|
The crystal and molecular structure of bis(2,4,6-trichlorophenolato)diimidazolecopper(II) monohydrate, Cu(C3H4N2)2(C6H6OCl3)2.H2O |
|
|
|
Titel: |
The crystal and molecular structure of bis(2,4,6-trichlorophenolato)diimidazolecopper(II) monohydrate, Cu(C3H4N2)2(C6H6OCl3)2.H2O |
Auteur: |
Wong, R. Y. Palmer, K. J. Tomimatsu, Y. |
Verschenen in: |
Acta crystallographica. Section B, Structural crystallography and crystal chemistry |
Paginering: |
Jaargang 32 (1976) nr. 2 pagina's 567-571 |
Jaar: |
1976-02-05 |
Inhoud: |
|
Uitgever: |
International Union of Crystallography, 5 Abbey Square, Chester, Cheshire CH1 2HU, England |
Bronbestand: |
Elektronische Wetenschappelijke Tijdschriften |
|
|
|
|