|
Stereochemical studies. 114. Structure of cis-2-(p-chlorophenyl)-4a,5,8,8a-tetrahydro-4H-3,1-benzoxazine |
|
|
|
Titel: |
Stereochemical studies. 114. Structure of cis-2-(p-chlorophenyl)-4a,5,8,8a-tetrahydro-4H-3,1-benzoxazine |
Auteur: |
Kálmán, A. Argay, G. Bernáth, G. Stájer, G. |
Verschenen in: |
Acta crystallographica. Section C, Crystal structure communications |
Paginering: |
Jaargang 42 (1986) nr. 12 pagina's 1883-1884 |
Jaar: |
1986-02-05 |
Inhoud: |
|
Uitgever: |
International Union of Crystallography, 5 Abbey Square, Chester, Cheshire CH1 2HU, England |
Bronbestand: |
Elektronische Wetenschappelijke Tijdschriften |
|
|
|
|