| nr |
titel |
auteur |
tijdschrift |
jaar |
jaarg. |
afl. |
pagina('s) |
type |
| 1 |
Achieving improved dielectric energy storage properties and temperature stability in 0.91Na0.5Bi0.5TiO3-0.09K0.7La0.1NbO3 based ferroelectric ceramics by composition design and processing optimization
|
Li, Qin
|
|
|
50 |
11PA |
p. 18945-18957
|
artikel
|
| 2 |
AgCl/g-C3N4/Ti-MOFs photocatalytic composite for visible light degradation of xanthate derived from mineral processing industries
|
Wu, Zhenjiang
|
|
|
50 |
11PA |
p. 18667-18680
|
artikel
|
| 3 |
A new green thermal insulating ceramic pigment with high near-infrared reflectance: Mn2+ doped BaAl2O4
|
Su, Yaojing
|
|
|
50 |
11PA |
p. 18169-18176
|
artikel
|
| 4 |
A new wear-resistant component system of copper-based composite materials: Modified sepiolite-complex ceramic powder
|
Wu, Jiaqi
|
|
|
50 |
11PA |
p. 18559-18568
|
artikel
|
| 5 |
Anisotropic and hierarchical porous boron nitride/graphene aerogels supported phase change materials for efficient solar-thermal energy conversion
|
Li, Yong
|
|
|
50 |
11PA |
p. 18923-18931
|
artikel
|
| 6 |
A novel class of ATF fuels with large grain size, enhanced thermophysical properties and oxidation resistance
|
Yang, Zhenliang
|
|
|
50 |
11PA |
p. 18986-18992
|
artikel
|
| 7 |
A novel low loss rare-earth germanate La4GeO8 microwave dielectric ceramic with orthorhombic structure
|
Li, Yingxiang
|
|
|
50 |
11PA |
p. 19067-19073
|
artikel
|
| 8 |
Bamboo-shaped N-doped carbon nanotubes encapsulated with Co nanoparticles for improved microwave absorption properties
|
Xu, Shaodong
|
|
|
50 |
11PA |
p. 18347-18356
|
artikel
|
| 9 |
Bioceramic modular tissue-engineered bone with rapid vascularization for large bone defects
|
Luo, Siwei
|
|
|
50 |
11PA |
p. 18275-18283
|
artikel
|
| 10 |
Bio-inspired design of flexible semitransparent encapsulation toward self-cleaning and anti-reflective quantum dot light-emitting diodes
|
Jiang, Haohong
|
|
|
50 |
11PA |
p. 18741-18749
|
artikel
|
| 11 |
Biomass C-doped three-dimensional Bi2WO6 for enhanced visible-light-driven photodegradation of diclofenac and rhodamine B
|
Zhang, Xiaofang
|
|
|
50 |
11PA |
p. 18594-18608
|
artikel
|
| 12 |
Bond theory, vibrational spectroscopy, and dielectric responses of trirutile ATa2O6 (A = Mg, Ni) microwave ceramics
|
Yang, Hongyu
|
|
|
50 |
11PA |
p. 19171-19181
|
artikel
|
| 13 |
Ce-doping enhanced ORR kinetics and CO2 tolerance of Nd1-x Ce x BaCoFeO5+δ (x = 0–0.2) cathodes for solid oxide fuel cells
|
Chen, Mingcun
|
|
|
50 |
11PA |
p. 18416-18425
|
artikel
|
| 14 |
Chemical synthesis of Mn–Zn magnetic ferrite nanoparticles: Effect of secondary phase on extrinsic magnetic properties of Mn–Zn ferrite nanoparticles
|
Deepty, M.
