| nr |
titel |
auteur |
tijdschrift |
jaar |
jaarg. |
afl. |
pagina('s) |
type |
| 1 |
Ablation behavior of C/C-ZrC and C/SiC-ZrC composites fabricated by a joint process of slurry impregnation and chemical vapor infiltration
|
Zhou, Haijun
|
|
|
44 |
5 |
p. 4777-4782
|
artikel
|
| 2 |
Addition impact of nano-carbon black on the performance of MgO.CaO compounds
|
Dehsheikh, Hassan Gheisari
|
|
|
44 |
5 |
p. 5524-5527
|
artikel
|
| 3 |
A design of Ti-6Al-4V/ZrB2 multilayers with good thermal stability to enhance mechanical properties of titanium alloy
|
Nie, Yuyao
|
|
|
44 |
5 |
p. 4704-4710
|
artikel
|
| 4 |
Air-stable all inorganic green perovskite light emitting diodes based on ZnO/CsPbBr3/NiO heterojunction structure
|
Zhuang, Shiwei
|
|
|
44 |
5 |
p. 4685-4688
|
artikel
|
| 5 |
Amorphous NiP as cocatalyst for photocatalytic water splitting
|
Xie, Juan
|
|
|
44 |
5 |
p. 5459-5465
|
artikel
|
| 6 |
A new low-temperature firable 0.95Pb(ZrxTi1-x)O3-0.05Bi(Mn1/2Ti1/2)O3 ceramic for high-power applications
|
Zhang, Bo
|
|
|
44 |
5 |
p. 5453-5458
|
artikel
|
| 7 |
An experimental investigation on laser assisted waterjet micro-milling of silicon nitride ceramics
|
Wang, Liang
|
|
|
44 |
5 |
p. 5636-5645
|
artikel
|
| 8 |
Annealing impact on the structural and optical properties of electrospun SnO2 nanofibers for TCOs
|
Ch, Seshendra Reddy
|
|
|
44 |
5 |
p. 4586-4591
|
artikel
|
| 9 |
A novel aerogels/porous Si3N4 ceramics composite with high strength and improved thermal insulation property
|
Sun, Yongqiang
|
|
|
44 |
5 |
p. 5233-5237
|
artikel
|
| 10 |
A prospective material for orthopedic applications: Ti substrates coated with a composite coating of a titania-nanotubes layer and a silver-manganese-doped hydroxyapatite layer
|
Huang, Yong
|
|
|
44 |
5 |
p. 5528-5542
|
artikel
|
| 11 |
A reduced sintering temperature and improvement in the microwave dielectric properties of Li2Mg3TiO6 through Ge substitution
|
Xiang, Huaicheng
|
|
|
44 |
5 |
p. 5817-5821
|
artikel
|
| 12 |
A review: Conventional and supercritical hydro/solvothermal synthesis of ultrafine particles as cathode in lithium battery
|
Ye, Na
|
|
|
44 |
5 |
p. 4521-4537
|
artikel
|
| 13 |
Barnacle-like manganese oxide decorated porous carbon nanofibers for high-performance asymmetric supercapacitors
|
Shin, Dong-Yo
|
|
|
44 |
5 |
p. 4883-4890
|
artikel
|
| 14 |
Blow-bubble to produce ceramic ultra-thin films
|
Zhang, Haitian
|
|
|
44 |
5 |
p. 5799-5802
|
artikel
|
| 15 |
Calcium copper titanate/polyurethane composite films with high dielectric constant, low dielectric loss and super flexibility
|
Wan, Wei
|
|
|
44 |
5 |
p. 5086-5092
|
artikel
|
| 16 |
Can the regenerative potential of an alkali-free bioactive glass composition be enhanced when mixed with resorbable β-TCP?
|
Ferreira, Manuel M.
|
|
|
44 |
5 |
p. 5025-5031
|
artikel
|
| 17 |
Centrifugation-assisted preparation of nanoparticle decorated hierarchical nanowire arrays for improved solar cell performance
|
Zhu, Y.F.
