| nr |
titel |
auteur |
tijdschrift |
jaar |
jaarg. |
afl. |
pagina('s) |
type |
| 1 |
Achieving simultaneously low loss tangent and high resistivity in MgO modified Sr0.979Y0.014TiO3 colossal-permittivity ceramics via inhibiting the diffusion of oxygen vacancies
|
Wang, Bo
|
|
|
50 |
23PC |
p. 51650-51660
|
artikel
|
| 2 |
Acoustic wave devices based on piezoelectric/ferroelectric thin films for high-frequency communication systems and sensing applications
|
Xue, Yanmei
|
|
|
50 |
23PC |
p. 52051-52058
|
artikel
|
| 3 |
A data-driven cross-scale polarization states recognition method based on scanning convergent beam electron diffraction in ferroelectric ceramic
|
Xu, Jingzhe
|
|
|
50 |
23PC |
p. 51631-51635
|
artikel
|
| 4 |
Advancing energy storage capabilities in 0.7BNST(1-x)-0.3BLMN x lead-free dielectric ceramic materials
|
Dong, Guangzhi
|
|
|
50 |
23PC |
p. 51911-51918
|
artikel
|
| 5 |
Alternating current poling conditions determination by orthogonal experimental design
|
Chen, Ziyun
|
|
|
50 |
23PC |
p. 51738-51745
|
artikel
|
| 6 |
AMF-13 & AMEC-13
|
Zhang, Nan
|
|
|
50 |
23PC |
p. 51609
|
artikel
|
| 7 |
A miniature multi-DOF ring-shaped piezoelectric actuator capable of driving both flat and spherical movers
|
Li, Jing
|
|
|
50 |
23PC |
p. 51804-51811
|
artikel
|
| 8 |
An enhanced strain response in micrometer-thick BNT-ST thin films
|
Zhao, Jinyan
|
|
|
50 |
23PC |
p. 52059-52066
|
artikel
|
| 9 |
Bi-functional CoCr2O4 hollow-sphere for enhanced oxygen evolution reaction and photocatalyst for harmful environmental pollutants removal
|
Liu, Yung-Chieh
|
|
|
50 |
23PC |
p. 51901-51910
|
artikel
|
| 10 |
BiScO3-PbTiO3 based high temperature piezoelectric ceramics composite ultrasonic transducer
|
Sun, Xinhao
|
|
|
50 |
23PC |
p. 51987-51994
|
artikel
|
| 11 |
Broadband ultrasonic transducer based on nested composite structure with gradient acoustic impedance
|
Hou, Chenxue
|
|
|
50 |
23PC |
p. 51928-51934
|
artikel
|
| 12 |
Carbon quantum dots boosted resistive switching and magnetic properties in Co3O4-based memory devices
|
Yao, Chuangye
|
|
|
50 |
23PC |
p. 51832-51840
|
artikel
|
| 13 |
Ceramic nanoparticle based flexible hydrovoltaic devices for tactile and respiratory signal detection
|
Liu, Libo
|
|
|
50 |
23PC |
p. 51964-51971
|
artikel
|
| 14 |
Crystal structure, bond characteristics and enhanced microwave dielectric properties of Sr0.6Ca0.4LaAl1-x (Zn0.5Ti0.5) x O4 ceramics
|
Kang, Jinteng
|
|
|
50 |
23PC |
p. 51709-51717
|
artikel
|
| 15 |
Design and experimental study of a planar piezoelectric actuator with resonant actuation
|
Deng, Jie
|
|
|
50 |
23PC |
p. 51775-51781
|
artikel
|
| 16 |
Design, synthesis and Characterization of a novel antiferroelectric solid solution (1-x)PbHfO3-xBiAlO3
|
Chauhan, Vidhi
|
|
|
50 |
23PC |
