| nr |
titel |
auteur |
tijdschrift |
jaar |
jaarg. |
afl. |
pagina('s) |
type |
| 1 |
Ablation phenomena by intense terahertz vortex beam
|
Wang, You Wei
|
|
|
128 |
9 |
|
artikel
|
| 2 |
Advancements and applications of electrohydrodynamic printing in modern microelectronic devices: a comprehensive review
|
Esa, Zulfikre
|
|
|
128 |
9 |
|
artikel
|
| 3 |
An epsilon-shaped fractal antenna for UWB MIMO applications
|
Sediq, Hiwa Taha
|
|
|
128 |
9 |
|
artikel
|
| 4 |
Application of poly-Si/SiOx passivating contact in x-ray silicon pixel detector
|
Song, Hongyu
|
|
|
128 |
9 |
|
artikel
|
| 5 |
A sensitive electrochemical sensor for nitenpyram detection based on CeO2/MWCNTs nanocomposite
|
Ai, Jixing
|
|
|
128 |
9 |
|
artikel
|
| 6 |
Atomic force microscopy and multifractal analysis in diamond-like carbon films
|
Modabberasl, A.
|
|
|
128 |
9 |
|
artikel
|
| 7 |
Bipolar resistive switching in Mn-doped BiFeO3 thin films synthesized via sol–gel-assisted spin coating technique
|
Banda, Rajender Reddy
|
|
|
128 |
9 |
|
artikel
|
| 8 |
Controlled electrochemical growth of micro-scaled As2O3 and Ga2O3 oxide structures on p-type gallium arsenide
|
Acikgoz, Sabriye
|
|
|
128 |
9 |
|
artikel
|
| 9 |
Correction: Impact of plasma conditions on the shape of femtosecond laser-induced surface structures of Ti and Ni
|
Boltaev, G. S.
|
|
|
128 |
9 |
|
artikel
|
| 10 |
Correction to: Boron nitride nanosheet-reinforced WNiCoFeCr high-entropy alloys: the role of B4C on the structural, physical, mechanical, and radiological shielding properties
|
Kavaz, Esra
|
|
|
128 |
9 |
|
artikel
|
| 11 |
Correction to: One-step hydrothermal synthesis of Sb2WO6 nanoparticle towards excellent LED light driven photocatalytic dye degradation
|
Karmakar, Devdas
|
|
|
128 |
9 |
|
artikel
|
| 12 |
Correlation between chemical structural changes and laser fluence in femtosecond laser processing of polydimethylsiloxane
|
Ogawa, H.
|
|
|
128 |
9 |
|
artikel
|
| 13 |
Correlation between the structure, grain size distribution and radiation shielding peculiarities of YBCO ceramics prepared by two different milling methods
|
Hannachi, E.
|
|
|
128 |
9 |
|
artikel
|
| 14 |
Curing temperature-dependent physicochemical reconstruction of strontium aluminum lanthanum oxide film for enhanced liquid crystal systems
|
Kim, Dong Hyun
|
|
|
128 |
9 |
|
artikel
|
| 15 |
Determination of effect of hydrogen on strength of aluminum by MD simulation
|
Tigli, Ahmet
|
|
|
128 |
9 |
|
artikel
|
| 16 |
Effect of Au concentration on electrophysical properties of nanostructured (Ni80Fe20)xAu1-x thin films
|
Pazukha, I. M.
|
|
|
128 |
9 |
|
artikel
|
| 17 |
Effect of calcination temperature on structural, dielectric and piezoelectric properties of strontium bismuth niobate ceramics
|
Verma, Maya
|
|
|
128 |
9 |
|
artikel
|
| 18 |
Effect of irradiation time on characteristics of Gd2O3:Er,Yb NPs by laser ablation in liquid
|
Tei, Yuri
|
|
|
128 |
9 |
|
artikel
|
| 19 |
Effect of re-depositions and fiber exposure on the adhesive bond strength of CFRP after UV excimer laser treatment
|
Veltrup, M.
