
artikel |
171 |
2-[4-(2-Formyl-6-methoxyphenoxy)butoxy]-3-methoxybenzaldehyde
|
Diao, Chun-Hua |
|
2005 |
61 |
12 |
p. o4067-o4068 |
artikel |
172 |
3-[4-(5-Formyl-2-methoxyphenoxy)butoxy]-4-methoxybenzaldehyde
|
Han, Jian-Rong |
|
2005 |
61 |
12 |
p. o4049-o4050 |
artikel |
173 |
4-[4-(4-Formylphenoxy)butoxy]benzaldehyde
|
Han, Jian-Rong |
|
2005 |
61 |
12 |
p. o4358-o4359 |
artikel |
174 |
3-[2-(3-Formylphenoxy)ethoxy]benzaldehyde
|
Han, Jian-Rong |
|
2005 |
61 |
12 |
p. o4250-o4251 |
artikel |
175 |
μ-(Furan-2-carbaldehyde azine)-1κ2O,N:2κ2N′,O′-bis[(furan-2-carbaldehyde azine-κ2N,O)silver(I)] bis(hexafluorophosphate): an unusual complex containing two metal atoms and three ligands. Corrigendum
|
Wang, Le |
|
2005 |
61 |
12 |
p. e10 |
artikel |
176 |
1H-Benzimidazole-2-carboxylic acid monohydrate
|
Krawczyk, Sławomir |
|
2005 |
61 |
12 |
p. o4185-o4187 |
artikel |
177 |
2-(1H-1,2,3-Benzotriazol-1-ylmethyl)-1-benzoylethyl 4-ethylbenzoate
|
Wan, Jun |
|
2005 |
61 |
12 |
p. o4218-o4219 |
artikel |
178 |
2-(2H-Benzotriazol-2-yl)-1-phenylethanone
|
Wang, Shi-Ying |
|
2005 |
61 |
12 |
p. o4056-o4057 |
artikel |
179 |
Hexaaquacadmium(II) tetraaquabis(hexamethylenetetramine)cadmium(II) tetrakis(4-aminonaphthalene-1-sulfonate) hexahydrate
|
Zhou, Hong-Bin |
|
2005 |
61 |
12 |
p. m2749-m2751 |
artikel |
180 |
Hexaaqua[μ-di-μ-oxo-bis(hydroxodioxoiodate)]dieuropium(III) bis(perchlorate) dihydrate
|
Fischer, Andreas |
|
2005 |
61 |
12 |
p. i262-i264 |
artikel |
181 |
3,3,4,4,5,5-Hexafluoro-1,2-bis(3-methyl-5-phenyl-2-thienyl)cyclopent-1-ene, a new photochromic diarylethene compound
|
Pu, Shou-Zhi |
|
2005 |
61 |
12 |
p. o4369-o4371 |
artikel |
182 |
3,3,4,4,5,5-Hexafluoro-1-[2-methyl-5-(2-fluorophenyl)-3-thienyl]-2-(2-methyl-5-phenyl-3-thienyl)cyclopent-1-ene, a new photochromic dithienylethene
|
Pu, Shou-Zhi |
|
2005 |
61 |
12 |
p. o4246-o4249 |
artikel |
183 |
Hexakis[μ2-4-(N-n-butylimino)pentan-2-onato]trimagnesium(II)
|
Matthews, J. S. |
|
2005 |
61 |
12 |
p. m2598-m2600 |
artikel |
184 |
Hydrogen-bonding patterns in 2-amino-4,6-dimethylpyrimidine–cinnamic acid (1/2)
|
Balasubramani, Kasthuri |
|
2005 |
61 |
12 |
p. o4203-o4205 |
artikel |
185 |
Hydrogen-bonding patterns in trimethoprim tetrafluoroborate
|
Hemamalini, Madhukar |
|
2005 |
61 |
12 |
p. o4107-o4109 |
artikel |
186 |