|
|
|
50 |
11PA |
p. 18446-18453
|
artikel
|
| 15 |
Chitosan/montmorillonite nanocomposite film as anticancer drug carrier: A promising biomaterial to treat skin cancers
|
Cardoso, Henrique Pereira
|
|
|
50 |
11PA |
p. 18528-18539
|
artikel
|
| 16 |
Cold sintering of β-tricalcium phosphate/bioactive glass composites
|
Oliveira, Rodrigo Luiz Moraes Saldanha
|
|
|
50 |
11PA |
p. 18138-18145
|
artikel
|
| 17 |
Co(1-nSr)TiO3 (n=0, 0.05, 0.1) nano perovskites: Novel photocatalysts synthesized by sol-gel and cold-evaporated sol-gel methods for CO remediation from polluted air
|
Raeisipour, Javad
|
|
|
50 |
11PA |
p. 18125-18137
|
artikel
|
| 18 |
Corrosion and wear resistance of TiN/TiO2 composite ceramic coatings deposited by supersonic arc spraying
|
Wu, Lin
|
|
|
50 |
11PA |
p. 18655-18666
|
artikel
|
| 19 |
Crystallization, microstructural evolution, heavy metals migration, and solidification mechanism of blast furnace slag glass-ceramics
|
Guo, Yuhang
|
|
|
50 |
11PA |
p. 18462-18472
|
artikel
|
| 20 |
Densification and microstructure evolution of NaNbO3 ceramic via ultrafast high-temperature sintering
|
Li, Qianqian
|
|
|
50 |
11PA |
p. 18907-18914
|
artikel
|
| 21 |
Determining the critical Reynolds number for suppressing Marangoni convection of alumina in silicate melt
|
Burhanuddin,
|
|
|
50 |
11PA |
p. 18323-18328
|
artikel
|
| 22 |
DLP-printed standard tooth -colored ceramic dentures and its biocompatibility study
|
Wan, Li
|
|
|
50 |
11PA |
p. 19293-19301
|
artikel
|
| 23 |
3D-printed piezoelectric scaffolds composed of uniform core-shell structured BaTiO3@ bioactive glasses particles for bone regeneration
|
Yang, Zili
|
|
|
50 |
11PA |
p. 18303-18311
|
artikel
|
| 24 |
Effect of Al2O3 nanoparticles additions on wear resistance of plasma electrolytic oxidation coatings on TC4 alloys
|
Shi, Lei
|
|
|
50 |
11PA |
p. 18484-18496
|
artikel
|
| 25 |
Effect of auxiliary laser irradiation on characteristics and properties of micro-arc oxidation coating on Ti6Al4V alloy
|
Wang, Ye
|
|
|
50 |
11PA |
p. 19412-19423
|
artikel
|
| 26 |
Effect of Cerium on structures and electrical properties of Nb modified Bi3Ti1.5W0.5O9–Bi4Ti3O12 intergrowth aurivillius piezoceramics
|
Zeng, Renfen
|
|
|
50 |
11PA |
p. 19114-19123
|
artikel
|
| 27 |
Effect of concentration of Er3+ on up-conversion luminescence in NaYF4 embedded oxy-fluoride glass-ceramics under 1550 nm excitation
|
He, Zhengxu
|
|
|
50 |
11PA |
p. 19302-19307
|
artikel
|
| 28 |
Effect of gas atmospheres and SiO2 content on preparation and properties of SiO2–Si3N4 composite ceramics via nitridation of diamond-wire saw silicon waste powder
|
Ma, Xiaobing
|
|
|
50 |
11PA |
p. 19163-19170
|
artikel
|
| 29 |
Effect of mixed TeO2–B2O3 glass former in Ho3+/Yb3+-doped glass system: Raman spectroscopy, Judd-Ofelt and luminescence investigations
|
Naaim, M.M.
|
|
|
50 |
11PA |
p. 18497-18509
|
artikel
|
| 30 |
Effect of partial substitution of barium oxide by lanthanum oxide on the structure and properties of iron-based aluminosilicate glass
|
Zhu, Han
|
|
|
50 |
11PA |
p. 18958-18967
|
artikel
|
| 31 |
Effect of post-annealing on the electrical properties of textured Pb(Mg1/3Nb2/3)O3–PbZrO3–PbTiO3 piezoelectric ceramics
|
Zhang, Yulong
|
|
|
50 |
11PA |
p. 18814-18820
|
artikel
|
| 32 |
Effect of raw material pretreatment and ionic radius on the preparation and microwave dielectric properties of Re2TiO5 ceramics
|
Zhu, Guobin
|
|
|
50 |
11PA |
p. 19194-19201
|
artikel
|
| 33 |
Effects of cores types on non-solvent displacement nonaqueous precipitation synthesis of core-shell structured materials: A case study on effects of carbon sources on C@ZrSiO4 preparation
|
Feng, Guo
|
|
|
50 |
11PA |
p. 18370-18379
|
artikel
|
| 34 |
Effects of post-deposition treatment on zinc sulfide thin films prepared by an effective-cost chemical bath deposition method
|
Arsad, A.Z.
