| nr |
titel |
auteur |
tijdschrift |
jaar |
jaarg. |
afl. |
pagina('s) |
type |
| 1 |
A comparative study on macroscopic and nanoscale polarization mapping on large area PLD grown PZT thin films
|
Rath, Martando
|
|
|
44 |
8 |
p. 8749-8755
|
artikel
|
| 2 |
An Innovative method of synthesis of nanoparticles and rod-like shape boron carbide by a solid-state polymerization (SSP) of poly (vinyl alcohol) and boric acid
|
Shawgi, Nazar
|
|
|
44 |
8 |
p. 9887-9892
|
artikel
|
| 3 |
An isolated deep-trap phosphor for optical data storage
|
Wang, Wenxiang
|
|
|
44 |
8 |
p. 10010-10014
|
artikel
|
| 4 |
Anisotropic field induced phase transitions and negative electrocaloric effect in rhombohedral Mn doped Pb(In1/2Nb1/2)O3-Pb(Mg1/3Nb2/3)O3-PbTiO3 single crystals
|
Zhou, Yaming
|
|
|
44 |
8 |
p. 9045-9052
|
artikel
|
| 5 |
A novel light-induced ATRP for the preparation of water dispersible fluorescent nanodiamonds and their biological imaging applications
|
Chen, Junyu
|
|
|
44 |
8 |
p. 9907-9914
|
artikel
|
| 6 |
A novel one-pot biosynthesis of pure alpha aluminum oxide nanoparticles using the macroalgae Sargassum ilicifolium: A green marine approach
|
Koopi, Hadis
|
|
|
44 |
8 |
p. 8940-8945
|
artikel
|
| 7 |
A novel rapid synthesis, characterization and applications of calcium phosphate nanospheres from Baltic seawater
|
Qin, Tao
|
|
|
44 |
8 |
p. 9076-9079
|
artikel
|
| 8 |
Biocompatible Zirconia‐Coated 316 stainless steel with anticorrosive behavior for biomedical application
|
Kaliaraj, Gobi Saravanan
|
|
|
44 |
8 |
p. 9780-9786
|
artikel
|
| 9 |
Calcium phosphates grown on bacterial cellulose template
|
Busuioc, C.
|
|
|
44 |
8 |
p. 9433-9441
|
artikel
|
| 10 |
Characterization of alumina-magnesia-carbon refractory bricks containing aluminium and silicon
|
Calvo, W.A.
|
|
|
44 |
8 |
p. 8842-8855
|
artikel
|
| 11 |
Characterization of Ln4Al2O9 (Ln=Y, Sm, Eu, Gd, Tb) rare-earth aluminates as novel high-temperature barrier materials
|
Morán-Ruiz, Aroa
|
|
|
44 |
8 |
p. 8761-8767
|
artikel
|
| 12 |
Characterization of SiO2-encapsulated WSi2/W5Si3 nanoparticles synthesized by a mechanochemical route
|
Ovalı, Didem
|
|
|
44 |
8 |
p. 9442-9453
|
artikel
|
| 13 |
Citrate- and glycerol triesters as novel dual-functional dispersants and plasticisers for ceramic processing
|
Foghmoes, S.
|
|
|
44 |
8 |
p. 9132-9139
|
artikel
|
| 14 |
CO2 laser-assisted preparation of transparent Eu2Ti2O7 thin films
|
Mrázek, Jan
|
|
|
44 |
8 |
p. 9479-9483
|
artikel
|
| 15 |
Comparative study on energy storage performance of Na.5Bi.5(Ti,W,Ni)O3 thin films with different bismuth contents
|
Yang, Changhong
|
|
|
44 |
8 |
p. 9643-9648
|
artikel
|
| 16 |
Comparison between microwave and conventional sintering on the properties and microstructural evolution of tetragonal zirconia
|
Ramesh, S.
|
|
|
44 |
8 |
p. 8922-8927
|
artikel
|
| 17 |
Composite microstructures and piezoelectric properties in tantalum substituted lead-free K0.5Na0.5Nb1-xTaxO3 ceramics
|
Jean, F.
|
|
|
44 |
8 |
p. 9463-9471
|
artikel
|
| 18 |
Controlling the energy transfer via multi luminescent centers to achieve white/tunable light in a single-phased Sc2O3:Bi3+,Eu3+ phosphor
|
Xie, Wei
|
|
|
44 |
8 |
p. 9823-9829
|
artikel
|
| 19 |
Corrigendum to “Improved microstructure and sintering temperature of bismuth nano-doped GDC powders synthesized by direct sol-gel combustion” [Ceram. Int. (2018) 3800–3809]
|
Accardo, G.
|
|
|
44 |
8 |
p. 10020
|
artikel
|
| 20 |
Cyclic cold isostatic pressing and improved particle packing of coarse grained oxide ceramics for refractory applications
|
Schafföner, Stefan
|
|
|
44 |
8 |
p. 9027-9036
|
artikel
|
| 21 |
Design of magnetic-fluorescent based nanosensor for highly sensitive determination and removal of HG2+
|
Yang, C.H.