4-(2-Hydroxyethyl)-4H-1,2,4-triazole, an intermediate in the synthesis of iron–triazole spin-crossover compounds
|
Schmidt, Martin U. |
|
2005 |
61 |
12 |
p. o4343-o4344 |
artikel |
187 |
5-Hydroxy-7-methoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one. Corrigendum
|
Teh, Jeannie Bee-Jan |
|
2005 |
61 |
12 |
p. e9 |
artikel |
188 |
4′-Hydroxy-5-methoxy-6,7-methylenedioxyisoflavone
|
Teh, Jeannie Bee-Jan |
|
2005 |
61 |
12 |
p. o4310-o4312 |
artikel |
189 |
1-[5-(4-Hydroxy-3-methoxyphenyl)-3-methyl-4,5-dihydro-1H-pyrazol-1-yl]ethanone
|
Wang, Shi-Fan |
|
2005 |
61 |
12 |
p. o3985-o3986 |
artikel |
190 |
2-(4-Hydroxy-3-methoxyphenyl)-1-phenethyl-1,2-dihydroquinazolin-4(3H)-one
|
Swamy, G. Y. S. K. |
|
2005 |
61 |
12 |
p. o4238-o4240 |
artikel |
191 |
3-[(2-Hydroxyphenyl)amino]-1,3-diphenylprop-2-en-1-one
|
Shi, Yao-Cheng |
|
2005 |
61 |
12 |
p. o4362-o4364 |
artikel |
192 |
3-Hydroxy-1-phenyl-3-(3,4,5-trimethoxyphenyl)propan-1-one
|
Yu, Zhifang |
|
2005 |
61 |
12 |
p. o4075-o4076 |
artikel |
193 |
Infinite hydrogen-bonded chains in tris(1,10-phenanthroline)zinc(II) nitrate bis(glutaric acid) dihydrate
|
Aghabozorg, Hossein |
|
2005 |
61 |
12 |
p. m2664-m2666 |
artikel |
194 |
3-Isopropyl-2-propoxy-5,6,7,8-tetrahydro-1-benzothieno[2,3-d]pyrimidin-4(3H)-one
|
Zeng, Xiao-Hua |
|
2005 |
61 |
12 |
p. o4336-o4337 |
artikel |
195 |
Maleopimaric anhydride ethyl ester
|
Li, Yong-Hong |
|
2005 |
61 |
12 |
p. o4305-o4306 |
artikel |
196 |
Matrinium tetrachloroferrate(III)
|
Jin, Zhi-Min |
|
2005 |
61 |
12 |
p. m2466-m2468 |
artikel |
197 |
mer-(2,2′-Bipyridine)trichloro(tetramethylene sulfoxide)ruthenium(III) dichloromethane solvate
|
Srivastava, Radhey S. |
|
2005 |
61 |
12 |
p. m2572-m2574 |
artikel |
198 |
meso-4,5-Dihydroxy-4,5-dimethylocta-1,7-diyne
|
Bolte, Michael |
|
2005 |
61 |
12 |
p. o4064-o4066 |
artikel |
199 |
4′-(4-Methoxybenzoyl)-1′-methyldispiro[indole-3(2H),2′-pyrrolidine-3′,3′′(2′′H)-indole]-2,2′′-dione
|
Palani, K. |
|
2005 |
61 |
12 |
p. o4260-o4262 |
artikel |
200 |
2-[3-(4-Methoxybenzoyl)thioureido]-3-phenylpropionic acid methanol solvate
|
Ngah, Nurziana |
|
2005 |
61 |
12 |
p. o4307-o4309 |
artikel |
201 |
10-(3-Methoxybenzylidene)anthrone
|
Zhou, Wei |
|
2005 |
61 |
12 |
p. o4263-o4265 |
artikel |
202 |
5-[(4-Methoxyphenylamino)methylene]-2,2-dimethyl-1,3-dioxane-4,6-dione
