| nr |
titel |
auteur |
tijdschrift |
jaar |
jaarg. |
afl. |
pagina('s) |
type |
| 1 |
Abundant optical soliton solutions to the Kudryashov equation and its modulation instability analysis
|
Ali, Karmina K.
|
|
|
56 |
1 |
|
artikel
|
| 2 |
A compact dual-band hybrid dielectric resonator antenna for blood glucose sensing and wireless communication
|
Mishra, Piyush Kumar
|
|
|
56 |
1 |
|
artikel
|
| 3 |
A comparative analysis of phase retrieval algorithms in asymmetric double image cryptosystem in gyrator domain
|
Tobria, Archana
|
|
|
56 |
1 |
|
artikel
|
| 4 |
A comprehensive study on optical, physical, mechanical and radiation shielding properties of calcium bismuth borophosphate glass–ceramics with distinct V2O5 contents
|
Khattari, Z. Y.
|
|
|
56 |
1 |
|
artikel
|
| 5 |
Advanced computational techniques for solving the modified KdV-KP equation and modeling nonlinear waves
|
Khater, Mostafa M. A.
|
|
|
56 |
1 |
|
artikel
|
| 6 |
Aluminium doping effects on physical properties of semiconductors InSb for optoelectronic devices: a computational insight
|
Gagui, S.
|
|
|
56 |
1 |
|
artikel
|
| 7 |
Aluminum-doped zinc oxide nanoparticles prepared via nanosecond Nd: YAG laser ablation in water: optoelectronic properties
|
Khashan, Khawla S.
|
|
|
56 |
1 |
|
artikel
|
| 8 |
A mathematical model for simulating photoacoustic signal generation and propagation in biological tissues
|
GadAllah, Mohammed Tarek
|
|
|
56 |
1 |
|
artikel
|
| 9 |
Analysis of optical solutions of higher-order nonlinear Schrödinger equation by the new Kudryashov and Bernoulli’s equation approaches
|
Murad, Muhammad Amin S.
|
|
|
56 |
1 |
|
artikel
|
| 10 |
Analytical treatment with the Nucci reduction technique on the p-forced nonlinear Klein–Gordon equation
|
Hashemi, M. S.
|
|
|
56 |
1 |
|
artikel
|
| 11 |
Analyzing dispersive optical solitons in nonlinear models using an analytical technique and its applications
|
Ahmad, Jamshad
|
|
|
56 |
1 |
|
artikel
|
| 12 |
An investigation of optical solitons of the fractional cubic-quintic nonlinear pulse propagation model: an analytic approach and the impact of fractional derivative
|
Akbar, M. Ali
|
|
|
56 |
1 |
|
artikel
|
| 13 |
An investigation on effect of various mono and Di-sulphide coatings on the performance of an Au–Ag bimetallic SPR sensor: an attempt towards noninvasive urine-glucose detection
|
Sahu, Ashok K.
|
|
|
56 |
1 |
|
artikel
|
| 14 |
A smooth evolution of wavelength complement coding integrated MDM/coherent NGPON incorporating probabilistically shaped-512 QAM
|
Kumari, Meet
|
|
|
56 |
1 |
|
artikel
|
| 15 |
Bell state-based semi-quantum signature scheme with arbitrator
|
Zhang, Tianyuan
|
|
|
56 |
1 |
|
artikel
|
| 16 |
Bifurcation and exact traveling wave solutions to a conformable nonlinear Schrödinger equation using a generalized double auxiliary equation method
|
Gasmi, Boubekeur
|
|
|
56 |
1 |
|
artikel
|
| 17 |
Blood component detection using photonic crystal fibre sensor
|
Akhdar, Hanan
|
|
|
56 |
1 |
|
artikel
|
| 18 |
Comparison of 970- and 790-nm pumping for a 2.8 μm, Er3+-doped ZBLAN fiber laser
|
Jung, Junha
|
|
|
56 |
1 |
|
artikel
|
| 19 |
Computational, experimental investigations on effect of phosphoric acid to enhance the linear and nonlinear optical properties of hexamine p-nitrophenol crystal
|
Durgadevi, R.
