| nr |
titel |
auteur |
tijdschrift |
jaar |
jaarg. |
afl. |
pagina('s) |
type |
| 1 |
Achieving high energy-storage properties in Bi0.5Na0.5TiO3-based lead-free ceramics under low electric fields
|
Wang, Hua
|
|
|
47 |
1 |
p. 1344-1352
|
artikel
|
| 2 |
A comprehensive study on copper incorporated bio-glass matrix for its potential antimicrobial applications
|
Akhtach, Sihame
|
|
|
47 |
1 |
p. 424-433
|
artikel
|
| 3 |
Aerosol deposited BaTiO3 film based interdigital capacitor and squared spiral capacitor for humidity sensing application
|
Kumar, Alok
|
|
|
47 |
1 |
p. 510-520
|
artikel
|
| 4 |
Al2O3-10 wt% Fe composite prepared by high energy ball milling: Structure and magnetic properties
|
Raimundo, Rafael A.
|
|
|
47 |
1 |
p. 984-991
|
artikel
|
| 5 |
A method for identifying the interface shear stress of unidirectional ceramic matrix composites
|
Han, Xiao
|
|
|
47 |
1 |
p. 64-72
|
artikel
|
| 6 |
Analysis of cutting responses of Sialon ceramic tools in high-speed milling of FGH96 superalloys
|
Ming, Weiwei
|
|
|
47 |
1 |
p. 149-156
|
artikel
|
| 7 |
Anisotropic elastic, thermal properties and electronic structures of M2AlB2 (M=Fe, Cr, and Mn) layer structure ceramics
|
Liu, Y.Z.
|
|
|
47 |
1 |
p. 1421-1428
|
artikel
|
| 8 |
Anisotropic growth and magnetic properties of nickel–zinc ferrite thin film by spin spray deposition
|
Liu, Hai
|
|
|
47 |
1 |
p. 1318-1324
|
artikel
|
| 9 |
Annihilation behavior of irradiation defects induced by γ-ray in biphasic tritium breeding materials xLi2TiO3-(1-x) Li4SiO4
|
Qi, Qiang
|
|
|
47 |
1 |
p. 434-438
|
artikel
|
| 10 |
A novel and flexible processing for hot embossing of glass microfluidic channels
|
Jiang, Kai
|
|
|
47 |
1 |
p. 1447-1455
|
artikel
|
| 11 |
A novel graphene-like titanium carbide MXene/Au–Ag nanoshuttles bifunctional nanosensor for electrochemical and SERS intelligent analysis of ultra-trace carbendazim coupled with machine learning
|
Zhu, Xiaoyu
|
|
|
47 |
1 |
p. 173-184
|
artikel
|
| 12 |
A novel IR-transparent Ho3+:Y2O3–MgO nanocomposite ceramics for potential laser applications
|
Safronova, N.A.
|
|
|
47 |
1 |
p. 1399-1406
|
artikel
|
| 13 |
A novel single-phase Na3.6Y1.8(PO4)3:Bi3+,Eu3+ phosphor for tunable and white light emission
|
Zhang, WenNa
|
|
|
47 |
1 |
p. 284-291
|
artikel
|
| 14 |
A novel temperature-dependent hardness model for high-temperature structural ceramics
|
Wang, Ruzhuan
|
|
|
47 |
1 |
p. 1462-1465
|
artikel
|
| 15 |
A novel ZrB2-based composite manufactured with Ti3AlC2 additive
|
Shahedi Asl, Mehdi
|
|
|
47 |
1 |
p. 817-827
|
artikel
|
| 16 |
Application of a negative thermal expansion oxide in SOFC cathode
|
Lu, Fei
|
|
|
47 |
1 |
p. 1095-1100
|
artikel
|
| 17 |
A review of phosphorescent and fluorescent phosphors for fingerprint detection
|
Chávez, D.
|
|
|
47 |
1 |
p. 10-41
|
artikel
|
| 18 |
Bearing behaviors and failure mechanisms of 2D C/SiC plate with an open hole
|
Li, Xuqin
|
|
|
47 |
1 |
p. 1407-1413
|
artikel
|
| 19 |
CaO doped ZnO–Bi2O3 varistors: Grain growth mechanism, structure and electrical properties
|
Hembram, K.
|
|
|
47 |
1 |
p. 1229-1237
|
artikel
|
| 20 |
Cellulose-reinforced bioglass composite as flexible bioactive bandage to enhance bone healing
|
Mansoorianfar, Mojtaba
|
|
|
47 |
1 |
p. 416-423
|
artikel
|
| 21 |
Characterization and corrosion behavior of plasma sprayed calcium silicate reinforced hydroxyapatite composite coatings for medical implant applications
|
Singh, Jarnail
|
|
|
47 |
1 |
p. 782-792
|
artikel
|
| 22 |
Characterization of precipitates formed in X7R 0603 BME-MLCC during sintering
|
Hernández, Víctor I.