|
|
|
44 |
5 |
p. 5692-5698
|
artikel
|
| 18 |
Characteristics of ultra-high density Al:ZnO sputtering targets prepared by hot isostatic pressing
|
Gao, Ming
|
|
|
44 |
5 |
p. 5486-5491
|
artikel
|
| 19 |
Characterization and applications of a new composite material obtained by green synthesis, through deposition of zinc oxide onto calcium carbonate precipitated in green seaweeds extract
|
Dumbrava, Anca
|
|
|
44 |
5 |
p. 4931-4936
|
artikel
|
| 20 |
Characterization model of thermal shock resistance for fiber reinforced brittle matrix composites over a wide range of cooling environment temperatures
|
Deng, Yong
|
|
|
44 |
5 |
p. 5518-5523
|
artikel
|
| 21 |
Composite CdO-ZnO hexagonal nanocones: Efficient materials for photovoltaic and sensing applications
|
Umar, Ahmad
|
|
|
44 |
5 |
p. 5017-5024
|
artikel
|
| 22 |
Co2O3 substitution effects on the structure and microwave dielectric properties of low-firing (Zn0.9Mg0.1)TiO3 ceramics
|
Yang, Hongyu
|
|
|
44 |
5 |
p. 5010-5016
|
artikel
|
| 23 |
Coral-like iron particles synthesized by morphology controllable reduction process
|
Rahman, Jamil Ur
|
|
|
44 |
5 |
p. 5359-5364
|
artikel
|
| 24 |
Corrigendum to ‘Photophysical properties and photoelectrochemical performances of sol-gel derived copper stannate (CuSnO3) amorphous semiconductor for solar water splitting application’ [Ceramics International (2018) 1843–1849]
|
Kim, Bit Na
|
|
|
44 |
5 |
p. 5822
|
artikel
|
| 25 |
Corrosion behavior of carbon composite brick in high alumina slags
|
Xu, Ren-Ze
|
|
|
44 |
5 |
p. 5242-5249
|
artikel
|
| 26 |
Corrosion of high chromia refractory materials by basic coal slag under simulated coal gasification atmosphere
|
Cai, Binli
|
|
|
44 |
5 |
p. 4592-4602
|
artikel
|
| 27 |
Cu doped LiNi0.5Mn1.5−xCuxO4 (x = 0, 0.03, 0.05, 0.10, 0.15) with significant improved electrochemical performance prepared by a modified low temperature solution combustion synthesis method
|
Sun, H.Y.
|
|
|
44 |
5 |
p. 4603-4610
|
artikel
|
| 28 |
Damage characterization model of ceramic coating systems based on energy analysis and bending tests
|
Liu, H.Y.
|
|
|
44 |
5 |
p. 4807-4813
|
artikel
|
| 29 |
Dependence on temperature of the electrical properties of nanocrystalline Y2Ti2O7 ceramics
|
Joseph, Dona
|
|
|
44 |
5 |
p. 5426-5432
|
artikel
|
| 30 |
Developing and preparing interfacial coatings for high tensile strength silicon nitride fiber reinforced silica matrix composites
|
Zhang, Juan
|
|
|
44 |
5 |
p. 5297-5303
|
artikel
|
| 31 |
Development of biomorphic alumina using egg shell membrane as bio-template
|
Sabu, Ummen
|
|
|
44 |
5 |
p. 4615-4621
|
artikel
|
| 32 |
Development of gold-bronze metallic glazes in a clay-based system for stoneware bodies
|
Pekkan, Keriman
|
|
|
44 |
5 |
p. 4789-4794
|
artikel
|
| 33 |
Diamond tools wear in drilling of SiCp/Al matrix composites containing Copper
|
Xiang, Junfeng
|
|
|
44 |
5 |
p. 5341-5351
|
artikel
|
| 34 |
Dielectric relaxation properties of SrTiO3 ceramics modulated by stoichiometry
|
Wang, Xiaofei
|
|
|
44 |
5 |
p. 4740-4743
|
artikel
|
| 35 |
Distinct dispersion stability of various TiO2 nanopowders using ammonium polyacrylate as dispersant
|
Tsai, Hsin-Yi
|
|
|
44 |
5 |
p. 5131-5138
|
artikel
|
| 36 |
3D long-range ordered porous ceramics prepared by a novel bidirectional freeze-casting technique
|
Hu, Zhi-Jie
|
|
|
44 |
5 |
p. 5803-5806
|
artikel
|
| 37 |
1D mesoporous NaTi2(PO4)3/carbon nanofiber: The promising anode material for sodium-ion batteries
|
Liu, Hua
|
|
|
44 |
5 |
p. 5813-5816
|
artikel
|
| 38 |
3D-printed graphene-Al2O3 composites with complex mesoscale architecture
|
Tubío, Carmen R.
|
|
|
44 |
5 |
p. 5760-5767
|
artikel
|
| 39 |
3D printing of kaolinite clay ceramics using the Direct Ink Writing (DIW) technique
|
Revelo, Carlos F.
|
|
|
44 |
5 |
p. 5673-5682
|
artikel
|
| 40 |
Effect of elaboration parameters of a membrane ceramic on the filtration process efficacy
|
Sayehi, Malek
|
|
|
44 |
5 |
p. 5202-5208
|
artikel
|
| 41 |
Effect of graphene thickness on the morphology evolution of hierarchical NiCoO2 architectures and their superior supercapacitance performance
|
Wu, Jinqi
|
|
|
44 |
5 |
p. 4875-4882
|
artikel
|
| 42 |
Effect of HfN, HfC and HfB2 additives on phase transformation, microstructure and mechanical properties of ZrO2-based ceramics
|
Song, Jinpeng
|
|
|
44 |
5 |
p. 5371-5377
|
artikel
|
| 43 |
Effect of iron oxide coloring agent on the sintering behavior of dental yttria-stabilized zirconia
|
Kao, Ching-Ti
|
|
|
44 |
5 |
p. 4689-4693
|
artikel
|
| 44 |
Effect of non-magnetic Al3+ doping on structural, optical, electrical, dielectric and magnetic properties of BiFeO3 ceramics
|
Chandel, Shilpi
|
|
|
44 |
5 |
p. 4711-4718
|
artikel
|
| 45 |
Effect of polymer concentration, needle diameter and annealing temperature on TiO2-PVP composite nanofibers synthesized by electrospinning technique
|
Kuchi, Charan
|
|
|
44 |
5 |
p. 5266-5272
|
artikel
|
| 46 |
Effect of seed layers on low-temperature, chemical bath deposited ZnO nanorods-based near UV-OLED performance
|
Rezaie, Mahdiyar Nouri
|
|
|
44 |
5 |
p. 4937-4945
|
artikel
|
| 47 |
Effect of SNNWS content on the microstructure and properties of SNNWS/Si-C-N ceramic composites via PIP
|
Zheng, Yuanyi
|
|
|
44 |
5 |
p. 5102-5108
|
artikel
|
| 48 |
Effect of the metal type in perovskites prepared by modified proteic method in dye adsorption from aqueous medium
|
Santos, A.G.
