| nr |
titel |
auteur |
tijdschrift |
jaar |
jaarg. |
afl. |
pagina('s) |
type |
| 1 |
Achieving both large transduction coefficient and high Curie temperature of Bi and Fe co-doped PZT piezoelectric ceramics
|
lin, Jianyin
|
|
|
49 |
1 |
p. 474-479
|
artikel
|
| 2 |
A comparative investigation on microstructure evolution and wear resistance of in situ synthesized NbC, WC, TaC reinforced Mo2FeB2 coatings by laser cladding
|
Zhang, Hao
|
|
|
49 |
1 |
p. 894-906
|
artikel
|
| 3 |
A comparative study on the structural, magnetic and dielectric properties of magnesium substituted cobalt ferrites
|
Sarmah, Sikha
|
|
|
49 |
1 |
p. 1444-1463
|
artikel
|
| 4 |
AlSixP: A new family of ternary Si-based anodes for Li-ion batteries with superior Li-storage properties
|
Liu, Xiao
|
|
|
49 |
1 |
p. 1535-1539
|
artikel
|
| 5 |
Alumina ceramics sintered from hollow corundum microspheres with Al2O3 and ZrO2–Y2O3 as sintering activators
|
Ivanov, D.A.
|
|
|
49 |
1 |
p. 1496-1501
|
artikel
|
| 6 |
A multiphysics-multiscale-multidrive theoretical model for C3S hydration
|
Liu, Yang
|
|
|
49 |
1 |
p. 974-985
|
artikel
|
| 7 |
An easy approach to obtain high piezoelectric properties in hard PZT sintered at 950 °C
|
Cha, Jae-Min
|
|
|
49 |
1 |
p. 264-270
|
artikel
|
| 8 |
A new electrolytic process for the synthesis of tungsten oxide nanopowder from WC-6Co scrap
|
Salot, M.
|
|
|
49 |
1 |
p. 1507-1512
|
artikel
|
| 9 |
A novel microwave dielectric ceramic La5Sn4O15 with medium-permittivity and low loss
|
Liu, Shucheng
|
|
|
49 |
1 |
p. 95-100
|
artikel
|
| 10 |
A novel rare-earth high-entropy RE6MoO12 with high near-infrared reflectance as a promising inorganic “cool pigment”
|
Zheng, Junfeng
|
|
|
49 |
1 |
p. 558-564
|
artikel
|
| 11 |
A one step self-cleaning surface with robust superhydrophobic and photocatalytic properties: Electrostatic sprayed fluorinated ethylene propylene mixed with nano TiO2–SiO2 particles
|
Ansari, Ali
|
|
|
49 |
1 |
p. 57-66
|
artikel
|
| 12 |
A review on the preparation and application of BN composite coatings
|
Sun, Xiaoli
|
|
|
49 |
1 |
p. 24-39
|
artikel
|
| 13 |
A simple and efficient method for the preparation of SiO2/PI/AF aerogel composite fabrics and their thermal insulation performance
|
Xue, Rujing
|
|
|
49 |
1 |
p. 210-215
|
artikel
|
| 14 |
B4C-based hard and tough ceramics densified via spark plasma sintering using a novel Mg2Si sintering aid
|
Zhang, Wenwen
|
|
|
49 |
1 |
p. 145-153
|
artikel
|
| 15 |
Biosynthesis of novel NiFe12O19-X (X = ZnO and TiO2) magnetic nanophotocatalyst toward the degradation pharmaceutical ceftriaxone sodium from aqueous solution under sunlight irradiation and antibacterial activity
|
Javadmoosavi, Seyed Yoosef
|
|
|
49 |
1 |
p. 1351-1361
|
artikel
|
| 16 |
Cementitious nanocomposites engineered with high-oxidized graphene oxide: Spotting the nano to macro correlation
|
Chougan, Mehdi
|
|
|
49 |
1 |
p. 964-973
|
artikel
|
| 17 |
Chemical and thermal study of metal chalcogenides (zinc sulfide), aluminum oxide, and graphene oxide based nanocomposites for wastewater treatment
|
Domyati, Doaa
|
|
|
49 |
1 |
p. 1464-1472
|
artikel
|
| 18 |
Cobalt sulfide nanosheets decorated on polypyrrole nanowires for improved charge storage in supercapacitors
|
Liu, Aifeng
|
|
|
49 |
1 |
p. 1178-1187
|
artikel
|
| 19 |
Combination of direct ink writing and reaction bonded for rapid fabrication of SiCw/SiC composites
|
Xu, Haichao
|
|
|
49 |
1 |
p. 392-402
|
artikel
|
| 20 |
Comparative analysis of ‘La’ modified BiFeO3-based perovskite solar cell devices for high conversion efficiency
|
Raj, Abhishek
|
|
|
49 |
1 |
p. 1317-1327
|
artikel
|
| 21 |
Compression performances and damage mechanisms of Al2O3 ceramic lattices fabricated by additive manufacturing: Imitating metal crystal structures
|
Yu, Xuehua
|
|
|
49 |
1 |
p. 1419-1435
|
artikel
|
| 22 |
Confined nanoreactor for synthesis of MnCe composite oxide nanowires with enhanced catalytic activity towards aromatic VOCs oxidation
|
Wang, Yuheng
|
|
|
49 |