|
|
|
47 |
1 |
p. 310-319
|
artikel
|
| 23 |
Characterization of the structure and properties of processed alumina-graphene and alumina-zirconia composites
|
Duntu, Solomon Hanson
|
|
|
47 |
1 |
p. 367-380
|
artikel
|
| 24 |
Colossal dielectric response and relaxation behavior in novel system of Zr4+ and Nb5+ co-substituted CaCu3Ti4O12 ceramics
|
Mao, Pu
|
|
|
47 |
1 |
p. 111-120
|
artikel
|
| 25 |
Construction of pseudocapacitive Li2-xLaxZnTi3O8 anode for fast and super-stable lithium storage
|
Zhang, Zhongxue
|
|
|
47 |
1 |
p. 662-669
|
artikel
|
| 26 |
Construction of visible light driven CuBi2O4/ Bi2WO6 solid solutions anchored with Bi12O17ClxBr2−x nanoparticles for improved photocatalytic activity
|
Tahir, Muhammad Bilal
|
|
|
47 |
1 |
p. 320-328
|
artikel
|
| 27 |
Covalently functionalized graphene by thiourea for enhancing H2-evolution performance of TiO2 photocatalyst
|
Cao, Yanjie
|
|
|
47 |
1 |
p. 654-661
|
artikel
|
| 28 |
Crystal structure, polarization properties and reverse nonlinearity of solid solutions of the KNN-PZT system in a wide range of external influences
|
Andryushin, K.P.
|
|
|
47 |
1 |
p. 138-148
|
artikel
|
| 29 |
Cyclic thermal shock resistance of h-BN composite ceramics with La2O3–Al2O3–SiO2 addition
|
Qiu, Baofu
|
|
|
47 |
1 |
p. 73-79
|
artikel
|
| 30 |
Design and development of Ga-substituted Z-type hexaferrites for microwave absorber applications: Mössbauer, static and dynamic properties
|
Dhruv, Preksha N.
|
|
|
47 |
1 |
p. 1145-1162
|
artikel
|
| 31 |
Development of bioglass coating reinforced with hydroxyapatite whiskers on TiO2 nanotubes via electrophoretic deposition
|
Khanmohammadi, Shirin
|
|
|
47 |
1 |
p. 1333-1343
|
artikel
|
| 32 |
3D nanofibrous bioactive glass scaffolds produced by one-step spinning process
|
Medeiros, Eudes L.G.
|
|
|
47 |
1 |
p. 102-110
|
artikel
|
| 33 |
Effect of direct–current biasing on the adjustable radio-frequency negative permittivity characteristics of Bi2SiO5/multiwall carbon nanotube metacomposites
|
Haldar, Toton
|
|
|
47 |
1 |
p. 1389-1398
|
artikel
|
| 34 |
Effect of high energy milling on microstructure and mechanical properties of Al2O3-10 wt% Co composites consolidated by spark plasma sintering (SPS)
|
Raimundo, Rafael A.
|
|
|
47 |
1 |
p. 677-685
|
artikel
|
| 35 |
Effect of nitriding atmosphere on the morphology of AlN nanofibers from solution blow spinning
|
Li, Wei
|
|
|
47 |
1 |
p. 706-715
|
artikel
|
| 36 |
Effect of process conditions on spray dried calcium carbonate powders for thermal spraying
|
Chahal, H.K.
|
|
|
47 |
1 |
p. 351-360
|
artikel
|
| 37 |
Effect of suspension characteristics on the performance of thermal barrier coatings deposited by suspension plasma spray
|
Ganvir, Ashish
|
|
|
47 |
1 |
p. 272-283
|
artikel
|
| 38 |
Effect of Zn(OH)2 on properties of corundum based castables bonded with calcium aluminate cement
|
Li, Ye
|
|
|
47 |
1 |
p. 57-63
|
artikel
|
| 39 |
Effect of ZrO2 on the physicochemical properties and biological properties of β-SiAlON–ZrO2 composite ceramics
|
Zhang, Liguo
|
|
|
47 |
1 |
p. 1244-1252
|
artikel
|
| 40 |
Effects of dopants on the reliability of low temperature sintered Li2ZnTi3O8 ceramics
|
Zhu, Jianhua
|
|
|
47 |
1 |
p. 238-242
|
artikel
|
| 41 |
Effects of heat treatment on microstructure and mechanical properties of TiC/TiB composite bioinert ceramic coatings in-situ synthesized by laser cladding on Ti6Al4V
|
Chen, Tao
|
|
|
47 |
1 |
p. 755-768
|
artikel
|
| 42 |
Electrical and magnetic properties of double perovskite: Y2CoMnO6
|
Das, Rutuparna
|
|
|
47 |
1 |
p. 439-448
|
artikel
|
| 43 |
Electromagnetic shielding and thermal conductive properties of SiC nanowires reinforced C/(PyC-SiC)n composites
|
Tian, Xinfa
|
|
|
47 |
1 |
p. 590-597
|
artikel
|
| 44 |
Energy storage and dielectric properties of a novel Bi1.5MgNb1.5O7-Bi2Mg2/3Nb4/3O7 thin film
|
Yu, Shihui
|
|
|
47 |
1 |
p. 1238-1243
|
artikel
|
| 45 |
Energy transfer and luminescence study of Dy3+ doped zinc-aluminoborosilicate glasses for white light emission
|
Monisha, M.
