nr |
titel |
auteur |
tijdschrift |
jaar |
jaarg. |
afl. |
pagina('s) |
type |
1 |
10-Acetonyl-10-hydroxyphenanthren-9(10H)-one
|
Usman, Anwar |
|
2002 |
58 |
8 |
p. o956-o958 |
artikel |
2 |
A comparative study of the interactions of cobalt(III) with naphtholate and phenolate moieties
|
Shongwe, Musa S. |
|
2002 |
58 |
8 |
p. m457-m459 |
artikel |
3 |
A methyl-coordinated RhIII ion in methylpentaamminerhodium(III)–chloropentaamminerhodium(III)–dithionate (0.73/2.27/3)
|
Harris, Pernille |
|
2002 |
58 |
8 |
p. m460-m462 |
artikel |
4 |
[5-Amino-6,8-dichloro-2,3-bis(2-pyridyl)quinoxaline]dichlorozinc(II)
|
An, Dao-Li |
|
2002 |
58 |
8 |
p. m436-m438 |
artikel |
5 |
Ammonium mercury(II) dichloride nitrate, (NH4)2HgCl2(NO3)2
|
Nockemann, Peter |
|
2002 |
58 |
8 |
p. i68-i69 |
artikel |
6 |
A new heteronuclear trirutheniumcobalt cluster containing a bulky phosphine ligand, [CoRu3(μ-H)3(μ-CO)(CO)10(PCy3)]
|
Lozano Diz, Enrique |
|
2002 |
58 |
8 |
p. m451-m453 |
artikel |
7 |
A new polymorph of atranorin, a lichen paradepside
|
Liu, Yen-Hsiang |
|
2002 |
58 |
8 |
p. o877-o878 |
artikel |
8 |
A novel three-dimensional supramolecule of 2,2′-dithiodibenzoic acid–4,4′-bipyridine (1/1)
|
Bi, Wenhua |
|
2002 |
58 |
8 |
p. o837-o839 |
artikel |
9 |
A trinuclear molybdenum cluster coordinated by N-phenylanthranilate
|
Kang, Yao |
|
2002 |
58 |
8 |
p. m420-m422 |
artikel |
10 |
1-Benzyl-4,5-diphenyl-3-vinylimidazolium bromide
|
Stibrany, Robert T. |
|
2002 |
58 |
8 |
p. o848-o850 |
artikel |
11 |
3,3′-Benzylidenebis(4-hydroxy-6-methylcoumarin). Erratum
|
Vijayalakshmi, L. |
|
2002 |
58 |
8 |
p. e11 |
artikel |
12 |
3-Benzylidene-1-(2,6-dichlorophenyl)indolin-2-one
|
Thamotharan, S. |
|
2002 |
58 |
8 |
p. o885-o886 |
artikel |
13 |
4,4′-Bipyridin-1-ium bromide monohydrate
|
Iyere, Peter A. |
|
2002 |
58 |
8 |
p. o825-o827 |
artikel |
14 |
Bis[aquabis(1,3-diphenylpropane-1,3-dionato-κ2O,O′)dioxouranium(VI)] dicyclohexyl-18-crown-6-ether chloroform disolvate
|
Fun, Hoong-Kun |
|
2002 |
58 |
8 |
p. m463-m465 |
artikel |
15 |
1,4-Bis(benzimidazol-2-yl)butane
|
Chen, Chunlong |
|
2002 |
58 |
8 |
p. o916-o917 |
artikel |
16 |
Bis[μ-bis(diphenylphosphino)methane-κ2P:P′]bis[(saccharinato-κN)palladium(I)] dichloromethane solvate
|
Henderson, William |
|
2002 |
58 |
8 |
p. m432-m433 |
artikel |
17 |
Bis(diethyldithiocarbamato)(4,7-dimethyl-1,10-phenanthroline)cadmium(II) acetonitrile solvate
|
Guo, Tengwen |
|
2002 |
58 |
8 |
p. m439-m440 |
artikel |
18 |
Bis(μ-2,2′′-dimethoxy-m-terphenyl)di-μ3-iodo-bis(tetrahydrofuran)tetralithium(I)
|
Rabe, Gerd W. |
|
2002 |
58 |
8 |
p. m434-m435 |
artikel |
19 |
Bis(l-proline) hydrogen nitrate
|
Pandiarajan, S. |
|
2002 |
58 |
8 |