|
|
|
50 |
11PA |
p. 18697-18707
|
artikel
|
| 35 |
Effects of SiCnw/Al2O3 composite powders on properties of Al2O3–SiC refractory castables
|
Wang, Cankun
|
|
|
50 |
11PA |
p. 19095-19103
|
artikel
|
| 36 |
Efficient broad-band NIR-II emitting phosphor Mg4Ta2O9: Ni2+ with satisfactory thermal stability of luminescence
|
Li, Jie
|
|
|
50 |
11PA |
p. 18647-18654
|
artikel
|
| 37 |
Elastic-plastic properties of ceramic matrix composites characterization by nanoindentation testing coupled with computer modeling
|
Yang, Yang
|
|
|
50 |
11PA |
p. 18540-18548
|
artikel
|
| 38 |
Electrochemical evaluation of Pr1.85M0.15NiO4+x (M=Ba, Sr, Ca) cathodes for protonic ceramic fuel cells
|
Gu, Yiheng
|
|
|
50 |
11PA |
p. 19437-19445
|
artikel
|
| 39 |
Electrodeposition and properties of Ni–W–Ti2AlC composite coatings
|
Gao, Mengyan
|
|
|
50 |
11PA |
p. 18832-18842
|
artikel
|
| 40 |
Electromechanical hardening of Na1/2Bi1/2TiO3-based ceramics by the in-situ formed secondary phase
|
Wang, Guohui
|
|
|
50 |
11PA |
p. 18227-18237
|
artikel
|
| 41 |
Electronic structures, optical properties and quantum capacitance of 2D Janus ZrMCO2 (M = Sc, Ti, V, Cr, Mn, Fe, Y, Zr, Nb, Mo, Hf, Ta, W) MXenes for supercapacitor electrodes
|
Zhang, Hao
|
|
|
50 |
11PA |
p. 18932-18944
|
artikel
|
| 42 |
Encapsulation of nano-sized ZIF-67 derived Co-NC on Au-loaded halloysite as composite catalyst for superior cooperative reduction of nitroaromatic pollutants
|
Fang, Jiasheng
|
|
|
50 |
11PA |
p. 18357-18369
|
artikel
|
| 43 |
Energy harvesting using lead-free multilayer piezo stacks based on 0.95(Bi0 . 5Na0.5)TiO3-0.05(BaTiO3) piezoceramics through the addition of ZrO2
|
Osinaga, Santiago
|
|
|
50 |
11PA |
p. 19259-19268
|
artikel
|
| 44 |
Energy-storage performance of NaNbO3-based ceramic capacitor derived from a high DOP glass network structure
|
Hao, Yuxin
|
|
|
50 |
11PA |
p. 19355-19364
|
artikel
|
| 45 |
Enhanced electrochemical performances of SrMoO4/MWCNT-PVP nanocomposites as electrocatalyst for hydrogen evolution reaction
|
Swathi, S.
|
|
|
50 |
11PA |
p. 18284-18293
|
artikel
|
| 46 |
Enhanced energy storage and cycling stability of (Sr0.7La0.2)(Mg1/3Nb2/3)O3-modified K0.5Na0.5NbO3 ceramics via multiple synergistic strategies
|
Duan, Xueliang
|
|
|
50 |
11PA |
p. 18797-18805
|
artikel
|
| 47 |
Enhancing light trapping efficiency: Germanium-coated porous silicon structures for optimal antireflection performance
|
Ali, Adnan
|
|
|
50 |
11PA |
p. 19424-19428
|
artikel
|
| 48 |
Enhancing the performance of PVC/PMMA polymer blend through hybrid nanofiller of TiO2 NPs/GNPs for capacitive energy storage applications
|
Althobiti, Randa A.