|
|
|
47 |
1 |
p. 598-610
|
artikel
|
| 46 |
Enhanced electrocaloric effect in the Sm and Hf co-doped BaTiO3 ceramics
|
Zhang, Boyang
|
|
|
47 |
1 |
p. 1101-1108
|
artikel
|
| 47 |
Enhanced thermoelectric performance of p-type sintered BiSbTe-based composites with AgSbTe2 addition
|
Tan, Chang
|
|
|
47 |
1 |
p. 725-731
|
artikel
|
| 48 |
Enhancing electrochemical performance and structural stability of LiNi0.5Mn1.5O4 cathode material for rechargeable lithium-ion batteries by boron doping
|
Wei, Aijia
|
|
|
47 |
1 |
p. 226-237
|
artikel
|
| 49 |
Estimating the density and molar volume of ferrite-based ternary molten slags by geometrical model
|
Yu, Zhigang
|
|
|
47 |
1 |
p. 634-642
|
artikel
|
| 50 |
Evolutionary mechanism of YBO3 whisker and its effect on the properties of YIG ferrite joint brazed by Bi2O3–B2O3–SiO2–ZnO glass
|
Xu, Jiujie
|
|
|
47 |
1 |
p. 973-983
|
artikel
|
| 51 |
Exploration on sulfur/acid treatment of sepiolite composite positive electrode material for lithium-sulfur battery
|
Kalaiselvi, C.
|
|
|
47 |
1 |
p. 692-699
|
artikel
|
| 52 |
Fabrication and properties of pressure-sintered reaction-bonded Si3N4 ceramics with addition of Eu2O3–MgO–Y2O3
|
Wu, Li-Xiang
|
|
|
47 |
1 |
p. 935-942
|
artikel
|
| 53 |
Fabrication and wear property of in-situ micro-nano dual-scale vanadium carbide ceramics strengthened wear-resistant composite layers
|
Xu, Liujie
|
|
|
47 |
1 |
p. 953-964
|
artikel
|
| 54 |
Fabrication of binary transition metal hydroxides and their nanocomposite with CNTs for electrochemical capacitor applications
|
Shakir, Imran
|
|
|
47 |
1 |
p. 1191-1198
|
artikel
|
| 55 |
Facile fabrication of SiO2 nanotubes coated with nitrogen-doped carbon layers as high-performance anodes for lithium-ion batteries
|
Zhang, Xi
|
|
|
47 |
1 |
p. 1373-1380
|
artikel
|
| 56 |
Facile synthesis of Ag/Zn1-xCuxO nanoparticle compound photocatalyst for high-efficiency photocatalytic degradation: Insights into the synergies and antagonisms between Cu and Ag
|
Luo, Kaiyi
|
|
|
47 |
1 |
p. 48-56
|
artikel
|
| 57 |
Facile synthesis of cobalt nanoparticles embedded in a rod-like porous carbon matrix with excellent electromagnetic wave absorption performance
|
Wang, Xiaokang
|
|
|
47 |
1 |
p. 643-653
|
artikel
|
| 58 |
Fe-doped SiCN composite fibers for electromagnetic waves absorption
|
Guo, Xue
|
|
|
47 |
1 |
p. 1184-1190
|
artikel
|
| 59 |
Flexible LiZnTiMn ferrite/PDMS composites with enhanced magnetic-dielectric properties for miniaturized application
|
Xie, Fei
|
|
|
47 |
1 |
p. 1121-1125
|
artikel
|
| 60 |
Geometrical polarization approach: A semi-empirical tool to estimate the intrinsic polarization of polar dielectrics
|
Freitas, V.F.
