nr |
titel |
auteur |
tijdschrift |
jaar |
jaarg. |
afl. |
pagina('s) |
type |
1 |
2a′-Chloro-3,8-dioxo-1′,2′,2a′,8a′-tetrahydrodispiro[cyclopropane-1,1′-cyclobuta[b]napthalene-2′,1′′-cyclopropane]
|
Wang, Lei |
|
2003 |
59 |
2 |
p. o106-o107 |
artikel |
2 |
A dimer of 7-cyanodibenzobarrelene
|
Jones, Peter G. |
|
2003 |
59 |
2 |
p. o167-o168 |
artikel |
3 |
β-Alaninium trichloroacetate at 105 K
|
Rajagopal, K. |
|
2003 |
59 |
2 |
p. o206-o208 |
artikel |
4 |
2-Amino-4-(4-chlorophenylthio)-5-phenyl-6-(1-piperidyl)pyrimidine
|
Lynch, Daniel E. |
|
2003 |
59 |
2 |
p. o222-o224 |
artikel |
5 |
5-Amino-4-(4-dimethylaminophenyl)-2-(4-methoxyphenyl)-7-(pyrrolidin-1-yl)-1,6-naphthyridine-8-carbonitrile
|
Bhaskaran, Sundari |
|
2003 |
59 |
2 |
p. o200-o202 |
artikel |
6 |
Ammonium dipotassium hydrogen difluorophosphate at room temperature
|
Krupková, Radmila |
|
2003 |
59 |
2 |
p. i14-i16 |
artikel |
7 |
An orthorhombic modification of lithium chloride monohydrate
|
Lerner, Hans-Wolfram |
|
2003 |
59 |
2 |
p. i20-i21 |
artikel |
8 |
An unsymmetrical tetrathiafulvalene with a fused 1,2,5-thiadiazole ring and an ethylenedioxy group
|
Tomura, Masaaki |
|
2003 |
59 |
2 |
p. o145-o147 |
artikel |
9 |
A potassium crown ether complex with dichloroaurate(I)
|
Hossain, Md. Alamgir |
|
2003 |
59 |
2 |
p. m57-m58 |
artikel |
10 |
A potassium cryptate-2,2,2 salt of tricarbonyl(η4-cyclopentadiene)manganese
|
Shao, Li |
|
2003 |
59 |
2 |
p. m69-m71 |
artikel |
11 |
A triclinic polymorph of octa-tert-butoxytetralithiumtetrasodium
|
Clegg, William |
|
2003 |
59 |
2 |
p. m64-m66 |
artikel |
12 |
α-BaCaAlF7
|
Werner, Franz |
|
2003 |
59 |
2 |
p. i17-i19 |
artikel |
13 |
(Benzoylmethyl)triphenylphosphonium iodide: supramolecular zigzag chains via C—H⋯O hydrogen bonding stabilized by C—H⋯I interactions
|
Baby Mariyatra, Mahimaidoss |
|
2003 |
59 |
2 |
p. o255-o257 |
artikel |
14 |
Bis[μ-bis(diphenylphosphino)methane]digold(I) bis(hexafluorophosphate) dichloromethane disolvate
|
Wu, Meimei |
|
2003 |
59 |
2 |
p. m72-m73 |
artikel |
15 |
4,11-Bis(4-chlorophenyl)-3,10-bis(2,6-dichlorophenyl)-1,8-dioxa-2,9-diazadispiro[4.1.4.3]tetradeca-2,9-dien-6-one 0.75-hydrate
|
Li, Xiao-Fang |
|
2003 |
59 |
2 |
p. o247-o249 |
artikel |
16 |
Bis(cinchonidinium) l-tartrate dihydrate
|
Zhang, Hui |
|
2003 |
59 |
2 |
p. o183-o185 |
artikel |
17 |
Bis(4-dimethylaminopyridinium) 1,2-difluorodiphosphate
|
Sluka, Radek |
|
2003 |
59 |
2 |
p. o190-o192 |
artikel |
18 |
Bis(dl-aspartic acid) oxalate
|
Alagar, M. |
|
2003 |
59 |
2 |
p. o108-o110 |
artikel |
19 |
Bis(μ-8-hydroxy-7-iodoquinoline-5-sulfonato-κ3N,O:O′)bis[triaquazinc(II)] tetrahydrate
|
Francis, Savarimuthu |
|
2003 |
59 |
2 |
p. m87-m90 |
artikel |
20 |
Bis(melaminium) hydrogen phosphite tetrahydrate
|
