| nr |
titel |
auteur |
tijdschrift |
jaar |
jaarg. |
afl. |
pagina('s) |
type |
| 1 |
A construction of Ag-modified raspberry-like AgCl/Ag2WO4 with excellent visible-light photocatalytic property and stability
|
Xu, Hui
|
|
|
102 |
C |
p. 342-352
|
artikel
|
| 2 |
Activated biomass carbon made from bamboo as electrode material for supercapacitors
|
Zhang, Guoxiong
|
|
|
102 |
C |
p. 391-398
|
artikel
|
| 3 |
A flexible multi-layer electret nanogenerator for bending deformation energy harvesting and strain sensing
|
Zhu, Jianxiong
|
|
|
102 |
C |
p. 130-136
|
artikel
|
| 4 |
Anomalous Raman and photoluminescence blue shift in mono- and a few layered pulsed laser deposited MoS2 thin films
|
Pradhan, Gobinda
|
|
|
102 |
C |
p. 406-411
|
artikel
|
| 5 |
A superior composite gel polymer electrolyte of Li7La3Zr2O12- poly(vinylidene fluoride-hexafluoropropylene) (PVDF-HFP) for rechargeable solid-state lithium ion batteries
|
Liang, Y.F.
|
|
|
102 |
C |
p. 412-417
|
artikel
|
| 6 |
Biogas reforming over Ni catalysts dispersed in different mixed oxides containing Zn2+, Al3+ and Zr4+cations
|
Bezerra, Débora Morais
|
|
|
102 |
C |
p. 186-195
|
artikel
|
| 7 |
Biosynthesis of the palladium/sodium borosilicate nanocomposite using Euphorbia milii extract and evaluation of its catalytic activity in the reduction of chromium(VI), nitro compounds and organic dyes
|
Nasrollahzadeh, Mahmoud
|
|
|
102 |
C |
p. 24-35
|
artikel
|
| 8 |
Bio-template assisted solvothermal synthesis of broom-like BaTiO3: Nd3+ hierarchical architectures for display and forensic applications
|
Dhanalakshmi, M.
|
|
|
102 |
C |
p. 235-247
|
artikel
|
| 9 |
Boosting visible light photocatalytic performance of g-C3N4 nanosheets by combining with LaFeO3 nanoparticles
|
Jin, Luo
|
|
|
102 |
C |
p. 353-361
|
artikel
|
| 10 |
Carbon coated hierarchical porous MoO2 nanoflowers as high-performance anodes in lithium-ion batteries
|
Tang, Shasha
|
|
|
102 |
C |
p. 277-281
|
artikel
|
| 11 |
Color-tunable emission by cation substitution in Ba3−ySryY4O9:Bi3+ and sites occupation preference
|
Xu, Hongwei
|
|
|
102 |
C |
p. 8-15
|
artikel
|
| 12 |
Easily separable N-doped ZnO microspheres with high photocatalytic activity under visible light
|
Sudrajat, Hanggara
|
|
|
102 |
C |
p. 319-323
|
artikel
|
| 13 |
Editorial Board
|
|
|
|
102 |
C |
p. ii
|
artikel
|
| 14 |
Effective photocatalytic removal of different dye stuffs using green synthesized zinc oxide nanogranules
|
Prasad, Anupama R.
|
|
|
102 |
C |
p. 116-121
|
artikel
|
| 15 |
Effect of oxygen vacancies and Ag deposition on the magnetic properties of Ag/N co-doped TiO2 single-crystal films
|
Le, Ling
|
|
|
102 |
C |
p. 337-341
|
artikel
|
| 16 |
Electrochemically reduced graphene oxide nanosheet coatings as solid lubricants in humid air
|
Mai, Yongjin
|
|
|
102 |
C |
p. 324-329
|
artikel
|
| 17 |
Enhanced photocatalytic degradation of phenol over Ag3PO4-BiOCl1−xBrx composites
|
Qi, Yi Ling
|
|
|
102 |
C |
p. 16-23
|
artikel
|
| 18 |
Expanded graphite for thermal conductivity and reliability enhancement and supercooling decrease of MgCl2⋅6H2O phase change material
|
Song, Zichen
|
|
|
102 |
C |
p. 203-208
|
artikel
|
| 19 |
Fabrication of Co3O4/PEI-GO composites for gas-sensing applications at room temperature
|
Zhang, Xinci
|
|
|
102 |
C |
p. 108-115
|
artikel
|
| 20 |
Fabrication of hollow carbonaceous nanospheres and their applications in lithium-ion batteries
|
Cao, Yanfang
|
|
|
102 |
C |
p. 51-55
|
artikel
|
| 21 |
Fabrication of RGO-Fe3O4 Hybrid Functionalized with Ag3PO4 as photocatalyst for degradation of Rhodamime B under Visible Light Irradiation
|
Idris, Ahmed Mahmoud
|
|
|
102 |
C |
p. 100-107
|
artikel
|
| 22 |
Fe-doped ZnO nanoellipsoids for enhanced photocatalytic and highly sensitive and selective picric acid sensor
|
Kumar, Ramesh
|
|
|
102 |
C |
p. 282-288
|
artikel
|
| 23 |
Fluorescein-sensitized Au/g-C3N4 nanocomposite for enhanced photocatalytic hydrogen evolution under visible light
|
Qian, Xiao-Bing
|
|
|
102 |
C |
p. 362-368
|
artikel
|
| 24 |
Graphene-elastomer nanocomposites based flexible piezoresistive sensors for strain and pressure detection
|
Niu, Dong
|
|
|
102 |
C |
p. 92-99
|
artikel
|
| 25 |
Growth and characterization of Cu3SbSe4 thin films through thermally diffusing Sb2Se3 – CuSe by chemical bath deposition (CBD)
|
Martínez-Ortíz, P.