|
|
|
47 |
1 |
p. 943-952
|
artikel
|
| 61 |
Ge-Se-Sb-Ag chalcogenide glasses for nuclear radiation shielding applications
|
Kebaili, Imen
|
|
|
47 |
1 |
p. 1303-1309
|
artikel
|
| 62 |
Graphene nanoplatelets/Cr2O3 nanocomposites as novel nanoantibiotics: Towards control of multiple drug resistant bacteria
|
Talat, Irum
|
|
|
47 |
1 |
p. 889-898
|
artikel
|
| 63 |
Hierarchical MnO2@NiCo2O4@Ti3SiC2/carbon cloth core-shell structure with superior electrochemical performance for all solid-state supercapacitors
|
Yan, Weikang
|
|
|
47 |
1 |
p. 292-300
|
artikel
|
| 64 |
High energy transfer in Dy3+ /Sm3+co-doped transparent borosilicate glass-ceramics containing novel Na5Y9F32 nanocrystals for w-LEDs applications
|
Chen, Chao
|
|
|
47 |
1 |
p. 1-9
|
artikel
|
| 65 |
Highly (h00)-oriented KNN homo-multilayer films grown on Si by sol-gel process via an alternating non-alkoxide and alkoxide route
|
Zhang, Wei
|
|
|
47 |
1 |
p. 87-93
|
artikel
|
| 66 |
High-rate lithium storage of TiNb2O7/reduced graphene oxide
|
Niu, Ben
|
|
|
47 |
1 |
p. 1177-1183
|
artikel
|
| 67 |
High sphericity and diameter controllable B4C ceramic pellets prepared via simple low-cost PVA assisted planet-type rotation method
|
Ye, Diyin
|
|
|
47 |
1 |
p. 836-841
|
artikel
|
| 68 |
High thermal stability and color purity of red-emitting phosphor Y2SiWO8: Eu3+ for w-LEDs: Synthesis and photoluminescence properties
|
Wang, Shengjia
|
|
|
47 |
1 |
p. 1063-1075
|
artikel
|
| 69 |
Hydrothermal synthesis of V2O5 nanospheres as catalyst for hydrogen sulfide removal from sour water
|
Sahraeian, Neda
|
|
|
47 |
1 |
p. 923-934
|
artikel
|
| 70 |
Improved electrochemical activity of Bi0.5Sr0.5FeO3-δ –Ce0.9Gd0.1O1.95composite cathode electrocatalyst for solid oxide fuel cells
|
Gao, Juntao
|
|
|
47 |
1 |
p. 748-754
|
artikel
|
| 71 |
Improved electrochemical performance of Bi doped La0.8Sr0.2FeO3-δ nanofiber cathode for IT-SOFCs via electrospinning
|
Zhang, Xiaojiao
|
|
|
47 |
1 |
p. 534-540
|
artikel
|
| 72 |
Influence of Bi2O3 concentration on barium-telluro-borate glasses: Physical, structural and radiation-shielding properties
|
Naseer, K.A.
|
|
|
47 |
1 |
p. 329-340
|
artikel
|
| 73 |
Influence of exposure energy and heat treatment conditions on through-glass via metallization of photoetchable glass interposers
|
Liang, Tianpeng
|
|
|
47 |
1 |
p. 1277-1283
|
artikel
|
| 74 |
Influence of lithium difluorophosphate additive on the high voltage LiNi0.8Co0.1Mn0.1O2/graphite battery
|
Yu, Ziyang
|
|
|
47 |
1 |
p. 157-162
|
artikel
|
| 75 |
Influence of modified multi-walled carbon nanotubes on the mechanical behavior and toughening mechanism of an environmentally friendly granulated blast furnace slag-based geopolymer matrix
|
Li, Faping
|
|
|
47 |
1 |
p. 907-922
|
artikel
|
| 76 |
Influence of the forming method on flash sintering of ZnO ceramics
|
Storion, Ana Gabriela
|
|
|
47 |
1 |
p. 965-972
|
artikel
|
| 77 |
Influences of deposition temperature, gas flow rate and ZrC content on the microstructure and anti-ablation performance of CVD-HfC-ZrC coating
|
Ren, Jincui
|
|
|
47 |
1 |
p. 556-566
|
artikel
|
| 78 |
Infrared radiative performance and anti-ablation behaviour of Sm2O3 modified ZrB2/SiC coatings
|
Xu, Junjie
|
|
|
47 |
1 |
p. 400-408
|
artikel
|
| 79 |
Inhibiting tribocorrosion damage of Cr/CrxN coatings by multi-layer design
|
Wang, Yixuan
|
|
|
47 |
1 |
p. 842-850
|
artikel
|
| 80 |
In situ growth of boron doped g-C3N4 on carbon fiber cloth as a recycled flexible film-photocatalyst
|
Lei, Lin
|
|
|
47 |
1 |
p. 1258-1267
|
artikel
|
| 81 |
Interface excess on Sb-doped TiO2 photocatalysts and its influence on photocatalytic activity
|
Gandelman, Henry
|
|
|
47 |
1 |
p. 619-625
|
artikel
|
| 82 |
Interfacial microstructure and mechanical properties of Ti3SiC2 ceramic and TC11 alloy joint diffusion bonded with a Cu interlayer
|
Niu, S.Y.