|
|
|
128 |
9 |
|
artikel
|
| 20 |
Effect of rolling process on magnetic properties of Fe-3.3 wt% Si non-oriented electrical steel
|
Du, Yizhou
|
|
|
128 |
9 |
|
artikel
|
| 21 |
Effects of carbon nanotubes addition on the superconducting properties and critical current density of NdBa2Cu3O7−δ
|
Chong, Tet Vui
|
|
|
128 |
9 |
|
artikel
|
| 22 |
Effects of pulse duration on laser-induced crystallization of urea from 300 to 1200 fs: impact of cavitation bubbles on crystal nucleation
|
Tsuri, Yuka
|
|
|
128 |
9 |
|
artikel
|
| 23 |
Effects of titanium addition on the microstructure and electrochemical corrosion behaviour in TZM alloy
|
Tuncay, Badegul
|
|
|
128 |
9 |
|
artikel
|
| 24 |
Effects of Y2O3 and Cr3C2 on the microstructure and properties of WC–Co–Ni alloy prepared by microwave sintering
|
Liu, Lei
|
|
|
128 |
9 |
|
artikel
|
| 25 |
Electronic, microstructure, and magnetic performances in MoS2-nanoparticles
|
Ray, Sekhar Chandra
|
|
|
128 |
9 |
|
artikel
|
| 26 |
Electrospinning preparation and white upconversion luminescence of Y2Ti2O7:Tm/Yb/Er nanotubes
|
Han, Zhanwen
|
|
|
128 |
9 |
|
artikel
|
| 27 |
Embedding functions for Pt and Pd: recalculation and verification on properties of bulk phases, Pt, Pd, and Pt–Pd nanoparticles
|
Samsonov, V. M.
|
|
|
128 |
9 |
|
artikel
|
| 28 |
Enhanced linear and nonlinear optical properties of erbium/ytterbium lead phosphate glass by gamma irradiation for optoelectronics applications
|
Sallam, O. I.
|
|
|
128 |
9 |
|
artikel
|
| 29 |
Enhancement of linear optical and dielectric properties as well as gamma-ray protection capacities of PbO reinforced in TeO2–WO3 glasses: Comparative study
|
Marzouk, Samir Y.
|
|
|
128 |
9 |
|
artikel
|
| 30 |
Entropy and heterogeneous interface engineering promote the low thermal conductivity in SnTe-based thermoelectric materials
|
Xin, Xu-Ye
|
|
|
128 |
9 |
|
artikel
|
| 31 |
Excellent ferroelectric, piezoelectric, and domain switching performance of Mn-doped Pb(In1/2Nb1/2)O3-Pb(Mg1/3Nb2/3)O3-PbTiO3 thin films optimized by oxygen partial pressure
|
Li, Zihao
|
|
|
128 |
9 |
|
artikel
|
| 32 |
Exploitation of dielectric properties of ferrite composites for microwave absorber applications: complex permittivity, real-imaginary impedance, geometrical thickness, and reflection loss parameters
|
Singh, Charanjeet
|
|
|
128 |
9 |
|
artikel
|
| 33 |
Exploring hydroxyapatite/graphene oxide/zinc oxide composite powders for the preparation of bioactive-antibacterial coatings by HVOF
|
Martinez, Gabriela
|
|
|
128 |
9 |
|
artikel
|
| 34 |
Exploring the impact of nickel doping on the structure and low-temperature magnetic features of cobalt nano-spinel ferrite
|
Desoky, W. M.
|
|
|
128 |
9 |
|
artikel
|
| 35 |
Fabrication, characterization, antibacterial properties, and the possibility of introducing silver tungstate nanoparticles with Zn as photosensitizers for photodynamic therapy
|
Marzieh, Sharifi
|
|
|
128 |
9 |
|
artikel
|
| 36 |
Fabrication of luminescent silicon carbide nanoparticles by pulsed laser synthesis in liquid
|
Tarasenka, Natalie
|
|
|
128 |
9 |
|
artikel
|
| 37 |
Fabrication of novel nanosized BaCO3 and their promising NO2 sensing properties
|
Al-Taisan, N. A.
