|
Structure of [bis(2-diphenylphosphinoethyl)phenylphosphine-P,P,P]carbonyl(phenylthiolato)cobalt(I), [Co{Ph2PCH2CH2P(Ph)CH2CH2PPh2}(SPh)(CO)] |
|
|
|
Titel: |
Structure of [bis(2-diphenylphosphinoethyl)phenylphosphine-P,P,P]carbonyl(phenylthiolato)cobalt(I), [Co{Ph2PCH2CH2P(Ph)CH2CH2PPh2}(SPh)(CO)] |
Auteur: |
Wei, G. Huang, Z. Lei, X. Cao, R. Jiang, F. Hong, M. Liu, H. |
Verschenen in: |
Acta crystallographica. Section C, Crystal structure communications |
Paginering: |
Jaargang 48 (1992) nr. 12 pagina's 2130-2132 |
Jaar: |
1992-02-05 |
Inhoud: |
|
Uitgever: |
International Union of Crystallography, 5 Abbey Square, Chester, Cheshire CH1 2HU, England |
Bronbestand: |
Elektronische Wetenschappelijke Tijdschriften |
|
|
|
|