| nr |
titel |
auteur |
tijdschrift |
jaar |
jaarg. |
afl. |
pagina('s) |
type |
| 1 |
A computational study of yttria-stabilized zirconia: II. Cation diffusion
|
Dong, Yanhao
|
|
|
126 |
C |
p. 438-450
|
artikel
|
| 2 |
A general model for thermal and electrical conductivity of binary metallic systems
|
Wei, Changdong
|
|
|
126 |
C |
p. 272-279
|
artikel
|
| 3 |
A methodology to determine the elastic moduli of crystals by matching experimental and simulated lattice strain pole figures using discrete harmonics
|
Wielewski, Euan
|
|
|
126 |
C |
p. 469-480
|
artikel
|
| 4 |
An atom probe study on Nb solute partitioning and nanocrystalline grain stabilization in mechanically alloyed Cu-Nb
|
Kapoor, Monica
|
|
|
126 |
C |
p. 564-575
|
artikel
|
| 5 |
An origin of functional fatigue of shape memory alloys
|
Gao, Y.
|
|
|
126 |
C |
p. 389-400
|
artikel
|
| 6 |
A novel high-strain-rate ferrite dynamic softening mechanism facilitated by the interphase in the austenite/ferrite microstructure
|
Haghdadi, N.
|
|
|
126 |
C |
p. 44-57
|
artikel
|
| 7 |
Cohesive and adhesive properties of ultrathin amorphous and crystalline Ge2Sb2Te5 films on polyimide substrates
|
Schlich, Franziska F.
|
|
|
126 |
C |
p. 264-271
|
artikel
|
| 8 |
Compositional effects in Ag2ZnSnSe4 thin films and photovoltaic devices
|
Gershon, Talia
|
|
|
126 |
C |
p. 383-388
|
artikel
|
| 9 |
Compressive and fatigue behavior of beta-type titanium porous structures fabricated by electron beam melting
|
Liu, Y.J.
|
|
|
126 |
C |
p. 58-66
|
artikel
|
| 10 |
Computer simulation of sequential transformations
|
Alves, André L.M.
|
|
|
126 |
C |
p. 451-468
|
artikel
|
| 11 |
Correlation of microchemistry of cell boundary phase and interface structure to the coercivity of Sm(Co0.784Fe0.100Cu0.088Zr0.028)7.19 sintered magnets
|
Sepehri-Amin, H.
|
|
|
126 |
C |
p. 1-10
|
artikel
|
| 12 |
Corrigendum to: “Grain growth competition during thin-sample directional solidification of dendritic microstructures: A phase-field study” [Acta Mater. 122 (2017) 220–235]
|
Tourret, D.
|
|
|
126 |
C |
p. 576
|
artikel
|
| 13 |
Crystallographic analysis on atomic-plane parallelisms between bcc precipitates and hcp matrix in recrystallized Zr-2.5Nb alloys
|
Matsukawa, Y.
|
|
|
126 |
C |
p. 86-101
|
artikel
|
| 14 |
Cu6Sn5 crystal growth mechanisms during solidification of electronic interconnections
|
Xian, J.W.
|
|
|
126 |
C |
p. 540-551
|
artikel
|
| 15 |
Damage micromechanisms in dual-phase steel investigated with combined phase- and absorption-contrast tomography
|
Toda, Hiroyuki
|
|
|
126 |
C |
p. 401-412
|
artikel
|
| 16 |
Defining the tensile properties of Al-12Si parts produced by selective laser melting
|
Prashanth, K.G.
|
|
|
126 |
C |
p. 25-35
|
artikel
|
| 17 |
Dislocation strengthening in FCC metals and in BCC metals at high temperatures
|
Madec, Ronan
|
|
|
126 |
C |
p. 166-173
|
artikel
|
| 18 |
Editors for Acta Materialia
|
|
|
|
126 |
C |
p. iii
|
artikel
|
| 19 |
Effect of hot rolling and primary annealing on the microstructure and texture of a β-stabilised γ-TiAl based alloy
|
Erdely, Petra
|
|
|
126 |
C |
p. 145-153
|
artikel
|
| 20 |
Effect of β (110) texture intensity on α-variant selection and microstructure morphology during β→α phase transformation in near α titanium alloy
|
Zhao, Z.B.
|
|
|
126 |
C |
p. 372-382
|
artikel
|
| 21 |
Energy of low angle grain boundaries based on continuum dislocation structure
|
Zhang, Luchan
|
|
|
126 |
C |
p. 11-24
|
artikel
|
| 22 |
Environmentally-assisted grain boundary attack as a mechanism of embrittlement in a nickel-based superalloy
|
Németh, A.A.N.
|
|
|
126 |
C |
p. 361-371
|
artikel
|
| 23 |
Evaluation of an Al-Ce alloy for laser additive manufacturing
|
Plotkowski, A.
|
|
|
126 |
C |
p. 507-519
|
artikel
|
| 24 |
Evolution of dislocation structure in neutron irradiated Zircaloy-2 studied by synchrotron x-ray diffraction peak profile analysis
|
Seymour, T.
|
|
|
126 |
C |
p. 102-113
|
artikel
|
| 25 |
Evolution of superdislocation structures during tertiary creep of a nickel-based single-crystal superalloy at high temperature and low stress
|
Tang, Yuling
|
|
|
126 |
C |
p. 336-345
|
artikel
|
| 26 |
Fabrication, characterisation and modelling of uniform and gradient auxetic foam sheets
|
Duncan, O.
|
|
|
126 |
C |
p. 426-437
|
artikel
|
| 27 |
Fatigue crack growth anisotropy in ultrafine-grained iron
|
Leitner, Thomas
|
|
|
126 |
C |
p. 154-165
|
artikel
|
| 28 |
Fluid flow through replicated microcellular materials in the Darcy-Forchheimer regime
|
Weber, L.
