| nr |
titel |
auteur |
tijdschrift |
jaar |
jaarg. |
afl. |
pagina('s) |
type |
| 1 |
Adsorption mechanism of oxide inclusions by microporous magnesia aggregates in tundish
|
Yuan, Cheng
|
|
|
48 |
1 |
p. 427-435
|
artikel
|
| 2 |
Air fabrication of SnO2 based planar perovskite solar cells with an efficiency approaching 20%: Synergistic passivation of multi-defects by choline chloride
|
Wang, Zhipeng
|
|
|
48 |
1 |
p. 212-223
|
artikel
|
| 3 |
A new type of microwave dielectric ceramic based on K2O–SrO–P2O5 composition with high quality factor and low sintering temperature
|
Bao, Jian
|
|
|
48 |
1 |
p. 784-794
|
artikel
|
| 4 |
An experimental and theoretical study on the photocatalytic antibacterial activity of boron-doped TiO2 nanoparticles
|
Wang, Yuzheng
|
|
|
48 |
1 |
p. 604-614
|
artikel
|
| 5 |
A novel green process for the synthesis of high-whiteness and ultrafine aluminum hydroxide powder from secondary aluminum dross
|
Lv, Han
|
|
|
48 |
1 |
p. 953-962
|
artikel
|
| 6 |
A novel lightweight periclase-composite (Mg8-xFex+yAl16-yO32) spinel refractory material for cement rotary kilns
|
Wu, Han
|
|
|
48 |
1 |
p. 615-623
|
artikel
|
| 7 |
Antioxidant properties of low-carbon magnesia-carbon refractories containing AlB2–Al–Al2O3 composites
|
Yang, Pan
|
|
|
48 |
1 |
p. 1375-1381
|
artikel
|
| 8 |
A porous calcium-zirconia scaffolds composed of magnetic nanoparticles for bone cancer treatment: Fabrication, characterization and FEM analysis
|
Jasemi, Amir
|
|
|
48 |
1 |
p. 1314-1325
|
artikel
|
| 9 |
Atomic-level thick TiO2–CoTiO3 multilayer p-n junction with extended built-in electric field as efficient photoanode
|
Luo, Xuan
|
|
|
48 |
1 |
p. 656-664
|
artikel
|
| 10 |
(Bi13Co11)Co2O40–Co3O4 nanocomposites: Approach to different fuels in sol-gel combustion synthesis using the Box-Behnken design
|
Lopes Matias, Jefferson A.
|
|
|
48 |
1 |
p. 481-494
|
artikel
|
| 11 |
Biomimetic hydroxyapatite (HAp) coatings on pure Mg and their physiological corrosion behavior
|
Hernández, Leonardo
|
|
|
48 |
1 |
p. 1208-1222
|
artikel
|
| 12 |
Cerium (IV) oxide reinforced Lithium-Borotellurite glasses: A characterization study through physical, optical, structural and radiation shielding properties
|
Ilik, Erkan
|
|
|
48 |
1 |
p. 1152-1165
|
artikel
|
| 13 |
Characterization of crystallographic orientation and lattice disorder in hydroxyapatite thin films by Raman scattering
|
Akazawa, Housei
|
|
|
48 |
1 |
p. 624-631
|
artikel
|
| 14 |
Chromium in lead metasilicate glass: Solubility, valence, and local environment via multiple spectroscopy
|
Sampaio, David V.
|
|
|
48 |
1 |
p. 173-178
|
artikel
|
| 15 |
Close-to-ideal spin polarization in zinc-doped Fe–Mo double perovskites at the nanoscale
|
Hien, Le Duc
|
|
|
48 |
1 |
p. 353-362
|
artikel
|
| 16 |
Competition between ferromagnetism and superconductivity in GdBa2Cu3O7-x/La0.7Sr0.3MnO3 bilayers with varying thickness
|
Oh, Jun-Yung
|
|
|
48 |
1 |
p. 1068-1076
|
artikel
|
| 17 |
Conductive hydrogels with 2D/2D β-NiS/Ti3C2Tx heterostructure for high-performance supercapacitor electrode materials
|
Yu, Ting
|
|
|
48 |
1 |
p. 1382-1393
|
artikel
|
| 18 |
Construction of simultaneous modified Na3V2(PO4)3/C cathode with K/Zr substitution and carbon nanotubes enwrapping for high performance sodium ion battery
|
Huang, Que
|
|
|
48 |
1 |
p. 397-406
|
artikel
|
| 19 |
Controllable preparation of dual-phase VC-C through in-situ electroconversion for lithium storage
|
Chen, Yunfei
|
|
|
48 |
1 |
p. 1024-1031
|
artikel
|
| 20 |
Cost-effective route to nanodiamonds from low-rank coal and their fluorescent & dielectric characteristics
|
Raj, Ashlin M.
