| nr |
titel |
auteur |
tijdschrift |
jaar |
jaarg. |
afl. |
pagina('s) |
type |
| 1 |
A comparative study of surface morphology, mechanical and tribological properties of DLC films deposited on Cr and Ni nanolayers
|
Shahsavari, Fatemeh
|
|
|
46 |
4 |
p. 5077-5085
|
artikel
|
| 2 |
Anchoring 2D NiMoO4 nano-plates on flexible carbon cloth as a binder-free electrode for efficient energy storage devices
|
Abbas, Yasir
|
|
|
46 |
4 |
p. 4470-4476
|
artikel
|
| 3 |
An integrative approach to coating/carbide substrate design of CVD and PVD coated cutting tools during the machining of austenitic stainless steel
|
He, Q.
|
|
|
46 |
4 |
p. 5149-5158
|
artikel
|
| 4 |
Anisotropic electromechanical properties of GaN ceramics caused by polarisation
|
Qin, GuoShuai
|
|
|
46 |
4 |
p. 5331-5336
|
artikel
|
| 5 |
A noticeable effect of Pr doping on key optoelectrical properties of CdS thin films prepared using spray pyrolysis technique for high-performance photodetector applications
|
Shkir, Mohd.
|
|
|
46 |
4 |
p. 4652-4663
|
artikel
|
| 6 |
A novel alternating current-assisted sintering method for rapid densification of Al2O3 ceramics with ultrahigh flexural strength
|
Xu, Jingkun
|
|
|
46 |
4 |
p. 5484-5488
|
artikel
|
| 7 |
A novel mass production method for Li2TiO3 tritium breeder ceramic pebbles using polyvinyl alcohol (PVA) and polyvinyl pyrrolidone (PVP) assisted granulation method
|
Wang, Hailiang
|
|
|
46 |
4 |
p. 4167-4173
|
artikel
|
| 8 |
A novel method for the fabrication of porous calcium hexaluminate (CA6) ceramics using pre-fired CaO/Al2O3 pellets as calcia source
|
Zhao, Fei
|
|
|
46 |
4 |
p. 4762-4770
|
artikel
|
| 9 |
Assessment of 2H–SiC based intercalation compound for use as anode in lithium ion batteries
|
Majid, Abdul
|
|
|
46 |
4 |
p. 5297-5305
|
artikel
|
| 10 |
(Ba,Sr)TiO3 solid solutions sintered from sol-gel derived powders: An insight into the composition and temperature dependent dielectric behavior
|
Patru, Roxana Elena
|
|
|
46 |
4 |
p. 4180-4190
|
artikel
|
| 11 |
Behavior and mechanism of in-situ synthesis of auxiliary electrode for electrochemical sulfur sensor by calcium aluminate system
|
Wen, Tianpeng
|
|
|
46 |
4 |
p. 4256-4264
|
artikel
|
| 12 |
Bioactive glasses and the impact of Si3N4 doping on the photon attenuation up to radiotherapy energies
|
Al-Hadeethi, Y.
|
|
|
46 |
4 |
p. 5306-5314
|
artikel
|
| 13 |
Biological and mechanical enhancement of zirconium dioxide for medical applications
|
Patil, Nikhil Avinash
|
|
|
46 |
4 |
p. 4041-4057
|
artikel
|
| 14 |
BiScO3-PbTiO3 piezoelectric ceramics with Bi excess for energy harvesting applications under high temperature
|
Ji, Jae-Hoon
|
|
|
46 |
4 |
p. 4104-4112
|
artikel
|
| 15 |
Boron doped M-phase VO2 nanoparticles with low metal-insulator phase transition temperature for smart windows
|
Zhou, Qiaoting
|
|
|
46 |
4 |
p. 4786-4794
|
artikel
|
| 16 |
Cadmium and iron decorated ZnO nanoparticles: Effects on physical, electrochemical and antibacterial performance
|
D, Neena
|
|
|
46 |
4 |
p. 5278-5288
|
artikel
|
| 17 |
Cd-substituted Mg composites with dual-equivalent permeability and permittivity for high-frequency miniaturization antennas
|
Gan, Gongwen
|
|
|
46 |
4 |
p. 4410-4415
|
artikel
|
| 18 |
Characterisation of joined surface modified SiCf/SiC composites
|
Casalegno, Valentina
|
|
|
46 |
4 |
p. 4159-4166
|
artikel
|
| 19 |
Characterization of domain structure and imprint of Pb(Zn1/3Nb2/3)O3-4.5%PbTiO3 (PZN-4.5%PT) single crystals by using PFM and SS-PFM techniques
|
Wang, Hongli
|
|
|
46 |
4 |
p. 4274-4279
|
artikel
|
| 20 |
Characterization of microstructure and phase distribution of sintered multiphasic calcium phosphate bioceramics
|
Stastny, Premysl
|
|
|
46 |
4 |
p. 5500-5504
|
artikel
|
| 21 |
Characterization of single crystal β-Ga2O3 films grown on SrTiO3 (100) substrates by MOCVD
|
Wang, Di
|
|
|
46 |
4 |
p. 4568-4572
|
artikel
|
| 22 |
Characterizing the chemical composition of Tang Sancai wares from five Tang dynasty kiln sites
|
Chang, Dongxue
|
|
|
46 |
4 |
p. 4778-4785
|
artikel
|
| 23 |
Controlling microstructure and electrochemical performance of TiO2 film by defect engineering
|
Hu, Zhitong
|
|
|
46 |
4 |
p. 5387-5393
|
artikel
|
| 24 |
Corrigendum to ‘2D Sn-doped ZnO ultrathin nanosheet networks for enhanced acetone gas sensing application’ [Ceramics International 43 (2019) 2418–2423]
|
Al-Hadeethi, Yas
|
|
|
46 |
4 |
p. 5505
|
artikel
|
| 25 |
Corrosion behavior of electrodeposited Wo3 thin films
|
Demir, Kübra Çınar
|
|
|
46 |
4 |
p. 4358-4364
|
artikel
|
| 26 |
Counterions present in syntheses induce the precipitation of two different populations of Sr-containing hydroxyapatite crystals
|
Silva, L.M.