|
Silva, Luiz Everson da |
|
2005 |
61 |
12 |
p. o4121-o4122 |
artikel |
203 |
Methyl 1-acetonyl-4-hydroxy-2-oxo-1,2-dihydroquinoline-3-carboxylate
|
Shishkina, Svetlana V. |
|
2005 |
61 |
12 |
p. o4180-o4182 |
artikel |
204 |
Methyl [6-amino-5-cyano-4-(4-methoxyphenyl)pyrano[2,3-c]pyrazol-3-yl]acetate
|
Akkurt, Mehmet |
|
2005 |
61 |
12 |
p. o4206-o4208 |
artikel |
205 |
1-(2-Methylbenzoyl)-3-{5-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl}urea
|
Tan, Xiao-Hong |
|
2005 |
61 |
12 |
p. o4212-o4214 |
artikel |
206 |
Methyl 2-benzyloxy-6-(2-methyl-1,3-dioxolan-2-yl)benzoate monohydrate
|
Li, Yuan-Xiang |
|
2005 |
61 |
12 |
p. o4225-o4226 |
artikel |
207 |
Methyl 5-bromosalicylate
|
Xiao, Feng-Ping |
|
2005 |
61 |
12 |
p. o4171-o4172 |
artikel |
208 |
Methyl N-[4-(4,6-dimethylpyrimidin-2-ylamino)thiocarbonyl]carbamate
|
Ren, Ying-Hui |
|
2005 |
61 |
12 |
p. o4013-o4015 |
artikel |
209 |
3-Methyl-4-(4-nitrophenyl)-1-phenyl-1,7-dihydro-6H-pyrazolo[3,4-b]thiazolo[5,4-e]pyridine-6-thione–dimethylformamide (1/1)
|
Delgado, Paula |
|
2005 |
61 |
12 |
p. o3998-o4000 |
artikel |
210 |
4-Methyl-N-(4-nitrophenyl)benzenesulfonamide
|
Xing, Jun-De |
|
2005 |
61 |
12 |
p. o4318-o4319 |
artikel |
211 |
3-(4-Methylphenyl)-2-morpholinobenzo[4,5]furo[3,2-d]pyrimidin-4(3H)-one
|
Hu, Yang-Gen |
|
2005 |
61 |
12 |
p. o4233-o4235 |
artikel |
212 |
3-Methyl-1-p-tolyl-1H-pyrazol-5-yl 2-chlorobenzoate
|
Guo, Zhi-Xiong |
|
2005 |
61 |
12 |
p. o4080-o4081 |
artikel |
213 |
2-(Methylsulfanyl)-1H-benzimidazole
|
Swamy, G. Y. S. K. |
|
2005 |
61 |
12 |
p. o4200-o4202 |
artikel |
214 |
N-[2-(Aminosulfonyl)-5,6-dihydro-6-methyl-7,7-dioxo-4H-thieno[2,3-b]thiopyran-4-yl]acetamide
|
Zou, Zhen-Guang |
|
2005 |
61 |
12 |
p. o4096-o4098 |
artikel |
215 |
3,3′-(1,4-Naphthalenedimethylene)bis(1-methylimidazolium) diiodide monohydrate
|
Jing, Lin-Hai |
|
2005 |
61 |
12 |
p. o3992-o3993 |
artikel |
216 |
n-Butyl 3,5-dinitrobenzoate
|
Li, Fen-Fang |
|
2005 |
61 |
12 |
p. o4173-o4174 |
artikel |
217 |
N-(1-Cyanocyclohexyl)-1,2,3-benzothiadiazole-7-carboxamide
|
Liu, Feng-Li |
|
2005 |
61 |
12 |
p. o4054-o4055 |
artikel |
218 |
N′-(2,4-Dichlorobenzylidene)benzohydrazide
|
Jing, Zuo-Liang |
|
2005 |
61 |
12 |
p. o4316-o4317 |
artikel |
219 |
N-[4-(2,4-Difluorophenyl)-5-(1H-1,2,4-triazol-1-yl)-1,3-thiazol-2-yl]-2-fluorobenzamide