|
|
|
48 |
1 |
p. 887-895
|
artikel
|
| 21 |
Crystal structure, phase transition, vibrational spectra, and microwave dielectric characteristics of Ta5+ ionic substituted Co0.5Ti0.5NbO4 ceramics
|
Yang, Hongyu
|
|
|
48 |
1 |
p. 648-655
|
artikel
|
| 22 |
Cu2ZnSnS4 as a hole-transport layer in triple-cation perovskite solar cells: Current density versus layer thickness
|
Rastegar Moghadamgohari, Zahra
|
|
|
48 |
1 |
p. 711-719
|
artikel
|
| 23 |
Defect tuned SnO2 nanolayer coated TiO2 1-D core-shell structure for enhanced overall solar water splitting
|
Thoa Huynh, Thi Kim
|
|
|
48 |
1 |
p. 1013-1023
|
artikel
|
| 24 |
Determining specimen thickness limit in fracture toughness tests applied to dental ceramics and metal alloy interfaces
|
Santos Porto, Carla Pereira
|
|
|
48 |
1 |
p. 803-810
|
artikel
|
| 25 |
Development and analysis of a high refractive index liquid phase Si3N4 slurry for mask stereolithography
|
Wu, Xiangquan
|
|
|
48 |
1 |
p. 120-129
|
artikel
|
| 26 |
Development and characterization of silicon dioxide clad silicon carbide optics for terrestrial and space applications
|
Jalluri, Tayaramma D.P.V.
|
|
|
48 |
1 |
p. 96-110
|
artikel
|
| 27 |
Development of high infrared emissivity porous ceramic coating using pre-synthesized flower-like CeO2 powder for high temperature applications
|
Han, Rifei
|
|
|
48 |
1 |
p. 1340-1348
|
artikel
|
| 28 |
Direct ink writing of aluminum-phosphate-bonded Al2O3 ceramic with ultra-low dimensional shrinkage
|
Xu, Xin
|
|
|
48 |
1 |
p. 864-871
|
artikel
|
| 29 |
Drying behavior of steel-ladle lining refractory castables under continuous heating rate
|
Cunha, T.M.
|
|
|
48 |
1 |
p. 1142-1151
|
artikel
|
| 30 |
Effect of Al atomic layer on the wetting behavior, interface structure and electrical contact properties of silver reinforced by Ti3AlC2 ceramic
|
Ding, Kuankuan
|
|
|
48 |
1 |
p. 190-198
|
artikel
|
| 31 |
Effect of Al(H2PO4)3/Zn/B4C doped resin on properties and microstructure of unfired Al2O3–C slide plate materials
|
Zhang, Jing
|
|
|
48 |
1 |
p. 472-480
|
artikel
|
| 32 |
Effect of energy transfer and local crystal field perturbation on the thermometric sensitivity of Ga-Tb-Eu ternary emission system
|
Yang, Xuening
|
|
|
48 |
1 |
p. 684-693
|
artikel
|
| 33 |
Effect of interface types on the heat-resistance of Cansas-II SiCf /SiC composites
|
Han, Xiao
|
|
|
48 |
1 |
p. 744-753
|
artikel
|
| 34 |
Effect of l-cysteine modified ZnS quantum dots on the growth of Aspergillus oryzae
|
Zhang, Guangzhi
|
|
|
48 |
1 |
p. 503-507
|
artikel
|
| 35 |
Effect of preparation method on the mechanism for oxidation of C/C-BN composites
|
Ning, Yao
|
|
|
48 |
1 |
p. 525-539
|
artikel
|
| 36 |
Effect of SnO–P2O5–MgO glass addition on the ionic conductivity of Li1.3Al0.3Ti1.7(PO4)3 solid electrolyte
|
Kang, Jingrui
|
|
|
48 |
1 |
p. 157-163
|
artikel
|
| 37 |
Effect of spraying ceramic powder pore structure on thermophysical properties of plasma-sprayed thermal barrier coatings
|
Yang, Ming
|
|
|
48 |
1 |
p. 1125-1131
|
artikel
|
| 38 |
Effect of the particle size on the performance of BaTiO3 piezoelectric ceramics produced by additive manufacturing
|
Chen, Xiaoteng
|
|
|
48 |
1 |
p. 1285-1292
|
artikel
|
| 39 |
Effect of TiO2 substituting SiO2 on the rheological and crystallization behavior of mold slags for casting Ti-containing steel
|
Ji, Junde