|
|
|
50 |
11PA |
p. 19039-19047
|
artikel
|
| 49 |
Exceptional levofloxacin adsorption/photo-regeneration cycles using nanosheets-like hollow TiO2 adsorbent: Adsorption performance and mechanism
|
Chen, Juanrong
|
|
|
50 |
11PA |
p. 18435-18445
|
artikel
|
| 50 |
Experimental and numerical investigations into the fabrication of alumina ceramic surface microchannel by electrochemical discharge machining
|
Li, Qiang
|
|
|
50 |
11PA |
p. 19202-19216
|
artikel
|
| 51 |
Experimental and theoretical study of Gd2O3 added pseudo-tetragonal Bi3TaTiO9-based ceramics for ferroelectric, electric and high-temperature piezoelectric applications
|
Hussain, Ahmad
|
|
|
50 |
11PA |
p. 18177-18184
|
artikel
|
| 52 |
Fabrication and properties of novel multilayered Y3Al5O12/MgAl2O4 ceramics doped with rare-earth ions
|
Valiev, D.
|
|
|
50 |
11PA |
p. 19374-19381
|
artikel
|
| 53 |
Fabrication of M-type barium ferrite (BaFe12O19) grafted reduced graphene oxide (BF@rGO) nanocomposite using ethyl imidazolium lactate ionic-liquid: An effective electrode modifier for caffeic acid sensor
|
Boominathan, Catherin Meena
|
|
|
50 |
11PA |
p. 18708-18717
|
artikel
|
| 54 |
Fulfilling X9R specification in CeO2 modified BNBST-based relaxor ferroelectric energy storage ceramic capacitors
|
Zhu, Wen
|
|
|
50 |
11PA |
p. 19365-19373
|
artikel
|
| 55 |
Giant dielectric properties and temperature stability of triple–doped Al x In0.05−x Ta0.05Ti0.9O2 ceramics
|
Siriya, Porntip
|
|
|
50 |
11PA |
p. 18977-18985
|
artikel
|
| 56 |
Growth of Ni5P4/Ni2P/C nanosheet arrays on ITO as dual-function electrochemical sensor for efficient Cu2+ and paracetamol detection
|
Wang, Xin
|
|
|
50 |
11PA |
p. 18584-18593
|
artikel
|
| 57 |
High-alumina refractory castables bonded with metakaolin-based geopolymers prepared with different alkaline liquid reagents
|
Bezerra, B.P.
|
|
|
50 |
11PA |
p. 18628-18637
|
artikel
|
| 58 |
High density Ti3C2TX-graphene quantum dot-Ru monolithic film electrode with rich anisotropic microstructures for high-performance supercapacitor and piezoresistive pressure sensor
|
Ruiyi, Li
|
|
|
50 |
11PA |
p. 19025-19038
|
artikel
|
| 59 |
High-entropy strategy for high-temperature broadband infrared radiation and low thermal conductivity
|
Wang, Shuqi
|
|
|
50 |
11PA |
p. 18806-18813
|
artikel
|
| 60 |
Highly efficient asymmetric supercapacitor based on magnetic CeO2@γ-Fe2O3 composite and reduced graphene oxide electrodes
|
Setayesh, Maryam
|
|
|
50 |
11PA |
p. 18185-18194
|
artikel
|
| 61 |
High strength and high toughness Csf/SiC composites prepared by laser powder bed fusion/ reactive melt infiltration with the impregnation of boron-and silicone-containing phenolic resin
|
Liu, Kai
|
|
|
50 |
11PA |
p. 18157-18168
|
artikel
|
| 62 |
High-strength and low-thermal conductivity La-doped BaZrO3-based composite ceramic and its thermodynamic stability evaluation
|
Li, Yuanbing
|
|
|
50 |
11PA |
p. 18750-18757
|
artikel
|
| 63 |
HPHT sintering and performance investigation of PDC with different interfacial geometry substrates for trimodal diamond particle size
|
Tu, Jianbo
|
|
|
50 |
11PA |
p. 19074-19083
|
artikel
|
| 64 |
Hybrid Bi2Te3/Bi2TeO5 nanoscale flakes via chemical disproportionation under microwave: Electrochemical supercapacitor applications
|
Liu, Jin
|
|
|
50 |
11PA |
p. 18408-18415
|
artikel
|
| 65 |
Impact of mixed heavy metal cations (Ba and Bi) on the structure, optical and ionizing radiation shielding parameters of Bi2O3–BaO–Fe2O3–SrO–B2O3 glass matrix
|
Babeer, Afaf M.