|
|
|
128 |
9 |
|
artikel
|
| 38 |
Femtosecond laser perforation of plant cells for evaluation of cell stiffness
|
Yamasaki, Yuki
|
|
|
128 |
9 |
|
artikel
|
| 39 |
Formation of gold/silver composite nanoparticles by pulsed laser ablation of gold–silver layered films in liquid
|
Homik, Zsolt
|
|
|
128 |
9 |
|
artikel
|
| 40 |
GaN-based light-emitting materials prepared by hot-wall metal-organic chemical vapor deposition
|
Le, Son Phuong
|
|
|
128 |
9 |
|
artikel
|
| 41 |
Giant blue-violet photoluminescence enhancement of Mn:CsPbCl3 nanocrystals by CdCl2 post-synthetic treatment
|
Lei, Wenshan
|
|
|
128 |
9 |
|
artikel
|
| 42 |
Glass lab-on-a-chip platform fabricated by picosecond laser for testing tumor cells exposed to X-ray radiation
|
Staicu, C. E.
|
|
|
128 |
9 |
|
artikel
|
| 43 |
Green synthesis of TiO2@MWCNTs composites by pulsed laser ablation in liquid
|
Khashan, Khawla S.
|
|
|
128 |
9 |
|
artikel
|
| 44 |
Growth of heteroepitaxial La and Mn co-substituted BiFeO3 thin films on Si (100) substrate by pulsed laser deposition
|
Kolte, Jayant
|
|
|
128 |
9 |
|
artikel
|
| 45 |
Helical phase modulation via four-wave mixing in a graphene system
|
Kong, Chenyu
|
|
|
128 |
9 |
|
artikel
|
| 46 |
Influence of salt solution concentration on structural properties of ZnO nanorods grown by hydrothermal method
|
Al-Rasheedi, Asmaa
|
|
|
128 |
9 |
|
artikel
|
| 47 |
Insight into dislocation activity during ECAP processing of AISI 304 stainless steel studied by X-ray diffraction profile analysis
|
Hajizadeh, K.
|
|
|
128 |
9 |
|
artikel
|
| 48 |
Investigation of 2D nanomaterials on MXene (Ti3C2Tx)-based aluminum plasmonic devices for biosensing in the near-infrared region
|
Shukla, S.
|
|
|
128 |
9 |
|
artikel
|
| 49 |
Investigation of structural, magnetic and microwave absorption properties of NixCo1-xFe2O4/Ni:ZnO (x:0.0, 0.5, and 1.0) embedded epoxy composites
|
Kıvrak, Burak
|
|
|
128 |
9 |
|
artikel
|
| 50 |
Investigation of structural, morphological, and optoelectronic properties of ZnO thin films with Sn–Ni as co-doping
|
Migdadi, A. B.
|
|
|
128 |
9 |
|
artikel
|
| 51 |
Investigation of surface roughness influence on superhydrophobic–superoleophilic patterns prepared by atmospheric pressure DBD in the layer-by-layer method
|
Omidi, Z.
|
|
|
128 |
9 |
|
artikel
|
| 52 |
Investigation on mechanism of ultraprecision three-body polishing of single-crystal silicon carbide with voids by molecular dynamics simulation
|
Dai, Houfu
|
|
|
128 |
9 |
|
artikel
|
| 53 |
La[Fe(CN)6]·5H2O-derived LaFeO3 hexagonal nano-sheets as low-power n-propanol sensors
|
Wang, Xiao-Feng
|
|
|
128 |
9 |
|
artikel
|
| 54 |
Low temperature coefficient of resistivity in antiperovskite Mn3Ga0.7Sn0.3N compound
|
Dai, Yongjuan
|
|
|
128 |
9 |
|
artikel
|
| 55 |
Luminescent carbon nanostructures synthesized by ultrasound-assisted laser ablation in liquid media
|
Escobar-Alarcon, L.