|
|
|
48 |
1 |
p. 256-265
|
artikel
|
| 40 |
Effects of carbonate ions in phosphate solution on the fabrication of carbonate apatite through a dissolution–precipitation reaction
|
Shimabukuro, Masaya
|
|
|
48 |
1 |
p. 1032-1037
|
artikel
|
| 41 |
Effects of Ga–Ba Co-doping on the morphology and conductivity of Li7La3Zr2O12 electrolyte synthesized by sol-gel method
|
Tian, Ying
|
|
|
48 |
1 |
p. 963-970
|
artikel
|
| 42 |
Effects of La0.8Sr0.2MnO3 and Ag electrodes on bismuth-oxide-based low-temperature solid electrolyte oxygen generators
|
Tsai, Jeng-Ting
|
|
|
48 |
1 |
p. 1132-1141
|
artikel
|
| 43 |
Effects of particle grading on properties of silica ceramics prepared by selective laser sintering
|
Zhang, Jie
|
|
|
48 |
1 |
p. 1173-1180
|
artikel
|
| 44 |
Effects of SiC particle size on flexural strength, permeability, electrical resistivity, and thermal conductivity of macroporous SiC
|
Yun, Sung Il
|
|
|
48 |
1 |
p. 1429-1438
|
artikel
|
| 45 |
Effects of Zn2+/Mg2+ ratio on dielectric properties of BaTiO3-based ceramics with excellent temperature stability: Experiments and the first-principle calculations
|
Wang, Menglong
|
|
|
48 |
1 |
p. 847-854
|
artikel
|
| 46 |
Enhanced dielectric properties and chemical bond characteristics of ZnNb2O6 ceramics due to zinc oxide doping
|
Wang, He
|
|
|
48 |
1 |
p. 82-89
|
artikel
|
| 47 |
Enhanced electromagnetic wave dissipation features of magnetic Ni microspheres by developing core-double shells structure
|
Zhang, Bo
|
|
|
48 |
1 |
p. 446-454
|
artikel
|
| 48 |
Enhanced energy storage performance in Na(1-3x)BixNb0.85Ta0.15O3 relaxor ferroelectric ceramics
|
Dong, Qinpeng
|
|
|
48 |
1 |
p. 776-783
|
artikel
|
| 49 |
Enhanced photoelectrochemical activity using NiCo2S4 / spaced TiO2 nanorod heterojunction
|
Nagappagari, Lakshmana Reddy
|
|
|
48 |
1 |
p. 920-930
|
artikel
|
| 50 |
Enhanced temperature coefficient of resistance and magnetoresistance of Co-doped La0.67Ca0.33MnO3 polycrystalline ceramics
|
Li, Yule
|
|
|
48 |
1 |
p. 407-414
|
artikel
|
| 51 |
Enhanced thermoelectric properties of Cu2-xSe by coordinating carrier concentration to reduce thermal conductivity
|
Liang, Hua
|
|
|
48 |
1 |
p. 248-255
|
artikel
|
| 52 |
Enhancement of the mechanical properties of nacre-like alumina ceramic by the synergism of graphene oxide and Si3N4 whisker
|
Sun, Xiaoning
|
|
|
48 |
1 |
p. 941-946
|
artikel
|
| 53 |
Enhancing the dielectric and energy storage properties of lead-free Na0.5Bi0.5TiO3–BaTiO3 ceramics by adding K0.5Na0.5NbO3 ferroelectric
|
Lv, Jingwen
|
|
|
48 |
1 |
p. 22-31
|
artikel
|
| 54 |
Etching of SiC–SiC-composites by a laser-induced plasma in a reactive gas
|
Zimmer, Klaus
|
|
|
48 |
1 |
p. 90-95
|
artikel
|
| 55 |
Evaluation of structural, morphological and optical properties of CdO nanostructures
|
Prakash, T.
|
|
|
48 |
1 |
p. 1223-1229
|
artikel
|
| 56 |
Experimental study on high temperature performances of silica-based ceramic core for single crystal turbine blades
|
Pan, Zhiping
|
|
|
48 |
1 |
p. 548-555
|
artikel
|
| 57 |
Fabrication and properties of Si2N2O-Si3N4 ceramics via direct ink writing and low-temperature sintering
|
Jiang, Qiao
|
|
|
48 |
1 |
p. 32-41
|
artikel
|
| 58 |
Fabrication, drug delivery kinetics and cell viability assay of PLGA-coated vancomycin-loaded silicate porous microspheres
|
Zirak, N.