1 |
p. 1137-1147
|
artikel
|
| 23 |
Controllable synthesis of Sn0.33WO3 tungsten bronze nanocrystals and its application for upconversion luminescence enhancement
|
Sun, Ying
|
|
|
49 |
1 |
p. 1128-1136
|
artikel
|
| 24 |
Controlling the microstructure and properties of lithium disilicate glass-ceramics by adjusting the content of MgO
|
Zhang, Haojie
|
|
|
49 |
1 |
p. 216-225
|
artikel
|
| 25 |
Core-shell titanium nitride/silicon nitride modified separators as polysulfide shuttling barriers for lithium-sulfur batteries via a facile and recyclable molten-salt route
|
Zhou, Peilong
|
|
|
49 |
1 |
p. 1381-1389
|
artikel
|
| 26 |
Corrigendum to “Enhanced strength and thermal oxidation resistance of shaddock peel-polycarbosilane-derived C–SiC–SiO2 composites” [Ceram. Int. 48 (19 Part A) (2022) 27516–27526]
|
Li, Guo-Qing
|
|
|
49 |
1 |
p. 1546
|
artikel
|
| 27 |
Corrigendum to “Structural evolution and mechanical properties of multi-element (TiCrZrVNb)C high entropy ceramics films by multi-arc ion plating” [Ceram. Int. 48(13) (2022) 19191–19197]
|
Xu, Wenju
|
|
|
49 |
1 |
p. 1548
|
artikel
|
| 28 |
Corrigendum to “Synergistic effect of doping and surface engineering on LiNi0.5Mn1.5O4 and its application as a high-performance cathode material for Li-ion batteries” [Ceram. Int. 48(19 Part A) (2022) 27859–27869]
|
Hsu, Shih-Chieh
|
|
|
49 |
1 |
p. 1547
|
artikel
|
| 29 |
Cost-effective Li4Ti5O12/C–S prepared by industrial H2TiO3 under a carbon reducing atmosphere as a superior anode for Li-ion batteries
|
Jiang, Xinyu
|
|
|
49 |
1 |
p. 625-634
|
artikel
|
| 30 |
Crystallization characteristics of Li2O–Nb2O5 compound films on sapphire substrates and formation of crack-free and thick LiNbO3 epitaxial films
|
Akazaw, Housei
|
|
|
49 |
1 |
p. 271-281
|
artikel
|
| 31 |
Crystal structure, chemical bond characteristics, and microwave dielectric properties of novel Sr2CaMoO6 ceramic at different sintering temperatures
|
Jian, Bao
|
|
|
49 |
1 |
p. 335-344
|
artikel
|
| 32 |
Cubic phase optimization and influence of post-annealing on microstructure, optical, wetting, and nanomechanical properties of zirconia thin films
|
Maithani, Yogita
|
|
|
49 |
1 |
p. 1048-1060
|
artikel
|
| 33 |
Design and fabrication of the ceramic composites via in-situ oxidized process: Phase and microstructure evolution in in-situ oxidized SiC/Al–Mg–Si process
|
Jiao, Yuhong
|
|
|
49 |
1 |
p. 1513-1520
|
artikel
|
| 34 |
Design, manufacturing and properties of controllable porosity of ceramic filters based on SLA-3D printing technology
|
Zhang, Guangxu
|
|
|
49 |
1 |
p. 1009-1019
|
artikel
|
| 35 |
Development of alumina-based hybrid composite coatings for high temperature erosive and corrosive environments
|
Gupta, Avi
|
|
|
49 |
1 |
p. 862-874
|
artikel
|
| 36 |
Dopant and compositional modulation triggered long-wavelength ultra-broadband and tunable NIR emission in MgO: Cr3+ phosphor for NIR spectroscopy applications
|
Chang, Huan
|
|
|
49 |
1 |
p. 309-322
|
artikel
|
| 37 |
Dual-strategy of Eu2+ sensitization and Ca2+ substitution improves the luminescence properties of phosphor Sr2La8(SiO4)6O2:Eu
|
Wang, Fei
|
|
|
49 |
1 |
p. 1487-1495
|
artikel
|
| 38 |
Dynamic mechanical properties of carbon fiber reinforced geopolymer concrete at different ages
|
Wang, Zhihang
|
|
|
49 |
1 |
p. 834-846
|
artikel
|
| 39 |
Effect of aggregate particle content on sintering and corrosion resistance of hibonite-cordierite saggar
|
Gan, Cunqiang
|
|
|
49 |
1 |
p. 907-917
|
artikel
|
| 40 |
Effect of a MgO–CaO–ZrO2-based refractory on the cleanliness of a K4169 Ni-based superalloy
|
Zhao, Yudong
|
|
|
49 |
1 |
p. 117-125
|
artikel
|
| 41 |
Effect of an annealing treatment on the microstructure and EMW-absorbing properties of SiCw/Si3N4 ceramics fabricated by 3D printing
|
Yu, Siwen
|
|
|
49 |
1 |
p. 1092-1101
|
artikel
|
| 42 |
Effect of Ca2+ site substitution on structural, optical, electrical and magnetic properties in Nd3+ and Mn2+-co-doped calcium molybdato-tungstates
|
Sawicki, B.
