nr |
titel |
auteur |
tijdschrift |
jaar |
jaarg. |
afl. |
pagina('s) |
type |
1 |
Crystallization mechanism study on ZSM-48 in the system Na2O-Al2O3-SiO2-H2N(CH2)6NH2
|
Fan, Weibin |
|
1997 |
8 |
3-4 |
p. 131-140 10 p. |
artikel |
2 |
Diffusion in a unidimensional zeolite pore system: Propane in AlPO4-5
|
Brandani, Stefano |
|
1997 |
8 |
3-4 |
p. 193-200 8 p. |
artikel |
3 |
Dissolution of high-silica zeolites in alkaline solutions II. Dissolution of ‘activated’ silicalite-1 and ZSM-5 with different aluminum content
|
Čimek, Ankica |
|
1997 |
8 |
3-4 |
p. 159-169 11 p. |
artikel |
4 |
Effect of steam activation on the porosity and chemical nature of activated carbons from Eucalyptus globulus and peach stones
|
Arriagada, R. |
|
1997 |
8 |
3-4 |
p. 123-130 8 p. |
artikel |
5 |
High pressure gas permeability of microporous carbon membranes
|
Katsaros, F.K. |
|
1997 |
8 |
3-4 |
p. 171-176 6 p. |
artikel |
6 |
Oxyfluorinated compounds with an open structure XVI. Synthesis, structure determination and magnetic properties of Fe4F3(PO4)(HPO4)4(H2O)4(N2C3H12) [ULM-15]
|
Cavellec, M. |
|
1997 |
8 |
3-4 |
p. 103-112 10 p. |
artikel |
7 |
Preparation and characterization of spinel-type high surface area Al2O3-ZnAl2O4 mixed metal oxides by an alkoxide route
|
Otero Areán, C. |
|
1997 |
8 |
3-4 |
p. 187-192 6 p. |
artikel |
8 |
Synthesis and characterization of Al-pillared and cationic surfactant modified Al-pillared Algerian bentonite
|
Khalaf, H. |
|
1997 |
8 |
3-4 |
p. 141-150 10 p. |
artikel |
9 |
Tailoring micropore dimensions in pillared clays for enhanced gas adsorption
|
Cheng, Linda S. |
|
1997 |
8 |
3-4 |
p. 177-186 10 p. |
artikel |
10 |
The influence of metal ions on the synthesis of MeAPO-5 (Me-Co, Mg) in the presence of acetate ions
|
Ahn, Sungil |
|
1997 |
8 |
3-4 |
p. 113-121 9 p. |
artikel |
11 |
The transformation of 1,2,4-trimethylbenzene A probe reaction to monitor external surface modifications of HZSM-5?
|
Röger, H.P. |
|
1997 |
8 |
3-4 |
p. 151-157 7 p. |
artikel |