|
|
|
44 |
5 |
p. 5743-5750
|
artikel
|
| 49 |
Effect of Zn substitution on the structural and magnetic properties of nanocrystalline NiFe2O4 ferrites
|
Anupama, M.K.
|
|
|
44 |
5 |
p. 4946-4954
|
artikel
|
| 50 |
Effects of A-site cationic radius and cationic disorder on the electromagnetic properties of La0.7Ca0.3MnO3 ceramic with added Sr, Pb, and Ba
|
Li, Yule
|
|
|
44 |
5 |
p. 5378-5384
|
artikel
|
| 51 |
Effects of Cu content on the wettability of SiC with Al-Ti-Si-xCu alloy and bending strength of resulting SiC matrix composite
|
Wang, Wei
|
|
|
44 |
5 |
p. 5327-5335
|
artikel
|
| 52 |
Effects of fine reactive alumina powders on properties of alumina-magnesia castables with TiO2 additions
|
Yuan, Wenjie
|
|
|
44 |
5 |
p. 5032-5036
|
artikel
|
| 53 |
Effects of preform structure on microstructure and mechanical properties of C/SiC composites reinforced by Si3N4 nanowires
|
Tao, Pengfei
|
|
|
44 |
5 |
p. 5719-5725
|
artikel
|
| 54 |
Effects of Si/Al molar ratio on strength endurance and volume stability of metakaolin geopolymers subject to elevated temperature
|
Lahoti, Mukund
|
|
|
44 |
5 |
p. 5726-5734
|
artikel
|
| 55 |
Effects of Ti-substitution on the crystal structures, micro-structures and microwave dielectric properties of Li2Mg3Zr1-xTixO6 (0 ≤ x ≤ 1) ceramics
|
Yang, C.H.
|
|
|
44 |
5 |
p. 5155-5162
|
artikel
|
| 56 |
Effects of water vapor on the crystallization and microstructure manipulation of MgO ceramic fibers
|
Jin, Xiaotong
|
|
|
44 |
5 |
p. 5257-5265
|
artikel
|
| 57 |
Electrospinning amorphous SiO2-TiO2 and TiO2 nanofibers using sol-gel chemistry and its thermal conversion into anatase and rutile
|
Huang, Fei
|
|
|
44 |
5 |
p. 4577-4585
|
artikel
|
| 58 |
Electro-synthesis and characterization of TiO2 nanoparticles and their application in removal of congo red from water without UV radiation
|
Kardanzadeh, Maryam
|
|
|
44 |
5 |
p. 5652-5659
|
artikel
|
| 59 |
Enhanced gas sensing properties to NO2 of SnO2/rGO nanocomposites synthesized by microwave-assisted gas-liquid interfacial method
|
Gui, Yang-hai
|
|
|
44 |
5 |
p. 4900-4907
|
artikel
|
| 60 |
Enhanced properties of pure alumina ceramics by oscillatory pressure sintering
|
Han, Yao
|
|
|
44 |
5 |
p. 5238-5241
|
artikel
|
| 61 |
Enhancing mechanical properties of fused silica composites by introducing well-dispersed boron nitride nanosheets
|
Sun, Guoxun
|
|
|
44 |
5 |
p. 5002-5009
|
artikel
|
| 62 |
Estimation of the minimum material removal thickness during the polishing process of ceramic tiles by laser triangulation
|
Soares Filho, J.E.