p. o862-o864 |
artikel |
20 |
Bis(2-pyridylmethyl)ammonium perchlorate
|
Butcher, Ray J. |
|
2002 |
58 |
8 |
p. o858-o859 |
artikel |
21 |
[1,4-Bis(pyridyl-2-ylmethyl)-1,4-diazacycloheptane]chlorocobalt(II) perchlorate
|
Guo, Ya-Mei |
|
2002 |
58 |
8 |
p. m454-m456 |
artikel |
22 |
Bis(trimethylammonium) tetrachloromercurate(II) at 343 K
|
Amami, Mongi |
|
2002 |
58 |
8 |
p. m416-m419 |
artikel |
23 |
4-Chloro-2-(4-chlorophenyl)-1-formyl-1,2-dihydroquinoline
|
Thinagar, S. |
|
2002 |
58 |
8 |
p. o893-o895 |
artikel |
24 |
Chloro-cis-dihydro-mer-tris(triphenylphosphine)rhodium(III) dichloromethane hemisolvate
|
Clegg, William |
|
2002 |
58 |
8 |
p. m406-m407 |
artikel |
25 |
Chloromethyl(η4-norbornadiene)platinum(II), an unsymmetrical substituted precursor for PtII complexes
|
Kickelbick, Guido |
|
2002 |
58 |
8 |
p. m387-m388 |
artikel |
26 |
Chloro(nitrato)[1,4,7-tris(4-vinyl)benzyl-1,4,7-triazacyclononane]copper(II)
|
Deschamps, Jeffrey R. |
|
2002 |
58 |
8 |
p. m396-m398 |
artikel |
27 |
cis,cis-Ceratospongamide monohydrate
|
Doi, Mitsunobu |
|
2002 |
58 |
8 |
p. o834-o836 |
artikel |
28 |
cis-2-(2-Methoxyphenyl)-3-(phenylselenyl)tetrahydropyran
|
Rickard, Clifton E. F. |
|
2002 |
58 |
8 |
p. o933-o934 |
artikel |
29 |
Co(dmgH)2(NO2)[C6H3(CH3)2NH2]–Co(dmgH)2(NO2)(C6H3Cl2NH2) cocrystal
|
Calmuschi, Beatrice |
|
2002 |
58 |
8 |
p. m402-m403 |
artikel |
30 |
2,2′-Diamino-4,4′-bi-1,3-thiazolium dichloride
|
Liu, Jia-Geng |
|
2002 |
58 |
8 |
p. o929-o930 |
artikel |
31 |
Dibromodicarbonylbis(triphenylphosphine)ruthenium(II) dichloromethane solvate
|
Lozano Diz, Enrique |
|
2002 |
58 |
8 |
p. m404-m405 |
artikel |
32 |
2-(2,4-Dibromophenylamino)-7-nitrobenzisoselenazol-3-one
|
Dupont, Léon |
|
2002 |
58 |
8 |
p. o828-o830 |
artikel |
33 |
Dichlorobis(trans-2-styrylbenzoxazole-κ2N,N′)cobalt(II)
|
Liu, Hui-Min |
|
2002 |
58 |
8 |
p. m426-m428 |
artikel |
34 |
1,4-Dichloro-1,4-diphenyl-2,3-diazabuta-1,3-diene
|
Tandon, Vishnu K. |
|
2002 |
58 |
8 |
p. o869-o870 |
artikel |
35 |
Dichloro{2,2′-thiobis[(4S)-4-isopropyl-1,3-oxazolinylphenyl]}zinc(II)
|
Kooijman, Huub |
|
2002 |
58 |
8 |
p. m429-m431 |
artikel |
36 |
4,7-Dichlorotricyclo[3.1.1.03,6]heptane-2-carboxylic acid
|
Gilardi, Richard |
|
2002 |
58 |
8 |
p. o860-o861 |
artikel |
37 |
Diethylammonium 5-phenyltetrazolate
|
Guzei, Ilia A. |
|
2002 |
58 |
8 |
p. o937-o939 |
artikel |
38 |
Diethyl N,N′-o-phenylenedioxamate
|
Martín, Susana |
|
2002 |
58 |
8 |
p. o913-o915 |
artikel |
39 |
3,5-Difluorobenzonitrile
|
Britton, Doyle |
|
2002 |
58 |
8 |
p. o840-o841 |
artikel |
40 |
Di-μ-iodo-bis{[bis(trans-cinnamaldehyde)ethylenediimine-κ2N,N′]copper(I)}
|
Amirnasr, Mehdi |
|
2002 |
58 |
8 |
p. m381-m382 |