|
|
|
48 |
1 |
p. 48-54
|
artikel
|
| 59 |
Fabrication of ultra-small SiC nanoparticles with adjustable size, stoichiometry and photoluminescence by AC multi-arc plasmas
|
Wang, Cheng
|
|
|
48 |
1 |
p. 632-641
|
artikel
|
| 60 |
Formation process of zirconia nanotubes and porous structures and model of oxygen bubble growth
|
Ni, Yilin
|
|
|
48 |
1 |
p. 495-502
|
artikel
|
| 61 |
Gas sensing properties of asymmetrically reduced Na1/2Bi1/2TiO3–based ceramics
|
Chen, Caiwen
|
|
|
48 |
1 |
p. 556-562
|
artikel
|
| 62 |
Giant magnetoresistance effect in Fe-doped SrCoO2.9-δF0.1 perovskites
|
Huang, Jun
|
|
|
48 |
1 |
p. 346-352
|
artikel
|
| 63 |
Glass production using tailing of upgraded rare metal mineralization, Abu Rusheid area – Egypt for nuclear waste immobilization
|
El-Sayed Seleman, Mohamed M.
|
|
|
48 |
1 |
p. 569-577
|
artikel
|
| 64 |
Graded Ti(C,N)-based cermets fabricated by mechanical activation and in situ carbothermal reduction: Investigation of nitrogen sintering pressure on microstructure and mechanical performance
|
Xu, Xiangyu
|
|
|
48 |
1 |
p. 913-919
|
artikel
|
| 65 |
Green-chemical-jump-thickening polishing for silicon carbide
|
Li, Min
|
|
|
48 |
1 |
p. 1107-1124
|
artikel
|
| 66 |
Hard and electrically conductive multicomponent diboride-based films with high thermal stability
|
Farhadizadeh, A.
|
|
|
48 |
1 |
p. 540-547
|
artikel
|
| 67 |
Heat capacity of nanocrystalline Yb2O3
|
Rojas, D.P.
|
|
|
48 |
1 |
p. 879-886
|
artikel
|
| 68 |
Hierarchically structured Bi2MoxW1-xO6 solid solutions with enhanced piezocatalytic activities
|
Sun, Dandan
|
|
|
48 |
1 |
p. 837-846
|
artikel
|
| 69 |
High CO2 resistance of indium-doped cobalt-free 60 wt.%Ce0.9Pr0.1O2-δ-40 wt.%Pr0.6Sr0.4Fe1-x In x O3-δ oxygen transport membranes
|
Huang, Yanhao
|
|
|
48 |
1 |
p. 415-426
|
artikel
|
| 70 |
Highly porous, hierarchical peanut-like Ecandrewsite binary metal oxide nanostructures for the high-efficiency detoxification of organic dyes from wastewater
|
Santhoshkumar, P.
|
|
|
48 |
1 |
p. 1057-1067
|
artikel
|
| 71 |
High-performance indium-free flexible transparent ATO/Au/ATO tri-layer films by magnetron sputtering
|
Peng, Wei
|
|
|
48 |
1 |
p. 381-386
|
artikel
|
| 72 |
High-temperature mechanical properties of ZrB2/SiC/Si3N4 ceramic tool materials with dual composite architectures
|
Zhang, Jingbao
|
|
|
48 |
1 |
p. 1038-1046
|
artikel
|
| 73 |
Homogenizing role of hydrogen in the synthesis of multicomponent Carbohydrides and Nitridohydrides of transition metals in the combustion mode
|
Aghajanyan, N.N.
|
|
|
48 |
1 |
p. 42-47
|
artikel
|
| 74 |
Improved visible light responsive photocatalytic hydrogen production over g-C3N4 with rich carbon vacancies
|
Rao, Feiyang
|
|
|
48 |
1 |
p. 1439-1445
|
artikel
|
| 75 |
Improving the microwave dielectric properties of Ga2[LiGa3]O8 inverse spinel by enhancing B-site ordering degree
|
Fang, Weishuang
|
|
|
48 |
1 |
p. 896-902
|
artikel
|
| 76 |
Influence of Al2O3 on the electrical conductivity and structure of calcium-silicate-based melts
|
Zhou, Lejun
|
|
|
48 |
1 |
p. 232-238
|
artikel
|
| 77 |
Influence of heat treatment on microstructure and mechanical properties of Cansas-II SiC/PyC/CVI-SiC mini-composites
|
Han, Xiao
|
|
|
48 |
1 |
p. 1077-1089
|
artikel
|
| 78 |
Influence of Y2O3 on densification, flexural strength and heat shock resistance of cordierite-based composite ceramics
|
Hu, Cheng
|
|
|
48 |
1 |
p. 74-81
|
artikel
|
| 79 |
Influences of ZrSiO4 doping on microstructure and mechanical properties of Y2SiO5–ZrSiO4 ceramics
|
Wang, Xin
|
|
|
48 |
1 |
p. 1277-1284
|
artikel
|
| 80 |
In-situ preparation of SiC reinforced Si3N4 ceramics aerogels by foam-gelcasting method
|
Han, Lei
|
|
|
48 |
1 |
p. 1166-1172
|
artikel
|
| 81 |
Interactions of Cr2O3–Al2O3–ZrO2 refractory with slags in an entrained-flow coal-water slurry gasifier
|
Wang, Shuai
|
|
|
48 |
1 |
p. 1197-1207
|
artikel
|
| 82 |
Interfacial characteristics and wear performances of iron matrix composites reinforced with zirconia-toughened alumina ceramic particles
|
Li, Cong
|
|
|
48 |
1 |
p. 1293-1305
|
artikel
|
| 83 |
Investigation on structural and H2 gas sensing response of AlCdZnNiFe2O4 sensor material
|
Sankaranarayanan, R.