|
|
|
44 |
5 |
p. 4646-4652
|
artikel
|
| 63 |
Evaluation of structural, magnetic and catalytic properties of Sn incorporated spinel nanoferrites
|
Goyal, Ankita
|
|
|
44 |
5 |
p. 5601-5612
|
artikel
|
| 64 |
Fabrication and photocatalytic performance of Sn-doped titania hollow spheres using polystyrene as template
|
Wang, Jieyu
|
|
|
44 |
5 |
p. 4981-4989
|
artikel
|
| 65 |
Fabrication and property of novel double-layer coating deposited on polyimide matrix composites by atmospheric plasma spraying
|
Huang, Wenzhi
|
|
|
44 |
5 |
p. 5473-5485
|
artikel
|
| 66 |
Fabrication of a novel ZnO–CoO/rGO nanocomposite for nonenzymatic detection of glucose and hydrogen peroxide
|
Wang, Min
|
|
|
44 |
5 |
p. 5250-5256
|
artikel
|
| 67 |
Fabrication of lamellar porous alumina with graded structures by combining centrifugal and directional freeze casting
|
Tang, Yufei
|
|
|
44 |
5 |
p. 5794-5798
|
artikel
|
| 68 |
Fabrication of porous fibrous alumina ceramics by direct coagulation casting combined with 3D printing
|
Chen, An-Nan
|
|
|
44 |
5 |
p. 4845-4852
|
artikel
|
| 69 |
Fabrication of Si2N2O ceramic with silicon kerf waste as raw material
|
Li, Yanjun
|
|
|
44 |
5 |
p. 5581-5586
|
artikel
|
| 70 |
Fabrications and applications of low cost ceramic membrane from kaolin: A comprehensive review
|
Hubadillah, Siti Khadijah
|
|
|
44 |
5 |
p. 4538-4560
|
artikel
|
| 71 |
Facile and ultrafast solid-state microwave approach to MnO2-NW@Graphite nanocomposites for supercapacitors
|
Bi, Yuhong
|
|
|
44 |
5 |
p. 5402-5410
|
artikel
|
| 72 |
Facile aqueous synthesis of Bi4O5Br2 nanosheets for improved visible-light photocatalytic activity
|
Wu, Gongjuan
|
|
|
44 |
5 |
p. 5392-5401
|
artikel
|
| 73 |
Facile modified synthesis and intermediate temperature electrical properties of Sn0.95Al0.05P2O7/KSn2(PO4)3 composite electrolyte
|
Liu, Junlong
|
|
|
44 |
5 |
p. 5179-5183
|
artikel
|
| 74 |
Filleted RDRA using novel ceramic dielectric (3G-BST) with stable gain and improved bandwidth for X-band application
|
Tripathi, P.
|
|
|
44 |
5 |
p. 5045-5054
|
artikel
|
| 75 |
Firing mechanism of oxide-carbon refractories with phenolic resin binder
|
Zhang, Jiu
|
|
|
44 |
5 |
p. 5594-5600
|
artikel
|
| 76 |
Flexural strength evaluations and fractography analyses of slip cast mesoporous submicron alumina
|
Rowthu, Sriharitha
|
|
|
44 |
5 |
p. 5193-5201
|
artikel
|
| 77 |
Gel-casting of transparent magnesium aluminate spinel ceramics fabricated by spark plasma sintering (SPS)
|
Shahbazi, H.
|
|
|
44 |
5 |
p. 4955-4960
|
artikel
|
| 78 |
Highly efficient La0.8Sr0.2MnO3-δ - Ce0.9Gd0.1O1.95 nanocomposite cathodes for solid oxide fuel cells
|
dos Santos-Gómez, L.
|
|
|
44 |
5 |
p. 4961-4966
|
artikel
|
| 79 |
High temperature corrosion resistant coatings for gas flare systems
|
Taie, Ihsan
|
|
|
44 |
5 |
p. 5124-5130
|
artikel
|
| 80 |
Hydrothermal synthesis of CoyZnyMn1-2yFe2O4 nanoferrites: Magneto-optical investigation
|
Asiri, S.
|
|
|
44 |
5 |
p. 5751-5759
|
artikel
|
| 81 |
Immobilization of toxic inorganic anions (Cr2O7 2-, MnO4 - and Fe(CN)6 3-) in metakaolin based geopolymers: A preliminary study
|
Al-Mashqbeh, Abdullah
|
|
|
44 |
5 |
p. 5613-5620
|
artikel
|
| 82 |
Impact of Ga3+ on the phase transition and luminescence properties of substituted Sr2SiO4:Eu2+ phosphor synthesized from a highly homogeneous oxide precursor based on a novel water-soluble silicon compound
|
Ray, Sudeshna
|
|
|
44 |
5 |
p. 5506-5512
|
artikel
|
| 83 |
Impedance spectroscopy and thermally simulated depolarization current study of barium strontium titanate glass ceramics: Effect of thermal annealing atmosphere on dielectric property
|
Song, Xiaozhen
|
|
|
44 |
5 |
p. 5668-5672
|
artikel
|
| 84 |
Improved toughness of layered architecture TiAlN/CrN coatings for titanium high speed cutting
|
Sui, Xudong
|
|
|
44 |
5 |
p. 5629-5635
|
artikel
|
| 85 |
Improving piezoelectric properties of Pb(Ni, Nb)O3-Pb(Hf, Ti)O3 ceramics by LiF addition
|
Yan, Yangxi
|
|
|
44 |
5 |
p. 5790-5793
|
artikel
|
| 86 |
Influence of electrodeposition modes on the electrochemical performance of MnO2 films prepared using anionic MnO4 − (Mn7+) precursor
|
Mishra, R.K.
|
|
|
44 |
5 |
p. 5710-5718
|
artikel
|
| 87 |
Influence of gas carrier on morphological and optical properties of nanostructured In2O3 grown by solid-vapour process
|
Abdullah, Q.N.
|
|
|
44 |
5 |
p. 4699-4703
|
artikel
|
| 88 |
Influence of NH4F additive on the combustion synthesis of β-SiAlON in air
|
Tavassoli, O.