artikel |
41 |
4-Dimethylamino-4′-nitrobenzophenone
|
Kolev, Tsonko |
|
2002 |
58 |
8 |
p. o867-o868 |
artikel |
42 |
Di-n-butylbis(2′,4′-difluoro-4-hydroxybiphenyl-3-carboxylato-O,O′)tin(IV)
|
Hans, Karm |
|
2002 |
58 |
8 |
p. m441-m443 |
artikel |
43 |
3,5-Dinitrosalicylic acid-phenazine (1/1)
|
Senthil Kumar, V. S. |
|
2002 |
58 |
8 |
p. o865-o866 |
artikel |
44 |
Disappearance of inter- and intramolecular stacking due to one-atom addition in `propylene-linker' in a pyrazolo[3,4-d]pyrimidine-based flexible molecule
|
Avasthi, Kamlakar |
|
2002 |
58 |
8 |
p. o940-o941 |
artikel |
45 |
dl-Valinium dihydrogen phosphate
|
Ravikumar, Bagavath Singh |
|
2002 |
58 |
8 |
p. o879-o881 |
artikel |
46 |
(2E)-3-[(1E)-2-(5-Nitroisoxazol-3-yl)vinyloxy]prop-2-enal
|
Gilardi, Richard |
|
2002 |
58 |
8 |
p. o856-o857 |
artikel |
47 |
(E)-5-Methyl-2-(2-methylstyryl)pyrrole
|
Višnjevac, Aleksandar |
|
2002 |
58 |
8 |
p. o909-o910 |
artikel |
48 |
endo-6,syn-7-Dichloro-exo-6-phenylsulfonylbicyclo[3.1.1]heptane
|
Borbulevych, Oleg Ya. |
|
2002 |
58 |
8 |
p. o925-o926 |
artikel |
49 |
Ethyl 2-(cyclopentyloxy)-5-ethyl-4-hydroxy-6-methylnicotinate
|
Boland, Sandro |
|
2002 |
58 |
8 |
p. o964-o965 |
artikel |
50 |
fac-Bis(2-aminomethylbenzimidazole)(2-aminomethylbenzimidazolato)nickel(II) dicyanamide monohydrate
|
He, Yi |
|
2002 |
58 |
8 |
p. m389-m391 |
artikel |
51 |
Four-centre hydrogen bonds: a triethanolamine–triethanolamine oxide complex
|
Kemmitt, Tim |
|
2002 |
58 |
8 |
p. o851-o852 |
artikel |
52 |
Guanidinium pyromellitate
|
Sun, Yan-Qiong |
|
2002 |
58 |
8 |
p. o904-o906 |
artikel |
53 |
1,4,7,11,14,17-Hexaazacycloicosane-9,19-diol hexahydrobromide
|
Liang, Feng |
|
2002 |
58 |
8 |
p. m950-m952 |
artikel |
54 |
Hexakis(μ3-pyridine-2-thiolato-κ3N:S:S)hexasilver(I), [Ag6(μ3-SPy)6]
|
Han, Lei |
|
2002 |
58 |
8 |
p. m383-m384 |
artikel |
55 |
Hydridodichlorotris(methyldiphenylphosphine)rhodium(III) dichloromethane trisolvate
|
Clegg, William |
|
2002 |
58 |
8 |
p. m408-m409 |
artikel |
56 |
Hydrogen-bonded supramolecular ribbons in the antifolate drug pyrimethamine
|
Sethuraman, Velusamy |
|
2002 |
58 |
8 |
p. o817-o818 |
artikel |
57 |
2-Hydroxybenzoic acid salt of physostigmine
|
Flippen-Anderson, Judith L. |
|
2002 |
58 |
8 |
p. o853-o855 |
artikel |
58 |
[Hydroxy(4-pyridyl)methyl]phosphonic acid monohydrate
|
Yi, Xiao-Yi |
|
2002 |
58 |
8 |
p. o820-o821 |
artikel |
59 |
Indole-3-spiro-N-methyl-2′-pyrrolidine-3′-spiro-9′′-anthracene-2,10′′-dione
|
Abdul Ajees, A. |
|
2002 |
58 |
8 |
p. o802-o804 |
artikel |
60 |
l-Histidinium dinitrate
|
Benali-Cherif, Nourredine |
|
2002 |
58 |
8 |
p. o822-o824 |
artikel |
61 |
l-Methioninium nitrate
|
Pandiarajan, S. |
