nr |
titel |
auteur |
tijdschrift |
jaar |
jaarg. |
afl. |
pagina('s) |
type |
1 |
Complexation of nicotinamide with Ag+ ions in water-organic solvents
|
Zevakin, M. A. |
|
|
51 |
3 |
p. 495-498 |
artikel |
2 |
Complexation of nicotinamide with Ag+ ions in water-organic solvents
|
Zevakin, M. A. |
|
2006 |
51 |
3 |
p. 495-498 |
artikel |
3 |
Composition and formation kinetics of sodium polyvanadates in vanadium(IV, V) solutions
|
Podval’naya, N. V. |
|
|
51 |
3 |
p. 357-361 |
artikel |
4 |
Copper(II) complexes with condensation products of aminonaphthalene and benzoin derivatives
|
Skorokhod, L. S. |
|
|
51 |
3 |
p. 408-414 |
artikel |
5 |
Copper(II) complexes with condensation products of aminonaphthalene and benzoin derivatives
|
Skorokhod, L. S. |
|
2006 |
51 |
3 |
p. 408-414 |
artikel |
6 |
Crystal and molecular structure of a new gadolinium nitrate complex with furancarboxylic acid and dipyridyl
|
Xia, Li |
|
|
51 |
3 |
p. 386-391 |
artikel |
7 |
Crystal and molecular structure of a new gadolinium nitrate complex with furancarboxylic acid and dipyridyl
|
Xia, Li |
|
2006 |
51 |
3 |
p. 386-391 |
artikel |
8 |
Crystallization features of ternary reversible reciprocal systems
|
Tomashik, V. N. |
|
|
51 |
3 |
p. 465-469 |
artikel |
9 |
Crystallization features of ternary reversible reciprocal systems
|
Tomashik, V. N. |
|
2006 |
51 |
3 |
p. 465-469 |
artikel |
10 |
Donor ability of nitrogen-containing ligands
|
Kuznetsova, I. A. |
|
|
51 |
3 |
p. 504-505 |
artikel |
11 |
Donor ability of nitrogen-containing ligands
|
Kuznetsova, I. A. |
|
2006 |
51 |
3 |
p. 504-505 |
artikel |
12 |
Electrophoretic studies on the mixed nitrilotriacetate-penicillamine complexes of Pb2+ and UO22+
|
Tewari, B. B. |
|
|
51 |
3 |
p. 499-503 |
artikel |
13 |
Electrophoretic studies on the mixed nitrilotriacetate-penicillamine complexes of Pb2+ and UO22+
|
Tewari, B. B. |
|
2006 |
51 |
3 |
p. 499-503 |
artikel |
14 |
Ferrites YbSrFe2O5.5 and YbBaFe2O5.5: Synthesis and X-ray diffraction, thermodynamic, and electrophysical properties
|
Kasenov, B. K. |
|
|
51 |
3 |
p. 368-373 |
artikel |
15 |
Ferrites YbSrFe2O5.5 and YbBaFe2O5.5: Synthesis and X-ray diffraction, thermodynamic, and electrophysical properties
|
Kasenov, B. K. |
|
2006 |
51 |
3 |
p. 368-373 |
artikel |
16 |
Fluorescence properties of mixed-ligand europium carboxylates
|
Kalinovskaya, I. V. |
|
|
51 |
3 |
p. 457-461 |
artikel |
17 |
Fluorescence properties of mixed-ligand europium carboxylates
|
Kalinovskaya, I. V. |
|
2006 |
51 |
3 |
p. 457-461 |
artikel |
18 |
4,7,13,16,21,24-Hexaoxa-1,10-diazaniabicyclo[8.8.8]-hexacosane Bis(dihydrogenphosphate) dihydrate: Synthesis and crystal structure