|
|
|
49 |
1 |
p. 944-955
|
artikel
|
| 43 |
Effect of concentration of Fe-dopant on the photoelectrochemical properties of Titania nanotube arrays
|
Mir, Arshid
|
|
|
49 |
1 |
p. 677-682
|
artikel
|
| 44 |
Effect of configurational entropy on phase formation, structure, and magnetic properties of deeply substituted strontium hexaferrites
|
Zhivulin, V.E.
|
|
|
49 |
1 |
p. 1069-1084
|
artikel
|
| 45 |
Effect of in-situ formed whiskers diameter from tourmaline on microstructure and mechanical properties of 3Y-TZP ceramics
|
Zhang, Xiaoxu
|
|
|
49 |
1 |
p. 236-242
|
artikel
|
| 46 |
Effect of interface on oxidation behavior and tribological properties of CrAlN/SiNx multilayer films
|
He, Youxing
|
|
|
49 |
1 |
p. 1369-1380
|
artikel
|
| 47 |
Effect of ITO electrode on conductance quantization and multi-level cells in TiN/SiOx/ITO devices
|
Jeon, Beomki
|
|
|
49 |
1 |
p. 425-430
|
artikel
|
| 48 |
Effect of magnetic field intensity on the microstructure and abrasion resistance of magnetic electrodeposited Ni–Co–SiC thin films
|
Dong, Xiaowei
|
|
|
49 |
1 |
p. 1479-1486
|
artikel
|
| 49 |
Effect of Mil-88a metal-organic framework coating on the electrochemical properties of LiCoPO4
|
Hamdalla, Taymour A.
|
|
|
49 |
1 |
p. 1214-1219
|
artikel
|
| 50 |
Effect of Nb2O5 on ZnBiMnO varistor ceramic prepared by solid-state sintering at 850°C
|
Zhao, Ming
|
|
|
49 |
1 |
p. 67-73
|
artikel
|
| 51 |
Effect of ply structure on mechanical hysteresis behavior in 3D needle-punched C/SiC composites
|
Li, Longbiao
|
|
|
49 |
1 |
p. 489-502
|
artikel
|
| 52 |
Effect of rolling deformation and passes on microstructure and mechanical properties of 7075 aluminum alloy
|
Hongfu, Yang
|
|
|
49 |
1 |
p. 1165-1177
|
artikel
|
| 53 |
Effect of Sn4+–Isovalent doping concentration on giant dielectric properties of Sn x Ta0.025Ti0.975-x O2 ceramics
|
Mingmuang, Yasumin
|
|
|
49 |
1 |
p. 188-193
|
artikel
|
| 54 |
Effect of starch on pore structure and thermal conductivity of diatomite-based porous ceramics
|
Wu, Cuiwei
|
|
|
49 |
1 |
p. 383-391
|
artikel
|
| 55 |
Effect of Y2O3 content on densification, microstructure and mechanical properties of reaction sintered magnesium aluminate spinel
|
Baruah, Biswajit
|
|
|
49 |
1 |
p. 755-765
|
artikel
|
| 56 |
Effects of annealing temperature on the phase formation, optical, photoluminescence and magnetic properties of sol-gel YFeO3 films
|
Baqiah, Hussein
|
|
|
49 |
1 |
p. 600-606
|
artikel
|
| 57 |
Efficiently enhanced deep-red emission of Ba3WO6:Mn4+ oxide phosphor via the Gd3+ incorporation
|
Cao, Ziye
|
|
|
49 |
1 |
p. 1409-1418
|
artikel
|
| 58 |
Efficient optoelectronic properties of FeS2 nanostructures by Zn doping
|
Zebarjad, Maryam
|
|
|
49 |
1 |
p. 323-334
|
artikel
|
| 59 |
Electrospinning-assisted construction of 3D LiFePO4@rGO/carbon nanofibers as flexible cathode to boost the rate capabilities of lithium-ion batteries
|
Liu, Jifei
|
|
|
49 |
1 |
p. 1401-1408
|
artikel
|
| 60 |
Electrospinning preparation and electrochemical supercapacitor performance of dendrite-like 3D MgCo2O4/C nanofibers