|
|
|
50 |
11PA |
p. 19245-19258
|
artikel
|
| 66 |
Impact of Nd3+, Er3+ions on the structural, morphological and opto-electrical properties of ZrO2/La2O3doped Y2O3 ceramics
|
Tripathi, Harshit
|
|
|
50 |
11PA |
p. 18549-18558
|
artikel
|
| 67 |
Improved thermal properties and CMAS corrosion resistance of high-entropy RE zirconates by tuning fluorite-pyrochlore structure
|
Tian, Yue
|
|
|
50 |
11PA |
p. 19182-19193
|
artikel
|
| 68 |
Improvement of mechanical properties of bio-inspired layered Si3N4/BN ceramics
|
Shen, Xinghua
|
|
|
50 |
11PA |
p. 18220-18226
|
artikel
|
| 69 |
Influence of bioactive glass addition on the machinability, mechanical and biological response of Mg-PSZ-based biocomposites
|
Singh, Satyendra Kumar
|
|
|
50 |
11PA |
p. 18238-18257
|
artikel
|
| 70 |
Influence of graphene-based nanostructures processing routes and aspect ratio in flexural strength and fracture mechanisms of 3Y-TZP-matrix composites
|
Moriche, R.
|
|
|
50 |
11PA |
p. 19217-19227
|
artikel
|
| 71 |
Infrared luminescence properties and energy transfer mechanism in NaYGeO4:Tm3+ powders
|
Melentsova, Anna A.
|
|
|
50 |
11PA |
p. 18681-18688
|
artikel
|
| 72 |
Inkjet printing of SnO2 nanoparticles with exposed high-energy facets for CO gas sensing
|
Taulo, Gracian Tiyamike
|
|
|
50 |
11PA |
p. 18638-18646
|
artikel
|
| 73 |
Investigating the properties of a ZnSe-based solid solution at 2.0 GPa
|
Wang, Lijuan
|
|
|
50 |
11PA |
p. 18269-18274
|
artikel
|
| 74 |
Investigation of B4C for inhibiting crystallization in silica at high temperatures
|
Crystal, Isabel R.
|
|
|
50 |
11PA |
p. 19335-19343
|
artikel
|
| 75 |
Large strain with broad temperature insensitivity in PZT-PNN multilayer piezoactuators
|
Xia, Guo
|
|
|
50 |
11PA |
p. 18821-18831
|
artikel
|
| 76 |
Laser-assisted surface grinding of innovative superhard SiC-bonded diamond (DSiC) materials
|
Paknejad, Masih
|
|
|
50 |
11PA |
p. 18391-18407
|
artikel
|
| 77 |
Low-temperature preparation of lightweight ceramic proppants using high-proportioned coal-based solid wastes
|
Zhao, Xu
|
|
|
50 |
11PA |
p. 18117-18124
|
artikel
|
| 78 |
Low-temperature stepwise lithiation method toward layered oxide cathodes with low Li+/Ni2+ antisite defects
|
Li, Pei-yao
|
|
|
50 |
11PA |
p. 18689-18696
|
artikel
|
| 79 |
Luminescence properties and thermal stability of Dy2O3/Sm2O3 doped glass ceramics containing NaBi(WO4)2
|
Zhao, Shuting
|
|
|
50 |
11PA |
p. 18776-18786
|
artikel
|
| 80 |
Mesoporous bioactive scaffolds based on the 14.6Li2O⋅8.6ZrO2⋅67.3SiO2⋅9.5Al2O3 glass-ceramic as drug delivery for bone regeneration
|
Mattos, Ana Sônia
|
|
|
50 |
11PA |
p. 19084-19094
|
artikel
|
| 81 |
Microstructural changes and properties of LaxBa(1-x) (Zr0 · 1Ti0.9)O3 multilayer dielectric ceramics via digital light processing
|
Zeng, Liangyi
|
|
|
50 |
11PA |
p. 19402-19411
|
artikel
|
| 82 |
Microstructure and synthesis mechanism of ScYSZ powders prepared by chemical co-precipitation with different dynamic microenvironment
|
Qie, Zhilin
|
|
|
50 |
11PA |
p. 18765-18775
|
artikel
|
| 83 |
Microwave-assisted combustion synthesis and characterization studies of novel dysprosium doped yttrium calcium borate (Dy3+: Y2CaB10O19) phosphor materials for efficient white light applications
|
Behera, Mitrabhanu
|
|
|
50 |
11PA |
p. 18146-18156
|
artikel
|
| 84 |
MoO3/MeMoO4 (Me = Cu, Ni, Co, Fe, Mn, and Cr) composites as materials for prospective optical and electrical applications
|
Talik, E.