|
|
|
46 |
4 |
p. 4502-4510
|
artikel
|
| 27 |
Covalently bonded Fe3O4@SiO2−reduced graphene oxide nanocomposites as high-efficiency electromagnetic wave absorbers
|
Liu, Xudong
|
|
|
46 |
4 |
p. 5175-5184
|
artikel
|
| 28 |
Densification behavior involving creep during spark plasma sintering of ZrB2-SiC based ultra-high temperature ceramic composites
|
Kashyap, Sunil Kumar
|
|
|
46 |
4 |
p. 5028-5036
|
artikel
|
| 29 |
Densification behaviour of UO2/Mo core-shell composite pellets with a reduced coefficient of thermal expansion
|
Cheng, Liang
|
|
|
46 |
4 |
p. 4730-4736
|
artikel
|
| 30 |
Deposition of boron-containing coatings by electron-beam evaporation of boron-containing targets
|
Yushkov, Yu.G.
|
|
|
46 |
4 |
p. 4519-4525
|
artikel
|
| 31 |
Development of antibiotic loaded mesoporous bioactive glass and its drug release kinetics
|
Anand, Akrity
|
|
|
46 |
4 |
p. 5477-5483
|
artikel
|
| 32 |
Development of mesoporous SiO2/CeO2 core/shell nanoparticles with tunable structures for non-damage and efficient polishing
|
Chen, Yang
|
|
|
46 |
4 |
p. 4670-4678
|
artikel
|
| 33 |
Dielectric properties, nonlinear electrical response and microstructural evolution of CaCu3Ti4-x Sn x O12 ceramics prepared by a double ball-milling process
|
Boonlakhorn, Jakkree
|
|
|
46 |
4 |
p. 4952-4958
|
artikel
|
| 34 |
Direct coarse powder aqueous slip casting and pressureless sintering of highly transparent AlON ceramics
|
Sun, Xiannian
|
|
|
46 |
4 |
p. 4850-4856
|
artikel
|
| 35 |
Dispersing of functionalized CNTs in Si–O–C ceramics and electromagnetic wave absorbing and mechanical properties of CNTs/Si–O–C nanocomposites
|
Ding, Donghai
|
|
|
46 |
4 |
p. 5407-5419
|
artikel
|
| 36 |
Dispersion and stability of SiC ceramic slurry for stereolithography
|
Ding, Guojiao
|
|
|
46 |
4 |
p. 4720-4729
|
artikel
|
| 37 |
Easy-to-use model to reveal the nature of octahedral rotation transformations in perovskites
|
Qian, Hao
|
|
|
46 |
4 |
p. 4477-4483
|
artikel
|
| 38 |
Effect of active Ti element on the bonding characteristic of the Ag(111)/α-Al2O3(0001) interface by using first principle calculation
|
Guo, Weibing
|
|
|
46 |
4 |
p. 5430-5435
|
artikel
|
| 39 |
Effect of alumina particle size on characteristics, corrosion, and tribological behavior of Co/Al2O3 composite coatings
|
Mahdavi, S.