|
|
|
56 |
1 |
|
artikel
|
| 20 |
Controllable transparency and slow–fast light in an optomechanical system with a triple quantum well
|
Yu, Chunchao
|
|
|
56 |
1 |
|
artikel
|
| 21 |
Correction: Extinction efficiency and scattering asymmetry of a PEMC sphere illuminated by vortex electromagnetic waves
|
Arfan, M.
|
|
|
56 |
1 |
|
artikel
|
| 22 |
Correction: Laguerre–Gaussian beam scattering by a marine aerosol
|
Arfan, M.
|
|
|
56 |
1 |
|
artikel
|
| 23 |
Correction: Theoretical studies on the effects of pressure, temperature, and aluminum concentration on the optical absorption, refractive index and group velocity within GaAs/Ga1–xAlxAs quantum ring in the presence of Rashba spin–orbit interaction
|
Ghazwani, H. A.
|
|
|
56 |
1 |
|
artikel
|
| 24 |
Design and analysis of all optical header recognition system employing combination of carrier reservoir SOA and conventional SOA
|
Agarwal, Vipul
|
|
|
56 |
1 |
|
artikel
|
| 25 |
Design and optimization of hexagonal SPR-based photonic crystal fiber magnetic field sensor with magnetic fluid infiltration
|
Tang, Chang
|
|
|
56 |
1 |
|
artikel
|
| 26 |
Design and optimization of meandered plasmonic MIMO antenna with defected ground structure showing ultra-wideband response and high isolation for 6G/TWPAN communication
|
Patel, Shobhit K.
|
|
|
56 |
1 |
|
artikel
|
| 27 |
Design and simulation of photonic crystal fibre sensor for harmful chemicals detection in polycarbonate plastics
|
Maidi, Abdul Mu’iz
|
|
|
56 |
1 |
|
artikel
|
| 28 |
Dynamical structure and variety of new fiber optical solitons of the stochastic Ginzburg–Landau dynamical model
|
Raza, Nauman
|
|
|
56 |
1 |
|
artikel
|
| 29 |
Dynamics of M-truncated optical solitons in fiber optics governed by fractional dynamical system
|
Younas, U.
|
|
|
56 |
1 |
|
artikel
|
| 30 |
Dynamics of nonlinear diverse wave propagation to Improved Boussinesq model in weakly dispersive medium of shallow waters or ion acoustic waves using efficient technique
|
Bilal, Muhammad
|
|
|
56 |
1 |
|
artikel
|
| 31 |
Eco-friendly synthesis of tin oxide nanoparticles utilizing the buckthorn leaf extracts
|
Hadi, Aseel
|
|
|
56 |
1 |
|
artikel
|
| 32 |
Effect of different Gaussian-like laser profiles on electron energy gain in laser wakefield acceleration
|
Sharma, Vivek
|
|
|
56 |
1 |
|
artikel
|
| 33 |
Effect of ZnO doping co-carried out by Co–Cu on nonlinear optical properties prepared by the spin coating method
|
Mohammedi, Abdelkader
|
|
|
56 |
1 |
|
artikel
|
| 34 |
Efficiency droop free UV-C LED by introducing p-doped LQB and p-n-p-n-p doped AlGaN hole injection layer
|
Mazumder, Indrani
|
|
|
56 |
1 |
|
artikel
|
| 35 |
Electronic, optical, thermodynamic and thermoelectric properties of LiCu3Bi5 compound under strain effect
|
Jabar, A.