|
|
|
44 |
5 |
p. 5683-5691
|
artikel
|
| 89 |
Influence of sintering support design on the properties of NiO-YSZ anode support micro-tubes
|
Timurkutluk, Bora
|
|
|
44 |
5 |
p. 5587-5593
|
artikel
|
| 90 |
Investigation on the comparison of the structural, electrical and optical properties between ZCO:Na and ZCO:(Na, N) films synthesized by RF magnetron sputtering
|
Wang, Zhanwu
|
|
|
44 |
5 |
p. 5219-5225
|
artikel
|
| 91 |
In vitro biocompatibility of a nanocrystalline β-Ta2O5 coating for orthopaedic implants
|
Xu, Jiang
|
|
|
44 |
5 |
p. 4660-4675
|
artikel
|
| 92 |
Jet pulse electrodeposition and characterization of Ni–AlN nanocoatings in presence of ultrasound
|
Ma, Chunyang
|
|
|
44 |
5 |
p. 5163-5170
|
artikel
|
| 93 |
Joining of dense Si3N4 ceramics with tape cast Lu-Al-Si-O-N interlayer
|
Liang, Hanqin
|
|
|
44 |
5 |
p. 4824-4828
|
artikel
|
| 94 |
Large electrostrictive effect and high optical temperature sensing in Bi0.5Na0.5TiO3-BaTiO3-(Sr0.7Bi0.18Er0.02)TiO3 luminescent ferroelectrics
|
Pan, Haoli
|
|
|
44 |
5 |
p. 5785-5789
|
artikel
|
| 95 |
Lattice geometry controlled synthesis of Cu – Doped nickel oxide nanoparticles
|
Chopade, S.C.
|
|
|
44 |
5 |
p. 5621-5628
|
artikel
|
| 96 |
Liquid-phase synthesis of SrCo0.9Nb0.1O3-δ cathode material for proton-conducting solid oxide fuel cells
|
Wang, Bin
|
|
|
44 |
5 |
p. 5139-5144
|
artikel
|
| 97 |
Lithium storage behaviors of KNb3O8 nanowires for rechargeable batteries
|
Chen, Ziwei
|
|
|
44 |
5 |
p. 5699-5704
|
artikel
|
| 98 |
Luminescence enhancement of Cd2V2O7:Re3+ (Re = Pr, Sm) red phosphors through Li+ ions charge compensation
|
Zhang, Wentao
|
|
|
44 |
5 |
p. 5420-5425
|
artikel
|
| 99 |
Magnetic, dielectric, and magneto-dielectric properties of Aurivillius Bi7Fe2CrTi3O21 ceramic
|
Zuo, Xuzhong
|
|
|
44 |
5 |
p. 5319-5326
|
artikel
|
| 100 |
Magnetic properties of low temperature sintered LiZn ferrites by using Bi2O3-Li2CO3-CaO-SnO2-B2O3 glass as sintering agent
|
Liao, Yulong
|
|
|
44 |
5 |
p. 5513-5517
|
artikel
|
| 101 |
Mechanical strength of highly porous ceramic foams with thin and lamellate cell wall from particle-stabilized foams
|
Huo, Wenlong
|
|
|
44 |
5 |
p. 5780-5784
|
artikel
|
| 102 |
Mechanochemical self-explosive synthesis and characterization of Mo-V2C nanocomposite
|
Baradaran-Ghandi, M.H.
|
|
|
44 |
5 |
p. 5447-5452
|
artikel
|
| 103 |
Medieval glazed ceramic from Caesar's Forum (Rome, Italy): Production technology
|
De Vito, Caterina
|
|
|
44 |
5 |
p. 5055-5062
|
artikel
|
| 104 |
Microstructure and thermal cycling behavior of plasma-sprayed LaMgAl11O19 coatings
|
Sun, Junbin
|
|
|
44 |
5 |
p. 5572-5580
|
artikel
|
| 105 |
Microstructure design and preparation of Al2O3/TiC/TiN micro-nano-composite ceramic tool materials based on properties prediction with finite element method
|
Wang, Dong
|
|
|
44 |
5 |
p. 5093-5101
|
artikel
|
| 106 |
Monitoring the Bi/Fe ratio at different pH values in BiFeO3 nanoparticles derived by normal and reverse chemical co-precipitation: A comparative study on the purity, microstructure and magnetic properties
|
Sangian, H.
|
|
|
44 |
5 |
p. 5109-5115
|
artikel
|
| 107 |
Morphology, structure and photowettability of TiO2 coatings doped with copper and fluorine
|
Sobczyk-Guzenda, Anna
|
|
|
44 |
5 |
p. 5076-5085
|
artikel
|
| 108 |
MoS2 nanosheets attached on carbon microspheres used as anodes for lithium ion batteries
|
Li, Haojie
|
|
|
44 |
5 |
p. 5311-5318
|
artikel
|
| 109 |
Multicolour tunable luminescence of thermal-stable Ce3+/Tb3+/Eu3+-triactivated Ca3Gd(GaO)3(BO3)4 phosphors via Ce3+ → Tb3+ → Eu3+ energy transfer for near-UV WLEDs applications
|
Li, Bin
|
|
|
44 |
5 |
p. 4915-4923
|
artikel
|
| 110 |
Nanosized SnO2-CoS constructed porous cubeas advanced lithium-ion batteries anode
|
Zhang, Xinqun
|
|
|
44 |
5 |
p. 5569-5571
|
artikel
|
| 111 |
N-doped TiO2 nanoparticles obtained by a facile coprecipitation method at low temperature
|
Sanchez-Martinez, A.