p. 52118-52126
|
artikel
|
| 17 |
DFT and experimental approaches of effect of (Al, Ga) doping ions on colossal dielectric properties of ZnO ceramic
|
Nachaithong, Theeranuch
|
|
|
50 |
23PC |
p. 52134-52143
|
artikel
|
| 18 |
Dielectric energy storage properties of low-temperature sintered BNT-based ceramics with LiF and B2O3–Bi2O3 as sintering aids
|
Dong, Rizhuang
|
|
|
50 |
23PC |
p. 51617-51624
|
artikel
|
| 19 |
Dielectric, impedance, and ferroelectric performances with structural heterogeneity of Sr0.7Bi0.2TiO3 modified lead-free bismuth ferrite-based ceramics
|
Shi, Jing
|
|
|
50 |
23PC |
p. 51679-51686
|
artikel
|
| 20 |
3D printed piezoelectric focused element for ultrasonic transducer
|
Zheng, Kun
|
|
|
50 |
23PC |
p. 51863-51869
|
artikel
|
| 21 |
3D printing PMN-PT textured ceramics for transducer applications
|
Zheng, Kun
|
|
|
50 |
23PC |
p. 51870-51876
|
artikel
|
| 22 |
Dramatic impact of raw chemicals on the electrical properties of SrTiO3 ceramics
|
Wang, Yuanyuan
|
|
|
50 |
23PC |
p. 51841-51847
|
artikel
|
| 23 |
Dual polymer (PVDF-HFP and PES) matrix / Li6·4La3Zr1·4Ta0·6O12 composite solid electrolyte with good stability for solid state lithium ion batteries operating at different temperatures
|
Wu, Xi
|
|
|
50 |
23PC |
p. 52110-52117
|
artikel
|
| 24 |
Effect of epoxy resin addition on the acoustic impedance, microstructure, dielectric and piezoelectric properties of 1–3 connectivity lead-free barium zirconate titanate ceramic cement-based composites
|
Wittinanon, Thanyapon
|
|
|
50 |
23PC |
p. 52144-52151
|
artikel
|
| 25 |
Effects of Ga2O3 doping on the microstructure and dielectric properties of SrTiO3–SmAlO3 ceramics for microwave applications
|
Yao, Mengchen
|
|
|
50 |
23PC |
p. 51782-51788
|
artikel
|
| 26 |
Effects of particle size and O-contamination of LiF on the phase purity and microwave dielectric properties of BaLiF3 ceramic
|
Bian, J.J.
|
|
|
50 |
23PC |
p. 51877-51880
|
artikel
|
| 27 |
Effects of structural defects on dielectric properties of Nb-doped SrTiO3-based ceramics
|
He, Zichen
|
|
|
50 |
23PC |
p. 51636-51641
|
artikel
|
| 28 |
Energy storage properties of high polarization 2D-Na0.5Bi0.5TiO3 reinforced polyimide composites
|
Zhao, Ting
|
|
|
50 |
23PC |
p. 51995-52003
|
artikel
|
| 29 |
Enhanced comprehensive energy storage performance of BNST-based lead-free ceramics with innovative BLZT addition
|
Dong, Guangzhi
|
|
|
50 |
23PC |
p. 51671-51678
|
artikel
|
| 30 |
Enhanced domain switching contributing to large strain response in (Bi0 . 5Na0.5)TiO3–SrTiO3 lead-free thin films
|
Zhao, Jinyan
|
|
|
50 |
23PC |
p. 51724-51732
|
artikel
|
| 31 |
Enhanced electrical and energy storage performances of Fe, Sb co-doped BNBCTS ceramics synthesized via the solid-state combustion technique
|
Kornphom, C.