|
|
|
44 |
8 |
p. 9746-9752
|
artikel
|
| 22 |
Dielectric anomalies in stoichiometric Bi.49Er.01Na.5TiO3-K.5Na.5NbO3 ceramics
|
Xing, Hongjie
|
|
|
44 |
8 |
p. 10006-10009
|
artikel
|
| 23 |
Dielectric relaxation and microwave absorption properties of aurivillius-type multiferroic ceramics
|
Sun, Shujie
|
|
|
44 |
8 |
p. 9942-9949
|
artikel
|
| 24 |
Drug and ion releasing tetracalcium phosphate based dual action cement for regenerative treatment of infected bone defects
|
Jayasree, R.
|
|
|
44 |
8 |
p. 9227-9235
|
artikel
|
| 25 |
Effect of annealing temperature on the structural and magnetic properties of Ba-Pb-hexaferrite powders synthesized by sol-gel auto-combustion method
|
Choudhary, Harish Kumar
|
|
|
44 |
8 |
p. 8877-8889
|
artikel
|
| 26 |
Effect of calcination temperature on morphology and electrochemical performance of PbLi2Ti6O14
|
Zhang, Jundong
|
|
|
44 |
8 |
p. 9506-9513
|
artikel
|
| 27 |
Effect of current pattern and conductive phase on sintering behavior of Si3N4-based ceramic composite
|
Zuo, Fei
|
|
|
44 |
8 |
p. 9561-9567
|
artikel
|
| 28 |
Effect of graphene nano-platelet reinforcement on the mechanical properties of hot pressed boron carbide based composite
|
Alexander, Rajath
|
|
|
44 |
8 |
p. 9830-9838
|
artikel
|
| 29 |
Effect of in-situ oxidation on structure and ferromagnetic properties of Fe3Al and FeAl2O4 thin films prepared by electrodeposition
|
Mukhtar, Fazeelat
|
|
|
44 |
8 |
p. 9550-9560
|
artikel
|
| 30 |
Effect of MoSi2 addition on ablation behavior of ZrC coating fabricated by vacuum plasma spray
|
Liu, Tao
|
|
|
44 |
8 |
p. 8946-8954
|
artikel
|
| 31 |
Effect of phosphorus on microstructure development in cordierite transparent glaze
|
Chen, Peng
|
|
|
44 |
8 |
p. 9991-9994
|
artikel
|
| 32 |
Effect of physical and chemical characteristics on the washout resistance of calcium sulfate pellets
|
Hsu, Pei-Yi
|
|
|
44 |
8 |
p. 8934-8939
|
artikel
|
| 33 |
Effect of SiC addition on mechanical properties of hot-pressed Al2O3-GdAlO3 ceramics with eutectic composition
|
Henniche, Abdelkhalek
|
|
|
44 |
8 |
p. 9585-9592
|
artikel
|
| 34 |
Effect of surface heat transfer coefficient gradient on thermal shock failure of ceramic materials under rapid cooling condition
|
Chen, Limin
|
|
|
44 |
8 |
p. 8992-8999
|
artikel
|
| 35 |
Effect of TGO thickness on the thermal barrier coatings life under thermal shock and thermal cycle loading
|
Torkashvand, Kaveh
|
|
|
44 |
8 |
p. 9283-9293
|
artikel
|
| 36 |
Effect of the molecular weight and concentration of PEG solution on microstructure and mechanical properties of Si3N4 ceramics fabricated by gel-casting
|
Liu, Peng-fei
|
|
|
44 |
8 |
p. 8800-8808
|
artikel
|
| 37 |
Effect of waste serpentine on the properties of basic insulating refractories
|
Ramezani, A.