|
|
|
48 |
1 |
p. 720-731
|
artikel
|
| 84 |
Lattice relaxation effect in CsxMA(1-x)PbBr3 single crystal to enhance optoelectronic performance of perovskite photodetectors
|
Li, Lei
|
|
|
48 |
1 |
p. 436-445
|
artikel
|
| 85 |
Lattice vibrational characteristics and structure-property relationships of Ca(Mg1/2W1/2)O3 microwave dielectric ceramics with different sintering temperatures
|
Wang, Xiangyu
|
|
|
48 |
1 |
p. 1415-1422
|
artikel
|
| 86 |
LiBAlF6:Cr3+ (B = Ca, Sr) fluoride phosphors with ultra-broad near-infrared emission for NIR pc-LEDs
|
Wu, Di
|
|
|
48 |
1 |
p. 387-396
|
artikel
|
| 87 |
Lifetime prediction of WC-6Ni/SiC friction pair under seawater lubrication using an Inverse Gaussian model
|
Ma, Zhonghai
|
|
|
48 |
1 |
p. 463-471
|
artikel
|
| 88 |
Loading CuFe2O4 onto ceramic fabric for photocatalytic degradation of methylene blue under visible light irradiation
|
Cheng, Deshan
|
|
|
48 |
1 |
p. 1256-1263
|
artikel
|
| 89 |
Low-frequency plasmonic state and tunable negative permittivity in percolative graphite / barium titanate composites
|
Song, X.T.
|
|
|
48 |
1 |
p. 832-836
|
artikel
|
| 90 |
Low-temperature firing and microwave dielectric properties of MgNb2-xVx/2O6-1.25x ceramics
|
Wang, Shun
|
|
|
48 |
1 |
p. 199-204
|
artikel
|
| 91 |
Macrostructural design of highly porous SiOC ceramic foams by preceramic polymer viscosity tailoring
|
Li, Quan
|
|
|
48 |
1 |
p. 224-231
|
artikel
|
| 92 |
Manganese dioxide/cobalt tungstate/ nitrogen-doped carbon nano-onions nanocomposite as new supercapacitor electrode
|
Sohouli, Esmail
|
|
|
48 |
1 |
p. 295-303
|
artikel
|
| 93 |
Manufacture of carbon-bonded alumina based on a lactose-tannin binder system via slip casting
|
Wu, Xian
|
|
|
48 |
1 |
p. 148-156
|
artikel
|
| 94 |
Mathematical law of size effect on the flexural property of ceramics
|
Yu, Hui
|
|
|
48 |
1 |
p. 769-775
|
artikel
|
| 95 |
Mechanical properties and wear behavior of Al5083 matrix composites reinforced with high amounts of SiC particles fabricated by combined stir casting and squeeze casting; A comparative study
|
Alizadeh, Ali
|
|
|
48 |
1 |
p. 179-189
|
artikel
|
| 96 |
Micromechanical and microstructure characterization of BaO-Sm2O3–5TiO2 ceramic with addition of Al2O3
|
Liu, Ming
|
|
|
48 |
1 |
p. 992-1005
|
artikel
|
| 97 |
Microstructure and high-temperature mechanical properties of co-continuous (Ti3AlC2+ Al3Ti)/2024Al composite fabricated by pressureless infiltration
|
Wang, Hongjie
|
|
|
48 |
1 |
p. 1230-1237
|
artikel
|
| 98 |
Mixed phase FeTe: Fe2TeO5 nanopebbles through solution chemistry: Electrochemical supercapacitor application
|
Bommineedi, Lakshmana Kumar
|
|
|
48 |
1 |
p. 137-147
|
artikel
|
| 99 |
Molten-salt synthesis of luminescent zirconia nanocrystals
|
Zhang, Qiang
|
|
|
48 |
1 |
p. 1423-1428
|
artikel
|
| 100 |
Nano TiC-Graphene-Cu composites fabrication by a modified ball-milling method followed by reactive sintering: Effects of reinforcements content on microstructure, consolidation, and mechanical properties
|
Akbarpour, M.R.