|
|
|
47 |
1 |
p. 130-137
|
artikel
|
| 83 |
Investigation on 3D printing ZrO2 implant abutment and its fatigue performance simulation
|
Zhao, Yongtao
|
|
|
47 |
1 |
p. 1053-1062
|
artikel
|
| 84 |
Large-scale synthesis of SiC/PyC core-shell structure nanowires via chemical liquid-vapor deposition
|
He, Qinchuan
|
|
|
47 |
1 |
p. 500-509
|
artikel
|
| 85 |
Large strain with enhanced energy-storage and temperature stable dielectric properties in Bi0.38Na0.38Sr0.24Ti(1-x)(Mn1/3Nb2/3) x O3 ceramics
|
Li, Mengyuan
|
|
|
47 |
1 |
p. 1325-1332
|
artikel
|
| 86 |
Lithium ion batteries with enhanced electrochemical performance by using carbon-coated SiOx/Ag composites as anode material
|
Ouyang, Puhua
|
|
|
47 |
1 |
p. 1086-1094
|
artikel
|
| 87 |
Load effect on the mechanical behaviour of zirconia-reinforced lithium silicate glass ceramics
|
Alao, Abdur-Rasheed
|
|
|
47 |
1 |
p. 1353-1363
|
artikel
|
| 88 |
Low-cost and high-performance 3D printed YBCO superconductors
|
Mendes, Diogo
|
|
|
47 |
1 |
p. 381-387
|
artikel
|
| 89 |
Luminescence and optical thermometry strategy based on emission and excitation spectra of Pr3+ doped SrMoO4 phosphors
|
Li, Li
|
|
|
47 |
1 |
p. 769-775
|
artikel
|
| 90 |
Magnetoresistance, magnetothermopower, magnetothermal conductivity and magnetostriction in La1-x Na x MnO3 ( 0 ≤ x ≤ 0.05 )
|
Das, Rajasree
|
|
|
47 |
1 |
p. 393-399
|
artikel
|
| 91 |
Manufacturing of a ceramic groove part based on additive and subtractive technologies
|
Wang, Xinfeng
|
|
|
47 |
1 |
p. 740-747
|
artikel
|
| 92 |
Mechanical properties and thermal shock in thin ZrO2–Y2O3–Al2O3 films obtained by the sol-gel method
|
Díaz-Parralejo, Antonio
|
|
|
47 |
1 |
p. 80-86
|
artikel
|
| 93 |
Mechanical properties and translucency of a multi-layered zirconia with color gradient for dental applications
|
Alves, Manuel F.R.P.
|
|
|
47 |
1 |
p. 301-309
|
artikel
|
| 94 |
Micromachining porous alumina ceramic for high quality trimming of turbine blade cores via double femtosecond laser scanning
|
Min, Chaoqing
|
|
|
47 |
1 |
p. 461-469
|
artikel
|
| 95 |
Microstructural design of cellular 3 YTZ-Al2O3 ceramic membranes
|
Ivanova, Yu A.
|
|
|
47 |
1 |
p. 1040-1046
|
artikel
|
| 96 |
Microstructural evolution of TiB2–SiC composites empowered with Si3N4, BN or TiN: A comparative study
|
Nguyen, Van-Huy
|
|
|
47 |
1 |
p. 1002-1011
|
artikel
|
| 97 |
Microstructural transformation of stainless steel slag-based CAMS glass ceramics prepared by SPS
|
Liu, Saiyu
|
|
|
47 |
1 |
p. 1284-1293
|
artikel
|
| 98 |
Microstructure and properties of in-situ composite coatings prepared by plasma spraying MoO3–Al composite powders
|
Wang, Yan-wei
|
|
|
47 |
1 |
p. 1109-1120
|
artikel
|
| 99 |
Microstructure and properties of monolayer, bilayer and multilayer Ta2O5-based coatings on biomedical Ti-6Al-4V alloy by magnetron sputtering
|
Ding, Zeliang
|
|
|
47 |
1 |
p. 1133-1144
|
artikel
|
| 100 |
Microstructure evolution and reaction mechanism of Pb(Zr1/2Ti1/2)O3-Pb(Zn1/3Nb2/3)O3–Pb(Ni1/3Nb2/3)O3 piezoelectric ceramics with plate-like PbTiO3 template
|
Li, Leilei
|
|
|
47 |
1 |
p. 470-478
|
artikel
|
| 101 |
Microstructure induced ultra-high energy storage density coupled with rapid discharge properties in lead-free Ba0.9Ca0.1Ti0.9Zr0.1O3–SrNb2O6 ceramics
|
Jain, Aditya
|
|
|
47 |
1 |
p. 487-499
|
artikel
|
| 102 |
Microstructure of HVOF-sprayed Ag–BaF2⋅CaF2–Cr3C2–NiCr coating and its tribological behavior in a wide temperature range (25 °C to 800 °C)
|
Su, Weiming
|
|
|
47 |
1 |
