nr |
titel |
auteur |
tijdschrift |
jaar |
jaarg. |
afl. |
pagina('s) |
type |
1 |
A cationic zinc(II) complex of a new ligand based on N,N,N′,N′-tetramethylstreptamine 2,4,6-orthoformate as the chloride salt
|
Jones, Peter G. |
|
2003 |
59 |
4 |
p. m168-m170 |
artikel |
2 |
A cationic zinc(II) complex of a new ligand based on N,N,N′,N′-tetramethylstreptamine 2,4,6-orthoformate as the trichloro(pyridine)zincate(II) salt
|
Jones, Peter G. |
|
2003 |
59 |
4 |
p. m171-m173 |
artikel |
3 |
2-Acetylbenzo[b]furan
|
Thiruvalluvar, A. |
|
2003 |
59 |
4 |
p. o395-o396 |
artikel |
4 |
1-Acetyl-4-(p-chlorobenzylideneamino)-3-methyl-4,5-dihydro-1H-1,2,4-triazol-5-one
|
Çoruh, Ufuk |
|
2003 |
59 |
4 |
p. o530-o532 |
artikel |
5 |
A dithietane of 2-methylpropanedithioic acid
|
Mahjoub, Ahmed |
|
2003 |
59 |
4 |
p. o545-o546 |
artikel |
6 |
2-Amino-4-phenyl-5,6-dihydrobenzo[h]quinazoline
|
Wang, Xiangshan |
|
2003 |
59 |
4 |
p. o423-o424 |
artikel |
7 |
Ammonium 2-mercaptopyridine-3-carboxylate hydrate
|
Smith, Graham |
|
2003 |
59 |
4 |
p. o540-o541 |
artikel |
8 |
()-anti-7-Ethyl-1-(4-methoxyphenyl)-5,5,syn-8-trimethyl-2-oxabicyclo[2.2.2]octan-3-one, a bicyclic δ-lactone
|
Xie, Songwen |
|
2003 |
59 |
4 |
p. o403-o405 |
artikel |
9 |
Aqua(trifluoroacetato)triphenyltin–2,2′-bipyridine (2/2)
|
Chee, Chin Fei |
|
2003 |
59 |
4 |
p. m205-m206 |
artikel |
10 |
Aqua(trifluoroacetato)triphenyltin–15-crown-5 (2/1)
|
Chee, Chin Fei |
|
2003 |
59 |
4 |
p. m202-m204 |
artikel |
11 |
Aquatriphenyl(trifluoroacetato)tin–2,2′:6′,2′′-terpyridine (1/1)
|
Chee, Chin Fei |
|
2003 |
59 |
4 |
p. m174-m175 |
artikel |
12 |
A synchrotron study of μ3-chloro-tri-μ-chloro-μ3-sulfido-hexakis(triphenylphospine)triruthenium(II)–tetrahydrofuran–water (1/1.25/0.75)
|
Tolhurst, Vicki-Anne |
|
2003 |
59 |
4 |
p. m218-m219 |
artikel |
13 |
1-(Benzotriazol-1-ylmethyl)-5-(4-dimethylaminophenyl)-3-phenyl-4,5-dihydro-1H-pyrazole
|
Low, John Nicolson |
|
2003 |
59 |
4 |
p. o517-o518 |
artikel |
14 |
1,2-Bis(benzothiazol-2-ylsulfanyl)ethane
|
Zou, Ru-Qiang |
|
2003 |
59 |
4 |
p. o393-o394 |
artikel |
15 |
Bis[μ-bis(diphenylphosphino)methane-κ2P:P′]bis[diacetonitrilecopper(I)] bis(hexafluorophosphate)
|
Wu, Mei-Mei |
|
2003 |
59 |
4 |
p. m195-m196 |
artikel |
16 |
Bis(diethylenetriamine-κ3N)nickel hexafluorogermanate
