| nr |
titel |
auteur |
tijdschrift |
jaar |
jaarg. |
afl. |
pagina('s) |
type |
| 1 |
Adequately stabilized and exposed copper heterostructure for CO2 electroreduction to ethanol with ultrahigh mass activity
|
Jiang, Xingxing
|
|
|
58 |
C |
p. 216-225
|
artikel
|
| 2 |
Catalytic conversion of triglycerides into diesel, jet fuel, and lube base oil
|
Baik, Yaejun
|
|
|
58 |
C |
p. 15-24
|
artikel
|
| 3 |
Chlorine radical-mediated photocatalytic C(sp 3)−H bond oxidation of aryl ethers to esters
|
Liu, Yuting
|
|
|
58 |
C |
p. 123-128
|
artikel
|
| 4 |
Construction of intramolecular and interfacial built-in electric field in a donor-acceptor conjugated polymers-based S-scheme heterojunction for high photocatalytic H2 generation
|
Wang, Lele
|
|
|
58 |
C |
p. 194-205
|
artikel
|
| 5 |
Construction of S-scheme heterojunction from protonated D-A typed polymer and MoS2 for efficient photocatalytic H2 production
|
Pan, Jinkang
|
|
|
58 |
C |
p. 180-193
|
artikel
|
| 6 |
Electrocatalytic nitrate reduction to ammonia: A perspective on Fe/Cu-containing catalysts
|
Chen, Lili
|
|
|
58 |
C |
p. 25-36
|
artikel
|
| 7 |
Electrochemical synthesis in company with hydrogen production via renewable energy: Opportunities and challenges
|
Wei, Zidong
|
|
|
58 |
C |
p. 1-6
|
artikel
|
| 8 |
Electronic modification of Ni active sites by W for selective benzylamine oxidation and concurrent hydrogen production
|
Tu, Zhentao
|
|
|
58 |
C |
p. 146-156
|
artikel
|
| 9 |
Functional ladder-like heterojunctions of Mo2C layers inside carbon sheaths for efficient CO2 fixation
|
Xu, Yu-Shuai
|
|
|
58 |
C |
p. 138-145
|
artikel
|
| 10 |
Ipolymer Cd3(C3N3S3)2/Zn3(C3N3S3)2 S-scheme heterojunction enhances photocatalytic H2 production
|
Yang, Tingting
|
|
|
58 |
C |
p. 157-167
|
artikel
|
| 11 |
Mutualism in organic synthetic chemistry: Simultaneous heterodehydrocoupling of hydrostannane and reduction of quinoline
|
Liu, Tianwei
|
|
|
58 |
C |
p. 129-137
|
artikel
|
| 12 |
Near infrared-driven photocatalytic overall water splitting: Progress and perspective
|
Huang, Yuanyong
|
|
|
58 |
C |
p. 105-122
|
artikel
|
| 13 |
Primary alcohols as killers of Ni-based catalysts in transfer hydrogenation
|
Nesterov, Nikolay
|
|
|
58 |
C |
p. 168-179
|
artikel
|
| 14 |
Progress on facet engineering of catalysts for application in photo/electro-catalysis
|
Li, Qi
|
|
|
58 |
C |
p. 86-104
|
artikel
|
| 15 |
Revolutionizing Zn-Air batteries with chainmail catalysts: Ultrathin carbon-encapsulated FeNi alloys on N-doped graphene for enhanced oxygen electrocatalysis
|
Guo, Yibo
|
|
|
58 |
C |
p. 206-215
|
artikel
|
| 16 |
Synergy between heterogeneous catalysis and homogeneous radical reactions for pharmaceutical waste destruction: Perspective
|
Murzin, Dmitry Yu.
|
|
|
58 |
C |
p. 7-14
|
artikel
|
| 17 |
TEMPO radically expedites the conversion of sulfides to sulfoxides by pyrene-based metal-organic framework photocatalysis
|
Zeng, Bing
|
|
|
58 |
C |
p. 226-236
|
artikel
|
| 18 |
Top-down fabrication of active interface between TiO2 and Pt nanoclusters. Part 2: Catalytic performance and reaction mechanism in CO oxidation
|
Du, Xiaorui
|
|
|
58 |
C |
p. 247-254
|
artikel
|
| 19 |
Top-down fabrication of active interface between TiO2 and Pt nanoclusters. Part 1: Redispersion process and mechanism
|
Du, Xiaorui
|
|
|
58 |
C |
p. 237-246
|
artikel
|
| 20 |
Unleashing the versatility of porous nanoarchitectures: A voyage for sustainable electrocatalytic water splitting
|
Loh, Jian Yiing
|
|
|
58 |
C |
p. 37-85
|
artikel
|
Tijdschrift beschrijving