|
Du, Ding |
|
2005 |
61 |
12 |
p. o4241-o4242 |
artikel |
220 |
N-[4-(2,2-Dimethylpropionylamino)phenyl]-2,2-dimethylpropionamide
|
Guo, Hui-Zhen |
|
2005 |
61 |
12 |
p. o4062-o4063 |
artikel |
221 |
N-[4-(Ethoxycarbonyl)phenyl]-p-tolylsulfonamide
|
Xing, Jun-De |
|
2005 |
61 |
12 |
p. o4320-o4321 |
artikel |
222 |
2-[N-(2-Ethoxyphenyl)carbamoylmethoxy]-N-(2-pyridylmethyl)benzamide
|
Wen, Yong-Hong |
|
2005 |
61 |
12 |
p. o4333-o4335 |
artikel |
223 |
N-(2-Hydroxyethyl)-13c-methoxy-1-oxo-1,13c-dihydrodibenzo[a,kl]xanthene-2-carboxamide
|
Wang, Xiu-Zhen |
|
2005 |
61 |
12 |
p. o4353-o4354 |
artikel |
224 |
4-(2-Nitrovinyl)-2,3,6,7-tetrahydrobenzo[1,2-b;4,5-b′]difuran
|
Xu, Wei-Ming |
|
2005 |
61 |
12 |
p. o4351-o4352 |
artikel |
225 |
N,N′-Bis[4-(dimethylamino)benzylidene]ethane-1,2-diamine
|
Hao, Hong-Qing |
|
2005 |
61 |
12 |
p. o4274-o4275 |
artikel |
226 |
N,N′-Bis(3-dimethylaminopropyl)dithiooxamide
|
Cui, Jian-Zhong |
|
2005 |
61 |
12 |
p. o4011-o4012 |
artikel |
227 |
N′′-N′′′-Bis(di-2-pyridylmethylene)carbonic dihydrazide
|
Manoj, E. |
|
2005 |
61 |
12 |
p. o4110-o4112 |
artikel |
228 |
N,N′-Bis(2-nitrobenzylidene)ethylenediamine
|
Li, Yu-Guang |
|
2005 |
61 |
12 |
p. o4156-o4157 |
artikel |
229 |
N,N-Dibenzyl-4-(4,4-diphenylbuta-1,3-dienyl)-3-methylaniline
|
Wu, An-Shu |
|
2005 |
61 |
12 |
p. o4167-o4168 |
artikel |
230 |
[N,N′-Dimethyl-N′′-(2-pyridylmethylene)ethane-1,2-diamine]dithiocyanatozinc(II)
|
Chen, Guang |
|
2005 |
61 |
12 |
p. m2483-m2484 |
artikel |
231 |
N-(3-Nitrophenyl)-1-oxo-2,6,7-trioxa-1-phosphabicyclo[2.2.2]octane-4-carboxamide dimethylformamide solvate
|
Zang, Hong-Jun |
|
2005 |
61 |
12 |
p. o4195-o4197 |
artikel |
232 |
μ2-Oxalato-κ2O,O′:κ2O′′,O′′′-bis[aqua(1,10-phenanthroline-κ2N,N′)copper(II)] dinitrate dihydrate
|
Zhang, Xiang-Dong |
|
2005 |
61 |
12 |
p. m2643-m2645 |
artikel |
233 |
1,1,4,7,7-Pentamethyldiethylenetriammonium bis(hexafluorophosphate)
|
Morawitz, Thorsten |
|
2005 |
61 |
12 |
p. o4367-o4368 |
artikel |
234 |
2-Phenyl-3-[6-(3-phenylquinoxalin-2-yl)dibenzo[b,d]thiophen-3-yl]quinoxaline
|
Huang, Tai-Hsiang |
|
2005 |
61 |
12 |
p. o4236-o4237 |
artikel |
235 |
Piperidinium picrate
|
Saminathan, Kolandaivelu |
|
2005 |
61 |
12 |
p. o4379-o4381 |
artikel |
236 |
1-(Piperidin-1-ylmethyl)-2-naphthol
|
Liu, Qing-Wei |
|