|
|
|
50 |
23PC |
p. 51789-51803
|
artikel
|
| 32 |
Enhanced microwave dielectric properties in one-step cold sintered LiF ceramics via pre-calcination treatment
|
Yuan, Jia Peng
|
|
|
50 |
23PC |
p. 51625-51630
|
artikel
|
| 33 |
Enhanced piezoelectricity of P(VDF-TrFE) by BN nanosheets doping and leading to high performance laminated magnetoelectric composites
|
Song, Hongrui
|
|
|
50 |
23PC |
p. 51972-51978
|
artikel
|
| 34 |
Enhanced strain and reduced dielectric loss in a bismuth-based high-T C ternary solid solution system of BiScO3-Pb(Sc1/2Nb1/2)O3-PbTiO3
|
Liu, Zenghui
|
|
|
50 |
23PC |
p. 51701-51708
|
artikel
|
| 35 |
Enhancement of energy storage properties of BNST-based lead-free relaxor ferroelectrics via optimization strategy
|
Qiao, Wenjing
|
|
|
50 |
23PC |
p. 51754-51761
|
artikel
|
| 36 |
Fault-tolerant structures against breakdown in heterogeneous ferroelectric PbZr0.52Ti0.48O3 thin films based on adaptive self-repairing effects
|
Lao, Jinhua
|
|
|
50 |
23PC |
p. 51881-51887
|
artikel
|
| 37 |
Ferroelectricity in Ce0.2-HfO2 films around 500 nm in thickness
|
Wu, Yida
|
|
|
50 |
23PC |
p. 52036-52040
|
artikel
|
| 38 |
Flexible hybrid piezo/triboelectric energy harvester based on a lead-free BNT-BT-KNN ceramic-polymer composite film
|
Panpho, Phakakorn
|
|
|
50 |
23PC |
p. 52041-52050
|
artikel
|
| 39 |
Giant thermal enhancement of upconversion photoluminescence in Y2W3O12:Nd phosphor under 808 nm excitation
|
Lu, Hongyu
|
|
|
50 |
23PC |
p. 51733-51737
|
artikel
|
| 40 |
High-entropy Mg1.8R0.2Al4Si5O18 (R = Ni, Co, Zn, Cu, Mn) cordierite ceramics: Influence of octahedral distortion and electronegativity mismatch on the microwave dielectric properties
|
Yao, Yang
|
|
|
50 |
23PC |
p. 51826-51831
|
artikel
|
| 41 |
High-performance flexible lead-free piezo-antiferroelectric based on NaNbO3/PDMS composites for energy harvesting application
|
Sumang, Rattiphorn
|
|
|
50 |
23PC |
p. 51952-51963
|
artikel
|
| 42 |
High temperature fluorescence and multi-mode anti-counterfeiting material based on Eu doping
|
Xiong, Guangting
|
|
|
50 |
23PC |
p. 51888-51893
|
artikel
|
| 43 |
Improved in situ high temperature piezoelectric performance of BiScO3-PbTiO3-Pb(Sn1/3Nb2/3)O3 ceramics for actuator applications
|
Wang, Lei
|
|
|
50 |
23PC |
p. 51746-51753
|
artikel
|
| 44 |
Influence of interface on the domain polarization orientation in ferroelectric Hf0.5Zr0·5O2 thin films
|
Zheng, Yunzhe
|
|
|
50 |
23PC |
p. 51894-51900
|
artikel
|
| 45 |
K-ion preintercalated MnO2 nanorods as a high-rate cathode material for aqueous zinc-ion batteries
|
Chen, Lina
|
|
|
50 |
23PC |
p. 52103-52109
|
artikel
|
| 46 |
Luminescent properties and dosimetric behavior of Eu-ion-doped ASO4 (A = Ca, Sr, and Ba)
|
Jeong, M.J.
|
|
|
50 |
23PC |
p. 52127-52133
|
artikel
|
| 47 |
Microstructural and dielectric characteristics of A-site high-entropy oxide ceramics with a perovskite structure
|
Qiao, Wenjing
|
|
|
50 |
23PC |
p. 51812-51819
|
artikel
|
| 48 |
Modified energy storage properties of lead-free Sr0.3Bi0.35Na0.335Li0.015TiO3 ceramics with La3+ substitution via the solid-state combustion technique
|
Sinkruason, Thanapon
|
|
|
50 |
23PC |
p. 52011-52019
|
artikel
|
| 49 |
Ni-modified BaTiO3 film prepared by sol-gel with high energy storage performance
|
Fu, Dashuang
|
|
|
50 |
23PC |
p. 52004-52010
|
artikel
|
| 50 |
Optimal design of ultrasonic transducer based on multi-layer backing with adjustable impedance
|
Hou, Chenxue
|
|
|
50 |
23PC |
p. 51693-51700
|
artikel
|
| 51 |
Optimization of energy storage performance in 0.8Na0.5Bi0.5TiO3-0.2Bi3.25La0.75Ti3O12 thin films via defect dipoles
|
Zhang, Shuo
|
|
|
50 |
23PC |