|
2002 |
58 |
8 |
p. o882-o884 |
artikel |
62 |
2,3-Lutidine
|
Bond, Andrew D. |
|
2002 |
58 |
8 |
p. o961-o963 |
artikel |
63 |
Melampodinone
|
Fronczek, Frank R. |
|
2002 |
58 |
8 |
p. o874-o876 |
artikel |
64 |
(3-Methoxyphenyl)acetic acid
|
Choudhury, A. R |
|
2002 |
58 |
8 |
p. o889-o890 |
artikel |
65 |
3-Methoxy-1′-phenyl-4′β,5-dihydro-1H-pyrazolo[4′,3′:16,17]estra-1,3,5(10)-triene
|
König, Verena |
|
2002 |
58 |
8 |
p. o810-o811 |
artikel |
66 |
2-(2-Methoxyphenylhydrazono)-3-oxobutanoic acid
|
Rani, Asha |
|
2002 |
58 |
8 |
p. o805-o806 |
artikel |
67 |
4,4′-[2,2-Methylenebis(4-chlorophenoxy)]diphthalonitrile
|
Çoruh, Ufuk |
|
2002 |
58 |
8 |
p. o953-o955 |
artikel |
68 |
Montanastatin, cyclo[–(Val-d-Hyv-d-Val-Lac)2–]
|
Doi, Mitsunobu |
|
2002 |
58 |
8 |
p. o935-o936 |
artikel |
69 |
N,N-Dimethylammonium N′,N′-dimethylcarbamate
|
Kreher, Ulf |
|
2002 |
58 |
8 |
p. o948-o949 |
artikel |
70 |
N-(1-Phenylethyl)indole-2-carboxamide dimethylformamide solvate
|
Yang, Qi Yun |
|
2002 |
58 |
8 |
p. o907-o908 |
artikel |
71 |
N-(p-Tolyl)maleamic acid
|
Prasad, Satya Murti |
|
2002 |
58 |
8 |
p. o891-o892 |
artikel |
72 |
20-Oxopregn-5-ene-3β,16α-diyl diacetate
|
Andrade, L. C. R. |
|
2002 |
58 |
8 |
p. o898-o900 |
artikel |
73 |
(η5-Pentamethylcyclopentadienyl)(η5-5,6,7-trihydro-4,8-dimethyl-s-indacenyl)iron(II)
|
Jones, Peter G. |
|
2002 |
58 |
8 |
p. m412-m413 |
artikel |
74 |
(η5-Pentamethylcyclopentadienyl)(η5-5,6,7-trihydro-4,8-dimethyl-s-indacenyl)ruthenium(II)
|
Jones, Peter G. |
|
2002 |
58 |
8 |
p. m414-m415 |
artikel |
75 |
4,4′-[2,2′-(Piperidine-1,4-diyldiethylene)di(tosylimino)]diphthalonitrile
|
Çoruh, Ufuk |
|
2002 |
58 |
8 |
p. o896-o897 |
artikel |
76 |
Potassium trans-diaquabis(malonato)chromium(III) trihydrate
|
Lemmer, Markus |
|
2002 |
58 |
8 |
p. m447-m448 |
artikel |
77 |
Pyridinium 2,2′-dithiodisalicylate
|
Kang, Yao |
|
2002 |
58 |
8 |
p. o959-o960 |
artikel |
78 |
Quinoline N-oxide dihydrate from powder data
|
Ivashevskaja, Svetlana N. |
|
2002 |
58 |
8 |
p. o920-o922 |
artikel |
79 |
Redetermination of 3-hydroxy-2-naphthoic acid
|
Schmidt, Martin U. |
|
2002 |
58 |
8 |
p. o918-o919 |
artikel |
80 |
Redetermination of silicon(IV) acetate
|
Wicke, Lena |
|
2002 |
58 |
8 |
p. o927-o928 |
artikel |
81 |
(R,S)-1,2-Bis(benzylsulfinyl)ethane
|
Li, Jian-Rong |
|
2002 |
58 |
8 |
p. o911-o912 |
artikel |
82 |
[(1RS,7RS,8RS,14RS)-5,12-Dimethyl-7,14-diphenyl-1,4,8,11-tetraazacyclotetradeca-4,11-diene-κ4N1,4,8,11]nickel(II) perchlorate
|
Curtis, Neil F. |
|
2002 |
58 |
8 |
p. m423-m425 |
artikel |
83 |
Samarium orthosilicate oxyapatite, Sm5(SiO4)3O
|
Wang, Meitian |
|
2002 |
58 |
8 |
p. i70-i71 |
artikel |
84 |