|
|
|
44 |
5 |
p. 5273-5283
|
artikel
|
| 112 |
Numerical study of residual stress and crack nucleation in thermal barrier coating system with plane model
|
Yu, Q.M.
|
|
|
44 |
5 |
p. 5116-5123
|
artikel
|
| 113 |
One-step fabrication of boron nitride fibers networks
|
Wu, Chunzhi
|
|
|
44 |
5 |
p. 5385-5391
|
artikel
|
| 114 |
Optical and ferromagnetic properties of hydrothermally synthesized CeO2/CuO nanocomposites
|
Ma, Xiaojun
|
|
|
44 |
5 |
p. 5284-5290
|
artikel
|
| 115 |
Optical properties of ferroelectric lanthanum lithium niobate
|
Diaz-Moreno, Carlos A.
|
|
|
44 |
5 |
p. 4727-4733
|
artikel
|
| 116 |
Optical properties of zinc borate glasses dispersed with Eu-doped SiAlON for white LED applications
|
Segawa, Hiroyo
|
|
|
44 |
5 |
p. 4783-4788
|
artikel
|
| 117 |
Optimal synthesis and new understanding of P2-type Na2/3Mn1/2Fe1/4Co1/4O2 as an advanced cathode material in sodium-ion batteries with improved cycle stability
|
Chu, Shiyong
|
|
|
44 |
5 |
p. 5184-5192
|
artikel
|
| 118 |
Origin of giant permittivity in Ta, Al co-doped TiO2: Surface layer and internal barrier capacitance layer effects
|
Peng, Hui
|
|
|
44 |
5 |
p. 5768-5773
|
artikel
|
| 119 |
Oxidation protective MoSi2-SiC-Si coating for graphite materials prepared by slurry dipping and vapor silicon infiltration
|
Jiang, Yan
|
|
|
44 |
5 |
p. 5171-5178
|
artikel
|
| 120 |
Powder modification mechanism, effects of binder compositions on the thermal behavior, and the mechanical properties of the ceramic injection molded system
|
Liu, Wei
|
|
|
44 |
5 |
p. 5646-5651
|
artikel
|
| 121 |
Preparation, characterization and properties of MoS2 nanosheets via a microwave-assisted wet-chemical route
|
Tang, Gui
|
|
|
44 |
5 |
p. 5336-5340
|
artikel
|
| 122 |
Preparation, characterization and the antimicrobial properties of metal ion-doped TiO2 nano-powders
|
Zhao, Qianfei
|
|
|
44 |
5 |
p. 5145-5154
|
artikel
|
| 123 |
Preparation of meso-porous SnO2 fibers with enhanced sensitivity for n-butanol
|
Zhang, Xueying
|
|
|
44 |
5 |
p. 4990-4995
|
artikel
|
| 124 |
Processing, microstructure and performance of Al2O3/Er3Al5O12/ZrO2 ternary eutectic ceramics prepared by laser floating zone melting with ultra-high temperature gradient
|
Ren, Qun
|
|
|
44 |
5 |
p. 4766-4776
|
artikel
|
| 125 |
Properties of a single SnO2:Zn2SnO4 – Functionalized nanowire based nanosensor
|
Lupan, Oleg
|
|
|
44 |
5 |
p. 4859-4867
|
artikel
|
| 126 |
Pyrolyzable pore-formers for the porous-electrode formation in solid oxide fuel cells: A review
|
Hedayat, Nader
|
|
|
44 |
5 |
p. 4561-4576
|
artikel
|
| 127 |
Rapid mechanochemical synthesis of nickel-vanadium carbide nanocomposite powder by magnesiothermic reaction
|
Davoodi, Danial
|
|
|
44 |
5 |
p. 5411-5419
|
artikel
|
| 128 |
Reciprocating sliding tribology of ceramic fiber composites with variation of laminate orientation and surface conformity
|
Kumar, Parshant
|
|
|
44 |
5 |
p. 5365-5370
|
artikel
|
| 129 |
Research on microstructure and oxidation resistant property of ZrSi2-SiC/SiC coating on HTR graphite spheres
|
Zheng, Zujie
|
|
|
44 |
5 |
p. 4795-4800
|
artikel
|
| 130 |
Residual stress control in CrAlN coatings deposited on Ti alloys
|
Bai, Yanyun
|
|
|
44 |
5 |
p. 4653-4659
|
artikel
|
| 131 |
Resistive, capacitive and conducting properties of Bi0.5Na0.5TiO3-BaTiO3 solid solution
|
Sahoo, Sushrisangita
|
|
|
44 |
5 |
p. 4719-4726
|
artikel
|
| 132 |
Rietveld refinement, morphology and superparamagnetism of nanocrystalline Ni0.70−xCuxZn0.30Fe2O4 spinel ferrite
|
Humbe, Ashok V.