p. 865-876
|
artikel
|
| 103 |
Microstructure–property correlation in nano-diamond and TiN added TiC-based ceramics
|
Nguyen, Van-Huy
|
|
|
47 |
1 |
p. 449-460
|
artikel
|
| 104 |
Microwave absorption properties of polymer-derived SiCN(CNTs) composite ceramics
|
Wang, Shan
|
|
|
47 |
1 |
p. 1294-1302
|
artikel
|
| 105 |
Mn-doped Ruddlesden-Popper oxide La1.5Sr0.5NiO4+δ as a novel air electrode material for solid oxide electrolysis cells
|
Zheng, Yifeng
|
|
|
47 |
1 |
p. 1208-1217
|
artikel
|
| 106 |
MnSe nanoparticles encapsulated into N-doped carbon fibers with a binder-free and free-standing structure for lithium ion batteries
|
Han, Zhengsi
|
|
|
47 |
1 |
p. 1429-1438
|
artikel
|
| 107 |
Modified resistive switching performance by increasing Al concentration in HfO2 on transparent indium tin oxide electrode
|
Mahata, Chandreswar
|
|
|
47 |
1 |
p. 1199-1207
|
artikel
|
| 108 |
Multiphase phosphide cocatalyst for boosting efficient photocatalytic H2 production and enhancing the stability
|
Liu, Song
|
|
|
47 |
1 |
p. 1414-1420
|
artikel
|
| 109 |
Multiphysics phase-field modeling of quasi-static cracking in urania ceramic nuclear fuel
|
Li, Wei
|
|
|
47 |
1 |
p. 793-810
|
artikel
|
| 110 |
NaTaO3 microwave dielectric ceramic a with high relative permittivity and as an excellent compensator for the temperature coefficient of resonant frequency
|
Wang, Kangguo
|
|
|
47 |
1 |
p. 121-129
|
artikel
|
| 111 |
Non-isothermal decomposition kinetics of nano-scale CaCO3 as a function of particle size variation
|
Ray, Saibal
|
|
|
47 |
1 |
p. 858-864
|
artikel
|
| 112 |
Novel design of a Si3N4/BaO–Al2O3–SiO2 coating with a heterogeneous-layer structure on porous Si3N4 ceramic
|
Liu, Zhengdao
|
|
|
47 |
1 |
p. 1456-1461
|
artikel
|
| 113 |
Numerical analysis of a liquid metal cooled mini channel heat sink with five different ceramic substrates
|
Sarowar, Md Tanbir
|
|
|
47 |
1 |
p. 214-225
|
artikel
|
| 114 |
Optimization of room-temperature TCR of polycrystalline La0.9-x Sr x K0.1MnO3 ceramics by Sr adjustment
|
Li, Hongjiang
|
|
|
47 |
1 |
p. 94-101
|
artikel
|
| 115 |
Photoelectrochemical (PEC) etching of Ga2O3
|
Alhalaili, Badriyah
|
|
|
47 |
1 |
p. 479-486
|
artikel
|
| 116 |
Physical, optical and gamma radiation shielding competence of newly boro-tellurite based glasses: TeO2–B2O3–ZnO–Li2O3–Bi2O3
|
Sayyed, M.I.
|
|
|
47 |
1 |
p. 611-618
|
artikel
|
| 117 |
Phytoextract assisted hydrothermal synthesis of ZnO–NiO nanocomposites using neem leaves extract
|
Hessien, Manal
|
|
|
47 |
1 |
p. 811-816
|
artikel
|
| 118 |
Preparation and characterisation of Fe/Fe3O4 fibres based soft magnetic composites
|
Neamţu, B.V.
|
|
|
47 |
1 |
p. 581-589
|
artikel
|
| 119 |
Preparation and properties of a Jauman type microwave absorbing ceramic with carbon felt film
|
Li, Xiangming
|
|
|
47 |
1 |
p. 1381-1388
|
artikel
|
| 120 |
Preparation and properties of the Al2O3–SiO2 aerogel/alumina framework composite
|
Jia, Huijiao
|
|
|
47 |
1 |
p. 1466-1471
|
artikel
|
| 121 |
Preparation of cubic and spherical hollow silica structures by polystyrene-poly diallyldimethylammonium chloride and polystyrene-poly ethyleneimine hard templates
|
Akhondi, Maryam
|
|
|
47 |
1 |
p. 851-857
|
artikel
|
| 122 |
Pyrometallurgically regenerated LiMn2O4 cathode scrap material and its electrochemical properties
|
Liu, Dandan
|
|
|
47 |
1 |
p. 42-47
|
artikel
|
| 123 |
Rare-earth hexaboride 2D nanostructures synthesis and coupling with NaAlH4 for improved hydrogen release
|
Nersisyan, Hayk H.