|
|
|
44 |
8 |
p. 9269-9275
|
artikel
|
| 38 |
Effect of Zn and Ti Co-doping on structure and electrical properties of BiFeO3 ceramics
|
Zhu, Jian-Hui
|
|
|
44 |
8 |
p. 9215-9220
|
artikel
|
| 39 |
Effects of charge compensator Li+ co-doping on the structure and luminescence properties of Cd2V2O7:Eu3+ red phosphors
|
Zhang, Wentao
|
|
|
44 |
8 |
p. 9534-9539
|
artikel
|
| 40 |
Effects of Mg and Sr co-addition on the densification and biocompatible properties of calcium pyrophosphate
|
Kim, Dong Wook
|
|
|
44 |
8 |
p. 9689-9695
|
artikel
|
| 41 |
Effects of Ni addition on properties of vitrified bond CBN composites in strong magnetic field
|
Yu, Tianbiao
|
|
|
44 |
8 |
p. 9312-9317
|
artikel
|
| 42 |
Effects of Ni substitution on magnetism and thermal expansion of antiperovskite Mn3Ga1-xNixN (0 ≤ x ≤ 1.0)
|
Lu, Huiqing
|
|
|
44 |
8 |
p. 9574-9580
|
artikel
|
| 43 |
Effects of sintering temperature and KBT content on microstructure and electrical properties of (Bi.5Na.5)TiO3-BaTiO3-(Bi.5K.5)TiO3 Pb-free ceramics
|
Liu, Gang
|
|
|
44 |
8 |
p. 9303-9311
|
artikel
|
| 44 |
Electrophoretic deposition of plasma activated sub-micron alumina powder
|
Drdlik, Daniel
|
|
|
44 |
8 |
p. 9787-9793
|
artikel
|
| 45 |
Enhanced dielectric properties of Ca2+ doped Li-Al-Si photoetchable glass
|
Liang, Tianpeng
|
|
|
44 |
8 |
p. 8756-8760
|
artikel
|
| 46 |
Enhanced dielectric properties of three phase dielectric MWCNTs/BaTiO3/PVDF nanocomposites for energy storage using fused deposition modeling 3D printing
|
Kim, Hoejin
|
|
|
44 |
8 |
p. 9037-9044
|
artikel
|
| 47 |
Enhanced electromechanical response and piezoelectric properties in lead-free erbium-modified Ba(Zr,Ti)O3 piezoceramics
|
Shao, Lihuan
|
|
|
44 |
8 |
p. 9915-9922
|
artikel
|
| 48 |
Enhanced piezoelectric properties by reducing leakage current in Co modified 0.7BiFeO3-0.3BaTiO3 ceramics
|
Huang, Shigang
|
|
|
44 |
8 |
p. 8955-8962
|
artikel
|
| 49 |
Enhanced upconversion emission and temperature sensor sensitivity in presence of Bi3+ ions in Er3+/Yb3+ co-doped MgAl2O4 phosphor
|
Choudhary, A.K.
|
|
|
44 |
8 |
p. 9633-9642
|
artikel
|
| 50 |
Enhancement of density and ionic conductivity for garnet-type Li5La3Ta2O12 solid electrolyte by self-consolidation strategy
|
Zhao, Pengcheng
|
|
|
44 |
8 |
p. 9105-9111
|
artikel
|
| 51 |
Enhancing thermal and mechanical response of aluminum using nanolength scale TiC ceramic reinforcement
|
Reddy, M. Penchal
|
|
|
44 |
8 |
p. 9247-9254
|
artikel
|
| 52 |
Evaluation of mechanical properties and bond strength of nano-hydroxyapatite-silica added glass ionomer cement
|
Moheet, Imran Alam
|
|
|
44 |
8 |
p. 9899-9906
|
artikel
|
| 53 |
Evolution of microstructure and electrical properties of Aurivillius phase (CaBi4Ti4O15)1-x
(Bi4Ti3O12)
x
ceramics
|
Wu, Bo
|
|
|
44 |
8 |
p. 9168-9173
|
artikel
|
| 54 |
Exploring the structural stability and mechanical properties of TM5SiB2 ternary silicides
|
Pan, Y.
|
|
|
44 |
8 |
p. 9893-9898
|
artikel
|
| 55 |
Fabrication and characterization of monodispersed Mn0.8Ni0.2Co2O4 mesoporous microspheres for supercapacitor application
|
Mariappan, C.R.
|
|
|
44 |
8 |
p. 8864-8869
|
artikel
|
| 56 |
Fabrication and characterization of porous biphasic β-tricalcium phosphate/carbonate apatite alginate coated scaffolds
|
Yong, Xuan Hui
|
|
|
44 |
8 |
p. 9499-9505
|
artikel
|
| 57 |
Fabrication and microstructure of a new ternary solid solution of Ti3Al0.8Si0.2Sn0.2C2 with high solid solution strengthening effect
|
Cai, Leping
|
|
|
44 |
8 |
p. 9593-9600
|
artikel
|
| 58 |
Fabrication and performance of calcium phosphate cement/small intestinal submucosa composite bionic bone scaffolds with different microstructures
|
Bian, Tierong
|
|
|
44 |
8 |
p. 9181-9187
|
artikel
|
| 59 |
Fabrication and performance of micro-diamond modified C/SiC composites via precursor impregnation and pyrolysis process
|
Chen, Lei
|
|
|
44 |
8 |
p. 9601-9608
|
artikel
|
| 60 |
Fabrication and properties of Y2Ti2O7 transparent ceramics with excess Y content
|
Wang, Xiaojun
|
|
|
44 |
8 |
p. 9514-9518
|
artikel
|
| 61 |
Fabrication of efficient electrode material: CoxZn1-xFe2O4-graphene nano-heterostructures for high-performance supercapacitors
|
Nazim, Sidra
|
|
|
44 |
8 |
p. 9616-9622
|
artikel
|
| 62 |
Fabrication of MgO-CaZrO3 refractory composites from Egyptian dolomite as a clinker to rotary cement kiln lining
|
Ewais, Emad M.M.