|
|
|
48 |
1 |
p. 130-136
|
artikel
|
| 101 |
Near infrared emitting Cr3+ doped Zn3Ga2Ge2O10 long persistent phosphor for night vision surveillance and anti-counterfeit applications
|
Das, Sourav
|
|
|
48 |
1 |
p. 824-831
|
artikel
|
| 102 |
Novel and green synthesis of BiVO4 and GO/BiVO4 photocatalysts for efficient dyes degradation under blue LED illumination
|
Moral-Rodríguez, A.I.
|
|
|
48 |
1 |
p. 1264-1276
|
artikel
|
| 103 |
Novel rhombus-shaped cerium oxide sheets as a highly durable methanol oxidation electrocatalyst and high-performance supercapacitor electrode material
|
Talluri, Bhusankar
|
|
|
48 |
1 |
p. 164-172
|
artikel
|
| 104 |
Novel synthesis of ZrO2-SiCw-C insert ring materials for slide plates
|
Su, Kai
|
|
|
48 |
1 |
p. 694-701
|
artikel
|
| 105 |
Occurrence forms of major impurity elements in silicon carbide
|
Feng, Dong
|
|
|
48 |
1 |
p. 205-211
|
artikel
|
| 106 |
Optical and structural properties of ZnO NPs and ZnO–Bi2O3 nanocomposites
|
Dhahri, Imen
|
|
|
48 |
1 |
p. 266-277
|
artikel
|
| 107 |
Optical properties and radiation stability of SiO2/ZnO composite pigment prepared by co-sintering method
|
Chen, Junge
|
|
|
48 |
1 |
p. 754-759
|
artikel
|
| 108 |
Optimization of TiO2 paste concentration employed as electron transport layers in fully ambient air processed perovskite solar cells with a low-cost architecture
|
Noori, Laya
|
|
|
48 |
1 |
p. 320-336
|
artikel
|
| 109 |
Organic-inorganic composites for novel optical transformation induced by high-energy laser ablation
|
Wang, Aoao
|
|
|
48 |
1 |
p. 508-513
|
artikel
|
| 110 |
Performance of geopolymer foams of blast furnace slag covered with poly(lactic acid) for wastewater treatment
|
Humberto Tommasini Vieira Ramos, Flávio James
|
|
|
48 |
1 |
p. 732-743
|
artikel
|
| 111 |
Polyaniline-based networks combined with Fe3O4 hollow spheres and carbon balls for excellent electromagnetic wave absorption
|
Shu, Xiangfeng
|
|
|
48 |
1 |
p. 811-823
|
artikel
|
| 112 |
Predictive modelling for contact angle of liquid metals and oxide ceramics by comparing Gaussian process regression with other machine learning methods
|
Jiang, Dewen
|
|
|
48 |
1 |
p. 665-673
|
artikel
|
| 113 |
Preparation and elastic–plastic indentation response of MgAlON transparent ceramics
|
Zhang, Wei
|
|
|
48 |
1 |
p. 855-863
|
artikel
|
| 114 |
Preparation and electrochemical properties of Li4Ti5O12/Si3N4 composites as anode materials for high-performance lithium-ion batteries
|
Wang, Yangyang
|
|
|
48 |
1 |
p. 1006-1012
|
artikel
|
| 115 |
Preparation and morphological investigation on bioactive ion-modified carbonated hydroxyapatite-biopolymer composite ceramics as coatings for orthopaedic implants
|
Furko, Monika
|
|
|
48 |
1 |
p. 760-768
|
artikel
|
| 116 |
Preparation of carbon fiber/Mg-doped nano-hydroxyapatite composites under low temperature by pressureless sintering
|
Zhao, Xueni
|
|
|
48 |
1 |
p. 674-683
|
artikel
|
| 117 |
Pressureless sintering of HfB2-based ceramics as control rod materials: Synergistic effects of the sintering additive and solid solution
|
Xue, Jia-Xiang
|
|
|
48 |
1 |
p. 1191-1196
|
artikel
|
| 118 |
Production of smart nanocomposite for glass coating toward photochromic and long-persistent photoluminescent smart windows
|
Al-Qahtani, Salhah D.
|
|
|
48 |
1 |
p. 903-912
|
artikel
|
| 119 |
Radiative properties of ‘Eu’in Li–Al–Si–O ceramics: Effect of ‘Si’ to ‘Li’ ratio
|
Mohapatra, M.
|
|
|
48 |
1 |
p. 278-284
|
artikel
|
| 120 |
Rapid manufacturing of silica glass parts with complex structures through stereolithography and pressureless spark plasma sintering
|
Cai, Peng
|
|
|
48 |
1 |
p. 55-63
|
artikel
|
| 121 |
Rapid synthesis of eggshell derived hydroxyapatite with nanoscale characteristics for biomedical applications
|
Muthu, D.