|
Zhang, Hong-Xia |
|
2003 |
59 |
4 |
p. m185-m187 |
artikel |
17 |
5,17-Bis(diphenylphosphinoyl)-25,26,27,28-tetrapropoxycalix[4]arene
|
Jeunesse, Catherine |
|
2003 |
59 |
4 |
p. o428-o429 |
artikel |
18 |
1,4-Bis(2-mercaptobenzothiazolyl)butane
|
Chen, Chunlong |
|
2003 |
59 |
4 |
p. o453-o454 |
artikel |
19 |
Bis[N,N′-bis(2-fluorobenzylidene)ethylenediamine-κ2N,N′]silver(I) nitrate
|
Usman, Anwar |
|
2003 |
59 |
4 |
p. m140-m141 |
artikel |
20 |
1,3-Bis(2,2′:6′,2′′-terpyridin-4′-yl)benzene, a new dinucleating bis(tridentate) ligand, as its dichloromethane solvate
|
Vaduvescu, Simona |
|
2003 |
59 |
4 |
p. o483-o484 |
artikel |
21 |
Bis(thiosemicarbazido-κ2N,S)nickel(II)–succinate–succinic acid (1/1/1)
|
Li, Sheng-Li |
|
2003 |
59 |
4 |
p. m199-m201 |
artikel |
22 |
Bis(triphenylphosphine)iminium μ-acetato-di-μ-acetylacetonato-bis[acetylacetonatomagnesate(II)] monohydrate
|
Jones, Peter G. |
|
2003 |
59 |
4 |
p. m192-m194 |
artikel |
23 |
3-Bromo-4-(dicyclohexylphosphinoyl)-2,6-dimethoxypyridine
|
Wu, Jing |
|
2003 |
59 |
4 |
p. o493-o494 |
artikel |
24 |
2-[(4-Bromophenyl)amino]-1-phenylethanone
|
Saraogi, Ishu |
|
2003 |
59 |
4 |
p. o443-o444 |
artikel |
25 |
(5-Bromopyrrol-3-yl)cyclohexylmethanone
|
Emge, Thomas J. |
|
2003 |
59 |
4 |
p. o425-o427 |
artikel |
26 |
catena-[1,3-Diammoniopropane di-μ2-hydroxo-di-μ4-phosphato-trioxotrivanadium dihydrate]: a redetermination at 180 (2) K
|
Almeida Paz, Filipe A. |
|
2003 |
59 |
4 |
p. m179-m182 |
artikel |
27 |
catena-Poly[[bis(3-aminobenzoic acid-κN)cadmium(II)]-di-μ-thiocyanato-κ4N:S;S:N]
|
Wang, Ruihu |
|
2003 |
59 |
4 |
p. m152-m154 |
artikel |
28 |
catena-Poly[disodium [[tris(formato-κO)copper(II)]-μ2-formato-κ2O:O′]], with partial substitution of formate by acetate, Na2n[Cu(O2CH)4−x(O2CCH3)x]n (x = 0.28)
|
Golobič, Amalija |
|
2003 |
59 |
4 |
p. m165-m167 |
artikel |
29 |
catena-Poly[[[μ-N,N′-bis(2-aminoethyl)oxamido]dicopper(II)]-di-μ-dicyanoamido]
|
Chu, Sheng |
|
2003 |
59 |
4 |
p. m215-m217 |
artikel |
30 |
1-(4-Chloro-2-nitrophenyl)-4,4′-bipyridinium triiodide
|
Sun, Yan-Qiong |
|
2003 |
59 |
4 |
p. o542-o544 |
artikel |
31 |
2-Chlorophenyl 4-toluenesulfonate: molecular aggregration through weak C—H⋯O interactions
|
Vembu, Nagarajan |
|
2003 |
59 |
4 |
p. o503-o505 |
artikel |
32 |