|
|
|
44 |
8 |
p. 9236-9246
|
artikel
|
| 63 |
Fabrication of Ni-W-B4C composite coatings and evaluation of its micro-hardness and corrosion resistance properties
|
He, Teng
|
|
|
44 |
8 |
p. 9188-9193
|
artikel
|
| 64 |
Facile synthesis of MTaO4 (M = Al, Cr and Fe) metal oxides and their application as anodes for lithium-ion batteries
|
Kong, Fanjun
|
|
|
44 |
8 |
p. 8827-8831
|
artikel
|
| 65 |
Fiber-reinforced one-part alkali-activated slag/ceramic binders
|
Abdollahnejad, Z.
|
|
|
44 |
8 |
p. 8963-8976
|
artikel
|
| 66 |
Formation mechanism of elongated β–Si3N4 crystals in Fe–Si3N4 composite via flash combustion
|
Li, Bin
|
|
|
44 |
8 |
p. 9395-9400
|
artikel
|
| 67 |
Graphene nanosheets toughened TiB2-based ceramic tool material by spark plasma sintering
|
Yin, Zengbin
|
|
|
44 |
8 |
p. 8977-8982
|
artikel
|
| 68 |
Green facile synthesis of low-toxic superparamagnetic iron oxide nanoparticles (SPIONs) and their cytotoxicity effects toward Neuro2A and HUVEC cell lines
|
Gholami, Leila
|
|
|
44 |
8 |
p. 9263-9268
|
artikel
|
| 69 |
Green preparation of in situ Cr3C2 nano-coatings on graphite surface and their water-wettability and rheological properties
|
Liu, Xiaoguang
|
|
|
44 |
8 |
p. 9526-9533
|
artikel
|
| 70 |
Growth and roughness dependent wetting properties of CeO2 films prepared by glancing angle deposition
|
An, Tao
|
|
|
44 |
8 |
p. 9742-9745
|
artikel
|
| 71 |
Growth mechanism of octahedral like nickel ferrite crystals prepared by modified hydrothermal method and morphology dependent magnetic performance
|
Shen, Wei
|
|
|
44 |
8 |
p. 9809-9815
|
artikel
|
| 72 |
Growth, microstructure, energy–storage and dielectric performances of chemical–solution NBT–based thin films: Effect of sodium nonstoichimometry
|
Yang, C.H.
|
|
|
44 |
8 |
p. 9152-9158
|
artikel
|
| 73 |
Hierarchical ZnFe2O4@RGO@CuS composite: Strong absorption and wide-frequency absorption properties
|
Wang, Yan
|
|
|
44 |
8 |
p. 9816-9822
|
artikel
|
| 74 |
High-alumina refractory castables bonded with novel alumina-silica-based powdered binders
|
Luz, A.P.
|
|
|
44 |
8 |
p. 9159-9167
|
artikel
|
| 75 |
High dielectric tunability in composites prepared using SiO2 coated Ba0.5Sr0.5TiO3 nanoparticles
|
Lu, Xu
|
|
|
44 |
8 |
p. 9875-9879
|
artikel
|
| 76 |
High magnetic and ferroelectric properties of BZT-LSM multiferroic composites at room temperature
|
Jarupoom, Pakpoom
|
|
|
44 |
8 |
p. 8768-8776
|
artikel
|
| 77 |
High Performance One Dimensional α-MoO3 Nanorods for Supercapacitor Applications
|
Prakash, N. Guru
|
|
|
44 |
8 |
p. 9967-9975
|
artikel
|
| 78 |
High-temperature thermoelectric properties of polycrystalline CaMn1-x
Nb
x
O3-δ
|
Seo, J.W.