|
|
|
47 |
1 |
p. 877-888
|
artikel
|
| 124 |
Residual stress and fracture toughness of sintered body of ZrO2-GO composite ceramics material
|
Zhao, Li
|
|
|
47 |
1 |
p. 388-392
|
artikel
|
| 125 |
Resistance to intense electron beam bombardment of TiC/Graphite: Numerical modeling and experimental investigation
|
Chen, Changhua
|
|
|
47 |
1 |
p. 361-366
|
artikel
|
| 126 |
RETRACTED: The synthesis of Bi12GeO20/Ag3PO4 nanowire composite for increased photocatalytic activity and decreased electron/hole recombination
|
Liu, Wenhuan
|
|
|
47 |
1 |
p. 1310-1317
|
artikel
|
| 127 |
Sb-doped SnO2 (ATO) hollow submicron spheres for solar heat insulation coating
|
Wang, Minjia
|
|
|
47 |
1 |
p. 547-555
|
artikel
|
| 128 |
(Sb2O3/Sb2O5)-doped SnO2–Co3O4–Cr2O3 varistors: The Sb2O4 in-situ formation and its influence over the electrical and microstructural properties
|
Miranda-López, Martin I.
|
|
|
47 |
1 |
p. 163-172
|
artikel
|
| 129 |
Significant improvements of the relative density, microhardness, and fracture toughness of SiC via the addition of Ni3Al and Mg2Si
|
Li, Jingkun
|
|
|
47 |
1 |
p. 1472-1477
|
artikel
|
| 130 |
Silver doped glasses from the system BaO/SrO/ZnO/SiO2 – The influence of Sb, Sn, and Ta on the formation of core-shell structures
|
Thieme, Christian
|
|
|
47 |
1 |
p. 1126-1132
|
artikel
|
| 131 |
Space charge layer induced superionic conduction and charge transport behaviour of “alkali carbonates and tri-doped ceria nanocomposites” for LT-SOFCs applications
|
Singh, Monika
|
|
|
47 |
1 |
p. 1218-1228
|
artikel
|
| 132 |
Structural evolution and thermal conductivity of flexible graphite films prepared by carboxylic graphene/polyimide
|
Ma, Lianru
|
|
|
47 |
1 |
p. 1076-1085
|
artikel
|
| 133 |
Structural, magnetic and magneto-transport properties of Bi0.7-xLaxSr0.3MnO3 manganites
|
Souza, Anita D.
|
|
|
47 |
1 |
p. 1021-1033
|
artikel
|
| 134 |
Structure and electronic properties of δ-Bi2O3 tuned by vacancy and doping: A first-principles study
|
Huang, R.Z.
|
|
|
47 |
1 |
p. 205-213
|
artikel
|
| 135 |
Structure and thermoelectric properties of higher manganese silicides synthesized by pack cementation
|
Teknetzi, Aikaterini
|
|
|
47 |
1 |
p. 243-251
|
artikel
|
| 136 |
Structure-conductivity relationship of PrBaMnMoO6-δ through in-situ measurements: A neutron diffraction study
|
Afroze, Shammya
|
|
|
47 |
1 |
p. 541-546
|
artikel
|
| 137 |
Sucrose derived microporous–mesoporous carbon for advanced lithium–sulfur batteries
|
Wang, Nannan
|
|
|
47 |
1 |
p. 899-906
|
artikel
|
| 138 |
Superior antibacterial activity against seed-borne plant bacterial disease agents and enhanced physical properties of novel green synthesized nanostructured ZnO using Thymbra spicata plant extract
|
Şahin, B.