|
|
|
46 |
4 |
p. 5351-5359
|
artikel
|
| 40 |
Effect of annealing on the thermoelectricity of indium tin oxide thin film thermocouples
|
Jin, Xinhang
|
|
|
46 |
4 |
p. 4602-4609
|
artikel
|
| 41 |
Effect of CNT orientation on the mechanical property and fracture mechanism of vertically aligned carbon nanotube/carbon composites
|
Shen, Sijia
|
|
|
46 |
4 |
p. 4933-4938
|
artikel
|
| 42 |
Effect of cobalt on properties of vitrified bond and vitrified cubic boron nitride composites
|
Sun, Xue
|
|
|
46 |
4 |
p. 5337-5343
|
artikel
|
| 43 |
Effect of hot dip silicon-plating temperature on microstructure characteristics of silicide coating on tungsten substrate
|
Zhang, Yingyi
|
|
|
46 |
4 |
p. 5223-5228
|
artikel
|
| 44 |
Effect of interfacial residual thermal stress on the fracture behavior of Cf/B4C composites prepared by spark plasma sintering
|
Chen, Huan
|
|
|
46 |
4 |
p. 4587-4594
|
artikel
|
| 45 |
Effect of micron sized particle on the electrochemical properties of nickel-rich LiNi0.8Co0.1Mn0.1O2 cathode materials
|
Zhang, Maolin
|
|
|
46 |
4 |
p. 4643-4651
|
artikel
|
| 46 |
Effect of nanosilica addition on bioactivity and in vivo properties of calcium aluminate cement
|
Mohammadi, Hossein
|
|
|
46 |
4 |
p. 4335-4343
|
artikel
|
| 47 |
Effect of normal scratch load and HF etching on the mechanical behavior of annealed and chemically strengthened aluminosilicate glass
|
Wang, Zhen
|
|
|
46 |
4 |
p. 4813-4823
|
artikel
|
| 48 |
Effect of β–Si3N4 seeds on microstructure and properties of porous Si3N4 ceramics prepared by gelcasting using DMAA system
|
Yin, Shuang
|
|
|
46 |
4 |
p. 4924-4932
|
artikel
|
| 49 |
Effect of sintering temperature on microstructure and mechanical properties of boron nitride whisker reinforced fused silica composites
|
Duan, Wenjiu
|
|
|
46 |
4 |
p. 5132-5140
|
artikel
|
| 50 |
Effect of splat-interface discontinuity on effective thermal conductivity of plasma sprayed thermal barrier coating
|
Qiu, Shi-yi
|
|
|
46 |
4 |
p. 4824-4831
|
artikel
|
| 51 |
Effect of ZnO content on the physical, mechanical and chemical properties of glass-ceramics in the CaO–SiO2–Al2O3 system
|
Montoya-Quesada, Estefanía
|
|
|
46 |
4 |
p. 4322-4328
|
artikel
|
| 52 |
Effects of cement content on the microstructural evolution and mechanical properties of cement-bonded corundum castables
|
Pan, Liping
|
|
|
46 |
4 |
p. 4634-4642
|
artikel
|
| 53 |
Effects of M2O3–Y2O3 (M = Sc and Al) additives on electrical conductivity of hot-pressed SiC ceramics
|
Kim, Kwang Joo
|
|
|
46 |
4 |
p. 5454-5458
|
artikel
|
| 54 |
Effects of the annealing atmosphere on the microstructure and properties of BiFe0.99Zn0.01O3 films
|
Zhang, Fengqing
|
|
|
46 |
4 |
p. 4314-4321
|
artikel
|
| 55 |
Effects of the film thickness and poling electric field on photovoltaic performances of (Pb,La)(Zr,Ti)O3 ferroelectric thin film-based devices
|
Chen, Guang
|
|
|
46 |
4 |
p. 4148-4153
|
artikel
|
| 56 |
Effects of zirconium carbide content on thermal stability and ablation properties of carbon/phenolic composites
|
Wang, Shuang
|
|
|
46 |
4 |
p. 4307-4313
|
artikel
|
| 57 |
Electrical transport properties of (Pr1-x La x )0.7Sr0.3MnO3 (0 ≤ x ≤ 0.3) polycrystalline ceramics prepared by sol-gel process for potential room temperature bolometer use
|
Pu, Xingrui
|
|
|
46 |
4 |
p. 4984-4991
|
artikel
|
| 58 |
Electro and photon double-driven non-volatile and non-destructive readout memory in Pt/Bi0.9Eu0.1FeO3/Nb:SrTiO3 heterostructures
|
Wei, Maocai
|
|
|
46 |
4 |
p. 5126-5131
|
artikel
|
| 59 |
Electrocaloric properties of Bi and Cu doped PLZT 9/65/35 ceramics at low electric field
|
Limpichaipanit, Apichart
|
|
|
46 |
4 |
p. 5252-5261
|
artikel
|
| 60 |
Electrochemical tuning induced oxygen vacancies for the photoluminescence enhancement
|
Gu, Yaohang
|
|
|
46 |
4 |
p. 4071-4078
|
artikel
|
| 61 |
Electromagnetic and microwave absorption properties of FeSiAl and flaky graphite filled Al2O3 composites with different FeSiAl particle size
|
Zhou, Liang
|
|
|
46 |
4 |
p. 4329-4334
|
artikel
|
| 62 |
Encapsulation of N-doped carbon layer via in situ dopamine polymerization endows nanostructured NaTi2(PO4)3 with superior lithium storage performance
|
Jiang, Zhen
|
|
|
46 |
4 |
p. 4402-4409
|
artikel
|
| 63 |
Enhanced breakdown strength and dielectric properties of Bi0.0025Nb0.0025Ti0.995O2–Bi2Ti4O11 ceramics sintered at 1130 °C
|
Song, Yue-Chan
|
|
|
46 |
4 |
p. 5443-5447
|
artikel
|
| 64 |
Enhanced photocatalytic activity of novel TiO2/Ag/MoS2/Ag nanocomposites for water-treatment
|
Jiang, Nan
|
|
|
46 |
4 |
p. 4889-4896
|
artikel
|
| 65 |
Enhanced superconducting properties of a YGBCO/Gd-CeO2/YGBCO tri-layer film deposited by pulsed laser deposition
|
Liu, Shunfan
|
|
|
46 |
4 |
p. 5436-5442
|
artikel
|
| 66 |
Ensuring origin of intrinsic magnetism from structural studies in Cu0.945Fe0.055-x Mn x O
|
Nasir, Mohammad
|
|
|
46 |
4 |
p. 4191-4196
|
artikel
|
| 67 |
Erosion resistance and toughening mechanism of AlBO and BNw whiskers modified thermal barrier coatings
|
Haoliang, Tian
|
|
|
46 |
4 |
p. 4573-4580
|
artikel
|
| 68 |
Extrusion-based additive manufacturing of yttria-partially-stabilized zirconia ceramics
|
Yu, Tianyu
|
|
|
46 |
4 |
p. 5020-5027
|
artikel
|
| 69 |
Fabrication and characterisation of AlN-SiC porous composite ceramics by nitridation of Al4SiC4
|
Xing, Guangchao
|
|
|
46 |
4 |
p. 4959-4967
|
artikel
|
| 70 |
Fabrication and preliminary evaluation of the osteogenic potential for micro-/nano-structured porous BCP ceramics
|
Wang, Jing
|
|
|
46 |
4 |
p. 4801-4812
|
artikel
|
| 71 |
Fabrication of transparent MgAl2O4 ceramics by gelcasting and cold isostatic pressing
|
Liu, Yinan
|
|
|
46 |
4 |
p. 4154-4158
|
artikel
|
| 72 |
Fabrication of Y6MoO12 molybdate ceramics: From synthesis of cubic nano-powder to sintering
|
Sobota, P.