2005 |
61 |
12 |
p. o4285-o4286 |
artikel |
237 |
Poly[μ2-4,4′-bipyridine-di-μ2-imidazolidocadmium(II)]
|
Han, Jin-Yu |
|
2005 |
61 |
12 |
p. m2667-m2669 |
artikel |
238 |
Poly[bis(4,4′-bipyridine)(μ3-4,4′-dicarboxybiphenyl-3,3′-dicarboxylato)cobalt(II)]
|
Hao, Xiang-Rong |
|
2005 |
61 |
12 |
p. m2477-m2479 |
artikel |
239 |
Poly[[μ-1,4-bis(ethylsulfanyl)butane-κ2S,S′]di-μ-bromo-mercury(II)]
|
Liu, Chun-Bo |
|
2005 |
61 |
12 |
p. m2469-m2470 |
artikel |
240 |
Poly[diaqua-μ4-acetylenedicarboxylato-zinc(II)]
|
Stein, Irena |
|
2005 |
61 |
12 |
p. m2680-m2682 |
artikel |
241 |
Poly[diaqua(μ6-benzene-1,2,4,5-tetracarboxylato)(μ6-2,5-dicarboxybenzene-1,4-dicarboxylato)disamarium]
|
Dai, Yu-Mei |
|
2005 |
61 |
12 |
p. m2548-m2549 |
artikel |
242 |
Poly[[diaquabis(1,10-phenanthroline)bis(μ3-5-sulfonatosalicylato)tricopper(II)] tetrahydrate]
|
Fan, Sai-Rong |
|
2005 |
61 |
12 |
p. m2556-m2558 |
artikel |
243 |
Poly[di-μ4-1,4-benzenedicarboxylato-μ6-succinato-didysprosium(III)]
|
Li, Zhi-Feng |
|
2005 |
61 |
12 |
p. m2689-m2690 |
artikel |
244 |
Poly[di-μ3-hydroxymethanesulfinato-zinc(II)]
|
Masciocchi, Norberto |
|
2005 |
61 |
12 |
p. m2683-m2685 |
artikel |
245 |
Polymorph β of 1H-benzimidazole
|
Krawczyk, Sławomir |
|
2005 |
61 |
12 |
p. o4116-o4118 |
artikel |
246 |
Poly[[(1,10-phenanthroline)(μ3-pyridine-2,3-dicarboxylato)manganese(II)] monohydrate]
|
Niu, Xue-Li |
|
2005 |
61 |
12 |
p. m2507-m2509 |
artikel |
247 |
Potassium magnesium hydrogendiphosphate dihydrate
|
El Bali, Brahim |
|
2005 |
61 |
12 |
p. i275-i277 |
artikel |
248 |
1-Propyl 5-nitrosalicylate
|
Li, Fen-Fang |
|
2005 |
61 |
12 |
p. o3994-o3995 |
artikel |
249 |
9-(2-Pyridylmethyl)carbazole
|
Wang, Lei |
|
2005 |
61 |
12 |
p. o4060-o4061 |
artikel |
250 |
2-(2-Pyridyl)pyridinium bis(pyridine-2,6-dicarboxylato-κ2O2,O6)iron(III) trihydrate
|
Zhao, Qi-Hua |
|
2005 |
61 |
12 |
p. m2575-m2577 |
artikel |
251 |
Quininium (S)-2-chloro-n-butyrate
|
Samas, Brian |
|
2005 |
61 |
12 |
p. o3983-o3984 |
artikel |
252 |
Racemic (1SR,2SR,7aRS)-1,2,7a-trihydroxy-2-methylperhydro-1-phosphaindene 1-oxide monohydrate
|
Trzesowska, Agata |
|
2005 |
61 |
12 |
p. o4123-o4125 |
artikel |
253 |
r-2,c-6-Bis(2-chlorophenyl)-t-3,t-5-dimethyl-1-nitrosopiperidin-4-one oxime
|
Hema, R. |
|
2005 |
61 |
12 |
p. o3987-o3989 |
artikel |
254 |