|
|
|
128 |
9 |
|
artikel
|
| 56 |
Microfabrication on low-refractive-index hydrogels using femtosecond laser direct writing
|
Nagao, Ryuki
|
|
|
128 |
9 |
|
artikel
|
| 57 |
Micro-nanoarchitectonics of electroless Cu-Fe3O4@graphene/Ni composite materials based on wood
|
Pan, Yanfei
|
|
|
128 |
9 |
|
artikel
|
| 58 |
Microstructure and mechanical properties of laser-deposited Ti65 near-alpha titanium alloy
|
He, Bo
|
|
|
128 |
9 |
|
artikel
|
| 59 |
Miniaturized wideband 5G millimeter-wave antenna with two-port positioning analysis for vehicular communication
|
Shanmuganathan, Shanmathi
|
|
|
128 |
9 |
|
artikel
|
| 60 |
Molten salt synthesis of Gd-doped SrBi2Ta2O9 ceramics with enhanced dielectric properties at room temperature
|
Afqir, Mohamed
|
|
|
128 |
9 |
|
artikel
|
| 61 |
Morphologies of cemented tungsten carbide ablated by pulsed femtosecond laser to manufacture next-generation blades of a cutting tool
|
Shin, Young-Gwan
|
|
|
128 |
9 |
|
artikel
|
| 62 |
Morphology and structure of diamond-like carbon film induced by picosecond laser ablation
|
Takabayashi, Keisuke
|
|
|
128 |
9 |
|
artikel
|
| 63 |
Multipitched plasmonic nanoparticle grating for broadband light enhancement in white light-emitting organic diodes
|
Auer-Berger, Manuel
|
|
|
128 |
9 |
|
artikel
|
| 64 |
Nano-CeO2-loaded chitosan-bocglycine zinc complex for the photocatalytic degradation of picric acid by the combination of Fenton’s reagent
|
Mahender Rao, Arshanapelly
|
|
|
128 |
9 |
|
artikel
|
| 65 |
Nanoscale electronic inhomogeneity in ZrNx thin films growth by reactive sputtering at room temperature
|
Haberkorn, N.
|
|
|
128 |
9 |
|
artikel
|
| 66 |
New insights into perovskite phase stabilization in donor–acceptor co-doped BaTiO3
|
Jumana, P. J.
|
|
|
128 |
9 |
|
artikel
|
| 67 |
Numerical simulation of a laser-induced bubble of new laser propulsion method inhaling water
|
Ohkubo, Tomomasa
|
|
|
128 |
9 |
|
artikel
|
| 68 |
Optical properties of a new binary lead-free ferroelectric semiconductor Bi1/2Na1/2TiO3–Nd1/2Na1/2TiO3 solid solution system
|
Dung, Dang Duc
|
|
|
128 |
9 |
|
artikel
|
| 69 |
Osteoporosis biomarker ‘c-terminal telopeptide’ identification on carbon nanofiber-modified interdigitated electrode sensor
|
Yao, Bin
|
|
|
128 |
9 |
|
artikel
|
| 70 |
Oxygen plasma-induced enhancement of structural, electrical properties, and thermopower of La0.5Sr0.5MnO3
|
Chettri, Pronita
|
|
|
128 |
9 |
|
artikel
|
| 71 |
Paper-based ZnO ultraviolet photodetector with enhanced stability and detectivity by PTFE coatings
|
Zheng, Yiling
|
|
|
128 |
9 |
|
artikel
|
| 72 |
Photoelectric and optoelectronic effects of hard ferromagnetic manganese cobalt (Mn–Co) ferrite nanoparticles for high-frequency device application
|
Ibiyemi, Abideen A.
|
|
|
128 |
9 |
|
artikel
|
| 73 |
Photoluminescence enhancement of silicon nanocrystals by excimer laser implanted gold nanoparticles
|
Richter, Lukas Janos
|
|
|
128 |
9 |
|
artikel
|
| 74 |
Physical, elastic-mechanical and radiation shielding properties of antimony borate–lithium in the form B2O3-CaO-Li2O-Sb2O3: Experimental, theoretical and simulation approaches
|
Khattari, Z. Y.