Gordon, Laura E. |
|
2003 |
59 |
2 |
p. o195-o197 |
artikel |
21 |
Bis(η5-pentamethylcyclopentadienyl)[bis-η5-syn-[2.2](4,7)indenophanyl]diruthenium(II)
|
Jones, Peter G. |
|
2003 |
59 |
2 |
p. m85-m86 |
artikel |
22 |
2-Bromo-N-[3-bromo-1-(phenylsulfonyl)indol-2-ylmethyl]-4-methylaniline
|
Govind, M. M. |
|
2003 |
59 |
2 |
p. o177-o179 |
artikel |
23 |
2-(4-Bromophenyl)-5-methyl-2,3-dihydro-4H-1,2,4-triazol-3-one
|
Thamotharan, S. |
|
2003 |
59 |
2 |
p. o225-o226 |
artikel |
24 |
5-Butylthevinone: stereochemistry of the Diels–Alder reaction of 5-butylthebaine with 3-buten-2-one
|
Chen, Weibin |
|
2003 |
59 |
2 |
p. o114-o116 |
artikel |
25 |
catena-Poly[[bis(4-cyanobenzoato)copper(II)]-μ-4,4′-bipyridine-κ2N:N′]
|
He, Hong-Yin |
|
2003 |
59 |
2 |
p. o174-o176 |
artikel |
26 |
catena-Poly[[silver(I)-μ-2,5-bis(4-pyridyl)-1,3,4-oxadiazole] nitrate], a one-dimensional coordination polymer exhibiting a double-chain supramolecular structure through hydrogen bonds
|
Liu, He |
|
2003 |
59 |
2 |
p. m59-m60 |
artikel |
27 |
Chloro[tris(perfluorophenyl)phosphine]gold(I)
|
Chen, Hsiao Wei |
|
2003 |
59 |
2 |
p. m50-m52 |
artikel |
28 |
1′-Deoxy-1′-hydroxymethyl-1,2′-O-isopropylidene-β-d-arabinofuranose
|
Doboszewski, Bogdan |
|
2003 |
59 |
2 |
p. o158-o160 |
artikel |
29 |
2,3:9,10-Dibenzotricyclo[5.3.0.04,8]deca-2,5,9-triene-6,7-dicarbonitrile
|
Jones, Peter G. |
|
2003 |
59 |
2 |
p. o220-o221 |
artikel |
30 |
Dichloro{2-[N-(2-hydroxyethylammonioethyl)iminomethyl]phenolate}zinc(II)
|
Usman, Anwar |
|
2003 |
59 |
2 |
p. o215-o217 |
artikel |
31 |
9,10-Dicyanodibenzoisobullvalene
|
Jones, Peter G. |
|
2003 |
59 |
2 |
p. o169-o170 |
artikel |
32 |
Diethyl (4-tert-butyl-1,3-thiazol-2-ylaminomethylene)malonate
|
Lynch, Daniel E. |
|
2003 |
59 |
2 |
p. o242-o243 |
artikel |
33 |
2,7-Dimethyl-4,5-bis(trimethylsilyl)octa-2,3,5,6-tetraene
|
Jones, Peter G. |
|
2003 |
59 |
2 |
p. o119-o120 |
artikel |
34 |
Dimethylethylammonium bromide
|
Scheibitz, Matthias |
|
2003 |
59 |
2 |
p. o253-o254 |
artikel |
35 |
6,6-Dimethyl-2-(1-methylethenyl)-3,4,5-tris(1-methylethylidene)-1-(2-methylpropen-1-yl)cyclohexane
|
Jones, Peter G. |
|
2003 |
59 |
2 |
p. o186-o187 |
artikel |
36 |
3-{3,3-Dimethylspiro[2,3-dihydro-1H-indole-2,3′-(3′H-naphtho[2,1-b][1,4]oxazin)]-1-yl}propionic acid
|
Gao, Yu |
|
2003 |
59 |
2 |
p. o135-o137 |
artikel |
37 |
5,6-Dioxo-1,10-phenanthrolin-1-ium bromide at 120 K
|
Bomfim, João A. S. |
|
2003 |
59 |
2 |
p. o244-o246 |
artikel |
38 |
Diphenyl (3,3-diphenoxycyclohexyl)phosphonate
|
Guzei, Ilia A. |
|
2003 |
59 |
2 |
p. o129-o131 |
artikel |
39 |
dl-Phenylalaninium maleate at 123 K
|
Alagar, M. |
|
2003 |
59 |
2 |
p. o209-o211 |
artikel |
40 |
(1E,3S,4aR,12aR)-3-Isopropenyl-8-methoxy-3,4,4a,5,6,11,12,12a-octahydro-1(2H)-chrysenone oxime