|
Yu, Hongquan
|
|
|
49 |
1 |
p. 1203-1213
|
artikel
|
| 61 |
Enhanced CO2 response of La1-xFeO3-δ perovskites with A-site deficiency synthesized by flame spray pyrolysis
|
Jiao, Anqi
|
|
|
49 |
1 |
p. 591-599
|
artikel
|
| 62 |
Enhanced electrical transport properties of polycrystalline La0.67Sr x Ca0.23-x K0.1MnO3 ceramics through A-site multielement co-doping
|
Wu, KaiKai
|
|
|
49 |
1 |
p. 1344-1350
|
artikel
|
| 63 |
Enhanced in vitro inhibition of MCF-7 and magnetic properties of cobalt incorporated calcium phosphate (HAp and β-TCP) nanoparticles
|
Srinivasan, Baskar
|
|
|
49 |
1 |
p. 855-861
|
artikel
|
| 64 |
Enhanced NO2 gas sensing properties of ZnO-PANI composite nanofibers
|
Bonyani, Maryam
|
|
|
49 |
1 |
p. 1238-1249
|
artikel
|
| 65 |
Enhanced thermoelectric power generation performance of mixed-phase FeS/FeS2 nanostructures by controlling the reaction time duration
|
Rehman, Ubaid ur
|
|
|
49 |
1 |
p. 512-517
|
artikel
|
| 66 |
Excellent yellow emission of Si3N4:Eu nanorods derived from waster silicon with better thermal stability for white LEDs
|
Ge, Wanyin
|
|
|
49 |
1 |
p. 1328-1335
|
artikel
|
| 67 |
Exploring the methods of synthesis, functionalization, and characterization of graphene and graphene oxide for supercapacitor applications
|
Rashi,
|
|
|
49 |
1 |
p. 40-47
|
artikel
|
| 68 |
FA+ and Mn2+ codoped CsPbCl3 perovskite quantum dots with super thermal stability
|
Zhou, Xianju
|
|
|
49 |
1 |
p. 1002-1008
|
artikel
|
| 69 |
Fatigue free relaxor ferroelectric and electrocatalytic hydrogen evolution of yttrium substituted BaBi2Nb2O9 layered structured nanoceramics for energy storage application
|
Adak, Mrinal Kanti
|
|
|
49 |
1 |
p. 1020-1029
|
artikel
|
| 70 |
Fluoride ion conducting behavior in nonstoichiometric lanthanum oxyfluoride
|
Momai, Mizuki
|
|
|
49 |
1 |
p. 1502-1506
|
artikel
|
| 71 |
Formation mechanism of large porosity in solid oxide cell electrode coatings fabricated using ethylene glycol-based precursor solutions and its impact on the electrochemical performance
|
Eksioglu, Aycan
|
|
|
49 |
1 |
p. 956-963
|
artikel
|
| 72 |
Giant negative thermal expansion in Zn2-x Cu x P2O7 ceramics via microstructure effect
|
Shi, Naike
|
|
|
49 |
1 |
p. 294-300
|
artikel
|
| 73 |
Green synthesis, structural and luminescent characterization of BaZrO3:Eu3+ nanoparticles
|
López-Esquivel, R.I.
|
|
|
49 |
1 |
p. 413-418
|
artikel
|
| 74 |
Hierarchical framework of CoZnS as a high-performance electrode material for supercapacitors
|
Chavan, G.T.
|
|
|
49 |
1 |
p. 282-293
|
artikel
|
| 75 |
Hierarchically porous networks structure based on flexible SiO2 nanofibrous aerogel with excellent low frequency noise absorption
|
Yang, Mengmeng
|
|
|
49 |
1 |
p. 301-308
|
artikel
|
| 76 |
High-accuracy reliability evaluation for the WC–Co-based cemented carbides assisted by machine learning
|
Guan, Zehao
|
|
|
49 |
1 |
p. 613-624
|
artikel
|
| 77 |
High electrode performance of hydrothermally developed activated C coated O3–NaFeO2 electrode for Na-ion batteries applications
|
Jayachitra, J.