|
|
|
56 |
1 |
|
artikel
|
| 36 |
Energy efficient optimization using RTSO machine learning approach towards next generation optical network circuit for smart cities
|
Alanazi, Saad
|
|
|
56 |
1 |
|
artikel
|
| 37 |
Enhancing UWOC link performance using a hybrid OFDM/SAC-OCDMA system
|
Aissaoui, Amel
|
|
|
56 |
1 |
|
artikel
|
| 38 |
Explicit solitary wave solutions for the nonlinear equations in semiconductor and magnetic field with their stability analysis
|
Shahzad, Tahir
|
|
|
56 |
1 |
|
artikel
|
| 39 |
Exploration of optical solitons of a hyperbolic nonlinear Schrödinger equation
|
Ahmad, Shafiq
|
|
|
56 |
1 |
|
artikel
|
| 40 |
Exploring the properties of quaternary X2NaTlF6 (X = Cs, Rb) halide double perovskite materials for energy conversion, harvesting, and storage using density functional theory
|
Ayub, Gohar
|
|
|
56 |
1 |
|
artikel
|
| 41 |
Extraction of optical solitons for nonlinear Biswas–Milovic equation in magneto-optic waveguide
|
Shahzad, Tahir
|
|
|
56 |
1 |
|
artikel
|
| 42 |
Fine band gap tuning via Sr incorporated PbTiO3 for optoelectronic application: a DFT study
|
Rizwan, M.
|
|
|
56 |
1 |
|
artikel
|
| 43 |
Flower-like Cr2O3-Cr(OH)3/poly-2-chloroaniline nanocomposite photoelectrode grown on polypyrrole film for hydrogen generation from sewage water
|
Trabelsi, Amira Ben Gouider
|
|
|
56 |
1 |
|
artikel
|
| 44 |
Formation of optical soliton wave profiles of Shynaray-IIA equation via two improved techniques: a comparative study
|
Faridi, Waqas Ali
|
|
|
56 |
1 |
|
artikel
|
| 45 |
Four Laguerre–Gaussian mode-division multiplexed incorporated hybrid XG-PON and FSO Gamma Gamma fading system under severe weather conditions
|
Kumari, Meet
|
|
|
56 |
1 |
|
artikel
|
| 46 |
Generation of arbitrary shape microwave waveform centered on two fold cascaded Mach–Zehnder modulators
|
Raghuwanshi, Sanjeev Kumar
|
|
|
56 |
1 |
|
artikel
|
| 47 |
Growth and optical properties of (Na0.5Bi0.5)(Mo1−xWx)O4 (x = 0.25) single crystal: a potential candidate for optoelectronic devices
|
Guler, I.
|
|
|
56 |
1 |
|
artikel
|
| 48 |
High gain metamaterial-based 3D cross-shaped THz 16-port massive MIMO antenna array for future wireless network
|
Musaed, Alya Ali
|
|
|
56 |
1 |
|
artikel
|
| 49 |
Impact of Bi3+, Ba2+, and Pb2+ ions on the structural, thermal, mechanical, optical, and gamma ray shielding performance of borosilicate glass
|
Aloraini, Dalal Abdullah
|
|
|
56 |
1 |
|
artikel
|
| 50 |
Impact of iron doping on the structural and optical properties of nano Tin mono-sulfide SnS
|
Heiba, Zein K.
|
|
|
56 |
1 |
|
artikel
|
| 51 |
Improving the physical and optical characteristics of Zinc doped borate glass for bone replacement
|
Salatein, N. M.
|
|
|
56 |
1 |
|
artikel
|
| 52 |
Influence of intrinsic decoherence on quantum metrology of two atomic systems in the presence of dipole–dipole interaction
|
Abdel-Wahab, N. H.
|
|
|
56 |
1 |
|
artikel
|
| 53 |
Influence of [Na2O]/[CuO] on the physical and photon attenuation capacities of cupric sodium phosphate glasses: A comparative study
|
Al-Ghamdi, Hanan
|
|
|
56 |
1 |
|
artikel
|
| 54 |
investigating nonlinear fractional systems: reproducing kernel Hilbert space method
|
Attia, Nourhane
|
|
|
56 |
1 |
|
artikel
|
| 55 |
Investigation of fuzzy fractional Kuramoto–Sivashinsky equations by an efficient approach
|
Ahmad, Jamshad
|
|
|
56 |
1 |
|
artikel
|
| 56 |
Investigation of mechanical, optical, phonon frequencies, and sound velocity of nano-structured Gallium Phosphide (GaP) material under the effect of pressure
|
Elamin, Nuha Y.