cis-Dichlorobis(4,4′-dimethyl-2,2′-bipyridine)iridium(III) hexafluorophosphate
|
Yoshikawa, Naokazu |
|
2003 |
59 |
4 |
p. m155-m156 |
artikel |
33 |
Cobalt hydrogen selenite chloride dihydrate, Co(HSeO3)Cl·2H2O
|
Johnston, Magnus G. |
|
2003 |
59 |
4 |
p. i62-i64 |
artikel |
34 |
(18-Crown-6-κ6O)potassium 2,4-dinitrophenolate 2,4-dinitrophenol
|
Barnes, John C. |
|
2003 |
59 |
4 |
p. m160-m161 |
artikel |
35 |
Di-μ-acetato-κ3O,O′:O′-di-μ-trichloroacetato-κ2O:O′-bis[aqua(trichloroacetato)(1,10-phenanthroline-κ2N,N′)praseodymium(III)] dimethylformamide disolvate
|
Shi, Zhan |
|
2003 |
59 |
4 |
p. m142-m144 |
artikel |
36 |
Dianilinium tetradecachlorohexamolybdate dihydrate, (PhNH3)2[(Mo6Cl8)Cl6]·2H2O
|
Flemström, Andreas |
|
2003 |
59 |
4 |
p. m162-m164 |
artikel |
37 |
(3,4),(6,7)Dibenzo-9,10-dicyanotriquinacene
|
Jones, Peter G. |
|
2003 |
59 |
4 |
p. o522-o523 |
artikel |
38 |
8,10-Dibenzylimidazonorbornylene
|
Gouin, Sebastien G. |
|
2003 |
59 |
4 |
p. o401-o402 |
artikel |
39 |
Di-μ3-bromo-dibromotetrakis[μ-diphenyl(2-pyridyl)phosphine)]tetracopper(I) dichloromethane hexasolvate
|
Zhou, Jian-Liang |
|
2003 |
59 |
4 |
p. m176-m178 |
artikel |
40 |
4,5-Dibromo-1-methyl-1H-imidazole
|
Noland, Wayland E. |
|
2003 |
59 |
4 |
p. o458-o460 |
artikel |
41 |
[Dicarbonyl(η5-cyclopentadienyl)iron(II)]-μ2-1,3-propanediyl-[dicarbonyl(η5-cyclopentadienyl)ruthenium(II)]
|
Friedrich, Holger B. |
|
2003 |
59 |
4 |
p. m145-m147 |
artikel |
42 |
4-{[3,4-Dihydro-5-methyl-3-oxo-2-phenyl-2H-pyrazol-4-ylidene](phenyl)methylamino}-1,5-dimethyl-2-phenyl-1H-pyrazol-3(2H)-one
|
Wang, Jin-Ling |
|
2003 |
59 |
4 |
p. o430-o432 |
artikel |
43 |
Di-μ-iodo-bis[dicarbonylrhodium(I)]
|
Burger, Sylvain |
|
2003 |
59 |
4 |
p. i53-i54 |
artikel |
44 |
(2,6-Diisopropylphenyl)isopropylideneammonium iodide
|
Baker, Robert J. |
|
2003 |
59 |
4 |
p. o538-o539 |
artikel |
45 |
3,4-Dimethoxyphenylacetic acid
|
Chopra, Deepak |
|
2003 |
59 |
4 |
p. o433-o434 |
artikel |
46 |
(4,4′-Dimethyl-2,2′-bipyridine)(ethynylbenzene)(triphenylphosphine)platinum(II) hexafluoroantimonate
|
Wu, Mei-Mei |
|
2003 |
59 |
4 |
p. m210-m211 |
artikel |
47 |
Dimethyl{3-[1-methyl-4-(1-methyl-4-nitropyrrole-2-carboxamido)pyrrole-2-carboxamido]propyl}ammonium chloride methanol solvate
|
Lu, Liping |
|
2003 |
59 |
4 |
p. o417-o419 |
artikel |
48 |