|
|
|
44 |
5 |
p. 5466-5472
|
artikel
|
| 133 |
Role of europium on WO3 performance under visible-light for photocatalytic activity
|
Tahir, M. Bilal
|
|
|
44 |
5 |
p. 5705-5709
|
artikel
|
| 134 |
Role of ytterbium on structural and magnetic properties of NiCr0.1Fe1.9O4 co-precipitated ferrites
|
Ahmad, Mushtaq
|
|
|
44 |
5 |
p. 5433-5439
|
artikel
|
| 135 |
Shrinkage mechanism and enhanced piezoelectric properties of Ta doped 0.94Bi0.5Na0.5TiO3–0.06BaTiO3 lead free ceramics
|
Han, Wook-Hee
|
|
|
44 |
5 |
p. 5352-5358
|
artikel
|
| 136 |
Simulation and characterization of Ni–doped SiC nanocoatings prepared by jet electrodeposition
|
Cui, Wei
|
|
|
44 |
5 |
p. 5500-5505
|
artikel
|
| 137 |
Sintering, microstructure and hardness of Y-TZP- 64S bioglass ceramics
|
Soubelet, Clara G.
|
|
|
44 |
5 |
p. 4868-4874
|
artikel
|
| 138 |
Solvent free mechanochemical synthesis of MnO2 for the efficient degradation of Rhodamine-B
|
Gagrani, Ankita
|
|
|
44 |
5 |
p. 4694-4698
|
artikel
|
| 139 |
Spherical AlN particles synthesized by the carbothermal method: Effects of reaction parameters and growth mechanism
|
Wang, Qi
|
|
|
44 |
5 |
p. 4829-4834
|
artikel
|
| 140 |
Stabilizing effect of the carbon shell on phase transformation of the nanocrystalline alumina particles
|
Yakovlev, Ilya V.
|
|
|
44 |
5 |
p. 4801-4806
|
artikel
|
| 141 |
Stirring speed assisted homogenization of precipitation reaction for enhanced optical performance of Y2O3 transparent ceramics
|
Zhang, Le
|
|
|
44 |
5 |
p. 4967-4972
|
artikel
|
| 142 |
Strain induced magnetic anisotropy of high epitaxial Ni thin films grown on different oriented PMN-PT substrates
|
Tan, Yaoyu
|
|
|
44 |
5 |
p. 5564-5568
|
artikel
|
| 143 |
Structure design of Al2O3/TiC/CaF2 multicomponent gradient self-lubricating ceramic composite and its tribological behaviors
|
Wu, Guangyong
|
|
|
44 |
5 |
p. 5550-5563
|
artikel
|
| 144 |
Structure evolution and exceptionally ultra-low hysteresis unipolar electric field-induced strain in (1−x)NaNbO3-xBaTiO3 lead-free ferroelectrics
|
Lu, Xu
|
|
|
44 |
5 |
p. 5492-5499
|
artikel
|
| 145 |
Studies on spinel cobaltites, MCo2O4 (M = Mn, Zn, Fe, Ni and Co) and their functional properties
|
Darbar, Devendrasinh
|
|
|
44 |
5 |
p. 4630-4639
|
artikel
|
| 146 |
Study of structure and conductivity of Li3/8Sr7/16-3x/2LaxZr1/4Nb3/4O3 solid electrolytes
|
Lu, Jiayao
|
|
|
44 |
5 |
p. 4744-4750
|
artikel
|
| 147 |
Surface modification-based three-phase nanocomposites with low percolation threshold for optimized dielectric constant and loss
|
Li, Weiyan
|
|
|
44 |
5 |
p. 4835-4844
|
artikel
|
| 148 |
Synthesis and characterization of Eu3+-doped C12H18Ca3O18 phosphor
|
He, Huan
|
|
|
44 |
5 |
p. 5070-5075
|
artikel
|
| 149 |
Synthesis and characterization of geopolymers containing blends of unprocessed steel slag and metakaolin: The role of slag particle size
|
Furlani, E.
|
|
|
44 |
5 |
p. 5226-5232
|
artikel
|
| 150 |
Synthesis and characterization of silica sand-derived nano-forsterite ceramics
|
Nurbaiti, Upik
|
|
|
44 |
5 |
p. 5543-5549
|
artikel
|
| 151 |
Synthesis and growth behavior of micron-sized rod-like ZrB2 powders
|
Song, Shaolei
|
|
|
44 |
5 |
p. 4640-4645
|
artikel
|
| 152 |
Synthesis and oxidation behavior of (Mo0.97Nb0.03)(Si0.97Al0.03)2 ceramic
|
Zhu, Gaoming
|
|
|
44 |
5 |
p. 4924-4930
|
artikel
|
| 153 |
Synthesis of Al2O3 nanowires by heat-treating Al4O4C in a carbon-containing environment
|
Cheng, Keren
|
|
|
44 |
5 |
p. 4996-5001
|
artikel
|
| 154 |
Synthesis of nanocrystalline boron carbide by sucrose precursor method-optimization of process conditions
|
Vijay, Soja K.