p. 51944-51951
|
artikel
|
| 52 |
Phase-field modeling for energy storage optimization in ferroelectric ceramics capacitors during heat treatment process
|
Huang, Suilong
|
|
|
50 |
23PC |
p. 52020-52026
|
artikel
|
| 53 |
Phase transition, antiferroelectric and pulse discharge properties of (1-x)NaNbO3–xBi2/3ZrO3 ceramics
|
Chen, Min
|
|
|
50 |
23PC |
p. 52096-52102
|
artikel
|
| 54 |
Piezoelectric metasurface for high-frequency ultrasonic transducer application around 50 MHz
|
Li, Zhaoxi
|
|
|
50 |
23PC |
p. 51919-51927
|
artikel
|
| 55 |
Polyetherimide copolymer film with room-temperature self-healing properties and high breakdown field strength
|
Ning, Zeyu
|
|
|
50 |
23PC |
p. 52152-52157
|
artikel
|
| 56 |
Preferential site occupancy, octahedral stabilization energy, and microwave dielectric properties of mixed spinel Mg0.95X0.05Al2O4
|
Zeng, Fengsheng
|
|
|
50 |
23PC |
p. 51687-51692
|
artikel
|
| 57 |
Property of Cu and PbSrZrTiO3 multilayer actuator fabricated by cofiring with wet reduction
|
Jeong, Soon-Jong
|
|
|
50 |
23PC |
p. 51935-51943
|
artikel
|
| 58 |
PZN-PT single crystal based high-frequency intravascular ultrasound transducers
|
Quan, Yi
|
|
|
50 |
23PC |
p. 51820-51825
|
artikel
|
| 59 |
Rapid thermal processing induced interfacial diffusion and solid reaction in the Al2O3/ZnO nano-laminates films
|
Wang, Hong
|
|
|
50 |
23PC |
p. 51858-51862
|
artikel
|
| 60 |
Remarkably enhanced piezoelectric temperature stability in lead-free ferroelectrics by modulating element diffusion at laminated interfaces
|
Yao, Ruifeng
|
|
|
50 |
23PC |
p. 51642-51649
|
artikel
|
| 61 |
Structural design and enhanced energy density of Ba0.6Sr0.4TiO3/PVDF nanocomposites with multilayer gradient structure
|
Liu, Zhuang
|
|
|
50 |
23PC |
p. 51661-51670
|
artikel
|
| 62 |
Structural transformation and microwave dielectric properties of Li4Mg2SbO6F ceramics
|
Pei, Cuijin
|
|
|
50 |
23PC |
p. 51718-51723
|
artikel
|
| 63 |
Study on aluminium oxide doping modification of indium oxide and thermoelectric properties
|
Liu, Jiangjiang
|
|
|
50 |
23PC |
p. 52027-52035
|
artikel
|
| 64 |
Study on surface morphology and properties of biological type Ag-IPMC and its application on butterfly soft robot
|
Zhang, Liping
|
|
|
50 |
23PC |
p. 52075-52081
|
artikel
|
| 65 |
Synthesis and characterization of the electrical and energy storage properties of new Barium titanate - Europium titanate solid solution
|
Claire, Neha
|
|
|
50 |
23PC |
p. 52082-52089
|
artikel
|
| 66 |
Texture in atomic layer deposited Hf0.5Zr0.5O2 ferroelectric thin films
|
Wang, Yiwei
|
|
|
50 |
23PC |
p. 51770-51774
|
artikel
|
| 67 |
The dielectric and energy storage performance of B-Site substitution NBT-SBT lead-free relaxor antiferroelectric ceramics
|
Liu, Yangyang
|
|
|
50 |
23PC |
p. 51610-51616
|
artikel
|
| 68 |
The differences in phase transition characteristics of antiferroelectric PbZrO3 thin films via grain size engineering
|
Li, Dongxu
|
|
|
50 |
23PC |
p. 51762-51769
|
artikel
|
| 69 |
The effect of doping donor ions in the dielectric properties of (In0.5 B 0.5)0.1Ti0.9O2 (B V, Nb, Ta) ceramics
|
Xue, Ying
|
|
|
50 |
23PC |
p. 51848-51857
|
artikel
|
| 70 |
Tribovoltaic performance of the Schottky contact between metal and PZT ceramic
|
Sriphan, Saichon
|
|
|
50 |
23PC |
p. 52067-52074
|
artikel
|
| 71 |
Tristable TaOx-based memristor by controlling oxygen vacancy transportion based on valence transition mechanism
|
Cai, Qingfeng
|
|
|
50 |
23PC |
p. 52090-52095
|
artikel
|
| 72 |
Ultrasonic flexible array for non-destructive testing of complex curved surfaces
|
Sun, Yajun
|
|
|
50 |
23PC |
p. 51979-51986
|
artikel
|
Tijdschrift beschrijving