|
Chekhlov, A. N. |
|
|
51 |
3 |
p. 397-401 |
artikel |
19 |
4,7,13,16,21,24-Hexaoxa-1,10-diazaniabicyclo[8.8.8]-hexacosane Bis(dihydrogenphosphate) dihydrate: Synthesis and crystal structure
|
Chekhlov, A. N. |
|
2006 |
51 |
3 |
p. 397-401 |
artikel |
20 |
4,7,13,16,21,24-Hexaoxa-1,10-diazaniabicyclo[8.8.8]-hexacosane dichloride monohydrate: Synthesis and crystal structure
|
Chekhlov, A. N. |
|
|
51 |
3 |
p. 392-396 |
artikel |
21 |
4,7,13,16,21,24-Hexaoxa-1,10-diazaniabicyclo[8.8.8]-hexacosane dichloride monohydrate: Synthesis and crystal structure
|
Chekhlov, A. N. |
|
2006 |
51 |
3 |
p. 392-396 |
artikel |
22 |
Interaction in the Yb2S3-In2S3 system
|
Akhmedova, N. R. |
|
|
51 |
3 |
p. 478-483 |
artikel |
23 |
Interaction in the Yb2S3-In2S3 system
|
Akhmedova, N. R. |
|
2006 |
51 |
3 |
p. 478-483 |
artikel |
24 |
Isothermal sections at 1473 K through the Pb-Au-FeS and Pb-Ag-FeS phase diagrams
|
Rybkin, S. G. |
|
2006 |
51 |
3 |
p. 470-473 |
artikel |
25 |
Magnetic and thermodynamic properties of Heisenberg chains and n-nuclear cyclic clusters: Si = 3/2 (n ≤ 11, n → ∞) and Si = 2 (n ≤ 10, n → ∞) systems
|
Rakitin, Yu. V. |
|
|
51 |
3 |
p. 421-428 |
artikel |
26 |
Magnetic and thermodynamic properties of Heisenberg chains and n-nuclear cyclic clusters: Si = 3/2 (n ≤ 11, n → ∞) and Si = 2 (n ≤ 10, n → ∞) systems
|
Rakitin, Yu. V. |
|
2006 |
51 |
3 |
p. 421-428 |
artikel |
27 |
Nanostructuring in the process of formation of rare-earth tungstates
|
Bandurkin, G. A. |
|
|
51 |
3 |
p. 429-437 |
artikel |
28 |
Nanostructuring in the process of formation of rare-earth tungstates
|
Bandurkin, G. A. |
|
2006 |
51 |
3 |
p. 429-437 |
artikel |
29 |
New complex ytterbium molybdophosphates M2IYb(PO4)(MoO4) (MI = K, Na): Synthesis and structure solution
|
Komissarova, L. N. |
|
|
51 |
3 |
p. 350-356 |
artikel |
30 |
Proton conductivity in TaH(PO4)2 · 2H2O + SiO2 composite electrolytes
|
Ponomareva, V. G. |
|
|
51 |
3 |
p. 343-346 |
artikel |
31 |
Quasi-one-dimensional oxides Sr4Co3 − xMnxO9 (0 ≤ x ≤ 3): Synthesis and magnetic properties
|
Melkozerova, M. A. |
|
|
51 |
3 |
p. 362-367 |
artikel |
32 |
Quasi-one-dimensional oxides Sr4Co3 − xMnxO9 (0 ≤ x ≤ 3): Synthesis and magnetic properties
|
Melkozerova, M. A. |
|
2006 |
51 |
3 |
p. 362-367 |
artikel |
33 |
Reaction of dolomite with dilute solutions of sulfuric acid and Iron(II), Copper (II), and Zinc(II) sulfates
|
Makarov, V. N. |
|
|
51 |
3 |
p. 347-349 |
artikel |
34 |
Reduction kinetics of gold(III) complexes with calix[4]arenes derivatized with thioether groups on the upper rim