|
|
|
47 |
1 |
p. 341-350
|
artikel
|
| 139 |
Susceptor-assisted fast microwave sintering of TiN reinforced SiAlON composites in a single mode cavity
|
Canarslan, Özgür Sevgi
|
|
|
47 |
1 |
p. 828-835
|
artikel
|
| 140 |
Synergistic effect of Ce4+ modification on the electrochemical performance of LiNi0·6Co0·2Mn0·2O2 cathode materials at high cut-off voltage
|
Wang, Ruoxing
|
|
|
47 |
1 |
p. 1268-1276
|
artikel
|
| 141 |
Synthesis and characterization of electrospun cerium-doped bioactive glass/chitosan/polyethylene oxide composite scaffolds for tissue engineering applications
|
Saatchi, Alieza
|
|
|
47 |
1 |
p. 260-271
|
artikel
|
| 142 |
Synthesis and characterization of whitlockite from sea urchin skeleton and investigation of antibacterial activity
|
Yücel, Ayşegül
|
|
|
47 |
1 |
p. 626-633
|
artikel
|
| 143 |
Synthesis and electrochemical properties of mixed-phase α x /β 1-x -LiVOPO4/C composites
|
Cai, Yanjun
|
|
|
47 |
1 |
p. 700-705
|
artikel
|
| 144 |
Synthesis and material properties of polymer-derived niobium carbide and niobium nitride nanocrystalline ceramics
|
Laskoski, Matthew
|
|
|
47 |
1 |
p. 1163-1168
|
artikel
|
| 145 |
Synthesis and optical properties of intense blue colors oxides based on Mn5+ in tetrahedral sites in Ba7Al2-x Mn x O10+y
|
Wang, Yuqian
|
|
|
47 |
1 |
p. 686-691
|
artikel
|
| 146 |
Synthesis and properties of TiB2/Ti3SiC2 composites
|
Islak, Bilge Yaman
|
|
|
47 |
1 |
p. 1439-1446
|
artikel
|
| 147 |
Synthesis and the characterization for transition metal-ion based photonics: Broadband near-IR emission properties of nickel ion doped NaSbO3 ceramics
|
Yu, Guanliang
|
|
|
47 |
1 |
p. 776-781
|
artikel
|
| 148 |
Synthesis of thin alpha alumina platelets with a large aspect ratio
|
Liu, Qiang
|
|
|
47 |
1 |
p. 252-259
|
artikel
|
| 149 |
Synthesis of zirconolite-2M ceramics for immobilisation of neptunium
|
Wei, Zi-Jun
|
|
|
47 |
1 |
p. 1047-1052
|
artikel
|
| 150 |
Synthesis, physical, optical, mechanical, and radiation attenuation properties of TiO2–Na2O–Bi2O3–B2O3 glasses
|
Abouhaswa, A.S.
|
|
|
47 |
1 |
p. 185-204
|
artikel
|
| 151 |
Temperature self-monitoring photothermal nano-particles of Er3+/Yb3+ Co-doped zircon-tetragonal BiVO4
|
Sun, Jiashu
|
|
|
47 |
1 |
p. 409-415
|
artikel
|
| 152 |
Temperature-sensing characteristics of NaGd(MoO4)2: Sm3+, Tb3+ phosphors
|
Zhang, Lixin
|
|
|
47 |
1 |
p. 670-676
|
artikel
|
| 153 |
Template-free synthesis of novel Co3O4 micro-bundles assembled with flakes for high-performance hybrid supercapacitors
|
Chen, Huiyu
|
|
|
47 |
1 |
p. 716-724
|
artikel
|
| 154 |
Texture tolerance to B-site valence mismatch for [001] textured Pb97.5%Ba2.5%[(Zn1/3Nb2/3) (1-x)–Tix]O3 transparent ceramics
|
Hao, Mengmeng
|
|
|
47 |
1 |
p. 1253-1257
|
artikel
|
| 155 |
The effects of V2O5/K2O substitution on linear and nonlinear optical properties and the gamma ray shielding performance of TVK glasses
|
Somaily, H.H.
|
|
|
47 |
1 |
p. 1012-1020
|
artikel
|
| 156 |
The impact of B-site antisite defects on the magnetic and electronic properties in double perovskite Pb2FeOsO6
|
Ge, Zhizhong
|
|
|
47 |
1 |
p. 992-1001
|
artikel
|
| 157 |
The influence of different additives on microstructure and mechanical properties of aluminum titanate ceramics
|
Chen, Weiwei
|
|
|
47 |
1 |
p. 1169-1176
|
artikel
|
| 158 |
The production of graphene by direct liquid phase exfoliation of graphite at moderate sonication power by using low boiling liquid media: The effect of liquid media on yield and optimization
|
Güler, Ömer
|
|
|
47 |
1 |
p. 521-533
|
artikel
|
| 159 |
Thermo-mechanical simulation of ultrahigh temperature ceramic composites as alternative materials for gas turbine stator blades
|
Vaferi, Kourosh
|
|
|
47 |
1 |
p. 567-580
|
artikel
|
| 160 |
The study of corrosion behavior of WC-MgO composite in H2SO4 and NaOH solution
|
Fan, Bowen
|
|
|
47 |
1 |
p. 1364-1372
|
artikel
|
| 161 |
Two-dimensional (2D) Ti3C2Tx MXene nanosheets with superior adsorption behavior for phosphate and nitrate ions from the aqueous environment
|
Karthikeyan, Perumal
|
|
|
47 |
1 |
p. 732-739
|
artikel
|
| 162 |
Wide temperature stable Ba(Mg x Ta2/3)O3 microwave dielectric ceramics with ultra-high-Q applied for 5G dielectric filter
|
Ni, Lizheng
|
|
|
47 |
1 |
p. 1034-1039
|
artikel
|
Tijdschrift beschrijving