|
|
|
56 |
1 |
|
artikel
|
| 57 |
Investigation of the structural, optical, electrical, and photovoltaic characteristics of nanostructured Ce-doped BaTiO3 by a modified combustion method
|
Varghese, Rini
|
|
|
56 |
1 |
|
artikel
|
| 58 |
Leaky mode analysis using complex infinite elements
|
Khalil, Ahmed E.
|
|
|
56 |
1 |
|
artikel
|
| 59 |
Machine learning-based inverse design of raised cosine few mode fiber for low coupling
|
Chebaane, Saleh
|
|
|
56 |
1 |
|
artikel
|
| 60 |
Magnetic, electronic, optical, thermoelectric, and thermodynamic properties of ErMn0.5Fe0.5O3 perovskite via GGA+U approach and Monte Carlo simulations
|
Imami, M.
|
|
|
56 |
1 |
|
artikel
|
| 61 |
Mixed integer programming with kriging surrogate model technique for dispersion control of photonic crystal fibers
|
Hammad, Ahmed E.
|
|
|
56 |
1 |
|
artikel
|
| 62 |
Modeling and analysis of a photonic crystal embedded ENZ gyrotropic metatronic amplifier using the mode matching technique
|
Fadafan, Ali Allahpour
|
|
|
56 |
1 |
|
artikel
|
| 63 |
Multi-analyte hybrid plasmonic dual grating biosensor hetereostructured by convexing slit width geometrical corrugation and its potentiality for noninvasive salivary glucose monitoring
|
Qayoom, Taban
|
|
|
56 |
1 |
|
artikel
|
| 64 |
Multiple and multifocal THz emission under external periodic electric field on laser irradiation of spherical and cylindrical nanoparticles
|
Malik, Hitendra K.
|
|
|
56 |
1 |
|
artikel
|
| 65 |
Multiple optical soliton solutions for wave propagation in nonlinear low-pass electrical transmission lines under analytical approach
|
Iqbal, Mujahid
|
|
|
56 |
1 |
|
artikel
|
| 66 |
New analytical solutions to a medium with completing weakly nonlocal nonlinearity and parabolic law nonlinearity by modified first integral method
|
Liu, Hong-Zhun
|
|
|
56 |
1 |
|
artikel
|
| 67 |
New exact solutions of (3+1)-dimensional modified KdV-Zakharov-Kuznetsov equation by Sardar-subequation method
|
Yasin, Sadia
|
|
|
56 |
1 |
|
artikel
|
| 68 |
New geometric magnetic energy according to geometric Frenet formulas
|
Ekinci, Alper
|
|
|
56 |
1 |
|
artikel
|
| 69 |
Novel topological, non-topological, and more solitons of the generalized cubic p-system describing isothermal flux
|
Az-Zo’bi, Emad A.
|
|
|
56 |
1 |
|
artikel
|
| 70 |
Oceanic turbulent effect on the received intensity of a generalized Hermite cosh-Gaussian beam
|
Saad, Faroq
|
|
|
56 |
1 |
|
artikel
|
| 71 |
On the solitonic wave structures for the perturbed nonlinear Schrödinger equation arising in optical fibers
|
Badshah, Fazal
|
|
|
56 |
1 |
|
artikel
|
| 72 |
On the two-photon quantum Rabi model at the critical coupling strength
|
Hammani, M.
|
|
|
56 |
1 |
|
artikel
|
| 73 |
Optical essential secret image sharing using unequal modulus decomposition and gyrator transform
|
Abdelfattah, Mohamed G.