|
Kostin, G. A. |
|
|
51 |
3 |
p. 488-494 |
artikel |
35 |
Reduction kinetics of gold(III) complexes with calix[4]arenes derivatized with thioether groups on the upper rim
|
Kostin, G. A. |
|
2006 |
51 |
3 |
p. 488-494 |
artikel |
36 |
Solid solutions in the Nd(CCl3COO)3-Sm(CCl3COO)3-H2O system at 298 K
|
Grigor’eva, L. S. |
|
|
51 |
3 |
p. 462-464 |
artikel |
37 |
Solid solutions in the Nd(CCl3COO)3-Sm(CCl3COO)3-H2O system at 298 K
|
Grigor’eva, L. S. |
|
2006 |
51 |
3 |
p. 462-464 |
artikel |
38 |
Solubilities of zinc oxide and cadmium oxide in KCl-LiCl eutectic melts
|
Cherginets, V. L. |
|
|
51 |
3 |
p. 484-487 |
artikel |
39 |
Solubilities of zinc oxide and cadmium oxide in KCl-LiCl eutectic melts
|
Cherginets, V. L. |
|
2006 |
51 |
3 |
p. 484-487 |
artikel |
40 |
Solubility of hydrogen sulfide in organic solvents
|
Bryk, S. D. |
|
|
51 |
3 |
p. 506-511 |
artikel |
41 |
Solubility of hydrogen sulfide in organic solvents
|
Bryk, S. D. |
|
2006 |
51 |
3 |
p. 506-511 |
artikel |
42 |
Structure and some thermodynamic characteristics of the polymorphs of rubidium silicate Rb6Si10O23
|
Lapshin, A. E. |
|
|
51 |
3 |
p. 438-444 |
artikel |
43 |
Structure and some thermodynamic characteristics of the polymorphs of rubidium silicate Rb6Si10O23
|
Lapshin, A. E. |
|
2006 |
51 |
3 |
p. 438-444 |
artikel |
44 |
Synthesis and characterization of ciprofloxacin compounds with cadmium(II) and mercury(II) chlorides
|
Golovenv, N. N. |
|
|
51 |
3 |
p. 415-420 |
artikel |
45 |
Synthesis and characterization of ciprofloxacin compounds with cadmium(II) and mercury(II) chlorides
|
Golovenv, N. N. |
|
2006 |
51 |
3 |
p. 415-420 |
artikel |
46 |
Synthesis and crystal structure of KBi(C6H4O7) · 3.5H2O
|
Antsyshkina, A. S. |
|
|
51 |
3 |
p. 374-385 |
artikel |
47 |
Synthesis and crystal structure of KBi(C6H4O7) · 3.5H2O
|
Antsyshkina, A. S. |
|
2006 |
51 |
3 |
p. 374-385 |
artikel |
48 |
The LiF-LiCl-Li2SO4-Li2MoO4 quaternary system
|
Gubanova, T. V. |
|
|
51 |
3 |
p. 474-477 |
artikel |
49 |
The LiF-LiCl-Li2SO4-Li2MoO4 quaternary system
|
Gubanova, T. V. |
|
2006 |
51 |
3 |
p. 474-477 |
artikel |
50 |
Thermochemistry of the ternary solid complex Gd(C5H8NS2)3(C12H8N2)
|
Chen, S. |
|
|
51 |
3 |
p. 445-456 |
artikel |
51 |
Thermochemistry of the ternary solid complex Gd(C5H8NS2)3(C12H8N2)
|
Chen, S. |
|
2006 |
51 |
3 |
p. 445-456 |
artikel |
52 |
X-ray diffraction study of K3[UO2(C2O4)2(NCS)] · 3H2O
|
Mikhailov, Yu. N. |
|
|
51 |
3 |
p. 402-407 |
artikel |
53 |
X-ray diffraction study of K3[UO2(C2O4)2(NCS)] · 3H2O
|
Mikhailov, Yu. N. |
|
2006 |
51 |
3 |
p. 402-407 |
artikel |