|
|
|
46 |
4 |
p. 4619-4633
|
artikel
|
| 73 |
Facile preparation of morph-genetic SiC/C porous ceramic at low temperature by processed bio-template
|
Liu, Hexing
|
|
|
46 |
4 |
p. 4351-4357
|
artikel
|
| 74 |
Fatigue limit prediction model of ceramic matrix minicomposites
|
Gao, Xiguang
|
|
|
46 |
4 |
p. 5289-5296
|
artikel
|
| 75 |
Fern shaped La2O3 nanostructures as potential scaffold for efficient hydroquinone chemical sensing application
|
Umar, Ahmad
|
|
|
46 |
4 |
p. 5141-5148
|
artikel
|
| 76 |
Ferromagetic-paramagnetic transformation in hydrogenated ferrous titanate
|
Shi, Jinming
|
|
|
46 |
4 |
p. 5360-5367
|
artikel
|
| 77 |
Finite element optimization of sample geometry for measuring the torsional shear strength of glass/metal joints
|
Fakouri Hasanabadi, M.
|
|
|
46 |
4 |
p. 4857-4863
|
artikel
|
| 78 |
Flame aerosol transport method for assembling CeO2–SiO2 nanocomposites
|
Skrbek, Kryštof
|
|
|
46 |
4 |
p. 5495-5499
|
artikel
|
| 79 |
Frequency dependent electrocaloric effect in Nb-doped PZST relaxor thin film with the coexistence of tetragonal antiferroelectric and rhombohedral ferroelectric phases
|
Peng, Biaolin
|
|
|
46 |
4 |
p. 4300-4306
|
artikel
|
| 80 |
Gas sensitivity of heterojunction TiO2NT/GO materials prepared by a simple method with low-concentration acetone
|
Jiang, Lili
|
|
|
46 |
4 |
p. 5344-5350
|
artikel
|
| 81 |
Heat-rate-controlled hydrothermal crystallization of high-performance LiMn0.7Fe0.3PO4 cathode material for lithium-ion batteries
|
Song, Yijun
|
|
|
46 |
4 |
p. 5069-5076
|
artikel
|
| 82 |
Hierarchical manganese sillenite Bi12MnO20 microparticles assembled by nanocubes with microwave absorption enhancement
|
Zhao, Jiahui
|
|
|
46 |
4 |
p. 4700-4706
|
artikel
|
| 83 |
Highly transparent low resistance ATO/AgNWs/ATO flexible transparent conductive thin films
|
Wu, Muying
|
|
|
46 |
4 |
p. 4344-4350
|
artikel
|
| 84 |
High-porosity whisker-mullite/corundum membrane support prepared from recycled industrial waste coal cinder
|
Li, Lingling
|
|
|
46 |
4 |
p. 4086-4094
|
artikel
|
| 85 |
Hydrogenated LaFeO3 with oxygen vacancies for Enhanced Visible light photocatalytic performance
|
Shi, Jinming
|
|
|
46 |
4 |
p. 5315-5322
|
artikel
|
| 86 |
Hydrophobic TiO2–SiO2 composite aerogels synthesized via in situ epoxy-ring opening polymerization and sol-gel process for enhanced degradation activity
|
Parale, Vinayak G.