|
|
|
49 |
1 |
p. 48-56
|
artikel
|
| 78 |
Highly sensitive and selective glycol gas sensor based on SmFeO3 microspheres
|
Liu, Miao Miao
|
|
|
49 |
1 |
p. 1108-1113
|
artikel
|
| 79 |
High-performance 0.9Al2O3-0.1TiO2 microwave dielectric ceramics prepared by digital light processing
|
Wang, Xiang-Mei
|
|
|
49 |
1 |
p. 126-133
|
artikel
|
| 80 |
High temperature lattice structure evolution of C-axis preferred orientation AlN thin films and its application in temperature measurement
|
Dong, Ling
|
|
|
49 |
1 |
p. 607-612
|
artikel
|
| 81 |
High-temperature oxidation induced layering process for Si–C–B–N ceramic fibers with SiC nanograins
|
Tian, Yuan
|
|
|
49 |
1 |
p. 691-697
|
artikel
|
| 82 |
High-throughput data mined prediction of design and preparation of flexible carbon-based conductive materials in energy storage
|
Pan, Kewei
|
|
|
49 |
1 |
p. 736-744
|
artikel
|
| 83 |
Hydro-abrasive erosion and cavitation-silt erosion characteristics of HVOF sprayed WC-Ni cermet coatings under different flow velocities and sand concentrations
|
Hong, Sheng
|
|
|
49 |
1 |
p. 74-83
|
artikel
|
| 84 |
Impact of ethyl cellulose variation on microstructural and electrochemical properties of spin coated YSZ electrolyte thin films for SOFCs: Slurry composition evolution
|
Chasta, Gaurav
|
|
|
49 |
1 |
p. 1298-1307
|
artikel
|
| 85 |
Improved optoelectronic performance from the internal secondary excitation of MAPbCl3-MAPbBr3 single crystal photodetectors
|
Qiu, Xin
|
|
|
49 |
1 |
p. 518-527
|
artikel
|
| 86 |
Improvement of energy storage properties of NaNbO3-based ceramics through the cooperation of relaxation and oxygen vacancy defects
|
Luo, Guoqiang
|
|
|
49 |
1 |
p. 801-807
|
artikel
|
| 87 |
Inert ambiance-assisted laser ablation of CVD diamond leads to enhanced surface quality and grindability
|
Wang, Runkai
|
|
|
49 |
1 |
p. 1154-1164
|
artikel
|
| 88 |
Investigation on the influence of a titanium coating on the aging behavior of ATZ ceramics for implant applications
|
Hartmann, Axel
|
|
|
49 |
1 |
p. 1540-1545
|
artikel
|
| 89 |
Iron nickel sulphide embedded on multi-walled carbon nanotubes as efficient electrocatalysts for oxygen evolution reaction in alkaline medium
|
Ram Kumar, K.
|
|
|
49 |
1 |
p. 1195-1202
|
artikel
|
| 90 |
Kinetic study and model verification of reaction between alumina and charred layer
|
Liu, Yang
|
|
|
49 |
1 |
p. 375-382
|
artikel
|
| 91 |
Lead-free bimetallic oxide loaded on reduced graphene oxide‒poly(dopamine) hybrid nanocomposite with enhanced crystallinity and piezoelectric performance
|
Sasikumar, Ragu
|
|
|
49 |
1 |
p. 357-368
|
artikel
|
| 92 |
LiAlO2-coated LiNi0.8Co0.1Mn0.1O2 and chlorine-rich argyrodite enabling high-performance all-solid-state lithium batteries at suitable stack pressure
|
Zou, Changfei
|
|
|
49 |
1 |
p. 443-449
|
artikel
|
| 93 |
Long lifespan thermal barrier coatings overview: Materials, manufacturing, failure mechanisms, and multiscale structural design
|
Song, Jin-Bao
|
|
|
49 |
1 |
p. 1-23
|
artikel
|
| 94 |
Lotus root-like porous Na2MnPO4F·Na3V2(PO4)2F3/C as a high-performance cathode material for sodium-ion batteries
|
Wang, Bingjue
|
|
|
49 |
1 |
p. 1061-1068
|
artikel
|
| 95 |
Luminescence properties of Pr3+ doped high density germanate scintillating glasses for fast-event X-ray detection
|
Chen, Xinyu
|
|
|
49 |
1 |
p. 1148-1153
|
artikel
|
| 96 |
Mechanical and tribological characterization of deep eutectic solvent assisted electroless Ni–P-hBN coating
|
Khaira, Avinandan
|
|
|
49 |
1 |
p. 461-473
|
artikel
|
| 97 |
Mechanical behavior of YSZ-glass composite seals for solid oxide fuel cell application
|
Wang, Xiaochun
|
|
|
49 |
1 |
p. 995-1001
|
artikel
|
| 98 |
Mechanism of the formation, growth and transformation of BaTi2O5 nanorods synthesized by one-step in molten-salts
|
Zou, Wenzhong
|
|
|
49 |
1 |
p. 84-94
|
artikel
|
| 99 |
Mechanistic study of the bioactivity improvement of Al2O3-doped BBG after dynamic flow treatment
|
Chen, Ruiguo
|
|
|
49 |
1 |
p. 773-782
|
artikel
|
| 100 |
Mechanochemical fabrication of geopolymer composites based on the reinforcement effect of microfibrillated cellulose
|
Zheng, Yuhang
|
|
|
49 |
1 |
p. 503-511
|
artikel
|
| 101 |
Microstructural and electrical properties of AlN–CoCrFeMnNi cermet obtained by hot pressing
|
Zhang, Guopeng
|
|
|
49 |
1 |
p. 808-816
|
artikel
|
| 102 |
Microstructural, dielectric, and nonlinear properties of Ca1–xCdxCu3Ti4O12 thin films
|
Xue, Renzhong
|
|
|
49 |
1 |
p. 134-144
|
artikel
|
| 103 |