|
|
|
48 |
1 |
p. 1326-1339
|
artikel
|
| 122 |
Retraction notice to “Synthesis of CuCo2S4–Pd dumbbell shaped nanocrystals for enhanced photothermal effects for improved DOX delivery and cervical cancer treatment” [Ceram. Int. 48(1) (2022) 337–345]
|
Yan, Xiaoli
|
|
|
48 |
1 |
p. 337-345
|
artikel
|
| 123 |
Spinel nickel cobaltite nanoflakes anchored multiwalled carbon nanotubes driven photocatalyst for highly efficient degradation of organic pollutants using natural sunlight irradiation
|
Imranullah, M.
|
|
|
48 |
1 |
p. 313-319
|
artikel
|
| 124 |
Spray-deposited kesterite Cu2ZnSnS4 (CZTS): Optical, structural, and electrical investigations for solar cell applications
|
Deokate, R.J.
|
|
|
48 |
1 |
p. 795-802
|
artikel
|
| 125 |
Stable solid oxide electrolysis cells with SSF-based symmetrical electrode for direct high-temperature steam electrolysis
|
Ling, Yihan
|
|
|
48 |
1 |
p. 981-991
|
artikel
|
| 126 |
Steel/refractory/slag interfacial reaction and its effect on inclusions in high-Mn high-Al steel
|
Wang, Lanqing
|
|
|
48 |
1 |
p. 1090-1097
|
artikel
|
| 127 |
Structural, magnetic, and electrical evaluations of rare earth Gd3+ doped in mixed Co–Mn spinel ferrite nanoparticles
|
Yousaf, Muhammad
|
|
|
48 |
1 |
p. 578-586
|
artikel
|
| 128 |
Structure and mechanical properties of hot-pressed B4C-NdB6 composites
|
Li, Huaiqian
|
|
|
48 |
1 |
p. 285-294
|
artikel
|
| 129 |
Structure and optical properties of ZrxHf1-xO2 films deposited by pulsed laser co-ablation of Zr and Hf targets with the assistance of oxygen plasma
|
Yao, Chujun
|
|
|
48 |
1 |
p. 587-596
|
artikel
|
| 130 |
Structure and properties of ta-C films prepared by vacuum cathodic arc with an unbalanced external electromagnetic field
|
Feng, Ke-Jie
|
|
|
48 |
1 |
p. 111-119
|
artikel
|
| 131 |
Structure, magnetic properties and microwave absorption properties of NdFe1-xNixO3
|
Tong, Zhao Fei
|
|
|
48 |
1 |
p. 702-710
|
artikel
|
| 132 |
Structure, up-conversion luminescence and optical temperature sensitive properties of glass ceramics containing Ca5(PO4)3F with double luminescence centers
|
Xing, Junhao
|
|
|
48 |
1 |
p. 1098-1106
|
artikel
|
| 133 |
Surface hydroxylation of TiO2/g-C3N4 photocatalyst for photo-Fenton degradation of tetracycline
|
Li, Yanhong
|
|
|
48 |
1 |
p. 1306-1313
|
artikel
|
| 134 |
Synergistic effect of surface textures and DLC coatings for enhancing friction and wear performances of Si3N4/TiC ceramic
|
Xing, Youqiang
|
|
|
48 |
1 |
p. 514-524
|
artikel
|
| 135 |
Synthesis and characterization of Ca3-xLaxCo4-yCuyO9+δ cathodes for intermediate temperature solid oxide fuel cells
|
Padmasree, K.P.
|
|
|
48 |
1 |
p. 455-462
|
artikel
|
| 136 |
Synthesis and electrochemical analysis of Sn2Fe-TiOx-C composite as a high-performance anode material for Li-ion batteries
|
Baek, Maga
|
|
|
48 |
1 |
p. 597-603
|
artikel
|
| 137 |
Synthesis and magneto-optical studies of novel Ni0.5Zn0.5Fe2O4/ Zn0.95Co0.05O nanocomposite as a candidate for photocatalytic applications
|
Chehade, W.