|
|
|
46 |
4 |
p. 4939-4946
|
artikel
|
| 87 |
Impact of copper doping in NiO thin films on their structure, morphology, and antibacterial activity against Escherichia Coli
|
Aftab, Muzamil
|
|
|
46 |
4 |
p. 5037-5049
|
artikel
|
| 88 |
Increase of Voc using heterojunctions of BaTiO3 without sensitization
|
Lilge, Tatiane Strelow
|
|
|
46 |
4 |
p. 4907-4913
|
artikel
|
| 89 |
Influence of Fe3+ ions on optical, structural, thermal and mechanical properties of Li2O–Na2O–K2O–ZnO–B2O3 based glass system
|
Subhashini,
|
|
|
46 |
4 |
p. 5213-5222
|
artikel
|
| 90 |
Influence of novel anode design on the performance and coke resistance towards methane directly-fed solid oxide fuel cells
|
Sarruf, Bernardo Jordão Moreira
|
|
|
46 |
4 |
p. 5368-5379
|
artikel
|
| 91 |
Influence of pressure on chemical vapor deposition of boron nitride from BCl3/NH3/H2 gas mixtures
|
Wang, Mengqian
|
|
|
46 |
4 |
p. 4843-4849
|
artikel
|
| 92 |
Influence of TiO2 dopant on spontaneous infiltration to fabricate high volume fraction SiCp/Al cermets
|
Bao, Jianxun
|
|
|
46 |
4 |
p. 5459-5464
|
artikel
|
| 93 |
Influence of Ti4+ substitution for Ta5+ on the crystal structure, Raman spectra, and microwave dielectric properties of Ba3Ta4-4xTi4+5xO21 ceramics
|
Chen, Junqi
|
|
|
46 |
4 |
p. 4197-4203
|
artikel
|
| 94 |
Influence of transition metals co-doping on CeO2 magnetic and photocatalytic activities
|
Subramanyam, K.
|
|
|
46 |
4 |
p. 5086-5097
|
artikel
|
| 95 |
Influence of Zn0.5Ti0.5NbO4 on the structure and microwave dielectric properties of ZrTiO4 ceramics
|
Yang, Qiu
|
|
|
46 |
4 |
p. 4543-4549
|
artikel
|
| 96 |
Influences of clearance angle and point angle on drilling performance of 2D Cf/SiC composites using polycrystalline diamond tools
|
Zou, Fan
|
|
|
46 |
4 |
p. 4371-4380
|
artikel
|
| 97 |
Insight into the vacancy effects on mechanical and electronic properties of Tantalum Silicide
|
Chen, Jiaying
|
|
|
46 |
4 |
p. 4595-4601
|
artikel
|
| 98 |
Intrinsic dielectric behavior of Mg2TiO4 spinel ceramic
|
Li, Hao
|
|
|
46 |
4 |
p. 4235-4239
|
artikel
|
| 99 |
Isothermal phase diagram of CaO–SiO2–Nb2O5–La2O3 system at 1300 °C and 1200 °C
|
Qiu, Jiyu
|
|
|
46 |
4 |
p. 4832-4842
|
artikel
|
| 100 |
Materials selection of furnace linings with multi-component refractory ceramics based on an evolutionary screening procedure
|
Santos, D.P.
|
|
|
46 |
4 |
p. 4113-4125
|
artikel
|
| 101 |
Mechanical properties and machinability of GYGAG:Ce ceramic scintillators
|
Qiu, Xuting
|
|
|
46 |
4 |
p. 4550-4555
|
artikel
|
| 102 |
Mechanism of the interfacial reaction between sapphire and Sn-3.5Ag-4Ti solder at a low temperature in air by ultrasound
|
Xu, Yan
|
|
|
46 |
4 |
p. 4435-4443
|
artikel
|
| 103 |
Micromechanical modeling of thermo-mechanical properties of high volume fraction particle-reinforced refractory composites using 3D Finite Element analysis
|
Makarian, Kamran
|
|
|
46 |
4 |
p. 4381-4393
|
artikel
|
| 104 |
Microstructure and luminescence properties of YSZ-based thermal barrier coatings modified by Eu2O3
|
Haoliang, Tian
|
|
|
46 |
4 |
p. 4444-4453
|
artikel
|
| 105 |
Microstructure and thermal & mechanical properties of La2Zr2O7@YSZ composite ceramic
|
Zhang, Dongbo
|
|
|
46 |
4 |
p. 4737-4747
|
artikel
|
| 106 |
Microstructure and thermal physical properties of SiC matrix microencapsulated composites at temperature up to 1900 °C
|
Yang, Zhenliang
|
|
|
46 |
4 |
p. 5159-5167
|
artikel
|
| 107 |
Microstructure, magnetic and optical properties of Nb3+ and Y3+ ions co-substituted Sr hexaferrites
|
Güner, S.
|
|
|
46 |
4 |
p. 4610-4618
|
artikel
|
| 108 |
Modified gel casting technique to fabricate honeycomb structured vitrified-bonded ultrafine diamond grinding wheels
|
Miao, Weipeng
|
|
|
46 |
4 |
p. 4462-4469
|
artikel
|
| 109 |
MOF-derived hollow Co(Ni)Se2/N-doped carbon composite material for preparation of sodium ion battery anode
|
Xu, Zhipeng
|
|
|
46 |
4 |
p. 4532-4542
|
artikel
|
| 110 |
Multi-substituted garnet-type electrolytes for solid-state lithium batteries
|
Song, Shufeng
|
|
|
46 |
4 |
p. 5489-5494
|
artikel
|
| 111 |
Near-infrared emissions in host sensitized Ba2YV3O11: RE3+ (RE = Nd, Ho, Yb) down-converting phosphors
|
Zhao, Jin
|
|
|
46 |
4 |
p. 5015-5019
|
artikel
|
| 112 |
New orthorhombic sodium iron(+2) titanate
|
Shukaev, Igor L.