|
|
|
56 |
1 |
|
artikel
|
| 74 |
Optical Heisenberg antiferromagnetic electroosmotic magnetic torque microscale
|
Körpinar, Talat
|
|
|
56 |
1 |
|
artikel
|
| 75 |
Optical quantum electromagnetic binormal Heisenberg landau lifshitz electromotive microscale
|
Körpinar, Talat
|
|
|
56 |
1 |
|
artikel
|
| 76 |
Optical solitons of M-fractional nonlinear Schrödinger’s complex hyperbolic model by generalized Kudryashov method
|
Hamali, Waleed
|
|
|
56 |
1 |
|
artikel
|
| 77 |
Optical solitons of SMCH model in mathematical physics: impact of wind and friction on wave
|
Mannaf, Md. Abde
|
|
|
56 |
1 |
|
artikel
|
| 78 |
Optical soliton solutions of perturbed nonlinear Schrödinger equation with parabolic law nonlinearity
|
Arshed, Saima
|
|
|
56 |
1 |
|
artikel
|
| 79 |
Optical wave profiles for the higher order cubic-quartic Bragg-gratings with anti-cubic nonlinear form
|
Shahzad, Tahir
|
|
|
56 |
1 |
|
artikel
|
| 80 |
Optimization and performance investigation of 1-Toffoli gate quantum full adders for spin-torque-based n-qubit architecture
|
Kulkarni, Anant
|
|
|
56 |
1 |
|
artikel
|
| 81 |
Passive Q-switched fiber laser with MAX phase molybdenum titanium aluminum carbide film
|
Najm, Mustafa Mohammed
|
|
|
56 |
1 |
|
artikel
|
| 82 |
Performance analysis of convolutional codes in dynamic underwater visible light communication systems
|
Elfikky, Abdelrahman
|
|
|
56 |
1 |
|
artikel
|
| 83 |
Performance estimation of SISO and MIMO Ro-FSO link under atmospheric turbulence
|
Kaur, Sanmukh
|
|
|
56 |
1 |
|
artikel
|
| 84 |
Physical and electrochemical properties of ammonium nickel phosphate by hydrothermal synthesis: phase transition from nickel phosphide to ammonium nickel phosphate
|
Farahi, Ehsan
|
|
|
56 |
1 |
|
artikel
|
| 85 |
Polymer nanocomposites comprising PVA matrix and Ag–BaTiO3 nanofillers: a comparative study of structural, dielectric and optical characteristics for optics and quantum nanoelectronic applications
|
Oreibi, Idrees
|
|
|
56 |
1 |
|
artikel
|
| 86 |
Preparation of Ag@SiO2 core–shell nanoparticles for plasmonic dye-sensitized solar cell application using laser ablation in liquid technique
|
Mohammed, Mohammed Adil
|
|
|
56 |
1 |
|
artikel
|
| 87 |
Propagation behavior of a generalized Hermite cosh-gaussian laser beam through marine environment
|
Saad, Faroq
|
|
|
56 |
1 |
|
artikel
|
| 88 |
Propagation of light wave around planets in cosmic space
|
Berceli, Tibor
|
|
|
56 |
1 |
|
artikel
|
| 89 |
Properties of MZO/ceramic and MZO/glass thin layers based on the substrate’s quality
|
Bouras, Dikra
|
|
|
56 |
1 |
|
artikel
|
| 90 |
Quantum hyper-entangled system with multiple qubits based on spontaneous parametric down-conversion and birefringence effect
|
Yang, Yiqian
|
|
|
56 |
1 |
|
artikel
|
| 91 |
Realization of a single-mode plasmonic bandpass filter based on a ring-shaped resonator and silver nanorods
|
Korani, Nastaran
|
|
|
56 |
1 |
|
artikel
|
| 92 |
RETRACTED ARTICLE: Advancing chemical sensors synthesis and classification for the integration of mems optical phased array in polymer nanocomposites
|
Gupta, Ekta
|
|
|
56 |
1 |
|
artikel
|
| 93 |
RETRACTED ARTICLE: AI-driven electro chromic materials and devices for nanofabrication in machine learning integrated environments
|
Prasanna, K. Mahesh
|
|
|
56 |
1 |
|
artikel
|
| 94 |
RETRACTED ARTICLE: A nano-scale design of a multiply-accumulate unit for digital signal processing based on quantum computing
|
Ahmadpour, Seyed-Sajad
|
|
|
56 |
1 |
|
artikel
|
| 95 |
RETRACTED ARTICLE: Application of optical network transmission based on 5G network in knowledge management of digital factories
|
Zifei, Li
|
|
|
56 |
1 |
|
artikel
|
| 96 |
RETRACTED ARTICLE: Application of wireless sensor network and Internet of things in building heating energy saving design
|
Zhang, Lihua
|
|
|
56 |
1 |
|
artikel
|
| 97 |
RETRACTED ARTICLE: Big data analytics for dynamic network slicing in 5G and beyond with dynamic user preferences
|
Syamala, Maganti
|
|
|
56 |
1 |
|
artikel
|
| 98 |
RETRACTED ARTICLE: Composition statistics of gynecological microscopic images based on texture analysis and medical intelligence system
|
Li, Hui
|
|
|
56 |
1 |
|
artikel
|
| 99 |
RETRACTED ARTICLE: Demodulating an acoustic signal stimulated by photo-thermal elastic energy conversion using quartz tuning forks
|
Tamilselvi, M.
