|
Aravaite, Ba2Ca18(SiO4)6(PO4)3(CO3)F3O: modular structure and disorder of a new mineral with single and triple antiperovskite layers |
|
|
|
Titel: |
Aravaite, Ba2Ca18(SiO4)6(PO4)3(CO3)F3O: modular structure and disorder of a new mineral with single and triple antiperovskite layers |
Auteur: |
Krüger, Biljana Krüger, Hannes Galuskin, Evgeny V. Galuskina, Irina O. Vapnik, Yevgeny Olieric, Vincent Pauluhn, Anuschka |
Verschenen in: |
Acta crystallographica. Section B, Structural science, crystal engineering and materials |
Paginering: |
Jaargang 74 (2018) nr. 6 pagina's 492-501 |
Jaar: |
2018-02-01 |
Inhoud: |
|
Uitgever: |
International Union of Crystallography, 5 Abbey Square, Chester, Cheshire CH1 2HU, England |
Bronbestand: |
Elektronische Wetenschappelijke Tijdschriften |
|
|
|
|