|
|
|
46 |
4 |
p. 4416-4422
|
artikel
|
| 113 |
Non-crystallising glass sealants for SOFC: Effect of Y2O3 addition
|
Krainova, D.A.
|
|
|
46 |
4 |
p. 5193-5200
|
artikel
|
| 114 |
Non-focusing dense plasma focus device based alternative synthesis technology for ZnO thin films
|
Hussain, S.A.
|
|
|
46 |
4 |
p. 4690-4699
|
artikel
|
| 115 |
Novel multi-wavelength excitable single-component phosphor system for application in white-LEDs
|
Lohia, Naina
|
|
|
46 |
4 |
p. 4079-4085
|
artikel
|
| 116 |
Novel statistical analysis method for determining shear strength of C/C composite pin
|
Guo, Fei
|
|
|
46 |
4 |
p. 5262-5270
|
artikel
|
| 117 |
Numerical simulation of heat transfer during spark plasma sintering of zirconium diboride
|
Sakkaki, Milad
|
|
|
46 |
4 |
p. 4998-5007
|
artikel
|
| 118 |
Optimization of Gallium concentration to improve the performance of ZnO nanopowders for nanophotonic applications
|
Alamdari, S.
|
|
|
46 |
4 |
p. 4484-4492
|
artikel
|
| 119 |
Organic solvent supported fabrication of transparent free standing graphene oxide membranes
|
Narayanam, Pavan K.
|
|
|
46 |
4 |
p. 5394-5401
|
artikel
|
| 120 |
Photometric features and typical white light emanation via combustion derived trivalent dysprosium doped ternary aluminate oxide based nanophosphor for WLEDs
|
Hooda, Anju
|
|
|
46 |
4 |
p. 4204-4214
|
artikel
|
| 121 |
Physical, optical properties and radiation shielding studies of xLa2O3-(100-x)B2O3 glass system
|
Al-Hadeethi, Y.
|
|
|
46 |
4 |
p. 5380-5386
|
artikel
|
| 122 |
Poling effect on optical and dielectric properties of Pr3+-doped Na0.5Bi0.5TiO3 ferroelectric single crystal
|
An, Yang
|
|
|
46 |
4 |
p. 4664-4669
|
artikel
|
| 123 |
Polyelectrolytes/reduced graphene oxide assembled film as a promising NO2 gas sensing material
|
Yang, Zhi
|
|
|
46 |
4 |
p. 5119-5125
|
artikel
|
| 124 |
Preparation and characterization of Al3+-doped TiO2 tight ultrafiltration membrane for efficient dye removal
|
Huang, Xin
|
|
|
46 |
4 |
p. 4679-4689
|
artikel
|
| 125 |
Preparation and characterization of porous ceramics from nickel smelting slag and metakaolin
|
Wu, Qisheng
|
|
|
46 |
4 |
p. 4581-4586
|
artikel
|
| 126 |
Preparation and properties of LaMgAl11O19 thermal barrier coatings doped with Gd2O3
|
Sun, Junbin
|
|
|
46 |
4 |
p. 4174-4179
|
artikel
|
| 127 |
Preparation, characterization and growth mechanism of ZrO2 nanosheets
|
Liu, Xuefeng
|
|
|
46 |
4 |
p. 4864-4869
|
artikel
|
| 128 |
Preparation of AlN under vacuum by the alumina carbothermal reduction nitridation method
|
Zhou, Zhiqiang
|
|
|
46 |
4 |
p. 4095-4103
|
artikel
|
| 129 |
Preparation of high-porosity Al2O3 ceramic foams via selective laser sintering of Al2O3 poly-hollow microspheres
|
Liu, Shan-Shan
|
|
|
46 |
4 |
p. 4240-4247
|
artikel
|
| 130 |
Preparations, optical, structural, conductive and magnetic evaluations of RE's (Pr, Y, Gd, Ho, Yb) doped spinel nanoferrites
|
Yousaf, M.
|
|
|
46 |
4 |
p. 4280-4288
|
artikel
|
| 131 |
Production and properties of phase separated porous glass
|
Ertuş, E. Burak
|
|
|
46 |
4 |
p. 4947-4951
|
artikel
|
| 132 |
Promotion effect and mechanism of MnO x doped CeO2 nano-catalyst for NH3-SCR
|
Yang, Chen
|
|
|
46 |
4 |
p. 4394-4401
|
artikel
|
| 133 |
Pure and cerium-doped zinc orthosilicate as a pigment for thermoregulating coatings
|
Baghramyan, V.V.
|
|
|
46 |
4 |
p. 4992-4997
|
artikel
|
| 134 |
Radiation attenuation properties of Bi2O3–Na2O– V2O5– TiO2–TeO2 glass system using Phy-X / PSD software
|
Al-Hadeethi, Y.
|
|
|
46 |
4 |
p. 4795-4800
|
artikel
|
| 135 |
Rapid oxide sintering by concentrated solar power: A case study of lanthanum calcium ferrite
|
Lin, Pengzhu
|
|
|
46 |
4 |
p. 5465-5468
|
artikel
|
| 136 |
Ratiometric optical thermometer with high sensitivity based on dual far-red emission of Cr3+ in Sr2MgAl22O36
|
Wang, Qiang
|
|
|
46 |
4 |
p. 5008-5014
|
artikel
|
| 137 |
Reactive air brazing of the YSZ/AISI 310s couples using a novel Ag–Nb2O5 sealant
|
Sun, Z.