|
|
|
128 |
9 |
|
artikel
|
| 75 |
Plasmonic and electronic characteristics of (Zr,Nb)Nx thin films with different metal content
|
Tianrun, Wang
|
|
|
128 |
9 |
|
artikel
|
| 76 |
Polycarbosilane as a modulator for reaction-bonded silicon carbide processing of GNPs/Si mixtures
|
Liu, Fu
|
|
|
128 |
9 |
|
artikel
|
| 77 |
Preparation, microstructure and luminescence properties of TiO2/WO3 composites
|
Xiong, Sang
|
|
|
128 |
9 |
|
artikel
|
| 78 |
Preparation of 2H phase MoS2 on one-dimensional titanium dioxide nanotube array to construct high performance Z-type heterojunction photocatalytic decomposition of rhodamine B
|
Liu, Enyang
|
|
|
128 |
9 |
|
artikel
|
| 79 |
Prolonged flash sintering and its effects on defect chemistry, phase transformation and ionic conductivity of yttria-stabilized zirconia
|
Mohammad Alizadeh, Siavash
|
|
|
128 |
9 |
|
artikel
|
| 80 |
Pure and lanthanum-doped zinc oxide nanoparticles: synthesis, characterization, and antibacterial activity
|
Al Bitar, Maryam
|
|
|
128 |
9 |
|
artikel
|
| 81 |
Realization of dual-mode, high-selectivity SIW cavity bandpass filter by perturbing circular shape vias
|
Namanathan, Praveena
|
|
|
128 |
9 |
|
artikel
|
| 82 |
Realization of room temperature electro-phosphorescence from an iridium metal based efficient novel triplet emitter
|
Rao, Ankit Kumar
|
|
|
128 |
9 |
|
artikel
|
| 83 |
Research on stability and thermal properties of SiC-MWCNT hybrid nanofluids based on thermal conductive oil
|
Huang, Yushuang
|
|
|
128 |
9 |
|
artikel
|
| 84 |
Role of manganite in enhancing dielectric cum magnetic properties of BTFO-LSMO composites
|
Jena, Rasmita
|
|
|
128 |
9 |
|
artikel
|
| 85 |
SILAR processing and characterization of bare and graphene oxide (GO) and reduced graphene oxide (rGO)-doped CuO thin films
|
Altinay, Y.
|
|
|
128 |
9 |
|
artikel
|
| 86 |
Simple and effective synthesis via sol–gel of Zn-doped ITO films and their microstructural, optical, and photoelectrochemical properties
|
Ghemid, M.
|
|
|
128 |
9 |
|
artikel
|
| 87 |
Simultaneous introduction of surface plasmon resonance effect and oxygen vacancies onto Bi/Bi2O3 heterostructure for enhancing visible-light photocatalysis
|
Wu, Xiang-Feng
|
|
|
128 |
9 |
|
artikel
|
| 88 |
Solvatochromism, electrochemical characterization and anti-proliferative activity of bio-assisted fabrication of hierarchical carbon dots
|
Reddy, G. Deepthi
|
|
|
128 |
9 |
|
artikel
|
| 89 |
Sonochemical-assisted synthesis of α-Fe2O3 nanoparticles and their photocatalytic activity toward methylene blue and methyl orange dyes
|
Solanki, Reena
|
|
|
128 |
9 |
|
artikel
|
| 90 |
Spoof surface plasmon-based terahertz metasensor for glucose and ethanol
|
Bhati, Ruchi
|
|
|
128 |
9 |
|
artikel
|
| 91 |
Structural and magnetic properties of Ca1-xLaxFe0.5Mn0.5O3-δ (0.05 ≤ x ≤ 0.15) perovskites
|
Selmi, R.
|
|
|
128 |
9 |
|
artikel
|
| 92 |
Structural characteristics and electrical properties of lanthanum-doped nanoferrites synthesized by sonochemical method
|
Palaniappan, P.
|
|
|
128 |
9 |
|
artikel
|
| 93 |
Structural, dielectric, impedance and electric modulus properties of praseodymium-substituted BaPrxFe12-X O19 nanoparticles synthesized via sol–gel method
|
Samiullah,
|
|
|
128 |
9 |
|
artikel
|
| 94 |
Structural evolution and enhanced dielectric properties of CeO2 modified lead-free (Bi0.5Na0.5TiO3)-(BaTiO3) solid solutions
|
Sahoo, S.