|
|
|
56 |
1 |
|
artikel
|
| 100 |
RETRACTED ARTICLE: Design and analysis of inverse tapered silicon nitride waveguide for flat and highly coherent supercontinuum generation in the mid-infrared
|
Karim, M. R.
|
|
|
56 |
1 |
|
artikel
|
| 101 |
RETRACTED ARTICLE: Design and application of optical communication technology based on machine learning algorithms in physical education teaching information management system
|
Zhai, Qingwen
|
|
|
56 |
1 |
|
artikel
|
| 102 |
RETRACTED ARTICLE: Design and simulate the demultiplexer using photonic crystal ring resonator for DWDM system
|
Nivethitha, V.
|
|
|
56 |
1 |
|
artikel
|
| 103 |
RETRACTED ARTICLE: Design of precoder for a MIMO–NOMA system using Gaussian mixture modelling
|
Markkandan, S
|
|
|
56 |
1 |
|
artikel
|
| 104 |
RETRACTED ARTICLE: Emerging network communication for malicious node detection in wireless multimedia sensor networks
|
Jayadhas, S. Arockia
|
|
|
56 |
1 |
|
artikel
|
| 105 |
RETRACTED ARTICLE: Flow monitoring system and abnormal log traffic mode detection based on artificial intelligence
|
Cao, Jinghua
|
|
|
56 |
1 |
|
artikel
|
| 106 |
RETRACTED ARTICLE: Massive MIMO based beamforming by optical multi-hop communication with energy efficiency for smart grid IoT 5G application
|
Rajiv, Asha
|
|
|
56 |
1 |
|
artikel
|
| 107 |
RETRACTED ARTICLE: Novel thiazole carbamothioyl benzamide derivative Mn(II), Ni(II), and Cu(II) complexes: synthesis, structural characterisation, computational, and biological potency
|
Al-Farraj, Eida S.
|
|
|
56 |
1 |
|
artikel
|
| 108 |
RETRACTED ARTICLE: Optical bio sensor based cancer cell detection using optimized machine learning model with quantum computing
|
Balamurugan, G.
|
|
|
56 |
1 |
|
artikel
|
| 109 |
RETRACTED ARTICLE: Optical sensor based athlete player health monitoring and performance enhancement using data analytics based on machine learning model
|
Li, Chaojun
|
|
|
56 |
1 |
|
artikel
|
| 110 |
RETRACTED ARTICLE: Optical wireless communication based mobile edge computing integrated channel allocation using scheduling with machine learning protocols in advanced 5G networks
|
Vishnoi, Rahul
|
|
|
56 |
1 |
|
artikel
|
| 111 |
RETRACTED ARTICLE: Optimizing optical network longevity via Q-learning-based routing protocol for energy efficiency and throughput enhancement
|
Jatti, Ashwini V.
|
|
|
56 |
1 |
|
artikel
|
| 112 |
RETRACTED ARTICLE: Photovoltaic fuzzy based modelling on defining energy efficient solar devices in industry 4.0
|
Pavan Kumar, T. V. V.