r-2,c-6-Bis(4-chlorophenyl)-t-3,t-5-dimethyl-1-nitrosopiperidin-4-one oxime
|
Hema, R. |
|
2005 |
61 |
12 |
p. o4345-o4347 |
artikel |
255 |
(R)-(+)-3-Chlor-1-(4-morpholino-5-nitro-1H-imidazol-1-yl)propan-2-ol
|
Gzella, Andrzej |
|
2005 |
61 |
12 |
p. o4071-o4072 |
artikel |
256 |
Redetermination of bis(2,2′-bipyridine)iodocopper(II) triiodide
|
Choi, Sung-Nak |
|
2005 |
61 |
12 |
p. m2658-m2660 |
artikel |
257 |
Redetermination of HI3O8, an adduct of formula HIO3·I2O5
|
Fischer, Andreas |
|
2005 |
61 |
12 |
p. i278-i279 |
artikel |
258 |
Reinvestigation of MnSn2
|
Dong, Yongkwan |
|
2005 |
61 |
12 |
p. i282-i284 |
artikel |
259 |
Rerefinement of catena-poly[triethylammonium [triphenylstannate(IV)-μ-2,5-thiophenedicarboxylato]] in the space group Pc
|
Ng, Seik Weng |
|
2005 |
61 |
12 |
p. m2512-m2513 |
artikel |
260 |
(R*)-Methyl 3-carboxy-2-hydroxypropanoate
|
He, Xiang-Jiu |
|
2005 |
61 |
12 |
p. o4104-o4106 |
artikel |
261 |
(R)-(+)-2,3-Methylenedioxy-8-oxoberbine
|
Gzella, Andrzej |
|
2005 |
61 |
12 |
p. o4165-o4166 |
artikel |
262 |
(S)-(−)-3-Chlor-1-(4-morpholino-5-nitro-1H-imidazol-1-yl)propan-2-ol
|
Gzella, Andrzej |
|
2005 |
61 |
12 |
p. o4231-o4232 |
artikel |
263 |
(S)-(–)-2,3-Methylenedioxy-8-oxoberbine
|
Gzella, Andrzej |
|
2005 |
61 |
12 |
p. o4001-o4003 |
artikel |
264 |
Sodium diiron(III) diphosphate hydroxide dihydrate
|
Gao, Shan |
|
2005 |
61 |
12 |
p. i268-i269 |
artikel |
265 |
(2S)-2-[(1R)-1-Iodoethyl]-1-(4-methylphenylsulfonyl)pyrrolidine
|
Kakuda, Hiroko |
|
2005 |
61 |
12 |
p. o3964-o3965 |
artikel |
266 |
(3S,5R,6S,7S,10S,11R,15S,18R,19R)-12,12-Dimethyl-2-methylene-1,17-dioxo-9,16-dioxapentacyclo[14.2.1.06,18.07,11.07,15]nonadeca-5,10,19-triyl triacetate
|
Shi, Hao |
|
2005 |
61 |
12 |
p. o3966-o3967 |
artikel |
267 |
(3S,4S)-4-Amino-5-phenylpentane-1,3-diol
|
Tan, Bin |
|
2005 |
61 |
12 |
p. o4382-o4383 |
artikel |
268 |
(S,S)-N,N′-Dicyanoethyl-1,2-(2-hydroxyphenyl)ethylenediamine
|
Chun, Cindy P. |
|
2005 |
61 |
12 |
p. o4328-o4330 |
artikel |
269 |
(1S,3S)-1-tert-Butyldiphenylsiloxy-3-hydroxy-3-isopropenyl-1,2,3,4-tetrahydronaphthalene
|
Fan, Eric |
|
2005 |
61 |
12 |
p. o4295-o4297 |
artikel |
270 |
tert-Butyl 4,4-dimethyl-5-oxo-1,3-oxazolidine-3-carboxylate
|
Gayathri, D. |
|
2005 |
61 |
12 |
p. o4088-o4090 |
artikel |
271 |
3-(4-tert-Butylphenoxy)phthalonitrile
|