|
Kooijman, Huub |
|
2003 |
59 |
2 |
p. o121-o123 |
artikel |
41 |
7-Ethylamino-4-(trifluoromethyl)coumarin
|
Jasinski, Jerry P. |
|
2003 |
59 |
2 |
p. o153-o154 |
artikel |
42 |
Ethyl 5-ethoxymethylene-2-methyl-6-oxo-4-phenyl-1,4,5,6-tetrahydropyridine-3-carboxylate
|
Novoa de Armas, Héctor |
|
2003 |
59 |
2 |
p. o230-o231 |
artikel |
43 |
1-Ethyl-2-nitroguanidine
|
Vasiliev, Alexander D. |
|
2003 |
59 |
2 |
p. o193-o194 |
artikel |
44 |
[2.2](2,5)Furanoparacyclophane-12,13-dicarbaldehyde
|
Jones, Peter G. |
|
2003 |
59 |
2 |
p. o188-o189 |
artikel |
45 |
Guaninium sulfate monohydrate
|
Cherouana, Aouatef |
|
2003 |
59 |
2 |
p. o180-o182 |
artikel |
46 |
Hydrazine carbodithioic acid pyridinium-2-yl methyl ester chloride
|
Crouse, Karen A. |
|
2003 |
59 |
2 |
p. o148-o150 |
artikel |
47 |
l-Valinium hydrogenphosphite
|
Bendheif, Leulmi |
|
2003 |
59 |
2 |
p. o141-o142 |
artikel |
48 |
1-(4-Methacryloyloxyphenyl)-3-(3-bromophenyl)prop-2-en-1-one
|
Ravishankar, T. |
|
2003 |
59 |
2 |
p. o138-o140 |
artikel |
49 |
2-(4-Methoxyphenyl)-5-(4-methylpent-3-enyl)-2,3,3a,4,7,7a-hexahydro-1H-isoindole-1,3-dione
|
Lynch, Daniel E. |
|
2003 |
59 |
2 |
p. o198-o199 |
artikel |
50 |
NaAl(MoO4)2: a rare structure type among layered yavapaiite-related AM(XO4)2 compounds
|
Kolitsch, Uwe |
|
2003 |
59 |
2 |
p. i10-i13 |
artikel |
51 |
N-Benzoyl-N′-phenylthiourea
|
Yamin, Bohari M. |
|
2003 |
59 |
2 |
p. o151-o152 |
artikel |
52 |
N-[3,5-Bis(trifluoromethyl)phenyl]salicylaldimine
|
Karadayı, Nevzat |
|
2003 |
59 |
2 |
p. o161-o163 |
artikel |
53 |
N-(3-Chlorophenyl)-α-(2-hydroxyphenyl)nitrone: supramolecular aggregation through π–π and C–H⋯π interactions
|
Mothi Mohamed, Ebrahim |
|
2003 |
59 |
2 |
p. o234-o236 |
artikel |
54 |
N-[N-(Furan-2-carbonyl)hydrazinothiocarbonyl]benzamide
|
Yamin, Bohari M. |
|
2003 |
59 |
2 |
p. o124-o126 |
artikel |
55 |
N-Phenethylbiguanidium tetrachlorozincate(II)
|
Zhu, Miaoli |
|
2003 |
59 |
2 |
p. m91-m94 |
artikel |
56 |
(O-Ethyldithiocarbonato)[tris(p-methoxyphenyl)phosphine]gold(I)
|
Ho, Soo Yei |
|
2003 |
59 |
2 |
p. m53-m54 |
artikel |
57 |
1-O-p-Toluenesulfonyl-2,3:4,5-di-O-isopropylidene-l-arabitol
|
Jones, Peter G. |
|
2003 |
59 |
2 |
p. o117-o118 |
artikel |
58 |
Orthorhombic Yb5Si4 from synchrotron powder data
|
Černý, Radovan |
|
2003 |
59 |
2 |
p. i1-i3 |
artikel |
59 |
[2.2](2,7)Oxepinoparacyclophane-4,5-dicarbonitrile
|
Jones, Peter G. |
|
2003 |
59 |
2 |
p. o218-o219 |
artikel |
60 |
3-Oxoolean-12-en-20-yl α-methylcarboxylate
|
Doriguetto, Antonio C. |
|
2003 |
59 |
2 |
p. o164-o166 |
artikel |
61 |
Phyllanthin from the plant Phyllanthus amarus
|
Rajakannan, V. |
|
2003 |
59 |
2 |
p. o203-o205 |
artikel |
62 |
(Piperidine-κN)[N-(salicylidene)phenylalaninato-κ3O,N,O′]copper(II)
|
Butcher, Ray J. |