|
|
|
50 |
11PA |
p. 19308-19324
|
artikel
|
| 85 |
Multi-dimensional MoS2/S-doped-CoP heterostructure nanoarrays as an efficient electrocatalyst for hydrogen evolution reaction
|
Li, Xiang
|
|
|
50 |
11PA |
p. 18519-18527
|
artikel
|
| 86 |
Net gain in C+L band from LED pumped broadband emission in Er3+-doped oxyhalide tellurite glass
|
Sun, Yan
|
|
|
50 |
11PA |
p. 18968-18976
|
artikel
|
| 87 |
Novel orange-red emitting phosphor Y2MgTiO6:Sm3+ luminescence properties and optical thermometry
|
Long, Juling
|
|
|
50 |
11PA |
p. 19325-19334
|
artikel
|
| 88 |
Observation of La3+ entering (Bi2O2)2+ layer to tune tilting of NbO6 octahedra in CaBi2Nb2O9 ceramics
|
Min, Yunhui
|
|
|
50 |
11PA |
p. 19392-19401
|
artikel
|
| 89 |
One-step molten salt synthesis of high entropy oxides
|
Xue, Tianyu
|
|
|
50 |
11PA |
p. 18294-18302
|
artikel
|
| 90 |
Optical, electrical, and crystal structure study of BaZr0.01Ti0.99O3 ceramics modified with Gd3+ and Y3+ rare-earth ions
|
Hassan Yahakoub, El
|
|
|
50 |
11PA |
p. 19002-19016
|
artikel
|
| 91 |
Optimized energy storage properties of Bi0.5Na0.5TiO3-based lead-free ceramics by composition regulation
|
Li, Chaolong
|
|
|
50 |
11PA |
p. 18454-18461
|
artikel
|
| 92 |
Oxygen ion irradiation-driven Al-vacancy mediated room-temperature magnetism induced in amorphous Al-N-O alloy thin films
|
Nath, Deena
|
|
|
50 |
11PA |
p. 18868-18879
|
artikel
|
| 93 |
Penetration resistance of corrugated hybrid structures with ceramic insertions against steel projectile impact
|
Zhang, Longhui
|
|
|
50 |
11PA |
p. 19148-19162
|
artikel
|
| 94 |
Performance of Co-doped Sr1.9FeNbO6−δ as a symmetrical electrode for solid oxide cells
|
Liu, Bowen
|
|
|
50 |
11PA |
p. 19344-19354
|
artikel
|
| 95 |
Phase compositions and thermophysical performances for (Sm1-xYbx)3TaO7 compounds
|
Haoming, Zhang
|
|
|
50 |
11PA |
p. 18576-18583
|
artikel
|
| 96 |
Photo-induced coloration and reversible luminescence modulation based on phosphosilicate glass ceramics for optcal storage application
|
Zou, Lize
|
|
|
50 |
11PA |
p. 18569-18575
|
artikel
|
| 97 |
Pr doped CeO2 for chemical looping air separation at ultra-low temperatures
|
Wang, Xin
|
|
|
50 |
11PA |
p. 18473-18483
|
artikel
|
| 98 |
Preparation and characterization of novel lightweight Y2Si2O7 fibrous porous ceramics for high temperature thermal insulation
|
Zhao, Buyue
|
|
|
50 |
11PA |
p. 18510-18518
|
artikel
|
| 99 |
Preparation and negative thermal expansion in medium-entropy ceramics (Zr1/3Hf1/3Ti1/3)V2O7
|
Lian, Hong
|
|
|
50 |
11PA |
p. 18915-18922
|
artikel
|
| 100 |
Preparation of fibrous ceramic-based catalytic membranes by microwave heating and their structural properties and dust and NO removal characteristics
|
Miao, Linfeng
|
|
|
50 |
11PA |
p. 18195-18204
|
artikel
|
| 101 |
Preparation of monolithic Al2O3–SiO2 aerogels with high-temperature resistance using boehmite nanorods