|
|
|
44 |
8 |
p. 9204-9214
|
artikel
|
| 79 |
High-voltage electrochemical performance of LiNi0.5Co0.2Mn0.3O2 cathode materials via Al concentration gradient modification
|
Lei, Tongxing
|
|
|
44 |
8 |
p. 8809-8817
|
artikel
|
| 80 |
Hydrogen production through dry reforming of biogas using a porous electrochemical cell: Effects of a cobalt catalyst in the electrode and mixing of air with biogas
|
Shimonosono, Taro
|
|
|
44 |
8 |
p. 8904-8912
|
artikel
|
| 81 |
Impact of carbon nanotubes addition on transport and superconducting properties of YBa2Cu3O7−δ ceramics
|
Khalid, Nurul Auni
|
|
|
44 |
8 |
p. 9568-9573
|
artikel
|
| 82 |
Improved fracture toughness of laminated ZrB2-SiC-MoSi2 ceramics using SiC whisker
|
Bai, Yuhang
|
|
|
44 |
8 |
p. 8890-8897
|
artikel
|
| 83 |
Improved resistance to thermal fatigue of active metal brazing substrates for silicon carbide power modules using tough silicon nitrides with high thermal conductivity
|
Miyazaki, Hiroyuki
|
|
|
44 |
8 |
p. 8870-8876
|
artikel
|
| 84 |
Improvement of Al3+ ion conductivity by F doping of (Al0.2Zr0.8)4/3.8NbP3O12 solid electrolyte for mixed potential NH3 sensors
|
Wang, Ling
|
|
|
44 |
8 |
p. 8983-8991
|
artikel
|
| 85 |
Improvement of room-temperature TCR and MR in polycrystalline La0.67(Ca0.27Sr0.06)MnO3 ceramics by Ag2O doping
|
Sun, Tao
|
|
|
44 |
8 |
p. 9865-9874
|
artikel
|
| 86 |
Impurity effects on phase and microstructure stabilities of reactively-sintered porous MgTi2O5
|
Miao, Xinzhu
|
|
|
44 |
8 |
p. 10000-10005
|
artikel
|
| 87 |
Indentation size effect and energy balance issues in nanomechanical behavior of ZTA ceramics
|
Maiti, Payel
|
|
|
44 |
8 |
p. 9753-9772
|
artikel
|
| 88 |
Influence of a few important parameters on the rheological behaviour of silicon carbide nanoparticles dispersed aqueous suspension
|
Barick, Prasenjit
|
|
|
44 |
8 |
p. 9070-9075
|
artikel
|
| 89 |
Influence of calcium doping on performance of LaMnO3 supercapacitors
|
Mo, Haiyang
|
|
|
44 |
8 |
p. 9733-9741
|
artikel
|
| 90 |
Influence of Er3+ substitution on the structural, magnetic, and magnetostrictive properties of cobalt ferrite synthesized from spent Li-ion batteries
|
Dun, Changwei
|
|
|
44 |
8 |
p. 9276-9282
|
artikel
|
| 91 |
Influence of frequency and temperature on dielectric and electrical properties of Ca-substituted barium iron niobate
|
Puri, Maalti
|
|
|
44 |
8 |
p. 9112-9124
|
artikel
|
| 92 |
Influence of powder characteristics of reactive alumina on properties of alumina-spinel castables
|
Zhang, Danyang
|
|
|
44 |
8 |
p. 9984-9990
|
artikel
|
| 93 |
Influence of SiC on phase and microstructure of ZrB2 powders synthesized via carbothermal reduction at different temperatures
|
Xie, Bingying
|
|
|
44 |
8 |
p. 8795-8799
|
artikel
|
| 94 |
Insight into the evolution mechanism of carbon film and Eu valence in carbon coated BaMgAl10O17: Eu2+ phosphor annealed in air
|
Yin, Liang-Jun
|
|
|
44 |
8 |
p. 8898-8903
|
artikel
|
| 95 |
Large-scale and ultra-low thermal conductivity of ZrO2 fibrofelt/ZrO2-SiO2 aerogels composites for thermal insulation
|
He, Jian
|
|
|
44 |
8 |
p. 8742-8748
|
artikel
|
| 96 |
Luminescence properties of Dy3+-doped alkali lead alumino borosilicate glasses
|
Vijaya Babu, K.
|
|
|
44 |
8 |
p. 9080-9090
|
artikel
|
| 97 |
Magnesium ferrite nanoparticles as a magnetic sorbent for the removal of Mn2+, Co2+, Ni2+ and Cu2+ from aqueous solution
|
Ivanets, A.I.
|
|
|
44 |
8 |
p. 9097-9104
|
artikel
|
| 98 |
Magnetic properties and thermal stability of N-doped CrO2 (100) films
|
Cheng, Ming
|
|
|
44 |
8 |
p. 9664-9670
|
artikel
|
| 99 |
Magnetoelectric behaviors in BaTiO3/CoFe2O4/BaTiO3 laminated ceramic composites prepared by spark plasma sintering
|
Liu, Yang
|
|
|
44 |
8 |
p. 9649-9655
|
artikel
|
| 100 |
Mechanical properties and microstructures of TiCN/nano-TiB2/TiN cermets prepared by spark plasma sintering
|
Shankar, E.
|
|
|
44 |
8 |
p. 9384-9394
|
artikel
|
| 101 |
Mechanical properties and thermal shock resistance of Si2BC3N ceramics with ternary Al4SiC4 additive
|
Liao, Ning
|
|
|
44 |
8 |
p. 9009-9017
|
artikel
|
| 102 |
Mechanism of ferroelectric properties of (BaCa)(ZrTi)O3 from first-principles calculations
|
Luo, Bingcheng
|
|
|
44 |
8 |
p. 9684-9688
|
artikel
|
| 103 |
Microstructure and corrosion behaviors of conductive Hf/HfN multilayer coatings on magnesium alloys
|
Zhang, Dongfang
|
|
|
44 |
8 |
p. 9958-9966
|
artikel
|
| 104 |
Microstructure and electrical properties of Pb(Zr0.5Ti0.5)O3-Pb(Zn1/3Nb2/3)O3-Pb(Ni1/3Nb2/3)O3+xS3Ti2O7 ceramics
|
Li, Leilei
|
|
|
44 |
8 |
p. 9934-9941
|
artikel
|
| 105 |
Microstructure and mechanical properties of hot pressed submicron TiB2 powders
|
Fu, Zhezhen
|
|
|
44 |
8 |
p. 9995-9999
|
artikel
|
| 106 |
Microstructure and microwave dielectric properties of Al2O3 added Li2ZnTi3O8 ceramics
|
Ren, Junqing
|
|
|
44 |
8 |
p. 8928-8933
|
artikel
|
| 107 |
Microstructure evolution in densification of SiC ceramics by aluminium vapour infiltration and investigation of mechanical properties
|
Amrut Raj, S.V.