Microstructure and electrical properties of Er-doped 0.67 Pb(Mg1/3Nb2/3)O3-0.33PbTiO3 ceramics with BaTiO3 templates
|
Wang, Qing
|
|
|
49 |
1 |
p. 437-442
|
artikel
|
| 104 |
Microstructure and mechanical properties of nanomultilayered AlTiN/Cu coatings prepared by a hybrid system of AIP and PDCMS
|
Mei, Haijuan
|
|
|
49 |
1 |
p. 226-235
|
artikel
|
| 105 |
Microstructure and phase evolution of micronized ceramic colorants from a pilot plant for inks production
|
Ardit, Matteo
|
|
|
49 |
1 |
p. 882-893
|
artikel
|
| 106 |
Microstructure and properties of Nb2O5/Mg gradient coating on AZ31 magnesium alloy by magnetron sputtering
|
Ding, Ziyu
|
|
|
49 |
1 |
p. 154-167
|
artikel
|
| 107 |
Microwave dielectric properties of Ca1.15RE0.85Al0.85Ti0.15O4 (RE=Nd, La, Y) ceramics prepared by the reaction sintering method
|
Qu, Xin
|
|
|
49 |
1 |
p. 716-721
|
artikel
|
| 108 |
Mid-infrared evanescent wave sensor based on side-polished chalcogenide fiber
|
Yang, Yitao
|
|
|
49 |
1 |
p. 1291-1297
|
artikel
|
| 109 |
Mn2O3 nanoparticle-porous silicon nanocomposite based amperometric sensor for sensitive detection and quantification of Acetaminophen in real samples
|
Ahmed, Jahir
|
|
|
49 |
1 |
p. 933-943
|
artikel
|
| 110 |
Modelling of the bending strength of refractory materials at elevated temperatures
|
Macháček, Jan
|
|
|
49 |
1 |
p. 1030-1037
|
artikel
|
| 111 |
Modification of hydroxyapatite (HA) powder by carboxymethyl chitosan (CMCS) for 3D printing bioceramic bone scaffolds
|
Wei, Qinghua
|
|
|
49 |
1 |
p. 538-547
|
artikel
|
| 112 |
Molten salt dynamic sealing synthesis of MAX phases (Ti3AlC2, Ti3SiC2 et al.) powder in air
|
Liu, Zetan
|
|
|
49 |
1 |
p. 168-178
|
artikel
|
| 113 |
Multifunctional guanidinium thiocyanate additive to enhance the performance of quasi-two-dimensional perovskite blue-emitting devices
|
Gao, Jiulin
|
|
|
49 |
1 |
p. 1308-1316
|
artikel
|
| 114 |
Multi-functional mullite fiber-based porous ceramics with a multilevel pore structure assembled by alumina platelets and mullite whiskers
|
Dong, Xue
|
|
|
49 |
1 |
p. 847-854
|
artikel
|
| 115 |
Multi-type nanoscale domain switching dynamics in tetragonal PIN-PMN-PT single crystal under electrical bias
|
Li, Kai
|
|
|
49 |
1 |
p. 109-116
|
artikel
|
| 116 |
Natural calcium phosphates from circular economy as adsorbent phases for the remediation of textile industry waste-waters
|
Falini, Giuseppe
|
|
|
49 |
1 |
p. 243-252
|
artikel
|
| 117 |
Near-infrared-shielding energy-saving borosilicate glass-ceramic window materials based on doping of defective tantalum tungsten oxide (Ta0.3W0.7O2.85) nanocrystals
|
Yang, Guang
|
|
|
49 |
1 |
p. 403-412
|
artikel
|
| 118 |
Performance analysis of (Y1-xDyx)2CrTaO7 as promising thermal barrier material
|
Tian, Chen
|
|
|
49 |
1 |
p. 1276-1282
|
artikel
|
| 119 |
Phase and structural evolution of zirconolite ceramics prepared by solid-state reaction sintering
|
Chen, Yuan-Bin
|
|
|
49 |
1 |
p. 419-424
|
artikel
|
| 120 |
Phase compositions and crystal structure of Sn-deficient Ca2Sn2Al2O9 microwave dielectric ceramics with high Q×f values
|
Du, Kang
|
|
|
49 |
1 |
p. 202-209
|
artikel
|
| 121 |
Polymer precursor synthesis of novel ZrC–SiC ultrahigh-temperature ceramics and modulation of their molecular structure
|
Wu, Shibin
|
|
|
49 |
1 |
p. 707-715
|
artikel
|
| 122 |
Potentiality of the porous geopolymer sphere in adsorption of Pb (II) from aqueous solutions: Behaviors and mechanisms
|
Lu, Meng
|
|
|
49 |
1 |
p. 698-706
|
artikel
|
| 123 |
Preparation and dielectric properties of lead-free perovskite-structured high-entropy ceramics of (La0.25Sr0.25Ba0.25Na0.25)(Ti0.5Me0.5)O3-δ (Me=Sn, Zr, Hf) via doping at both A and B sites
|
Chen, Yingquan
|
|
|
49 |
1 |
p. 1038-1047
|
artikel
|
| 124 |
Preparation of AlN with low agglomeration using polyethylene glycol and emulsifier to disperse the ultrafine raw powders
|
Wang, Yuming
|
|
|
49 |
1 |
p. 1390-1400
|
artikel
|
| 125 |
Processing and characterization of ultra-high temperature ceramic matrix composites via water based slurry impregnation and polymer infiltration and pyrolysis
|
Servadei, Francesca
|
|
|
49 |
1 |
p. 1220-1229
|
artikel
|
| 126 |
Rare-earth high-entropy aluminate-toughened-zirconate dual-phase composite ceramics for advanced thermal barrier coatings
|
Luo, Xuewei
|
|
|
49 |
1 |
p. 766-772
|
artikel
|
| 127 |
Regulation mechanism of in-situ synthesized (Nb,Ta)C/Ni composite cladding coatings by laser shock peening: Microstructure evolution and electrochemical corrosion behavior
|
Jiang, G.Q.