3,5-Dinitroxytricyclo[2.2.1.02,6]heptane
|
Öztürk, Sema |
|
2003 |
59 |
4 |
p. o550-o552 |
artikel |
49 |
1,4-Diphenyl-2,3-dithien-3-ylcyclopentadien-1-one
|
Linehan, Justin |
|
2003 |
59 |
4 |
p. o466-o468 |
artikel |
50 |
Dipotassium disodium trans-bis(pyrazine-2,3-dicarboxylato)copper(II) dithiocyanate dihydrate
|
Wang, Ming-Sheng |
|
2003 |
59 |
4 |
p. m212-m214 |
artikel |
51 |
Dipotassium zinc bis(dihydrogendiphosphate) dihydrate, K2Zn(H2P2O7)2·2H2O
|
Tahiri, Aziz Alaoui |
|
2003 |
59 |
4 |
p. i50-i52 |
artikel |
52 |
Di-tert-butyl 3,6-bis(2-methylphenyl)-1,4-dioxo-1,2,4,5-tetrahydropyrrolo[3,4-c]pyrrole-2,5-dicarboxylate
|
Mizuguchi, Jin |
|
2003 |
59 |
4 |
p. o472-o473 |
artikel |
53 |
Di-tert-butyl 7,14-dihydro-7,14-dioxoquino[2,3-b]acridine-5,12-dicarboxylate
|
Mizuguchi, Jin |
|
2003 |
59 |
4 |
p. o474-o475 |
artikel |
54 |
(3E)-3-[(4-Hexylphenyl)imino]1H-indol-2(3H)-one
|
Öztürk, Sema |
|
2003 |
59 |
4 |
p. o569-o571 |
artikel |
55 |
Ethyl 3-(1-benzoyl-3-phenylaziridin-2-yl)propenoate
|
Batsanov, Andrei S. |
|
2003 |
59 |
4 |
p. o509-o510 |
artikel |
56 |
()-5-Ethyl-endo-4-(4-methoxyphenyl)-2,2,anti-8-trimethyl-6-oxabicyclo[3.2.1]octan-7-one, a bicyclic γ-lactone
|
Xie, Songwen |
|
2003 |
59 |
4 |
p. o406-o407 |
artikel |
57 |
Ethylenediammonium tetraaquabis(sulfato)iron(II)
|
Held, Peter |
|
2003 |
59 |
4 |
p. m197-m198 |
artikel |
58 |
Ethyl (2S*)-2-[(2R*,2′R*,5S*)-2′,5-dimethyl-5′-oxoperhydro-[2,2′]]bifuranyl-5-yl]-2-hydroxyethanoate
|
Coles, Simon J. |
|
2003 |
59 |
4 |
p. o501-o502 |
artikel |
59 |
1-Ethynyl-2-isopropoxy-3-methoxybenzene
|
Williams, Craig M. |
|
2003 |
59 |
4 |
p. o561-o563 |
artikel |
60 |
Guest differentiation in a 6I,6II-disubstituted β-cyclodextrin
|
Lichtenthaler, Frieder W. |
|
2003 |
59 |
4 |
p. o408-o411 |
artikel |
61 |
Hexacarbonyldicobalt addition across the C[triple-bond]C bond of the alkynethiolate ligand in the cluster [Ru3(μ3,η2-C[triple-bond]CSiMe3)(μ-SC[triple-bond]CSiMe3)(CO)9]
|
Delgado, Esther |
|
2003 |
59 |
4 |
p. m207-m209 |
artikel |
62 |
5-(1H-Indol-3-yl)-1-phenylpent-4-ene-1,3-dione
|
Arrieta, Antonio F. |
|
2003 |
59 |
4 |
p. o524-o526 |
artikel |
63 |
1H-Nicotinamidium 3,5-dinitrosalicylate
|
Koman, Marian |
|
2003 |
59 |
4 |
p. o441-o442 |
artikel |
64 |