|
|
|
56 |
1 |
|
artikel
|
| 113 |
RETRACTED ARTICLE: Reinforcement learning-based model for the prevention of beam-forming vector attacks on massive MIMO system
|
Paranthaman, R. Nithya
|
|
|
56 |
1 |
|
artikel
|
| 114 |
RETRACTED ARTICLE: Research on intelligent operation and maintenance of power systems in manufacturing enterprises based on digital twin technology
|
Liu, Chao
|
|
|
56 |
1 |
|
artikel
|
| 115 |
RETRACTED ARTICLE: Research on key technologies of data security and privacy protection in Internet of Things group intelligence
|
Liu, Yadong
|
|
|
56 |
1 |
|
artikel
|
| 116 |
RETRACTED ARTICLE: Securing communicating networks in the age of big data: an advanced detection system for cyber attacks
|
Rao, S. Uma Maheswara
|
|
|
56 |
1 |
|
artikel
|
| 117 |
RETRACTED ARTICLE: Simulation of optical image detection based on language activity detection algorithm in piano network teaching system
|
Xiao, Yayun
|
|
|
56 |
1 |
|
artikel
|
| 118 |
Retrieval of optical soliton solutions of stochastic perturbed Schrödinger-Hirota equation with Kerr law in the presence of spatio-temporal dispersion
|
Ozisik, Muslum
|
|
|
56 |
1 |
|
artikel
|
| 119 |
Revised mathematical model for assessment of thermal characteristics developed in ultrafast pulse laser assisted nanoimprinting lithography on silicon based substrate surface
|
Dutta, Jaideep
|
|
|
56 |
1 |
|
artikel
|
| 120 |
Simulation of Ginzburg–Landau equation via rational RBF partition of unity approach
|
Abbaszadeh, Mostafa
|
|
|
56 |
1 |
|
artikel
|
| 121 |
Spoof surface plasmons based reconfigurable bandstop filter for THz applications
|
Ram, G. Challa
|
|
|
56 |
1 |
|
artikel
|
| 122 |
Stability analysis and soliton solutions of truncated M-fractional Heisenberg ferromagnetic spin chain model via two analytical methods
|
Ahmad, Jamshad
|
|
|
56 |
1 |
|
artikel
|
| 123 |
Stability and numerical analysis of fractional BBM-Burger equation and fractional diffusion-wave equation with Caputo derivative
|
Mohan, Lalit
|
|
|
56 |
1 |
|
artikel
|
| 124 |
Structural, optical, and dielectric properties of PVC/ZnMn2O4/PbS polymers with and without MWCNTs
|
El-naggar, A. M.
|
|
|
56 |
1 |
|
artikel
|
| 125 |
Structural, vibrational, optical and second harmonic generation studies of urea doped single KDP crystals grown by Sankaranarayanan–Ramasamy technique
|
Phan, Vinh Trung
|
|
|
56 |
1 |
|
artikel
|
| 126 |
Study of optical bistability/multistability and transparency in cavity-assisted-hybrid optomechanical system embedded with quantum dot molecules
|
Kumar, Ranjan
|
|
|
56 |
1 |
|
artikel
|
| 127 |
Supercontinuum generation in tapered planar rib waveguide based on GAP-Se hybrid chalcogenide
|
Sheikhmolaee, Mohammad
|
|
|
56 |
1 |
|
artikel
|
| 128 |
Superior peak-to-valley current ratio in Esaki diode by utilizing a quantum well
|
Bayat, Ramin Nouri
|
|
|
56 |
1 |
|
artikel
|
| 129 |
The impact of gallium ions on borosilicate glasses for structural, optical and biological applications
|
Tiama, Taha M.
|
|
|
56 |
1 |
|
artikel
|
| 130 |
Theoretical studies on the effects of pressure, temperature, and aluminum concentration on the optical absorption, refractive index and group velocity within GaAs/Ga1−xAlxAs quantum ring in the presence of Rashba spin–orbit interaction
|
Ghazwani, H. A.
|
|
|
56 |
1 |
|
artikel
|
| 131 |
Tunable electromagnetically induced transparency metamaterial utilizing bright-dark mode coupling between electric and toroidal resonances
|
Shu, Chang
|
|
|
56 |
1 |
|
artikel
|
| 132 |
Wave propagation to the doubly dispersive equation and the improved Boussinesq equation
|
Ibrahim, Salisu
|
|
|
56 |
1 |
|
artikel
|
Tijdschrift beschrijving