|
|
|
49 |
1 |
p. 722-735
|
artikel
|
| 128 |
Relationship between bond characteristics and microwave dielectric properties of REVO4 (RE = Yb, Ho) ceramics
|
Dai, Yimin
|
|
|
49 |
1 |
p. 875-881
|
artikel
|
| 129 |
Relying on energy transfer to enhance the 2.9 μm emission by co-doped Tm3+ ions in Dy:Y2O3 transparent ceramics
|
Pan, Yuxin
|
|
|
49 |
1 |
p. 101-108
|
artikel
|
| 130 |
Room-temperature direct bonding of ZrO2 ceramic and SiCP/Al composite using ultrasonic waves
|
Dong, H.J.
|
|
|
49 |
1 |
p. 431-436
|
artikel
|
| 131 |
Seamless joining of ZTA ceramics without the application of pressure
|
Mun, Jeong-Un
|
|
|
49 |
1 |
p. 1529-1534
|
artikel
|
| 132 |
Self-assembly of MXene-decorated stearic acid/ionic liquid phase change material emulsion for effective photo-thermal conversion and storage
|
Wang, Fangxian
|
|
|
49 |
1 |
p. 480-488
|
artikel
|
| 133 |
SiCnw@SiC foam prepared based on vapor-solid mechanism for efficient microwave absorption
|
Su, Kai
|
|
|
49 |
1 |
p. 450-460
|
artikel
|
| 134 |
Sintering behaviour, phase composition, microstructure, and dielectric properties of BaSm2O4 microwave ceramics
|
He, Guoqiang
|
|
|
49 |
1 |
p. 548-557
|
artikel
|
| 135 |
Spin-glass behavior and redox catalytic properties of room temperature produced ZnCrMnO4
|
Kushwaha, Shreya
|
|
|
49 |
1 |
p. 683-690
|
artikel
|
| 136 |
SrLaNaTeO6:Eu3+ red-emitting phosphors with high luminescence efficiency and high thermal stability for high CRI white LEDs
|
Wang, Yuan
|
|
|
49 |
1 |
p. 579-590
|
artikel
|
| 137 |
Stable borosilicate glass doped with CsPbBr3 quantum dots for efficient photodetectors
|
Jia, Hong
|
|
|
49 |
1 |
p. 1283-1290
|
artikel
|
| 138 |
Stereolithography-based additive manufacturing of RB-SiC ceramics by a two-step sintering method
|
Chang, Haotian
|
|
|
49 |
1 |
p. 1085-1091
|
artikel
|
| 139 |
Structural characterization, phase analysis and electrochemical hydrogen storage studies on new pyrochlore SmRETi2O7 (RE = Dy, Ho, and Yb) microstructures
|
Esfahani, Maryam Hasanzadeh
|
|
|
49 |
1 |
p. 253-263
|
artikel
|
| 140 |
Structural transformation, dielectric and multiferroic properties of (Gd1-x Ba x )(Fe1-xTix)O3 ceramics by tuning composition
|
Sahoo, Sushrisangita
|
|
|
49 |
1 |
p. 918-932
|
artikel
|
| 141 |
Study the factors affecting water vapor barrier properties of organic–inorganic hybrid coatings
|
Du, Xiang-Yun
|
|
|
49 |
1 |
p. 1521-1528
|
artikel
|
| 142 |
Surface and subsurface formation mechanism of SiCp/Al composites under ultrasonic scratching
|
Li, Qilin
|
|
|
49 |
1 |
p. 817-833
|
artikel
|
| 143 |
Surface modification of silicate, borosilicate and phosphate bioactive glasses to improve/control protein adsorption: PART I
|
Gobbo, Virginia Alessandra
|
|
|
49 |
1 |
p. 1261-1275
|
artikel
|
| 144 |
Surgical cotton microfibers loaded with nanoceria: A new platform for bone tissue engineering
|
Singh, Sandhya
|
|
|
49 |
1 |
p. 1114-1127
|
artikel
|
| 145 |
Synergistic effect of binary metal doping and nanotechnology to boost the light-harvesting properties of rare earth metal oxide
|
Ishfaq, Muhammad
|
|
|
49 |
1 |
p. 745-754
|
artikel
|
| 146 |
Synthesis of Hf6Ta2O17 superstructure via spark plasma sintering for improved oxidation resistance of multi-component ultra-high temperature ceramics
|
Nisar, Ambreen
|
|
|
49 |
1 |
p. 783-791
|
artikel
|
| 147 |
Synthesis, structural stability and phase diagram of BiFeO3–CaSnO3 ceramics
|
Chen, Xin
|
|
|
49 |
1 |
p. 1436-1443
|
artikel
|
| 148 |
Taguchi optimization of YSZ/alumina/silica colloids for suspension plasma sprayed coating process
|
Ghiasi, A.R.