|
|
|
46 |
4 |
p. 5168-5174
|
artikel
|
| 138 |
Reactive wetting behavior and mechanism of AlN ceramic by CuNi-Xwt%Ti active filler metal
|
Yang, Jian
|
|
|
46 |
4 |
p. 4289-4299
|
artikel
|
| 139 |
Role of carbon nanotubes in the ballistic properties of boron carbide/carbon nanotube/ultrahigh molecular weight polyethylene composite armor
|
Dasgupta, Kinshuk
|
|
|
46 |
4 |
p. 4137-4141
|
artikel
|
| 140 |
Role of doped nitrogen and sulphur in cobalt/cobalt-zirconium nanoferrites synthesized by facile methods
|
S, Kavitha
|
|
|
46 |
4 |
p. 4423-4434
|
artikel
|
| 141 |
Segregation of S at Mo(001)/MoSi2(001) interface
|
Bi, Wei
|
|
|
46 |
4 |
p. 5050-5057
|
artikel
|
| 142 |
Selective photocatalytic degradation of organic pollutants by CuxS/ZnO/TiO2 heterostructures
|
Isac, Luminita
|
|
|
46 |
4 |
p. 4265-4273
|
artikel
|
| 143 |
Spark plasma sintering of ZrO2–Al2O3 nanocomposites at low temperatures aided by amorphous powders
|
Xu, Xiqing
|
|
|
46 |
4 |
p. 4365-4370
|
artikel
|
| 144 |
Splat formation and microstructure of solution precursor thermal sprayed Nb-doped titanium oxide coatings
|
Tejero-Martin, Daniel
|
|
|
46 |
4 |
p. 5098-5108
|
artikel
|
| 145 |
Structural and impedance analysis of Bi0.5Na0.5Ti0.80Mn0.20O3 ceramics
|
Pradhani, Neeha
|
|
|
46 |
4 |
p. 4126-4136
|
artikel
|
| 146 |
Structural, dielectric and electrical properties of BaSnO3 and BaSeO3 modified Bi0.5Na0.5TiO3 ceramics
|
Arya, B.B.
|
|
|
46 |
4 |
p. 4222-4234
|
artikel
|
| 147 |
Structural elucidation and dielectric behavior evaluation of sol-gel synthesized Co–Al co-substituted M-type hexaferrite materials
|
Gulbadan, Shagufta
|
|
|
46 |
4 |
p. 4914-4923
|
artikel
|
| 148 |
Structural, magnetic, and antimicrobial properties of zinc doped magnesium ferrite for drug delivery applications
|
Nigam, Abhishek
|
|
|
46 |
4 |
p. 4058-4064
|
artikel
|
| 149 |
Synergistic effect of CeO2 and Al2O3 nanoparticle dispersion on the oxidation behavior of MCrAlY coatings deposited by HVOF
|
Ghadami, F.
|
|
|
46 |
4 |
p. 4556-4567
|
artikel
|
| 150 |
Synthesis and characterization of Ba2+ and W6+ co-doped apatite-type lanthanum silicate electrolytes
|
Zhao, Yanqin
|
|
|
46 |
4 |
p. 5420-5429
|
artikel
|
| 151 |
Synthesis and characterization of corrosion-resistant and biocompatible Al2O3–TiB2 nanocomposite films on pure titanium
|
Sajedi Alvar, Fatemeh
|
|
|
46 |
4 |
p. 4215-4221
|
artikel
|
| 152 |
Synthesis and thermal stability of new inorganic-organic perovskite-like hybrids based on layered titanates HLnTiO4 (Ln = La, Nd)
|
Kurnosenko, Sergey A.
|
|
|
46 |
4 |
p. 5058-5068
|
artikel
|
| 153 |
Synthesis of β-SiC powders by the carbothermal reduction of porous SiO2–C hybrid precursors with controlled surface area
|
Youm, Mi Rae
|
|
|
46 |
4 |
p. 4870-4877
|
artikel
|
| 154 |
Synthesis of Ti2AlC & Ti3AlC2 MAX phases by Arc-PVD using Ti–Al target in C2H2/Ar gas mixture and subsequent annealing
|
Mahmoudi, Zahra
|
|
|
46 |
4 |
p. 4968-4975
|
artikel
|
| 155 |
Synthesis, properties and performance evaluation of vanadium carbide MXene as supercapacitor electrodes
|
Syamsai, Ravuri
|
|
|
46 |
4 |
p. 5323-5330
|
artikel
|
| 156 |
Tailoring electromagnetic absorption performances of TiO2/Co/carbon nanofibers through tuning graphitization degrees
|
Zhang, Xue
|
|
|
46 |
4 |
p. 4754-4761
|
artikel
|
| 157 |
Thallium and selenite doped carbonated hydroxyapatite: Microstructural features and anticancer activity assessment against human lung carcinoma
|
Shoueir, Kamel
|
|
|
46 |
4 |
p. 5201-5212
|
artikel
|
| 158 |
The effect of calcination's temperature on the structural, morphological, optical behaviour, hemocompatibility and antibacterial activity of nanocrystalline Co3O4 powders
|
Gajendiran, J.