|
|
|
44 |
8 |
p. 9221-9226
|
artikel
|
| 108 |
MnO2/C composite with 3D hierarchical architecture for high-performance supercapacitor electrodes
|
Guo, Xingmei
|
|
|
44 |
8 |
p. 9696-9702
|
artikel
|
| 109 |
Molten salt synthesis and characterization of lead-free (1-x)Na0.5Bi0.5TiO3-xSrTiO3 (x = 0, 0.10, 0.26) whiskers
|
Zhou, Xuefan
|
|
|
44 |
8 |
p. 9174-9180
|
artikel
|
| 110 |
Non-invasive on-site Raman study of blue-decorated early soft-paste porcelain: The use of arsenic-rich (European) cobalt ores – Comparison with huafalang Chinese porcelains
|
Colomban, Philippe
|
|
|
44 |
8 |
p. 9018-9026
|
artikel
|
| 111 |
Nonlinear bending and instability analysis of bioceramics composed with magnetite nanoparticles: Fabrication, characterization, and simulation
|
Sahmani, S.
|
|
|
44 |
8 |
p. 9540-9549
|
artikel
|
| 112 |
Novel Fe2O3-doped glass /chitosan scaffolds for bone tissue replacement
|
El-Meliegy, Emad
|
|
|
44 |
8 |
p. 9140-9151
|
artikel
|
| 113 |
Novel micro/nanostructured TiO2/ZnO coating with antibacterial capacity and cytocompatibility
|
Zhang, Ranran
|
|
|
44 |
8 |
p. 9711-9719
|
artikel
|
| 114 |
One-pot hydrothermal synthesis of strontium titanate nanoparticles photoelectrode using electrophoretic deposition for enhancing photoelectrochemical water splitting
|
Phoon, Bao Lee
|
|
|
44 |
8 |
p. 9923-9933
|
artikel
|
| 115 |
Partial nitridation of Li4SiO4 and ionic conductivity of Li4.1SiO3.9N0.1
|
Kim, Hanseul
|
|
|
44 |
8 |
p. 9058-9062
|
artikel
|
| 116 |
Phase composition, Raman spectra, infrared spectra and dielectric properties of Li2MgTi1-x(Mg1/3Nb2/3)xO4 ceramics at microwave frequency
|
Yang, C.H.
|
|
|
44 |
8 |
p. 9255-9262
|
artikel
|
| 117 |
Phase stability, thermo-physical properties and thermal cycling behavior of plasma-sprayed CTZ, CTZ/YSZ thermal barrier coatings
|
Wang, Jinshuang
|
|
|
44 |
8 |
p. 9353-9363
|
artikel
|
| 118 |
Phase transition and thermal expansion properties of Cr1.5-xScxZr0.5Mo2.5V0.5O12
|
Chen, Dongxia
|
|
|
44 |
8 |
p. 9609-9615
|
artikel
|
| 119 |
Porous Na3V2(PO4)3 prepared by freeze-drying method as high performance cathode for sodium-ion batteries
|
Zheng, Li-Li
|
|
|
44 |
8 |
p. 9880-9886
|
artikel
|
| 120 |
Preparation and thermal reflectivity of nickel antimony titanium yellow rutile coated hollow glass microspheres composite pigment
|
Zeng, Guoxun
|
|
|
44 |
8 |
p. 8788-8794
|
artikel
|
| 121 |
Preparation of Ag@AgCl/g-C3N4/TiO2 porous ceramic films with enhanced photocatalysis performance and self-cleaning effect
|
Lv, Xiang
|
|
|
44 |
8 |
p. 9326-9337
|
artikel
|
| 122 |
Preparation of nanocrystalline MoSi2 with enhanced lithium storage by sol–gel and carbonthermal reduction method
|
Xu, Jianguang
|
|
|
44 |
8 |
p. 9494-9498
|
artikel
|
| 123 |
Preparation of quaternary boro-phosphate multifunctional glasses and their structural, optical, switching and antibacterial properties
|
Baazm, Mahsa
|
|
|
44 |
8 |
p. 9414-9421
|
artikel
|
| 124 |
Rapid microwave-assisted synthesis of Bi2Te3 nanoflakes as an efficient contrast agent for X-ray computed tomography
|
Mahvi, Mohsen
|
|
|
44 |
8 |
p. 9679-9683
|
artikel
|
| 125 |
Recycling of LCW produced form water plants for synthesizing of nano FeO(OH), Al(OH)3, and layered double hydroxide: Effect of heat-treatment
|
Zawrah, M.F.