Supramolecular self-assembly via inter-ligands hydrogen bonds in [Cu(H2O)2(NO3)2(tb)] (tb is thiabendazole)
|
Sethuraman, Velusamy |
|
2002 |
58 |
8 |
p. m392-m395 |
artikel |
85 |
Synthesis and absolute configuration of methyl (–)-(3R)-8-(4-bromophenyl)-7-(naphthalen-1-ylmethyl)-5-oxo-2,3-dihydro-5H-thiazolo[3,2-a]pyridine-3-carboxylate
|
Åberg, Veronica |
|
2002 |
58 |
8 |
p. o812-o814 |
artikel |
86 |
2,3,1′,3′-Tetrahydro-[1,2′]biindenylidene
|
Jovanovic, Jovan |
|
2002 |
58 |
8 |
p. o815-o816 |
artikel |
87 |
2,3,6,7-Tetrakis(2-cyanoethylthio)tetrathiafulvalene
|
Yu, Wentao |
|
2002 |
58 |
8 |
p. o842-o844 |
artikel |
88 |
Tetramethyl biphenyl-3,5,3′,5′-tetracarboxylate benzene sesquisolvate
|
Coles, Simon J. |
|
2002 |
58 |
8 |
p. o887-o888 |
artikel |
89 |
The complex salt benzodiimidazolium tetrachlorozincate
|
Cai, Chen-Xin |
|
2002 |
58 |
8 |
p. m399-m401 |
artikel |
90 |
The 1:1 proton-transfer compound of benzylamine with 3,5-dinitrosalicylic acid
|
Smith, Graham |
|
2002 |
58 |
8 |
p. o845-o847 |
artikel |
91 |
The pseudoguaianolide peruvin
|
Fronczek, Frank R. |
|
2002 |
58 |
8 |
p. o871-o873 |
artikel |
92 |
The supramolecular structure of N-(6-amino-3,4-dihydro-3-methyl-5-nitroso-4-oxopyrimidin-2-yl)glycylglycinate contains a unique O—H⋯N(nitroso) hydrogen bond
|
Low, John Nicolson |
|
2002 |
58 |
8 |
p. o942-o945 |
artikel |
93 |
trans-Bis(acetonitrile)tetraaquacobalt(II) dinitrate at 150 K
|
Barnett, Sarah A. |
|
2002 |
58 |
8 |
p. m444-m446 |
artikel |
94 |
trans-Bis(1H-benzimidazole-1-thione-κS)tetrachlorotellurium methanol disolvate
|
Schollmeyer, Dieter |
|
2002 |
58 |
8 |
p. o901-o903 |
artikel |
95 |
trans-Dichlorobis(4-cyanopyridine)palladium(II)
|
Barnett, Sarah A. |
|
2002 |
58 |
8 |
p. m385-m386 |
artikel |
96 |
trans-2-(2-Naphthyl)-3-(phenylselenyl)tetrahydropyran
|
Rickard, Clifton E. F. |
|
2002 |
58 |
8 |
p. o931-o932 |
artikel |
97 |
2,4,5-Trichloroacetanilide
|
Mahalakshmi, L. |
|
2002 |
58 |
8 |
p. o946-o947 |
artikel |
98 |
Trichloro(perdeuteroacetonitrile)bis(triphenylphosphine)rhodium(III)
|
Clegg, William |
|
2002 |
58 |
8 |
p. m410-m411 |
artikel |
99 |
2,4,6-Trimethyl-1,3,5-tris(2-pyrimidinylthiomethyl)benzene chloroform hemisolvate
|
Zheng, Yan |
|
2002 |
58 |
8 |
p. o923-o924 |
artikel |
100 |
Triphenyl(benzoylmethyl)phosphonium nitrate: a three-dimensional hydrogen-bonded network
|
Baby Mariyatra, Mahimaidoss |
|
2002 |
58 |
8 |
p. o807-o809 |
artikel |
101 |
Triphenylboroxin N,N-diethylhydroxylamine adduct (dimethylformamide solvate)
|
Kliegel, Wolfgang |
|
2002 |
58 |
8 |
p. o831-o833 |
artikel |
102 |
Tris(O,O′-dimethyldithiophosphato)chromium(III)
|
Ito, Tetsuzo |
|
2002 |
58 |
8 |
p. m449-m450 |
artikel |
|