|
|
|
46 |
4 |
p. 5469-5476
|
artikel
|
| 159 |
The effect of high temperature heat treatment on the tribological property of a carbon fiber/pyrolytic carbon/silicon carbide composite using polycarbosilane
|
Zhang, Chen
|
|
|
46 |
4 |
p. 4493-4501
|
artikel
|
| 160 |
The effect of Ni12+ heavy ion irradiation on the optical and structural properties of BeO ceramics
|
Ryskulov, A.E.
|
|
|
46 |
4 |
p. 4065-4070
|
artikel
|
| 161 |
The effect of sol-gel process on the microstructure and particle size of ZrC–SiC composite powders
|
Zeng, Chen
|
|
|
46 |
4 |
p. 5244-5251
|
artikel
|
| 162 |
The effects of oxide additives on the mechanical characteristics of Ag–SnO2 electrical contact materials
|
Li, Guijing
|
|
|
46 |
4 |
p. 4897-4906
|
artikel
|
| 163 |
The electronic structure, site occupancy and luminescent properties of Ce3+-activated Li2Ca2Si2O7 blue phosphor
|
Wu, Quansheng
|
|
|
46 |
4 |
p. 4511-4518
|
artikel
|
| 164 |
Thermal expansion and thermodynamic properties of M′-YbTaO4 ceramics
|
Guskov, V.N.
|
|
|
46 |
4 |
p. 5402-5406
|
artikel
|
| 165 |
Thermal expansion coefficient tailoring of LAS glass-ceramic for anodic bondable low temperature co-fired ceramic application
|
Wei, Anqing
|
|
|
46 |
4 |
p. 4771-4777
|
artikel
|
| 166 |
Thermochemical compatibility between La2(Ce1-xZrx)2O7 and 4 mol% Y2O3 stabilized zirconia after high temperature heat treatment
|
Yi, Hao
|
|
|
46 |
4 |
p. 4142-4147
|
artikel
|
| 167 |
Thermoelectric properties of ZnO ceramics densified through spark plasma sintering
|
Radingoana, P.M.
|
|
|
46 |
4 |
p. 5229-5238
|
artikel
|
| 168 |
The role of copper during the growth of stoichiometric Cu2ZnSnS4 by successive ionic layer adsorption and reaction method
|
Garza-Hernández, Raquel
|
|
|
46 |
4 |
p. 5185-5192
|
artikel
|
| 169 |
Tin oxysulfide composite thin films based on atomic layer deposition of tin sulfide and tin oxide using Sn(dmamp)2 as Sn precursor
|
Choi, Jeong-Wan
|
|
|
46 |
4 |
p. 5109-5118
|
artikel
|
| 170 |
Transport properties for Bi2Se3/La0.7Sr0.3MnO3 composites
|
Yang, X.S.
|
|
|
46 |
4 |
p. 4748-4753
|
artikel
|
| 171 |
Tribological behavior of graphene reinforced chemically bonded ceramic coatings
|
Da, Bian
|
|
|
46 |
4 |
p. 4526-4531
|
artikel
|
| 172 |
Tunable broadband upconversion luminescence from Yb3+/Mn2+ co-doped dual-phase glass ceramics
|
Liu, Xueyun
|
|
|
46 |
4 |
p. 5271-5277
|
artikel
|
| 173 |
Tuning the electrocaloric effect in 0.94Bi0.5Na0.5TiO3-0.06BaTiO3 ceramics by relaxor phase blending
|
Li, Feng
|
|
|
46 |
4 |
p. 4454-4461
|
artikel
|
| 174 |
Ultra-high piezoelectric and dielectric properties of low-temperature-sintered lead hafnium titanate-lead niobium nickelate ceramics
|
Yan, Yangxi
|
|
|
46 |
4 |
p. 5448-5453
|
artikel
|
| 175 |
Understanding the structural, electronic, magnetic and optical properties of spinel MFe2O4 (M = Mn, Co, Ni) ferrites
|
Rafiq, Muhammad Amir
|
|
|
46 |
4 |
p. 4976-4983
|
artikel
|
| 176 |
Uniform coating of TiO2 nanoparticles using biotemplates for photocatalytic wastewater treatment
|
Najafidoust, Ahmad
|
|
|
46 |
4 |
p. 4707-4719
|
artikel
|
| 177 |
Well-designed nanosheet-constructed porous CoMoS4 arrays for ultrahigh-performance supercapacitors
|
Xu, Xiaoyang
|
|
|
46 |
4 |
p. 4878-4888
|
artikel
|
| 178 |
When C3N4 meets BaTiO3: Ferroelectric polarization plays a critical role in building a better photocatalyst
|
Yang, Bian
|
|
|
46 |
4 |
p. 4248-4255
|
artikel
|
| 179 |
YB2C2: A new additive for fabricating Si3N4 ceramics with superior mechanical properties and medium thermal conductivity
|
Liang, Hanqin
|
|
|
46 |
4 |
p. 5239-5243
|
artikel
|
Tijdschrift beschrijving