|
Ren, Yuhan
|
|
|
50 |
11PA |
p. 19429-19436
|
artikel
|
| 102 |
Properties and corrosion mechanism of Al2O3–SiC–C refractories for hot metal ladle with high FeOx: Effect of in-situ MgAl2O4
|
Wang, Jintao
|
|
|
50 |
11PA |
p. 19137-19147
|
artikel
|
| 103 |
Rapid temperature response of polymer-derived SiBCN ceramics
|
Peng, Xudong
|
|
|
50 |
11PA |
p. 18312-18322
|
artikel
|
| 104 |
Regulating SnZn defects and optimizing bandgap in the Cu2ZnSn(S,Se)4 absorption layer by Ge gradient doping for efficient kesterite solar cells
|
Guo, Rui
|
|
|
50 |
11PA |
p. 18329-18336
|
artikel
|
| 105 |
Role of oxygen vacancy on rapid densification and giant dielectric properties of flash sintered Ca2+ and Ta5+ co-doped TiO2 ceramics
|
Yang, Zaizhi
|
|
|
50 |
11PA |
p. 18993-19001
|
artikel
|
| 106 |
Simultaneously achieved large electrocaloric effect and broad working temperature range in transparent Sm-doped 0.88 Pb(Mg1/3Nb2/3)O3-0.12PbTiO3 ceramics at low electric field
|
Sun, Haochen
|
|
|
50 |
11PA |
p. 19237-19244
|
artikel
|
| 107 |
Solar-enhanced photodegradation of dye and drug mixture and evaluation of phytotoxicity on seed germination and growth by an eggshell HAp/Nb2O5 heterostructure
|
Castro, M.A.M.
|
|
|
50 |
11PA |
p. 19124-19136
|
artikel
|
| 108 |
Sol-gel synthesis and characterization of mesoporous TiB2 nano powder via Titanium isopropoxide /trimethyl borate precursors
|
Mahmoudi, Zahra
|
|
|
50 |
11PA |
p. 18081-18089
|
artikel
|
| 109 |
Stability, thermodynamic, electronic, and thermoelectric properties of triclinic Cu 2 Se structure
|
Kotmool, Komsilp
|
|
|
50 |
11PA |
p. 19060-19066
|
artikel
|
| 110 |
Strengthening mechanism of mechanical properties of lightweight mullite fiber thermal insulation materials with different types of binders
|
Mu, Yuwen
|
|
|
50 |
11PA |
p. 18718-18728
|
artikel
|
| 111 |
Surface modification of hierarchical hydroxyapatite fabricated via hydrothermal method
|
Mohandes, Fatemeh
|
|
|
50 |
11PA |
p. 19283-19292
|
artikel
|
| 112 |
Synergistic optimization of properties in carbon nanotubes reinforced Cu matrix composites prepared by co-deposition
|
Zhang, Yuqi
|
|
|
50 |
11PA |
p. 18337-18346
|
artikel
|
| 113 |
Synthesis and characterization of novel magnetic nano-catalyst (Fe3O4@SiO2@EDDHA-Fe) and their hydrogen production activity
|
Umaz, Adil
|
|
|
50 |
11PA |
p. 18258-18268
|
artikel
|
| 114 |
Synthesis and performance of tetragonal Ca2+ doped BaTiO3 fine powders
|
Zhang, Xiuyun
|
|
|
50 |
11PA |
p. 18609-18617
|
artikel
|
| 115 |
Synthesis of boronized Ti6Al4V/FHA composites by microwave sintering for dental applications
|
Zuo, Shangyong
|
|
|
50 |
11PA |
p. 18105-18116
|
artikel
|
| 116 |
Synthesis of SrTiO3-TiO2-CaTiO3/Cu2O composite for stable and efficient H2 generation in deionized water and river water
|
Yang, Junfeng
|
|
|
50 |
11PA |
p. 19104-19113
|
artikel
|
| 117 |