|
|
|
128 |
9 |
|
artikel
|
| 95 |
Structural, morphological, electrical, and magnetic characteristics of 20MnFe2O4-80SiO2 nanocomposite synthesized by the one-pot auto-combustion route
|
Salehizadeh, S. A.
|
|
|
128 |
9 |
|
artikel
|
| 96 |
Structural, optical, dielectric, and magnetic properties of iron-sillenite Bi25FeO40
|
Jebari, H.
|
|
|
128 |
9 |
|
artikel
|
| 97 |
Study of the up/down-conversion green luminescence of BaWO4: Er3+ phosphors for non-contact temperature sensing and solid-state lighting applications
|
Gopal, Ram
|
|
|
128 |
9 |
|
artikel
|
| 98 |
Study on the wear and corrosion resistance of Fe–Mo coatings on 65Mn steel ploughshares by laser cladding
|
Chen, Keyang
|
|
|
128 |
9 |
|
artikel
|
| 99 |
Surface evolution of crystalline SrTiO3, LaAlO3 and Y3Al5O12 targets during pulsed laser ablation
|
Jung, Florian
|
|
|
128 |
9 |
|
artikel
|
| 100 |
Surface micro/nanostructure on the TZ30 alloy regulated by the electrochemical etching method
|
Liu, Kai-Yang
|
|
|
128 |
9 |
|
artikel
|
| 101 |
Synthesis and application of triphenylamine-based aldehydes as photo-initiators for multi-photon lithography
|
Ladika, D.
|
|
|
128 |
9 |
|
artikel
|
| 102 |
Synthesis and characterization of magnetically recoverable CoFe2O4/ZnS/CuO nanoparticles as an effective photocatalyst and catalyst for degradation of MB and reduction of 4-nitrophenol
|
Kianfar, Ali Hossein
|
|
|
128 |
9 |
|
artikel
|
| 103 |
Synthesis and characterization of selenium nanoparticles obtained by femtosecond pulsed laser ablation in liquid media
|
Haro-Poniatowski, E.
|
|
|
128 |
9 |
|
artikel
|
| 104 |
Tailoring of structural, dielectric, and magnetic properties of SrBaCu2Fe12O22 hexaferrites by doping with Gd–Co binary mixtures
|
Malik, Huma
|
|
|
128 |
9 |
|
artikel
|
| 105 |
Tellurium level and bandgap energy of the O-rich ZnTexO1−x alloy calculated by first-principles calculations
|
Zhao, Chuan‑Zhen
|
|
|
128 |
9 |
|
artikel
|
| 106 |
Temperature-dependent structural and magnetic properties of (x)NiFe2O4+(1-x)BaTiO3 (0≤x≤1; Δx=0.1) multiferroic solid solutions
|
Bongurala, Prakash
|
|
|
128 |
9 |
|
artikel
|
| 107 |
The effect of pre-oxidation on the hot corrosion behavior of CoNiCrAlHf alloy in Na2SO4 environment at elevated temperature
|
Ali, Rawaid
|
|
|
128 |
9 |
|
artikel
|
| 108 |
The negative magnetization and exchange bias effect in compound NdMnO3: the role of magnetic ordering of Nd3+ and Mn3+ ions
|
Wang, Yan
|
|
|
128 |
9 |
|
artikel
|
| 109 |
Thermal and optical characterization of SiO2 spheres decorated with gold nanoparticles
|
Proa-Coronado, C.
|
|
|
128 |
9 |
|
artikel
|
| 110 |
Thermal stability and mechanical properties of Si/Ge superlattice nanowires having inclination interfaces from simulations at atomic scale
|
Zhao, Dandan
|
|
|
128 |
9 |
|
artikel
|
| 111 |
The structural, morphological, and optical study of chemical bath deposition and a spin coating deposited mackinawite FeS thin films
|
Malek, Tasmira J.
|
|
|
128 |
9 |
|
artikel
|
| 112 |
Wavelength dependence of laser-induced excitation dynamics in silicon
|
Venkat, Prachi
|
|
|
128 |
9 |
|
artikel
|
Tijdschrift beschrijving