Huang, Xin |
|
2005 |
61 |
12 |
p. o4384-o4386 |
artikel |
272 |
Tetraaquabis(3,5-dihydroxybenzoato-κO)nickel(II) trihydrate
|
Wang, Huan-Yu |
|
2005 |
61 |
12 |
p. m2639-m2640 |
artikel |
273 |
Tetraaquabis[5-(4-pyridyl)-1,3,4-oxadiazole-2-thiolato-κN4]zinc(II) dihydrate
|
Xu, Hong-Xia |
|
2005 |
61 |
12 |
p. m2462-m2463 |
artikel |
274 |
Tetrakis(μ2-3-hydroxypyridine-2-carboxylato-κ2O,N)di-μ3oxo-tetrakis[dimethyltin(IV)]
|
Tian, Guang-Ru |
|
2005 |
61 |
12 |
p. m2528-m2530 |
artikel |
275 |
Tetrakis(2-methoxy-5-pyridyl)silane
|
Saied, Okba |
|
2005 |
61 |
12 |
p. o4136-o4138 |
artikel |
276 |
Tetrakis(μ-2-nitrobenzoato-κ2O:O′)bis[(pyridine-κN)zinc(II)]
|
Zhao, Guo-Liang |
|
2005 |
61 |
12 |
p. m2699-m2700 |
artikel |
277 |
Tetrakis(4-nitropyridine N-oxide-κO)bis(perchlorato)copper(II)
|
Shi, Jing-Min |
|
2005 |
61 |
12 |
p. m2621-m2622 |
artikel |
278 |
Tetramethylammonium chlorodiphenylthiocyanatoantimonate(III)
|
Artali, Roberto |
|
2005 |
61 |
12 |
p. m2733-m2735 |
artikel |
279 |
Tetra-μ-6-methylpyridin-2-olato-ditungsten toluene sesquisolvate
|
Chisholm, Malcolm H. |
|
2005 |
61 |
12 |
p. m2503-m2504 |
artikel |
280 |
5,11,17,23-Tetra-tert-butyl-25,26,27,28-tetrapentoxycalix[4]arene
|
Brusko, Vasiliy |
|
2005 |
61 |
12 |
p. o4272-o4273 |
artikel |
281 |
The mono-(S)-α-methylbenzylammonium salt of (R)-homocitric lactone
|
Jia, Yunhua |
|
2005 |
61 |
12 |
p. o4034-o4036 |
artikel |
282 |
t-3-Methyl-1-nitroso-r-2,c-6-diphenylpiperidin-4-one oxime monohydrate
|
Hema, R. |
|
2005 |
61 |
12 |
p. o4348-o4350 |
artikel |
283 |
trans-1,4-Bis(pyrimidin-2-ylsulfanyl)but-2-ene
|
Sun, Hua |
|
2005 |
61 |
12 |
p. o4142-o4143 |
artikel |
284 |
trans-Chloromethyldipyridinepalladium(II)
|
Owen, Gareth R. |
|
2005 |
61 |
12 |
p. m2651-m2652 |
artikel |
285 |
trans-4-(4-Chlorophenyl)-2-[(2-chlorophenyl)(3-pyridylmethylamino)methyl]-5,5-dimethyl-1,3,2-dioxaphosphinane 2-oxide
|
Sun, Feng-Mei |
|
2005 |
61 |
12 |
p. o4162-o4164 |
artikel |
286 |
trans-Diaqua(malonato)(1,10-phenanthroline)nickel(II) trihydrate
|
Zhao, Shu-Min |
|
2005 |
61 |
12 |
p. m2544-m2545 |
artikel |
287 |
trans-Dichlorobis(tris{4-[(dimethylamino)methyl]phenyl}phosphine)platinum(II)
|
Lutz, Martin |
|
2005 |
61 |
12 |
p. m2728-m2729 |
artikel |
288 |
Triaqua(2,2′-bipyridine-κ2N,N′)(3-carboxyphenoxyacetato-κO)manganese(II) 3-carboxyphenoxyacetate monohydrate