1-(2-Hydroxyethyl)-4-{4,5,6,7-tetrahydro-1-[1-(2-hydroxyethyl)-pyridin-4(1H)-ylidene]-1H-inden-3-yl}pyridinium iodide
|
Gainsford, Graeme J. |
|
2003 |
59 |
4 |
p. o589-o590 |
artikel |
65 |
4′-Hydroxy-3′-methoxyacetophenone (acetovanillone)
|
Ma, Guibin |
|
2003 |
59 |
4 |
p. o579-o580 |
artikel |
66 |
5-[(2-Hydroxyphenyl)methyleneamino]-1,3,4-thiadiazole-2(3H)-thione
|
Zhang, Yu-Xia |
|
2003 |
59 |
4 |
p. o581-o582 |
artikel |
67 |
3-Hydroxypyridinium 2,5-dihydroxybenzoate
|
Fukunaga, Takeo |
|
2003 |
59 |
4 |
p. o420-o422 |
artikel |
68 |
4-Hydroxy-3,6,9-trimethyl-2,3-dihydrobenzo[de]chromene-7,8-dione
|
Guo, Xin-Dong |
|
2003 |
59 |
4 |
p. o558-o560 |
artikel |
69 |
K2MoO2P2O7
|
Zid, Mohamed Faouzi |
|
2003 |
59 |
4 |
p. i65-i67 |
artikel |
70 |
KPrF4
|
Werner, Franz |
|
2003 |
59 |
4 |
p. i47-i49 |
artikel |
71 |
Li3Sc(MoO4)3: substitutional disorder on three (Li,Sc) sites
|
Kolitsch, Uwe |
|
2003 |
59 |
4 |
p. i55-i58 |
artikel |
72 |
(m-Carboxyphenyl)ammonium perchlorate at 223 K
|
Bendjeddou, Lamia |
|
2003 |
59 |
4 |
p. o574-o576 |
artikel |
73 |
Mersinine A from Kopsia fruticosa
|
Subramaniam, G. |
|
2003 |
59 |
4 |
p. o555-o557 |
artikel |
74 |
Methyl 4-amino-2-oxo-1,2-dihydroquinoline-3-carboxylate
|
Rybakov, Victor B. |
|
2003 |
59 |
4 |
p. o412-o414 |
artikel |
75 |
Methyl ()-(1α,2β,8α,9α,10β)-2-chloro-4-aza-3-oxatetracyclo[8.4.0.02,9.04,8]tetradecane-9-carboxylate oxalic acid monohydrate
|
Yufit, Dmitrii S. |
|
2003 |
59 |
4 |
p. o572-o573 |
artikel |
76 |
Methyl (E)-2-acetyl-3-amino-2-pentenoate
|
Chen, Xuanhua |
|
2003 |
59 |
4 |
p. o553-o554 |
artikel |
77 |
Methyl 2-(4-methoxypyrimidin-2-ylcarbamoylsulfamoyl)benzoate
|
Ma, Ning |
|
2003 |
59 |
4 |
p. o438-o440 |
artikel |
78 |
1-Methyl-4-nitro-2-(trichloroacetyl)pyrrole
|
Lu, Liping |
|
2003 |
59 |
4 |
p. o478-o479 |
artikel |
79 |
6-Methyl-4-phenylthieno[2,3-b]pyridine-2,5-dicarboxylic acid
|
Novoa de Armas, Héctor |
|
2003 |
59 |
4 |
p. o450-o452 |
artikel |
80 |
Monoclinic form of 7-nitro-2-phenyl-1,2-benzisoselenazol-3(2H)-one
|
Dupont, Léon |
|
2003 |
59 |
4 |
p. o547-o549 |
artikel |
81 |
N-(4-Bromo-2-nitrophenyl)-N-methyl-N'-(quinolin-4-ylmethylene)hydrazine
|
Öztürk, Sema |
|
2003 |
59 |
4 |
p. o488-o489 |
artikel |
82 |
14-n-Butyldibenz[a,h]acridine
|
Ray, Jayanta Kumar |
|
2003 |
59 |
4 |
p. o514-o516 |
artikel |
83 |