|
2003 |
59 |
2 |
p. m61-m63 |
artikel |
63 |
Potassium 4-nitramino-1,2,4-triazolate
|
Vasiliev, Alexander D. |
|
2003 |
59 |
2 |
p. m67-m68 |
artikel |
64 |
Pr3MoO7
|
Barrier, N. |
|
2003 |
59 |
2 |
p. i22-i24 |
artikel |
65 |
4-[2-(4-Pyridyl)ethyl]pyridinium nitrate trihydrate
|
Almeida Paz, Filipe A. |
|
2003 |
59 |
2 |
p. o132-o134 |
artikel |
66 |
Rb6Nb4S24.4O0.6
|
Stoll, Petra |
|
2003 |
59 |
2 |
p. i4-i6 |
artikel |
67 |
r-2,c-6-Bis(4-chlorophenyl)-3,5-dimethyltetrahydropyran-t-4-ol
|
Krishnamoorthy, Belli Sundaram |
|
2003 |
59 |
2 |
p. o111-o113 |
artikel |
68 |
Redetermination of chloro(triethanolaminato)zinc(II) at 150 K
|
Lutz, Martin |
|
2003 |
59 |
2 |
p. m74-m76 |
artikel |
69 |
Redetermination of nickel bis(dithiocarbamate) at 100 K
|
Santos, Sauli |
|
2003 |
59 |
2 |
p. m77-m79 |
artikel |
70 |
Reinvestigation of 5,12-dihydro-5,12-dimethylquino[2,3-b]acridine-7,4-dione
|
Mizuguchi, Jin |
|
2003 |
59 |
2 |
p. o232-o233 |
artikel |
71 |
6(S)-Methyl-3(S)-(1-methylethyl)piperazin-2-one
|
Sawatzki, Peter |
|
2003 |
59 |
2 |
p. o171-o173 |
artikel |
72 |
Spiro[3,4-bis(4-chlorophenyl)-4,5-dihydroisoxazole-5,3′-flavan-4′-one]
|
Jeyabharathi, A. |
|
2003 |
59 |
2 |
p. o237-o239 |
artikel |
73 |
Spiro[3-(4-chlorophenyl)-4-(4-methylphenyl)-4,5-dihydroisoxazole-5,3′-flavan-4′-one]
|
Jeyabharathi, A. |
|
2003 |
59 |
2 |
p. o240-o241 |
artikel |
74 |
(5S,6R)-4,5-Dimethyl-6-phenyl-3-trimethylacetyl-2H-1,3,4-oxadiazinan-2-one
|
Ferrence, Gregory M. |
|
2003 |
59 |
2 |
p. o212-o214 |
artikel |
75 |
π–π-Stacking and nitro–π-stacking interactions of 1-(4-nitrophenyl)-4-phenyl-2,4-bis(phenylethynyl)butadiene
|
Wex, Brigitte |
|
2003 |
59 |
2 |
p. o227-o229 |
artikel |
76 |
μ4-Sulfido-bis(μ2-phenylthiolato)tetrakis(tricarbonyliron)
|
Hu, Mingqiang |
|
2003 |
59 |
2 |
p. m55-m56 |
artikel |
77 |
3-tert-Butyl-5-[(4-methoxybenzylidene)amino]-1-phenylpyrazole
|
Low, John Nicolson |
|
2003 |
59 |
2 |
p. o250-o252 |
artikel |
78 |
Tetrakis(tert-butyl 3-oxobutanoato)zirconium(IV)
|
Urs, Usha K. |
|
2003 |
59 |
2 |
p. m83-m84 |
artikel |
79 |
4,4′,5,5′-Tetramethyltetrathiafulvalene–1,4-dinitrobenzene (1/1)
|
Batsanov, Andrei S. |
|
2003 |
59 |
2 |
p. o155-o157 |
artikel |
80 |
The alluaudite-like phosphate Na1.79Mg1.79Fe1.21(PO4)3
|
Hidouri, Mourad |
|
2003 |
59 |
2 |
p. i7-i9 |
artikel |
81 |
Trimesic acid bis(N,N-dimethylformamide) solvate at 150 K
|
Dale, Sophie H. |
|
2003 |
59 |
2 |
p. o127-o128 |
artikel |
82 |
Undecacarbonyl(μ4-2-thiodithiobenzoato- κ4C,S,S′,S′′)(triphenylphosphine)tetrafer
|
Laifa, El Adoui |
|
2003 |
59 |
2 |
p. m80-m82 |
artikel |
83 |
(Z)-7-Chloro-3-(diméthylaminométhylène)-1-méthyl-5-phényl-1,3-dihydro-2H-[1,4]benzodiazépin-2-one
|
Benelbaghdadi, R. |
|
2003 |
59 |
2 |
p. o143-o144 |
artikel |
|