|
|
|
44 |
5 |
p. 4676-4684
|
artikel
|
| 155 |
Synthesis of vaterite CaCO3 as submicron and nanosized particles using inorganic precursors and sucrose in aqueous medium
|
Pérez-Villarejo, Luis
|
|
|
44 |
5 |
p. 5291-5296
|
artikel
|
| 156 |
Tetragonal Er3+-doped (K0.48Na0.48Li0.04)(Nb0.96Bi0.04)O3: Lead-free ferroelectric transparent ceramics with electrical and optical multifunctional performances
|
Wu, Xiao
|
|
|
44 |
5 |
p. 4908-4914
|
artikel
|
| 157 |
The effect of magnesium compounds (MgO and MgAl2O4) on the synthesis of Lanthanum magnesium hexaaluminate (LaMgAl11O19) by solid-state reaction method
|
Khorramirad, M.M.
|
|
|
44 |
5 |
p. 4734-4739
|
artikel
|
| 158 |
The effect of matrix composition and calcium content on the sulfate durability of metakaolin and metakaolin/slag alkali-activated mortars
|
Alcamand, Himad A.
|
|
|
44 |
5 |
p. 5037-5044
|
artikel
|
| 159 |
The effect of particle size on structural, magnetic and transport properties of La0.7Sr0.3MnO3 nanoparticles
|
Navin, Kumar
|
|
|
44 |
5 |
p. 4973-4980
|
artikel
|
| 160 |
The effect of the urea content on the properties of nano-size AlN powders synthesized by a wet chemical method
|
Cheng, Yanling
|
|
|
44 |
5 |
p. 5774-5779
|
artikel
|
| 161 |
The influence of heat treatment on the microstructure, flux pinning and magnetic properties of bulk BSCCO samples prepared by sol-gel route
|
Fallah-Arani, Hesam
|
|
|
44 |
5 |
p. 5209-5218
|
artikel
|
| 162 |
The microstructure, ferroelectric and dielectric properties of Ni-doped Na0.5Bi0.5TiO3 nanocrystalline films: A-site nonstoichiometry study
|
Yang, C.H.
|
|
|
44 |
5 |
p. 5807-5812
|
artikel
|
| 163 |
The observation and prediction of constant quality factors of LnAlO3 doped Ba6-3x Ln8+2x Ti18O54 (Ln = Nd, Sm, La) ceramics
|
Chen, Hetuo
|
|
|
44 |
5 |
p. 4611-4614
|
artikel
|
| 164 |
The rapid synthesis of nanostructured orthorhombic KNbO3 particles by a microwave-assisted hydrothermal method and their characterization
|
Wermuth, Tiago Bender
|
|
|
44 |
5 |
p. 4758-4765
|
artikel
|
| 165 |
The role of dielectric permittivity in the energy storage performances of ultrahigh-permittivity (SrxBa1−x)(Ti0.85Sn0.15)O3 ceramics
|
Luo, Qu
|
|
|
44 |
5 |
p. 5304-5310
|
artikel
|
| 166 |
Three-dimensional hierarchical aggregation growth of perovskite ferroelectric microplates with a high-efficient methylene blue adsorption performance
|
Yin, S.M.
|
|
|
44 |
5 |
p. 5735-5742
|
artikel
|
| 167 |
Two-step sintering strategy to prepare dense Li-Garnet electrolyte ceramics with high Li+ conductivity
|
Huang, Xiao
|
|
|
44 |
5 |
p. 5660-5667
|
artikel
|
| 168 |
Vacuum brazing of cubic boron nitride to medium carbon steel with Zr added passive and Ti activated eutectic Ag-Cu alloys
|
Simhan, D. Raghava
|
|
|
44 |
5 |
p. 4891-4899
|
artikel
|
| 169 |
Variation in structures and photoluminescence spectra of BaxEu1−xAl2O4 powders
|
Lee, Min-Ho
|
|
|
44 |
5 |
p. 5063-5069
|
artikel
|
| 170 |
Wavelike interfacial design and mechanical behaviour of joint between Si-SiC coated carbon/carbon composites and Li2O-Al2O3-SiO2 glass ceramics
|
Zhao, Fengling
|
|
|
44 |
5 |
p. 5440-5446
|
artikel
|
| 171 |
Wear behaviors of TiN/TiCN/DLC composite coatings in different environments
|
Cicek, Hikmet
|
|
|
44 |
5 |
p. 4853-4858
|
artikel
|
| 172 |
Wetting of AgCu-Ti filler on porous Si3N4 ceramic and brazing of the ceramic to TiAl alloy
|
Song, Xiaoguo
|
|
|
44 |
5 |
p. 4622-4629
|
artikel
|
| 173 |
Xanthate sensing properties of Pt-functionalized WO3 microspheres synthesized by one-pot hydrothermal method
|
Li, Tingting
|
|
|
44 |
5 |
p. 4814-4823
|
artikel
|
| 174 |
Zinc modified cadmium titanite nanoparticles: Electrical and room temperature methanol sensing properties
|
Fareed, S.
|
|
|
44 |
5 |
p. 4751-4757
|
artikel
|
Tijdschrift beschrijving