N-(4-Ethoxyphenyl)-2-[(4-ethoxyphenylcarbamoyl)methoxy]acetamide monohydrate, a supramolecular chain structure formed by hydrogen bonds
|
Li, Xiao-Feng |
|
2003 |
59 |
4 |
p. o435-o437 |
artikel |
84 |
N—H⋯O hydrogen bonding in the adduct of N-(2-aminoethyl)-2-hydroxybenzamide with picric acid
|
Tang, Yu |
|
2003 |
59 |
4 |
p. o577-o578 |
artikel |
85 |
N,N′-Bis(4-methylphenyl)pyridine-2,6-dicarboxamide
|
Qi, Jian Ying |
|
2003 |
59 |
4 |
p. o415-o416 |
artikel |
86 |
N,N-Dimethylbiguanidium nitrate
|
Zhu, Miaoli |
|
2003 |
59 |
4 |
p. o586-o588 |
artikel |
87 |
N,N-Dimethyl-N′-(o-fluorobenzoyl)hydrazide
|
Muir, Kenneth W. |
|
2003 |
59 |
4 |
p. o490-o492 |
artikel |
88 |
N,N,N′,N′-Tetramethylstreptamine 2,4,6-orthoformate
|
Beckmann, Claus |
|
2003 |
59 |
4 |
p. o564-o565 |
artikel |
89 |
N,N,N′,N′-Tetramethylstreptamine 2,4,6-orthoformate hydrochloride
|
Beckmann, Claus |
|
2003 |
59 |
4 |
p. o566-o568 |
artikel |
90 |
N-p-Bromophenyl-N′-(2-chlorobenzoyl)urea
|
Yamin, Bohari M. |
|
2003 |
59 |
4 |
p. o399-o400 |
artikel |
91 |
8-[N-(tert-Butoxycarbonyl)-l-glycyl]quinolin-8-amine
|
Shao, Ying |
|
2003 |
59 |
4 |
p. o527-o529 |
artikel |
92 |
n-Undecylammonium bromide monohydrate
|
Rademeyer, Melanie |
|
2003 |
59 |
4 |
p. o480-o482 |
artikel |
93 |
(−)-(P)-N,N′-Bis[(5-bromo-2-hydroxyphenyl)methylidene]-6,6′-dimethyl-1,1′-biphenyl-2,2′-dimethanamine
|
Linden, Anthony |
|
2003 |
59 |
4 |
p. o390-o392 |
artikel |
94 |
4-(2-Pyridyl)-1H,2H-pyrido[1,2-c]pyrimidine-1,3-dione
|
Wolska, Irena |
|
2003 |
59 |
4 |
p. o511-o513 |
artikel |
95 |
Quinolinium fumarate
|
Shan, Ning |
|
2003 |
59 |
4 |
p. o397-o398 |
artikel |
96 |
r-2,c-6-Bis(4-chlorophenyl)-t-3,t-5-dimethyltetrahydropyran-4-one
|
Jose Kavitha, Savaridasson |
|
2003 |
59 |
4 |
p. o463-o465 |
artikel |
97 |
r-2,c-6-Bis(p-tolyl)-t-3,t-5-dimethyltetrahydropyran-4-one
|
Krishnamoorthy, Belli Sundaram |
|
2003 |
59 |
4 |
p. o461-o462 |
artikel |
98 |
Redetermination of bis(N,N-diethyldithiocarbamato-κS)dimethyltin(IV) at low temperature
|
Mohamed, Ajax K. |
|
2003 |
59 |
4 |
p. m190-m191 |
artikel |
99 |
Redetermination of 4,4′-dibromobiphenyl
|
Mohamed, Ajax K. |
|
2003 |
59 |
4 |
p. o476-o477 |
artikel |
100 |
Redetermination of 5,11,17,23-tetra-tert-butyl-25,27-di(ethoxycarbonylmethoxy)-26,28-dihydroxycalix[4]arene chloroform disolvate at low temperature