|
|
|
48 |
1 |
p. 1238-1255
|
artikel
|
| 138 |
Synthesis and multiferroic properties of particulate composites resulting from combined size effects of the magnetic and ferroelectric phases
|
Viana, Diego Seiti Fukano
|
|
|
48 |
1 |
p. 931-940
|
artikel
|
| 139 |
Synthesis and photoluminescence properties of a novel double perovskite Ca2LaSbO6:Sm3+ phosphor for w-LEDs
|
Han, Bingjie
|
|
|
48 |
1 |
p. 971-980
|
artikel
|
| 140 |
Synthesis of low temperature firing scheelite-type BaWO4 microwave dielectric ceramics with high performances
|
Gui, Ling
|
|
|
48 |
1 |
p. 1360-1365
|
artikel
|
| 141 |
Tensile and stressed-oxidation behavior of 2D SiC/BN/SiC composites at Intermediate Temperatures in Air
|
Han, Xiao
|
|
|
48 |
1 |
p. 1-9
|
artikel
|
| 142 |
Tensile damage evolution of 2D SiC(f)/BN(i)/(SiC-B4C)(m) composites based on acoustic emission pattern recognition
|
Zhang, Yongzhen
|
|
|
48 |
1 |
p. 64-73
|
artikel
|
| 143 |
Ternary type BaY2ZnO5: Eu3+ deep-red phosphor for possible latent fingerprint, security ink and WLED applications
|
Rajkumar, G.
|
|
|
48 |
1 |
p. 10-21
|
artikel
|
| 144 |
The effect of in-situ formed layered hBN on the machinability and mechanical properties of SPS sintered SiC
|
Yılmaz, Zuhal
|
|
|
48 |
1 |
p. 1047-1056
|
artikel
|
| 145 |
The effect of residual stresses and dislocations on microwave dielectric loss in rutile-related (Ti0.6Zr0.4)0.8(Zn1/3Nb2/3)0.2O2
|
Qiao, Jianli
|
|
|
48 |
1 |
p. 239-247
|
artikel
|
| 146 |
The effects of the addition of tetragonal-ZrO2 on the mechanical properties of MgAl2O4 – ZrO2 composites
|
Marais, Francois
|
|
|
48 |
1 |
p. 563-568
|
artikel
|
| 147 |
The ‘metallic ware’ from Tell el Far'ah North (West Bank): Petrography, technology, and provenance of a hidden ceramic industry
|
Botticelli, Michela
|
|
|
48 |
1 |
p. 1366-1374
|
artikel
|
| 148 |
Thermal barrier coatings with high-entropy oxide as a top coat
|
Zhang, Dongbo
|
|
|
48 |
1 |
p. 1349-1359
|
artikel
|
| 149 |
Thermal expansion of the nanocrystalline titanium diboride
|
Kovalev, D.Yu
|
|
|
48 |
1 |
p. 872-878
|
artikel
|
| 150 |
Thermally conductive hexagonal boron nitride/spherical aluminum oxide hybrid composites fabricated with epoxyorganosiloxane
|
Lim, Gayoung
|
|
|
48 |
1 |
p. 1408-1414
|
artikel
|
| 151 |
Thermoelectric properties of different polymorphs of gallium phosphide; A first-principles study
|
Ul Haq, Bakhtiar
|
|
|
48 |
1 |
p. 642-647
|
artikel
|
| 152 |
Three-dimensional printing of high-flux ceramic membranes with an asymmetric structure via digital light processing
|
Chen, Ting
|
|
|
48 |
1 |
p. 304-312
|
artikel
|
| 153 |
Transparent heavily Eu3+-doped boroaluminate glass for X-ray detection
|
Chen, SunYueZi
|
|
|
48 |
1 |
p. 947-952
|
artikel
|
| 154 |
Tribological behaviors of polycrystalline cubic boron nitride sliding against silicon nitride in air and vacuum conditions
|
Cui, Jinmeng
|
|
|
48 |
1 |
p. 363-372
|
artikel
|
| 155 |
Tunable photoluminescence properties of Dy3+ doped LLZO phosphors for WLED and dosimetry applications
|
Kumar K, Ganesh
|
|
|
48 |
1 |
p. 1402-1407
|
artikel
|
| 156 |
Ultra-low dielectric loss lithium-based, temperature stable microwave dielectric ceramics
|
Wang, Dong
|
|
|
48 |
1 |
p. 1394-1401
|
artikel
|
| 157 |
Use of colemanite and borax penta-hydrate in soda lime silicate glass melting - A strategy to reduce energy consumption and improve glass properties
|
Khan, Sultan
|
|
|
48 |
1 |
p. 1181-1190
|
artikel
|
| 158 |
UV laser sterilization of Bacillus atrophaeus spores on ceramic tiles
|
Jang, Hanbyeol
|
|
|
48 |
1 |
p. 1446-1450
|
artikel
|
| 159 |
Wetting of YSZ by molten Sn–8Zr, Sn–4Zr–4Ti, and Sn–8Ti alloys at 800–900 °C
|
Lin, Qiaoli
|
|
|
48 |
1 |
p. 373-380
|
artikel
|
Tijdschrift beschrijving