|
|
|
49 |
1 |
p. 194-201
|
artikel
|
| 149 |
Tailoring afterglow properties of polychromatic long-persistent LiMg x Sr4-x-2y (BO3)3: y Eu2+ phosphor by codoping with Dy3+ or Nd3+
|
Li, Runze
|
|
|
49 |
1 |
p. 1336-1343
|
artikel
|
| 150 |
Tensile fracture test of nanocomposite ceramics under ultrasonic vibration based on nonlocal theory
|
Tong, Jinglin
|
|
|
49 |
1 |
p. 528-537
|
artikel
|
| 151 |
The effect of Y3+ doping upon Nd: S-FAP transparent ceramics for effective spectral performance improvement
|
Zhang, Yongqiang
|
|
|
49 |
1 |
p. 1362-1368
|
artikel
|
| 152 |
Thermophysical properties of zinc gallate
|
Kondrat'eva, Olga N.
|
|
|
49 |
1 |
p. 179-187
|
artikel
|
| 153 |
The upconverted luminescence and chemical stability of morphologically controllable La2O3:Yb3+/Er3+ nanoparticles
|
Zhao, Xiaoqi
|
|
|
49 |
1 |
p. 571-578
|
artikel
|
| 154 |
The visible-light-driven photocatalytic performance in H2 evolution for core-shell CN@CoP heterojunction
|
Zhao, Haidong
|
|
|
49 |
1 |
p. 1230-1237
|
artikel
|
| 155 |
Thickness dependence of microwave dielectric tunability in Ba0·5Sr0·5TiO3 thin films deposited by pulsed laser deposition
|
Goud, J. Pundareekam
|
|
|
49 |
1 |
p. 1188-1194
|
artikel
|
| 156 |
Third-order optical nonlinear features of Er3+ and Pr3+ activated multicomponent borate glasses in nanosecond pulse regime: A comparative study
|
Gurushantha, K.
|
|
|
49 |
1 |
p. 1473-1478
|
artikel
|
| 157 |
Tool wear characteristics analysis of cBN cutting tools in high-speed turning of Inconel 718
|
Tu, Luqiang
|
|
|
49 |
1 |
p. 635-658
|
artikel
|
| 158 |
Towards obtaining the optimum physical, optical and nuclear radiation attenuation behaviours of tellurite–germanate glasses through Eu2O3 reinforcement: Glass synthesis, experimental and theoretical characterisation study
|
Mattos, G.R.S.
|
|
|
49 |
1 |
p. 986-994
|
artikel
|
| 159 |
Tribological behaviour of bilayer alumina and mullite plasma-sprayed coatings deposited on a refractory substrate at high temperatures
|
Franco, D.
|
|
|
49 |
1 |
p. 1250-1260
|
artikel
|
| 160 |
Trifunctional electrocatalysts based on feather-like NiCoP 3D architecture for hydrogen evolution, oxygen evolution, and urea oxidation reactions
|
Yang, Liming
|
|
|
49 |
1 |
p. 659-668
|
artikel
|
| 161 |
Tunable dual-emission in Sb3+, Mn2+ codoped rare-earth based Cs2NaYCl6 nanocrystals and its LEDs applications
|
Bai, Songchao
|
|
|
49 |
1 |
p. 1102-1107
|
artikel
|
| 162 |
Tunable full-color emission phosphors: Enhanced security application via a patterned 3-dimensions code
|
Shen, Xiuyu
|
|
|
49 |
1 |
p. 345-356
|
artikel
|
| 163 |
Tuning of microwave dielectric properties of garnets Ca3Mg2CV2O12 (C = Si, Ti) through compression and expansion effects
|
Qiu, Huizi
|
|
|
49 |
1 |
p. 565-570
|
artikel
|
| 164 |
Ultra-low permittivity MgF2 ceramics with high Qf values and their role as microstrip patch antenna substrates
|
Zhou, Meng Fei
|
|
|
49 |
1 |
p. 369-374
|
artikel
|
| 165 |
Utilization of Ag ions to improve room-temperature TCR of La0.85-x Sr0.15Ag x MnO3 polycrystalline ceramics
|
Yan, Yixin
|
|
|
49 |
1 |
p. 669-676
|
artikel
|
| 166 |
Wide-band blue-emitting in Ce3+ doped Ca2YZr2Al3O12 garnet-type phosphor designed via local structural lattice distortion and synthesized in nonreducing atmosphere
|
Qu, Mingyang
|
|
|
49 |
1 |
p. 792-800
|
artikel
|
Tijdschrift beschrijving