Systematic study on the intensified upconversion performance of LaVO4:Yb3+/Er3+ nanocrystals through Ti4+ ions doping by combining experiments and DFT calculations
|
Chen, Mengjia
|
|
|
50 |
11PA |
p. 19017-19024
|
artikel
|
| 118 |
Temperature-dependent structure-property relations in continuous mullite-based ceramic fibers
|
Reinders, Leonie
|
|
|
50 |
11PA |
p. 19048-19059
|
artikel
|
| 119 |
Textured piezoelectric ceramic CaBi2Nb2O9 obtained by a conventional solid-state reaction
|
Zhao, Gaochao
|
|
|
50 |
11PA |
p. 18426-18434
|
artikel
|
| 120 |
Thermal boundary conductance in heterogeneous integration between β-Ga2O3 and semiconductors
|
Li, Yuan
|
|
|
50 |
11PA |
p. 18787-18796
|
artikel
|
| 121 |
Thermal, chemical, and mechanical properties of niobium phosphate glasses and glass-ceramics
|
Silva, Roni Alisson
|
|
|
50 |
11PA |
p. 18618-18627
|
artikel
|
| 122 |
Thermal stability and decomposition mechanism of Mo2AlB2 in argon atmosphere
|
Mou, Junji
|
|
|
50 |
11PA |
p. 18758-18764
|
artikel
|
| 123 |
The role of interlayers in the flash joining of Y2O3 transparent ceramic to titanium alloy
|
Zhang, Keying
|
|
|
50 |
11PA |
p. 18843-18852
|
artikel
|
| 124 |
The viscosity, crystallization behavior and glass-ceramics preparation of blast furnace slag: A review
|
Liu, Wenguo
|
|
|
50 |
11PA |
p. 18090-18104
|
artikel
|
| 125 |
Transparent hexagonal Yb:Sr5(PO4)3F ceramics fabricated by hot pressing sintering with LiF doping
|
Liu, Xinwen
|
|
|
50 |
11PA |
p. 18380-18390
|
artikel
|
| 126 |
Tuning of multiferroic traits in BiFeO3 ceramics by electronic structure
|
Wu, Xianfeng
|
|
|
50 |
11PA |
p. 18853-18867
|
artikel
|
| 127 |
Ultra-high performance hafnium-based capacitors: Synergistic achievement of high dielectric constant and low leakage current
|
Fuling, Wu
|
|
|
50 |
11PA |
p. 19382-19391
|
artikel
|
| 128 |
Utilizing machine learning to integrate silica-based production waste material in ceramic tiles manufacturing: Progressing toward sustainable solutions
|
Saif, Saadia
|
|
|
50 |
11PA |
p. 18880-18906
|
artikel
|
| 129 |
Vacuum filtration-assisted design of hierarchical structure in polyimide-BN composite films: Toward enhanced thermal conductivity, low dielectric and electrical insulation
|
Zhao, Ke
|
|
|
50 |
11PA |
p. 19228-19236
|
artikel
|
| 130 |
Visible light-driven TiO2-WO3@GO photocatalyst with catalytic memory for round-the-clock photocatalytic degradation of oilfield-produced water
|
Samuel, Ojo
|
|
|
50 |
11PA |
p. 18205-18219
|
artikel
|
| 131 |
Visible-light-responsive mesoporous PtO/2D YVO4 composite material for fostered photocatalytic hydrogen generation
|
Albukhari, Soha M.
|
|
|
50 |
11PA |
p. 18729-18740
|
artikel
|
| 132 |
Wetting, droplet evaporation and corrosion behavior of various composite and textured materials
|
Misyura, S.Y.
|
|
|
50 |
11PA |
p. 19269-19282
|
artikel
|
Tijdschrift beschrijving