|
Zhang, Xian-Fa |
|
2005 |
61 |
12 |
p. m2471-m2473 |
artikel |
289 |
Tricaesium tetraselenidoarsenate(V) monohydrate
|
Van Almsick, Tobias |
|
2005 |
61 |
12 |
p. i280-i281 |
artikel |
290 |
Trichloro(1,4,7-trimethyl-1,4,7-triazacyclononane)chromium(III)
|
Klitgaard, Søren Kegnaes |
|
2005 |
61 |
12 |
p. m2616-m2617 |
artikel |
291 |
Trierbium nickel trialuminium digermanide, Er3NiAl3Ge2
|
Bodak, O. |
|
2005 |
61 |
12 |
p. i273-i274 |
artikel |
292 |
1,6,7-Trihydroxy-3-methoxy-2,8-bis(3-methyl-2-butenyl)-9H-xanthen-9-one chloroform solvate
|
Boonnak, Nawong |
|
2005 |
61 |
12 |
p. o4376-o4378 |
artikel |
293 |
Trimethylammonium tetrafluoroborate at 100 K
|
Gotoh, Kazuma |
|
2005 |
61 |
12 |
p. o4016-o4017 |
artikel |
294 |
Trimethylarsonium iodide
|
Van Almsick, Tobias |
|
2005 |
61 |
12 |
p. o4229-o4230 |
artikel |
295 |
Tris(1-cyclopropyl-6-methyl-2-(N-methylaminocarbonyl)-4-oxo-1,4-dihydropyridin-4-olato)iron(III) dimethylformamide sesquisolvate dihydrate
|
Tam, Tim F. |
|
2005 |
61 |
12 |
p. m2601-m2603 |
artikel |
296 |
Tris(dimethylphenylsilyl)methanetellurenyl iodide
|
Klapötke, Thomas M. |
|
2005 |
61 |
12 |
p. o4047-o4048 |
artikel |
297 |
Tris(pyridine-κN)[salicylaldehyde (2-hydroxybenzoyl)hydrazonato-κ2N,O]nickel(II) pyridine sesquisolvate
|
Hu, Zong-Qiu |
|
2005 |
61 |
12 |
p. m2526-m2527 |
artikel |
298 |
2,4,6-Tri-tert-butylbenzenetellurenyl iodide
|
Klapötke, Thomas M. |
|
2005 |
61 |
12 |
p. o4045-o4046 |
artikel |
299 |
Xenotime-type Yb[AsO4]
|
Kang, Dong-Hee |
|
2005 |
61 |
12 |
p. i270-i272 |
artikel |
300 |
X-ray powder refinement of a natural garnet from Diamantina, Minas Gerais, Brazil
|
Resende, Jackson Antônio Lamounier Camargos |
|
2005 |
61 |
12 |
p. i265-i267 |
artikel |
301 |
6-[(Z)-Benzylidene]-2,3-diphenyl-2-azabicyclo[2.2.2]octan-5-one
|
Ravikumar, K. |
|
2005 |
61 |
12 |
p. o4198-o4199 |
artikel |
302 |
(Z)-6-{[1,3-Dihydroxy-2-(hydroxymethyl)propan-2-ylamino]methylene}-2-methoxy-4-{(E)-[3-(trifluoromethyl)phenyl]diazenyl}cyclohexa-2,4-dienone
|
Ersanlı, Cem Cüneyt |
|
2005 |
61 |
12 |
p. o4051-o4053 |
artikel |
303 |
(Z)-4-[(E)-(4-Butylphenyl)diazenyl]-6-{[1,3-dihydroxy-2-(hydroxymethyl)propan-2-ylamino]methylene}-2-methoxycyclohexa-2,4-dienone
|
Ersanlı, Cem Cüneyt |
|
2005 |
61 |
12 |
p. o4139-o4141 |
artikel |
|