|
|
|
102 |
C |
p. 418-423
|
artikel
|
| 26 |
Growth mechanism and wave-absorption properties of multiwalled carbon nanotubes fabricated using a gaseous detonation method
|
Zhao, Tiejun
|
|
|
102 |
C |
p. 153-159
|
artikel
|
| 27 |
Highly dispersive platinum nanoparticles supporting on polyaniline modified three dimensional graphene and catalyzing methanol oxidation
|
Wang, Yanli
|
|
|
102 |
C |
p. 172-179
|
artikel
|
| 28 |
Improved photo-degradation of dyes over Ag-loaded NiTiO3:V nanorods on visible-light-irradiation
|
Mi, Longqing
|
|
|
102 |
C |
p. 269-276
|
artikel
|
| 29 |
Influence of high energy ball milling on structural parameters, cation distribution and magnetic enhancement of nanosized Co0.3Zn0.7Fe2O4
|
Mondal, R.
|
|
|
102 |
C |
p. 160-171
|
artikel
|
| 30 |
Influence of propylene glycol/nitrates ratio on microwave-assisted combustion synthesis of CuO-ZnO-Al2O3 nanocatalyst: Structural and catalytic properties toward hydrogen production from methanol
|
Ajamein, Hossein
|
|
|
102 |
C |
p. 142-152
|
artikel
|
| 31 |
Morphologies and magnetism of A x B1- x Fe2O4 self-assembled nanospheres
|
Ma, Jie
|
|
|
102 |
C |
p. 137-141
|
artikel
|
| 32 |
Morphology of phase-separated VO2 films deposited on TiO2-(001) substrate
|
Cho, Youngji
|
|
|
102 |
C |
p. 289-293
|
artikel
|
| 33 |
Mussel-inspired surface modification of untreated wasted husks with stable polydopamine/polyethylenimine for efficient continuous Cr(VI) removal
|
Jiang, Xiao
|
|
|
102 |
C |
p. 218-225
|
artikel
|
| 34 |
One-pot rapid synthesis of high aspect ratio silver nanowires for transparent conductive electrodes
|
Yang, Hui
|
|
|
102 |
C |
p. 79-85
|
artikel
|
| 35 |
One-pot synthesis of porous g-C3N4 nanomaterials with different morphologies and their superior photocatalytic performance
|
Fei, Ban
|
|
|
102 |
C |
p. 209-217
|
artikel
|
| 36 |
Photocatalytic activities and chemically-bonded mechanism of SiO2@ TiO2 nanocomposites coated cement-based materials
|
Wang, Dan
|
|
|
102 |
C |
p. 262-268
|
artikel
|
| 37 |
Photocatalytic reduction of CO2 using CdS nanorods on porous anodic alumina support
|
Kandy, Mufeedah Muringa
|
|
|
102 |
C |
p. 440-449
|
artikel
|
| 38 |
Photoluminescence, thermoluminescence and defect centres in Y2O3 and Y2O3:Tb3+ under 100 MeV swift Ni8+ ion beam irradiation
|
Shivaramu, N.J.