|
|
|
126 |
C |
p. 280-293
|
artikel
|
| 29 |
Fragmentation-driven grain refinement in directional solidification of AlCu10wt-% alloy at low pulling speeds
|
Zimmermann, G.
|
|
|
126 |
C |
p. 236-250
|
artikel
|
| 30 |
Grain boundary segregation in immiscible nanocrystalline alloys
|
Abdeljawad, Fadi
|
|
|
126 |
C |
p. 528-539
|
artikel
|
| 31 |
Grain-size-induced ferroelectricity in NaNbO3
|
Koruza, Jurij
|
|
|
126 |
C |
p. 77-85
|
artikel
|
| 32 |
Growth of { 11 2 ¯ 2 } twins in titanium: A combined experimental and modelling investigation of the local state of deformation
|
Guo, Y.
|
|
|
126 |
C |
p. 221-235
|
artikel
|
| 33 |
In situ high-energy X-ray diffraction study of tensile deformation of neutron-irradiated polycrystalline Fe-9%Cr alloy
|
Zhang, Xuan
|
|
|
126 |
C |
p. 67-76
|
artikel
|
| 34 |
In-situ observation of coupled peritectic growth in a binary organic model alloy
|
Ludwig, A.
|
|
|
126 |
C |
p. 329-335
|
artikel
|
| 35 |
Keyhole formation and thermal fluid flow-induced porosity during laser fusion welding in titanium alloys: Experimental and modelling
|
Panwisawas, Chinnapat
|
|
|
126 |
C |
p. 251-263
|
artikel
|
| 36 |
Liquid channel segregation and morphology and their relation with hot cracking susceptibility during columnar growth in binary alloys
|
Wang, Lei
|
|
|
126 |
C |
p. 302-312
|
artikel
|
| 37 |
Mechanisms of radiation-induced segregation in CrFeCoNi-based single-phase concentrated solid solution alloys
|
He, Mo-Rigen
|
|
|
126 |
C |
p. 182-193
|
artikel
|
| 38 |
Misfit dislocation patterns of Mg-Nb interfaces
|
Chen, Y.
|
|
|
126 |
C |
p. 552-563
|
artikel
|
| 39 |
On the origin of the metastable β-Ta phase stabilization in tantalum sputtered thin films
|
Colin, Jonathan J.
|
|
|
126 |
C |
p. 481-493
|
artikel
|
| 40 |
On the ultimate tensile strength of tantalum
|
Hahn, Eric N.
|
|
|
126 |
C |
p. 313-328
|
artikel
|
| 41 |
On the understanding of the effects of sample size on the variability in fracture toughness of bulk metallic glasses
|
Gludovatz, Bernd
|
|
|
126 |
C |
p. 494-506
|
artikel
|
| 42 |
Piezoelectric and ferroelectric properties of <001>C Pb(In1/2Nb1/2)O3-Pb(Mg1/3Nb2/3)O3-PbTiO3 single crystals under combined thermal and mechanical loading
|
Schader, Florian H.
|
|
|
126 |
C |
p. 174-181
|
artikel
|
| 43 |
Probing electrocolored Fe-doped SrTiO3 bulks using optical second harmonic generation
|
Ascienzo, D.
|
|
|
126 |
C |
p. 520-527
|
artikel
|
| 44 |
Reactive wetting and filling of boron nitride nanotubes by molten aluminum during equilibrium solidification
|
Nautiyal, Pranjal
|
|
|
126 |
C |
p. 124-131
|
artikel
|
| 45 |
Regular eutectic and anomalous eutectic growth behavior in laser remelting of Ni-30wt%Sn alloys
|
Lin, Xin
|
|
|
126 |
C |
p. 210-220
|
artikel
|
| 46 |
Small-volume aluminum alloys with native oxide shell deliver unprecedented strength and toughness
|
Li, Shi-Hao
|
|
|
126 |
C |
p. 202-209
|
artikel
|
| 47 |
Structural and magnetic characterization of the double perovskites R2NiRuO6 (R = Pr-Er): A neutron diffraction study
|
Kayser, P.
|
|
|
126 |
C |
p. 114-123
|
artikel
|
| 48 |
The contribution of 180° domain wall motion to dielectric properties quantified from in situ X-ray diffraction
|
Fancher, C.M.
|
|
|
126 |
C |
p. 36-43
|
artikel
|
| 49 |
The effect of carbon on the microstructures, mechanical properties, and deformation mechanisms of thermo-mechanically treated Fe40.4Ni11.3Mn34.8Al7.5Cr6 high entropy alloys
|
Wang, Zhangwei
|
|
|
126 |
C |
p. 346-360
|
artikel
|
| 50 |
The temperature and size effect on the electrical resistivity of Cu/V multilayer films
|
Wang, P.P.
|
|
|
126 |
C |
p. 294-301
|
artikel
|
| 51 |
Three-dimensional modeling of grain structure evolution during welding of an aluminum alloy
|
Wei, H.L.
|
|
|
126 |
C |
p. 413-425
|
artikel
|
| 52 |
Twin recrystallization mechanisms and exceptional contribution to texture evolution during annealing in a magnesium alloy
|
Guan, Dikai
|
|
|
126 |
C |
p. 132-144
|
artikel
|
| 53 |
V0.5Mo0.5Nx/MgO(001): Composition, nanostructure, and mechanical properties as a function of film growth temperature
|
Kindlund, H.
|
|
|
126 |
C |
p. 194-201
|
artikel
|
Tijdschrift beschrijving