|
|
|
44 |
8 |
p. 9950-9957
|
artikel
|
| 126 |
Relaxor behavior and energy storage density induced by B-sites substitutions in (Ca0.28Ba0.72)2.1Na0.8Nb5O15 Tungsten bronze ceramics
|
Yang, Bian
|
|
|
44 |
8 |
p. 8832-8841
|
artikel
|
| 127 |
Research on the dynamic mechanical properties of C-plane sapphire under impact loading
|
Jiang, Feng
|
|
|
44 |
8 |
p. 9839-9847
|
artikel
|
| 128 |
Reversible, repeatable and low phase transition behaviour of spin coated nanostructured vanadium oxide thin films with superior mechanical properties
|
Mukherjee, Dipta
|
|
|
44 |
8 |
p. 8913-8921
|
artikel
|
| 129 |
Role of defect states on nonlinear properties of 8 MeV electrons irradiated zinc oxide thin films under off-resonant regime
|
Sandeep, K.M.
|
|
|
44 |
8 |
p. 9063-9069
|
artikel
|
| 130 |
Selective laser melting of alumina: A single track study
|
Fan, Zhiqi
|
|
|
44 |
8 |
p. 9484-9493
|
artikel
|
| 131 |
Self-propagating high-temperature synthesis of Ti3AlC2 MAX phase from mechanically-activated Ti/Al/graphite powder mixture
|
Akhlaghi, Maryam
|
|
|
44 |
8 |
p. 9671-9678
|
artikel
|
| 132 |
Sheet resistance dependence of fluorine-doped tin oxide films for high-performance electrochromic devices
|
Kim, Kue-Ho
|
|
|
44 |
8 |
p. 9408-9413
|
artikel
|
| 133 |
Slag foaming practice in the steelmaking process
|
Luz, A.P.
|
|
|
44 |
8 |
p. 8727-8741
|
artikel
|
| 134 |
Sol-gel processed high-k aluminum oxide dielectric films for fully solution-processed low-voltage thin-film transistors
|
Xia, Wenwen
|
|
|
44 |
8 |
p. 9125-9131
|
artikel
|
| 135 |
Solution-processed nickel oxide hole transport layer for highly efficient perovskite-based photovoltaics
|
Yoon, Saemon
|
|
|
44 |
8 |
p. 9347-9352
|
artikel
|
| 136 |
Stability, mechanical and electronic properties of ceramic interphases in biomedical composites via first-principles calculations
|
He, ZhengYuan
|
|
|
44 |
8 |
p. 9656-9663
|
artikel
|
| 137 |
Structural and biological assessment of boron doped bioactive glass nanoparticles for dental tissue applications
|
Moonesi Rad, Rezai
|
|
|
44 |
8 |
p. 9854-9864
|
artikel
|
| 138 |
Structural and magnetic properties of Ce-doped strontium hexaferrite
|
Almessiere, M.A.
|
|
|
44 |
8 |
p. 9000-9008
|
artikel
|
| 139 |
Structural and microstructural comparison of bioactive melt-derived and gel-derived glasses from CaO-SiO2 binary system
|
Wajda, Aleksandra
|
|
|
44 |
8 |
p. 8856-8863
|
artikel
|
| 140 |
Structural, electrical and magnetic properties of (110)-oriented BF-BZT-ST Films
|
Meng, Caimin
|
|
|
44 |
8 |
p. 9053-9057
|
artikel
|
| 141 |
Structural, hardness and toughness evolution in Si-incorporated TaC films
|
Du, Suxuan
|
|
|
44 |
8 |
p. 9318-9325
|
artikel
|
| 142 |
Structural, Mechanical and Biological Insights on Reduced Graphene Nanosheets Reinforced Sonochemically Processed Nano‐Hydroxyapatite Ceramics
|
Radha, G.
|
|
|
44 |
8 |
p. 8777-8787
|
artikel
|
| 143 |
Structural properties of melt versus sol-gel derived yttrium aluminosilicate systems
|
Eniu, D.