|
|
|
102 |
C |
p. 62-69
|
artikel
|
| 39 |
Preparation and characterization of Pb(Lu1/2Nb1/2)O3-Pb(Ni1/3Nb2/3)O3-PbTiO3 ternary ferroelectric ceramics with high piezoelectric constant
|
Qiao, Xianji
|
|
|
102 |
C |
p. 122-129
|
artikel
|
| 40 |
Preparation of graphene/WO3/TiO2 composite and its photocathodic protection performance for 304 stainless steel
|
Liu, Wenjie
|
|
|
102 |
C |
p. 399-405
|
artikel
|
| 41 |
Room temperature synthesis of urea based imidazole functionalised ZnO nanorods and their photocatalytic application
|
Mishra, Jayanti
|
|
|
102 |
C |
p. 311-318
|
artikel
|
| 42 |
Sensitive and selective colorimetric detection of Pb2+ by silver nanoparticles synthesized from Aconitum violaceum plant leaf extract
|
Khan, Nayab Ali
|
|
|
102 |
C |
p. 330-336
|
artikel
|
| 43 |
Sol-gel synthesis of Mn1.5Co1.5O4 spinel nano powders for coating applications
|
Hashemi, S.T.
|
|
|
102 |
C |
p. 180-185
|
artikel
|
| 44 |
Solution processed metal-doped NiS/PEDOT:PSS composite thin films as an efficient electrode for quantum-dot sensitized solar cells
|
Punnoose, Dinah
|
|
|
102 |
C |
p. 369-378
|
artikel
|
| 45 |
Strain effects on the modulation of band gap and optical properties of direct band gap silicon
|
Wei, Qun
|
|
|
102 |
C |
p. 1-7
|
artikel
|
| 46 |
Structural and magnetic properties of La2Ni1−x Co x MnO6 compounds
|
Pramanik, Debabrata
|
|
|
102 |
C |
p. 248-256
|
artikel
|
| 47 |
Structural, magnetic, dielectric and magneto-dielectric properties of (BaTiO3)0.70(Li0.3Zn0.4Fe2.3O4)0.30
|
Mahapatra, A.S.
|
|
|
102 |
C |
p. 226-234
|
artikel
|
| 48 |
Study of the structural and magnetic phase-transitions and multiferroic properties in BiFeO3-Ba0.95Ca0.05TiO3 solid solutions
|
Pal, Jaswinder
|
|
|
102 |
C |
p. 36-44
|
artikel
|
| 49 |
Study on dielectric behavior and harvesting properties of new Ba0.5Sr0.4Ca0.1TiO3/poly(ether imide) composite films
|
Hamciuc, Corneliu
|
|
|
102 |
C |
p. 70-78
|
artikel
|
| 50 |
Synthesis and gas sensing properties of NiO/SnO2 hierarchical structures toward ppb-level acetone detection
|
Hu, Jie
|
|
|
102 |
C |
p. 294-303
|
artikel
|
| 51 |
Synthesis and structural characterization of the vividly colored first row transition metal-containing oxyfluoride antiperovskites Sr3- x Mn xMO4F and Sr3- x Mn xMO 4-αF1-δ (M = Al, Ga)
|
Quilty, Calvin D.
|
|
|
102 |
C |
p. 424-432
|
artikel
|
| 52 |
Synthesis and study of Pd-Rh alloy nanoparticles and alumina-supported low-content Pd-Rh catalysts for CO oxidation
|
Vedyagin, A.A.
|
|
|
102 |
C |
p. 196-202
|
artikel
|
| 53 |
Synthesis and thermoelectric properties of doubly substituted La0.95Sr0.05Co1-xCrxO3 (0 ≤ x ≤ 0.5)
|
Chen, Cong
|
|
|
102 |
C |
p. 257-261
|
artikel
|
| 54 |
Synthesis, characterization and photocatalytic property of novel ZnO/bone char composite
|
Jia, Puqi
|
|
|
102 |
C |
p. 45-50
|
artikel
|
| 55 |
Synthesis of cuboid-type tungsten trioxide photocatalysts for oxygen evolution from water in the presence of silver(I) sulfate under visible light irradiation
|
Kaneyama, Yuka
|
|
|
102 |
C |
p. 56-61
|
artikel
|
| 56 |
The band structure and photocatalytic mechanism of MoS2-modified C3N4 photocatalysts with improved visible photocatalytic activity
|
Lan, Zijian
|
|
|
102 |
C |
p. 433-439
|
artikel
|
| 57 |
The effect of Gd3+ ions on fabrication and luminescence properties of Nd3+-doped (Ca1-xGdx)F2+x transparent ceramics
|
Yi, Guoqiang
|
|
|
102 |
C |
p. 304-310
|
artikel
|
| 58 |
Ultraviolet light induced degradation of luminescence in CsPbBr3 perovskite nanocrystals
|
Li, Ji
|
|
|
102 |
C |
p. 86-91
|
artikel
|
| 59 |
ZnCr-LDH/N-doped graphitic carbon-incorporated g-C3N4 2D/2D nanosheet heterojunction with enhanced charge transfer for photocatalysis
|
Liu, Jun
|
|
|
102 |
C |
p. 379-390
|
artikel
|
Tijdschrift beschrijving