|
Bolte, Michael |
|
2003 |
59 |
4 |
p. o533-o534 |
artikel |
101 |
(1R,2R)-(+)-1,2-Diphenylethylenediamine
|
Jones, Matthew D. |
|
2003 |
59 |
4 |
p. o455-o457 |
artikel |
102 |
(RS)-Phenylsuccinic acid
|
Fischer, Andreas |
|
2003 |
59 |
4 |
p. o485-o487 |
artikel |
103 |
(6R,9S,13R,14S)-7,8-Didehydro-3,7-dimethoxy-17-methyl-6-phenylmorphinan-4,6-diol
|
Li, Chun-Bao |
|
2003 |
59 |
4 |
p. o498-o500 |
artikel |
104 |
(S)-(−)-2,2′-Bis(diphenylphosphino)-1,1′-binaphthyl, a versatile chelating ligand
|
Jones, Matthew D. |
|
2003 |
59 |
4 |
p. o535-o537 |
artikel |
105 |
Tetraaquatetrakis[2-(2-hydroxyethylamino)ethanolato]tetracopper(II) tetranitrate 14/3-hydrate
|
Vinogradova, Elena A. |
|
2003 |
59 |
4 |
p. m148-m151 |
artikel |
106 |
Tetrabutylammonium 2,6-dihydroxybenzoate 2,6-dihydroxybenzoic acid solvate
|
Almeida Paz, Filipe A. |
|
2003 |
59 |
4 |
p. o506-o508 |
artikel |
107 |
Tetrachloro(N,N,N′,N′-tetramethylethylenediamine)zirconium(IV)
|
Rickard, Clifton E. F. |
|
2003 |
59 |
4 |
p. m183-m184 |
artikel |
108 |
Tetragonal form of barium cobalt disilicate, Ba2CoSi2O7
|
El Bali, Brahim |
|
2003 |
59 |
4 |
p. i59-i61 |
artikel |
109 |
2,2,6,6-Tetramethyl-4-oxopiperidinium trifluoroacetate
|
Breitung, Sven |
|
2003 |
59 |
4 |
p. o445-o446 |
artikel |
110 |
The 1:2 bis(maleonitriledithiolato)palladium(II) complex of the N-(2-fluoro-4-bromobenzyl)pyridinium cation
|
Chen, Youcun |
|
2003 |
59 |
4 |
p. m157-m159 |
artikel |
111 |
The 2:1 complex of 4-aminobenzoic acid and 4,4′-bipyridyl N,N′-dioxide
|
Moreno-Fuquen, Rodolfo |
|
2003 |
59 |
4 |
p. o495-o497 |
artikel |
112 |
The β-form of di-tert-butyl 1,4-dioxo-3,6-diphenyl-1,2,4,5-tetrahydropyrrolo[3,4-c]pyrrole-2,5-dicarboxylate
|
Mizuguchi, Jin |
|
2003 |
59 |
4 |
p. o469-o471 |
artikel |
113 |
trans-(3R,2aS)-(−)-3-Phenyl-2,3,5,6,7,8-hexahydro-oxazolo[3,2-a]pyridine-5-thione
|
Roa, Luis-Fernando |
|
2003 |
59 |
4 |
p. o519-o521 |
artikel |
114 |
Tris(N,N-diethyldithiocarbamato-κ2S,S′)nickel(II)
|
Mohamed, Ajax K. |
|
2003 |
59 |
4 |
p. m188-m189 |
artikel |
115 |
(Z)-α-Chloromethyl-3,3′,4,4′-tetramethoxystilbene
|
Stomberg, Rolf |
|
2003 |
59 |
4 |
p. o583-o585 |
artikel |
116 |
Zwitterionic 2-guanidinium-1-aminocarboxylate monohydrate
|
Kolev, Tsonko |
|
2003 |
59 |
4 |
p. o447-o449 |
artikel |
|