|
|
|
44 |
8 |
p. 9581-9584
|
artikel
|
| 144 |
Structural stability, electronic structures and enhanced photocatalytic properties of BiF3 nanowires: A first-principles study
|
Xie, Zhi
|
|
|
44 |
8 |
p. 9623-9632
|
artikel
|
| 145 |
Structure and magnetic properties of multi-morphological CoFe2O4/CoFe nanocomposites by one-step hydrothermal synthesis
|
Xu, Shichong
|
|
|
44 |
8 |
p. 9377-9383
|
artikel
|
| 146 |
Structure and morphology evolution in solid-phase synthesis lithium ion battery LiNi0.80Co0.15Al0.05O2 cathode materials with different micro-nano sizes of raw materials
|
Xia, Shubiao
|
|
|
44 |
8 |
p. 9294-9302
|
artikel
|
| 147 |
Subsolidus phase diagram in the GeO2–ZnO–SnO2 system at 1100 °C in air
|
Sharma, Abhishek
|
|
|
44 |
8 |
p. 9848-9853
|
artikel
|
| 148 |
Synthesis and characterization of human bone-like hydroxyapatite using Schiff's base
|
Anandan, Dhivyaa
|
|
|
44 |
8 |
p. 9401-9407
|
artikel
|
| 149 |
Synthesis and electrochemical properties of α-LiVOPO4 as cathode material for lithium-ion batteries
|
Liu, Zhonggang
|
|
|
44 |
8 |
p. 9372-9376
|
artikel
|
| 150 |
Synthesis and microstructural evolution in iron oxide kaolinite based proppant as a function of reducing atmosphere, sintering conditions, and composition
|
Han, Kyu-Bum
|
|
|
44 |
8 |
p. 9976-9983
|
artikel
|
| 151 |
Template-free aqueous tape casting of hydrothermally synthesized barium titanate powder and the fabrication of highly {001}-{100} textured tapes
|
Özen, Murat
|
|
|
44 |
8 |
p. 9720-9727
|
artikel
|
| 152 |
Template-free synthesis of MgO mesoporous nanofibers with superior adsorption for fluoride and Congo red
|
Yu, Zhichao
|
|
|
44 |
8 |
p. 9454-9462
|
artikel
|
| 153 |
The effect of a buffer layer on the structure and the performance of cutting-tools for ZrWN films that are deposited using DCMS and HIPIMS
|
Chang, Kai-Sheng
|
|
|
44 |
8 |
p. 9519-9525
|
artikel
|
| 154 |
The effect of carbon and nickel additions on the precursor synthesis of Cr3C2-Ni nanopowder
|
Kaunisto, Kimmo
|
|
|
44 |
8 |
p. 9338-9346
|
artikel
|
| 155 |
The effect of magnesium content on in vitro bioactivity, biological behavior and antibacterial activity of sol–gel derived 58S bioactive glass
|
Moghanian, Amirhossein
|
|
|
44 |
8 |
p. 9422-9432
|
artikel
|
| 156 |
The effect of synthesis conditions on the phase composition, structure, and chemical durability of uranium-bearing murataite ceramics
|
Stefanovsky, S.V.
|
|
|
44 |
8 |
p. 9773-9779
|
artikel
|
| 157 |
The effects of laser patterning 10CeTZP-Al2O3 nanocomposite disc surfaces: Osseous differentiation and cellular arrangement in vitro
|
Goyos-Ball, Lidia
|
|
|
44 |
8 |
p. 9472-9478
|
artikel
|
| 158 |
Thermal chemical vapor deposition of tin oxide nanowires in a hydrogen reduction atmosphere
|
Jeong, Won
|
|
|
44 |
8 |
p. 9801-9808
|
artikel
|
| 159 |
Thermal cycling and hot corrosion behavior of a novel LaPO4/YSZ double-ceramic-layer thermal barrier coating
|
Zhang, Chenglong
|
|
|
44 |
8 |
p. 8818-8826
|
artikel
|
| 160 |
Transparent ZnO-Y2O3 coatings: Bactericidal effect in the lighting and in the darkness
|
Evstropiev, S.K.
|
|
|
44 |
8 |
p. 9091-9096
|
artikel
|
| 161 |
Tribological performance of alumina matrix composites reinforced with nickel-coated graphene
|
Wozniak, J.
|
|
|
44 |
8 |
p. 9728-9732
|
artikel
|
| 162 |
Tunable luminescence and energy transfer for Ce3+/Tb3+/Sm3+ doped SrAl2Si2O8 phosphors
|
Wu, Yeqiu
|
|
|
44 |
8 |
p. 10015-10019
|
artikel
|
| 163 |
Tuning of ferrimagnetic nature and hyperfine interaction of Ni2+ doped cobalt ferrite nanoparticles for power transformer applications
|
Srinivasamurthy, K.M.
|
|
|
44 |
8 |
p. 9194-9203
|
artikel
|
| 164 |
Wet chemical precipitation synthesis of hydroxyapatite (HA) powders
|
Yelten-Yilmaz, Azade
|
|
|
44 |
8 |
p. 9703-9710
|
artikel
|
| 165 |
Wet-chemical synthesis of hexagonal plate-like niobate particles for lead-free piezoceramics
|
Bai, Shan
|
|
|
44 |
8 |
p. 9794-9800
|
artikel
|
| 166 |
ZnO/WO3 nanostructure as an efficient visible light catalyst
|
Sajjad, Ahmed Khan Leghari
|
|
|
44 |
8 |
p. 9364-9371
|
artikel
|
Tijdschrift beschrijving